| 1-Acetanilide-4-aminopyrazole-substituted quinazoline Aurora kinase inhibitors | 1634 |
| 1′-Acetoxychavicol acetate | 1221, 2177, 2193, 2370, 2457, 2465, 2519 |
| 1-alpha-24-Dihydroxyvitamin D3 | 2516 |
| 1-alpha,25-Dihydroxyvitamin D3 (See Calcitriol) | 109, 1635, 1918, 1931, 1933, 1945, 1955, 1980 |
| 1-alpha-Hydroxyergocalciferol | 1899 |
| 1-beta-D-Arabinofuranosylcytosine (Ara-C) | 2467 |
| 1-Aminobenzotriazole | 1332, 1358, 1400, 1435, 1589, 1611, 1634 |
| 1-Aminopyrene | 1332 |
| 1-and 2-Substituted-1,2,3-triazole letrozole-based analogs | 1945 |
| 1-Anilino-8-naphthalenesulfonate | 1121, 2105, 2323 |
| 1-Benzyl-1H-imidazoles [MOERAS115 (4-((5-phenyl-1H-imidazol-1-yl)methyl)benzonitrile)] | 1934 |
| 1′-Benzyl-3-methoxy-3H-spiro[[2]benzofuran-1,4′-piperidine] | 1634 |
| 1-Benzylimidazole | 1293, 1404 |
| 1-(beta-Naphthylmethyl)-6,7-dihydroxy-1,2,3,4-tetra-hydroisoquinoline | 2183 |
| 1-(Benzofuran-2-yl-(4-alkyl/aryl-phenyl)-methyl)-1H-triazoles | 1634 |
| 1-Bromopropane | 1592, 1945, 2167 |
| 1-Butanol | 823, 1088, 1110, 1182, 1221, 1247, 1253, 1255, 1265, 1978, 2018, 2072, 2086, 2094, 2168, 2193, 2200, 2323, 2324, 2370, 2519 |
| 1-Chloro-2,4-dinitrobenzene-glutathione conjugate | 2110, 2116 |
| 1-Chloronaphthalene | 1332 |
| 1-Cyano-2-hydroxy-3-butene | 1293, 2308 |
| 1-Cyclohexyl-4-(4-arylcyclohexyl)piperazines | 832 |
| 1H-(1,2,4)Oxadiazolo(4,3-a)quinoxalin-1-one | 1247, 2346, 2471 |
| 1H,1H,2H,2H-Perfluorodecanol | 2026, 2039, 2044 |
| 1H,1H,2H,2H-Perfluorooctan-1-ol | 2026, 2039, 2044 |
| 1-Hexanol | 1247, 2094 |
| 1-Hydroxycholecalciferol | 1898 |
| 1-Hydroxyethyl radical | 1215 |
| 1-Hydroxymethylmidazolam | 1898 |
| 1-Hydroxypyrene | 1898, 2436, 2490, 2493, 2495 |
| 1-Hydroxyvitamin D5 | 2341, 2516 |
| 1-Indanol | 1099 |
| 1-Isoquinolin-5-yl-3-(4-trifluoromethyl-benzyl)-urea | 2478 |
| 1-Methoxy-2-propanol | 1608 |
| 1-Methyl-3-isobutylxanthine | 1247, 1332, 1345, 2154, 2392, 2393 |
| 1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridine (MPTP) | 1301, 1435, 1531, 1589, 1634, 2420, 2208, 2379, 2396 |
| 1-Methyl-4-phenylpyridinium | 1215, 1221, 1435, 1592, 2282, 2376, 2411, 2420 |
| 1-Methylnaphthalene | 1332 |
| 1-Methyloxy-4-sulfone-benzene | 1435 |
| 1-Methylxanthine | 1332 |
| 1-Naphthol | 1293, 1332, 1345, 1355, 1367, 1377, 1400, 1423, 1589, 1611, 1800, 1898, 2432, 2434 |
| 1-Naphthylethyl-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline | 2183 |
| 1-Naphthylisothiocyanate | 812, 926, 929, 942, 946, 961, 964, 1042, 1043, 1096, 1210, 1215, 1221, 1293, 1332, 1611, 1932, 2053, 2061, 2066, 2072, 2116, 2120, 2177, 2183, 2193, 2208, 2250, 2253, 2261, 2278, 2308, 2312, 2317, 2386, 2400, 2406, 2407, 2422, 2430, 2457, 2465 |
| 1-Nitronaphthalene | 1106, 2116, 2125, 2432 |
| 1-Nitropropane | 1044, 1103, 1120, 2022, 2094, 2110, 2272 |
| 1-Nitropyrene | 2110, 2116, 2120 |
| 1-Octanol | 1247 |
| 1-Octen-3-ol | 1187 |
| 1-O-Hexadecyl-2-N-methylcarbamylphosphatidylcholine | 2370 |
| 1-Oleoyl-2-acetoyl-sn-glycerol | 1110, 2183, 2457 |
| 1-Oleoyl-2-acetylglycerol | 823, 1116 |
| 1-Palmitoyl-2-(5-oxovaleroyl)-sn-glycero-3-phosphorylcholine | 823, 1092, 1110, 1270, 2193, 2339, 2344, 2366, 2370, 2453, 2457 |
| 1-Phenyl-2-decanoylamino-3-morpholino-1-propanol | 832 |
| 1-Phenyl-2-hexadecanoylamino-3-pyrrolidino-1-propanol | 2471 |
| 1-Phenyl-3-dimethylamino-1,2,3,4-tetrahydronaphthalene | 2154 |
| 1-Phenylazo-2-naphthol | 1293, 1332, 1345, 1355, 1367, 1377, 1400, 1423, 1589, 1611, 1899, 2116 |
| 1-Propanol | 1762, 2086, 2094, 2168 |
| 1-Pyrenebutanol | 1899 |
| (1S,2R)-1-Acetoxy-2-(4-allyl-2,6-dimethoxyphenoxy)-1-(3,4-dimethoxyphenyl)propane | 1396 |
| 1-Substituted imidazoles | 1634 |
| 1-Substituted-1,2,3-triazole letrozole-based analogs | 1945 |
| 1-UFT protocol | 1995, 2222, 2382 |
| 1,1-bis(3′-Indolyl)-1-(4-trifluoromethylphenyl)methane | 1221, 2344, 2376 |
| 1,1-Dichloro-2,2-bis(p-chlorophenyl)ethylene (p,p’-dichlorodiphenyldichloroethylene, p, p’-DDE) | 1277 |
| 1,1-Dichloro-2,2-difluoroethylene | 1293 |
| 1,1-Dichloroethane | 1293, 1611 |
| 1,1-Dimethylbutyl-1-deoxy-delta(9)-THC | 2217, 2220 |
| 1,1,1-Trichloro-2-(4-hydroxyphenyl)-2-(4-methoxyphenyl)ethane | 1332, 1355, 1367, 1400, 1404, 1423, 1589, 1611, 1898, 2314 |
| 1,1,1-Trichloroethane | 1608 |
| 1,1,1,2-Tetrafluoro-2-chloroethane | 1611 |
| 1,2-bis(2-Aminophenoxy)ethane N,N,N’,N’-tetraacetic acid acetoxymethyl ester | 929, 1247, 2012, 2324, 2456 |
| 1,2-bis(2-Aminophenoxy)ethane-N,N,N’,N’-tetraacetic acid | 2086, 2370 |
| 1,2-bis(Methylsulfonyl)-1-(2-chloroethyl)-2-((2-methylamino)carbonyl)hydrazine | 2272 |
| 1,2-Diacylglycerol | 2188, 2231 |
| 1,2-Diamino-4-nitrobenzene | 1044, 1103, 1120, 2022, 2110, 2272 |
| 1,2-Diarylimidazole-4-carboxamides | 832 |
| 1,2-Dibromoethane | 1635 |
| 1,2-Dichloro-4-nitrobenzene | 2105, 2110 |
| 1,2-Dichlorobenzene | 1685 |
| 1,2-Dichloroethylene | 1611 |
| 1′,2′-Dihydrorotenone | 2282 |
| 1,2-Dihydroxybenzene-3,5-disulfonic acid disodium salt | 2183, 2456 |
| 1,2-Dilauroylphosphatidylcholine | 1898 |
| 1,2-Dimethylhydrazine | 1215, 1277, 2183, 2200, 2370, 2471 |
| 1,2-Dimethylnaphthalene | 1332 |
| 1,2-Dioleoyloxy-3-(trimethylammonium)propane | 2188, 2519 |
| 1,2-Dioleoyl-sn-glycero-3-phosphoglycerol | 2337 |
| 1,2-Dithiol-3-thione | 2062 |
| 1,2-Epoxy-3-(p-nitrophenoxy)propane | 2120 |
| 1,2-Naphthoquinone | 2110 |
| 1,2-Oleoylphosphatidylcholine | 1898, 2337 |
| 1,2,3,4-Tetrahydro-1-(phenylmethyl)isoquinoline | 2420 |
| 1,2,3,4-Tetrahydroisoquinoline | 2004 |
| 1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid | 1247 |
| 1,2,3,4,6,7,8-Heptachlorodibenzofuran | 1096 |
| 1,2,3,4,7,8-Hexachlorodibenzodioxin | 1096 |
| 1,2,3,4,7,8-Hexachlorodibenzofuran | 1096 |
| 1,2,3,5-Tetrachlorobenzene | 1589, 1611, 1685, 1898 |
| 1,2,3,7,8-Pentachlorodibenzofuran | 1096 |
| 1,2,4-Trichlorobenzene | 1293, 1332, 1589, 1611, 1685 |
| 1,2,4-Trihydroxy-9,10-anthracenedione | 1293, 1332, 1345, 1355, 1423, 1611, 1898 |
| 1,2,4,5-Tetrachlorobenzene | 1332, 2072 |
| 1,2,5,6-Dibenzanthracene | 1096, 1187, 1293, 1332, 2022, 2105, 2110 |
| 1,3,5-Triphenyl-2-pyrazolines | 832 |
| 1,3,5-tris(4-Hydroxyphenyl)-4-propyl-1H-pyrazole | 2039 |
| 1,3,8-Trihydroxy-5-methoxyxanthone | 1635 |
| 1,3-bis(4-(Phthalimidomethoxyiminomethyl)pyridinium-1-yl)propane | 1251 |
| 1,3-Butadiene | 1592, 1611, 1635, 2022, 2110, 2120 |
| 1,3-Dichloro-1-propene | 2120 |
| 1,3-Dichlorobenzene | 2039 |
| 1,3-Dichloropropane | 2120 |
| 1,3-Dihydroxy-2-hydroxymethylpropyl-2-ammonium 2-((R)-3-cyclo-hexyl-1-phenylpropyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylate monohydrate | 2183, 2200 |
| 1,3-Dimethylthiourea | 1261, 1611, 2177, 2208, 2457, 2465 |
| 1,4,7-tris(Carboxymethyl)-1,4,7,10-tetraazacyclododecane | 961 |
| 1,4-bis-2-(3,5-Dichloropyridyloxy)-benzene (TCPOBOP) | 961, 964, 970, 979, 1221, 1932, 2105, 2116, 2150, 2314, 2376, 2432, 2489 |
| 1,4-Cineole | 1635 |
| 1,4-Diamino-2,3-dicyano-1,4-bis(methylthio)butadiene (U0126) | 1234, 1236, 1702 |
| 1,4-Dichlorobenzene | 1685, 2039 |
| 1,4-Dihydropyridine | 832, 1898, 2317 |
| 1,4-Dihydropyridine calcium antagonists | 1436 |
| 1,4-Dihydroxyanthraquinone | 1293, 2490 |
| 1,4-Dimethylnaphthalene | 1332 |
| 1,4-Dioxane | 1049, 1270, 1611, 2208 |
| 1,4-Diphenylbutadiene | 1187 |
| 1,4-Naphthoquinone | 1293, 1332, 1345, 1367, 1377, 1400, 1404, 1423, 1589, 1611, 1800, 1898 |
| 1,4-Phenylene bis(methylene)selenocyanate | 1221, 2370 |
| 1,5-Isoquinolinediol | 2012, 2014 |
| 1,6-Dimethylnaphthalene | 1332 |
| 1,6-Hexamethylene diisocyanate | 2203, 2110, 2177, 2183, 2295 |
| 1,7-Dimethyluric acid | 1355 |
| 1,7-Dimethylxanthine | 1332, 1355, 1367, 1377, 1400, 1423, 1589, 1611, 1635, 1898 |
| 1,8-Cineole (Eucalyptol)(Eucalyptus polybractea) | 1635 |
| 1,9-Dideoxyforskolin | 1247 |
| 1,9-Pyrazoloanthrone (SP600125) | 832 |
| 1,10-Phenanthroline | 1247 |
| 1,25-Dihydroxyvitamin D | 1261, 2305, 2208, 2453 |
| 1,25(OH)2-16-ene-23-yne-26,27-Hexafluoro-19-nor-D3 | 2516 |
| 1,N6-Ethenodeoxyadenosine | 1592 |
| 1-(1-(1-Methylcyclooctyl)-4-piperidinyl)-2-[(3R)-3-piperidinyl]-1H-benzimidazole | 1435 |
| 1-(1-(4-Bromophenyl)-3-carbamoyl-1H-pyrazol-4-yl)urea | 946 |
| 1-(2-(1-Adamantyl)ethyl)-1-pentyl-3-(3-(4-pyridyl)propyl)urea | 2456, 2478 |
| 1-(2-(3-(4-Methoxyphenyl)propoxy)-4-methoxyphenylethyl)-1H-imidazole | 2456 |
| 1-(2-Methyl-4-methoxyphenyl)-4-((2-hydroxyethyl)amino)-6-trifluoromethoxy-2,3-dihydropyrrolo(3,2-c)quinoline | 1332, 1400, 1589, 1898 |
| 1-(3-(5-(1,2,4-Triazol-4-yl)-1H-indol-3-yl)propyl)-4-(2-(3-fluorophenyl)ethyl)piperazine | 2161 |
| 1-(3-Chlorophenyl)piperazine | 2072 |
| 1-(3-Trifluoromethylphenyl)piperazine (TFMPP) | 1635 |
| 1-(4-(4-(3,3-Dibutyl-7-(dimethylamino)-2,3,4,5-tetrahydro-4-hydroxy-1,1-dioxido-1-benzothiepin-5-yl)phenoxy)butyl)-4-aza-1-azoniabicyclo(2.2.2)octane | 929, 1932, 2401 |
| 1-(4-(4-(4-((4-(2,4-Difluorophenyl)-4-(1H-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl)methoxy)phenyl)piperazin-1-yl)phenyl)-3-(1-methylethyl)-2-imidazolidinone | 1332, 1355, 1377, 1400, 1423, 1589, 1611, 1898, 1978 |
| 1-((4-Methylsulfonyl)phenyl)-3-trifluoromethyl-5-(4-fluorophenyl)pyrazole | 1978, 2370 |
| 1-(4-Chlorobenzoyl)-5-methoxy-2-1H-indole-3-acetic acid 3-(nitrooxymethyl)phenyl ester | 2370 |
| 1-(4-(Octahydropyrido(1,2-a)pyrazin-2-yl)phenyl)-2-phenyl-1,2,3,4-tetrahydroisoquinolin-6-ol | 2039 |
| 1-(5-(2-Thenyloxy)-1H-indol-3-yl)propan-2-amine | 2072 |
| 1-(5-Chloro-1-((2,4-dimethoxyphenyl)sulfonyl)-3-(2-methoxyphenyl)-2-oxo-2,3-dihydro-1H-indol-3-yl)-4-hydroxy-N,N-dimethyl-2-pyrrolidinecarboxamide | 1247 |
| 1-(5-Isoquinolinesulfonyl)-2-methylpiperazine | 929, 1293, 2072, 2445 |
| 1-(6-((3-Methoxyestra-1,3,5(10)-trien-17-yl)amino)hexyl)-1H-pyrrole-2,5-dione | 1067, 1116, 2012, 2018, 2072, 2478 |
| 2-((((2-Chloroethyl)nitrosoamino)carbonyl)amino)propanamide | 1231, 2272, 2471 |
| 2-((3,4-Dichlorophenethyl)(propyl)amino)-1-(pyridin-3-yl)ethanol (LK-935) | 1636 |
| 2-(((3,5-Dichlorophenyl)carbamoyl)oxy)-2-methyl-3-butenoic acid | 1187, 2039, 2044 |
| 2-(1-Hexyloxyethyl)-2-devinyl pyropheophorbide-a | 1400 |
| 2-(2-(2-Dimethylaminothiazol-5-yl)ethenyl)-6-(2-(fluoro)ethoxy)benzoxazole | 1164, 1182 |
| 2-(2-(4-(4-Nitrobenzyloxy)phenyl)ethyl)isothiourea methanesulfonate | 1261, 2072, 2445 |
| 2-(2-(4-Phenoxy-2-propylphenoxy)ethyl)indole-5-acetic acid | 2344 |
| 2-(2,3-Dicarboxycyclopropyl)glycine | 2099 |
| 2-(2-Aminoethyl)pyridine | 2154 |
| 2-(2-Aminoethyl)thiazole | 2154 |
| 2-(2-Chloro-4-iodophenylamino)-N-cyclopropylmethoxy-3,4-difluoro-benzamide | 2018 |
| 2-(4-Amino-3-methylphenyl)-5-fluorobenzothiazole | 1096, 1293, 1345, 2208 |
| 2′-(4-Fluorophenyl)-21-fluoro-20-oxo-11beta,17alpha-dihydroxy-pregn-4-eno(3,2-c)pyrazole | 2317 |
| 2-(4-Hydroxyphenyl)-3-methyl-1-(4-(2-piperidin-1-yl-ethoxy)-benzyl)-1H-indol-5-ol | 1221, 2039, 2376 |
| 2-(4-Isobutylphenyl)propionylmethanesulfonamide | 2193, 2212, 2213 |
| 2-(4′-Maleimidylanilino)naphthalene-6-sulfonic acid | 942 |
| 2-(4-Morpholinyl)-8-phenyl-4H-1-benzopyran-4-one | 961, 1060, 1088, 1164, 1182, 1187, 1221, 1247, 1261, 1265, 2018, 2039, 2051, 2101, 2105, 2116, 2188, 2193, 2203, 2227, 2238, 2308, 2333, 2346, 2376, 2422, 2442, 2445, 2457, 2471, 2489, 2519 |
| 2-(4-(Quinolin-2-yl-methoxy)phenyl)-2-cyclopentylacetic acid | 1110, 2276 |
| 2-(Acetoxyamino)-1-methyl-6-phenylimidazo(4,5-b)pyridine | 2105, 2116 |
| 2-Acetylaminofluorene | 926, 942, 961, 964, 1024, 1044, 1100, 1103, 1108, 1111, 1120, 1221, 1233, 1235, 1241, 1293, 1332, 1346, 1611, 1635, 1932, 2018, 2022, 2026, 2064, 2072, 2094, 2104, 2105, 2110, 2179, 2183, 2193, 2238, 2272, 2276, 2295, 2300, 2312, 2376, 2382, 2425, 2430, 2436, 2445, 2457, 2471 |
| 2-Allylphenol | 2105, 2110, 2116 |
| 2-Amino-1,3-thiazol-4(5H)-one class of 11beta-hydroxysteroid dehydrogenase type 1 inhibitors | 1635 |
| 2-Amino-1-methyl-6-phenylimidazo(4,5-b)pyridine (PhIP) | 932, 946, 961, 1024, 1277, 1293, 1301, 1332, 1614, 2105, 2295, 2366, 2370, 2376, 2432, 2471, 2489, 2490 |
| 2-Amino-3,4-dimethylimidazo(4,5-f)quinoline | 1332 |
| 2-Amino-3,8-dimethylimidazo(4,5-f)quinoxaline | 1301, 2241, 2366, 2370, |
| 2-Amino-3,8-dimethylimidazo[4,5-f]quinoxaline (MeIQx) | 1301 |
| 2-Amino-3-methyl-9H-pyrido(2,3-b)indole | 1332, 2295, 2432, 2433, 2434, 2435, 2436 |
| 2-Amino-3-methylimidazo(4,5-f)quinoline(IQ) | 1278, 1332, 2366, 2370 |
| 2-Amino-4,6-dinitrotoluene | 2471 |
| 2-Amino-4-phenylbutyric acid | 1247 |
| 2-Amino-6-(2-(cyclopropylmethoxy)-6-hydroxyphenyl)-4-piperidin-4-yl nicotinonitrile | 1221 |
| 2-Amino-6-methyldipyrido(1,2-a-3′,2′-d)imidazole | 1332 |
| 2-Aminoethoxydiphenyl borate | 1265, 2012, 2213, 2457 |
| 2-Aminofluorene | 1293, 1904, 1905, 2295 |
| 2-Aminophenol | 1215 |
| 2-Anisidine | 1293, 1332, 1367, 1589, 1611, 1899, 2295, 2308 |
| 2-Anthramine | 1293, 1332 |
| 2-Arachidonylglycerol | 1258, 2193, 2208, 2457 |
| 2-Arylthiazolidine-4-carboxylic acid amides (ATCAA) | 832 |
| 2-Aziridin-1-yl-3-((2-((2-(3-aziridin-1-yl-1,4-dioxo-1,4-dihydronaphthalen-2-yl)thio)ethoxy)ethyl)thio)naphthoquinone | 1233 |
| 2-Bromo-4-{[(4-cyanophenyl)(4H-1,2,4-triazol-4-yl)amino]methyl}phenylsulfamate | 1945 |
| 2-(Bromoacetylamino)fluorene | 2295 |
| 2-Bromopalmitate | 2339, 2341 |
| 2-Butanol | 1053, 1088, 2086 |
| 2-Butenal | 942, 2116, 2183, 2200, 2217, 2457 |
| 2-Butylamino-2-demethoxy-hypocrellin B | 2300, 2471 |
| 2-Chloro-5-nitrobenzanilide | 2053, 2193, 2217, 2220, 2339, 2344, 2346, 2370, 2445, 2448, 2457 |
| 2-Chlorobiphenyl | 1332 |
| 2-Chloroethyl ethyl sulfide | 1215, 2072, 2193, 2198, 2208, 2422, 2425, 2472, 2526 |
| 2-Chloro-N-(2,6-diethylphenyl)acetamide | 1899 |
| 2-Chlorophenol | 1187 |
| 2′-Cyano-2′-deoxyarabinofuranosylcytosine | 1231, 2472 |
| 2-Cyano-3,12-dioxooleana-1,9(11)-dien-28-oic acid ethyl amide | 2183, 2430 |
| 2-Cyano-3-hydroxy-N-(4-(trifluoromethyl)phenyl)-2-hepten-6-ynamide | 1990, 2445 |
| 2-Cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]-2-butenamide (A771726) | 1319 |
| 2-Dichlorobenzene | 1215, 1293, 1332, 1589, 1611 |
| 2-Diethylaminoethyl-2,2-diphenylvalerate-HCl (SKF525A) | 1436 |
| (2E,4E,6E,10E)-3,7,11,15-Tetramethyl-2,4,6,10,14-hexadecapentaenoic acid | 1042, 1221 |
| 2-Ethoxy-3-(4-((4-(methylsulfonyloxy)phenethyl)oxy)phenyl)propanoic acid | 2339, 2344 |
| 2-Ethyl-2-thiopseudourea | 2300 |
| 2-Ethyl-4-(4-hydroxyphenyl)-5-(4-(2-piperidin-1-ylethoxy)phenyl)-2-imidazoline | 2039 |
| 2-Ethylhexanoic acid | 2339, 2341, 2344 |
| 2-Ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine | 1978 |
| 2-Fluoro N10-substituted acridones | 832 |
| 2-Fluoro-A-85380 | 1019 |
| 2-(Glutathion-S-yl)-caffeic acid | 937 |
| 2-Hexenal | 1108, 2105, 2116 |
| 2-Hydroxy estrogens | 937 |
| 2-Hydroxy-1-naphthylaldehyde isonicotinoyl hydrazone | 1221, 1233, 2376, 2472 |
| 2-Hydroxy-3-methoxyestradiol | 1264 |
| 2-Hydroxy-9-cis-octadecenoic acid | 1221, 1233, 1235, 2376 |
| 2-Hydroxyamino-1-methyl-6-phenylimidazo(4,5-b)pyridine | 2489, 2490, 2493, 2495 |
| 2′-Hydroxychalcone | 1293, 1346, 2430 |
| 2-Hydroxyestradiol | 1187, 1264, 1293, 1332, 1346, 1899, 2370, 2434, 2436, 2490, 2493, 2519 |
| 2-Hydroxyestrone | 2039, 2490, 2493 |
| 2-Hydroxymenthofuran | 2105 |
| 2-Hydroxypyridine | 1293 |
| 2-Hydroxytacrine | 1293, 1332 |
| 2-Iodophenyl-(1-(1-methylpiperidin-2-ylmethyl)-1H-indol-3-yl)methanone | 1258 |
| 2-Isopropyl-6-methyl-4-pyrimidinol | 1289 |
| 2-Methoxy-4-aminoazobenzene | 1332 |
| 2-Methoxyaniline (O-anisidine) | 1605 |
| 2-Methoxycinnamaldehyde | 2193, 2370 |
| 2-Methoxyestradiol | 1264, 2347, 2490, 2493 |
| 2-Methoxynaphthalene | 1332 |
| 2-Methoxynitrobenzene (O-nitroanisole) | 1605 |
| 2-Methoxyoestrone-3-O-sulfamate | 1978, 2208, 2457 |
| 2-Methyl-3-(2-((4-nitrooxybutyloxy)carbonyl)vinyl)phenyl ursodeoxycholic acid ester | 2183 |
| 2-Methyl-4-(N-propyl-N-cycloproanemethylamino)-5-chloro-6-(2,4,6-trichloranilino) pyrimidine | 1266 |
| 2-Methyl-4-chlorophenoxyacetic acid | 2457 |
| 2-Methyl-5-HT | 2168, 2193, 2208, 2220, 2457 |
| 2-Methylhistamine | 2154 |
| 2-Methylindole | 1636 |
| 2-Methylnaphthalene | 1332 |
| 2-Methylphenanthrene | 1096 |
| 2-Methylquinoline | 1332 |
| 2-Methylthio-ADP | 2324 |
| 2-Methylthio-ATP | 2324 |
| 2-Morpholin-4-yl-6-thianthren-1-yl-pyran-4-one | 2472 |
| 2-Naphthol | 1187, 1293, 1332, 1367, 1611, 1800, 1899 |
| 2-Naphthylamine | 1207, 1228, 1265, 1332, 1903, 1905, 2014, 2064, 2213, 2217, 2295, 2420, 2432, 2433, 2434, 2435, 2465, 2472 |
| 2-Nitro-4-phenylenediamine | 1044, 1103, 1120, 2022, 2094, 2110, 2272 |
| 2-Nitroanisole | 1293, 1332, 1592, 2308, 2525 |
| 2-Nitrofluorene | 1103, 1221, 1235, 1243, 1995, 2022, 2104, 2224, 2272, 2308, 2376, 2438, 2480, 2499, 2519, 2525 |
| 2-Nitrophenol | 1293, 1367, 1592, 1611 |
| 2-Nitropropane | 1044, 1100, 1103, 1120, 2022, 2094, 2110, 2272 |
| 2-Nitrotoluene | 2072 |
| 2-Nonenal | 1100, 1103, 1108 |
| 2-Octanol | 1247 |
| 2-Octenal | 1108 |
| 2-Octyl-4H-1,3,2-benzodioxaphosphorin-2-oxide | 2253 |
| 2-Oxindole | 1235, 2237 |
| 2-Oxothiazolidine-4-carboxylic acid | 2116, 2272 |
| 2-Phenyl-2-(1-piperidinyl)propane (PPP) | 1358, 1367, 1436 |
| 2-Phenyl-4-(3-pyridin-2-yl-1H-pyrazol-4-yl)pyridine | 1261, 2445, 2448 |
| 2-Phenyl-4,4,5,5-tetramethylimidazoline-1-oxyl-3-oxide | 2300, 2445, 2472 |
| 2-Phenyl-5-(pyrrolidin-1-yl)-1-(3,4,5-trimethoxybenzyl)-1H-benzimidazole | 832 |
| 2-Phenylbenzotriazole-type compounds | 1636 |
| 2-Phenylphenol | 1187, 1215, 2039, 2472 |
| 2-Propanol | 1611, 2086 |
| 2-Propyl-4-pentenoic acid | 1355, 1367, 1400 |
| 2-Propylpentanoic acid (See Valproic Acid) | 780, 921, 928, 961, 962, 996, 1083, 1099, 1236, 1252, 1262, 1265, 1355, 1356, 1363, 1367, 1368, 1398, 1401, 1422, 1566, 1576, 1888, 1910, 1977, 2006, 2069, 2074, 2101, 2125, 2129, 2131, 2135, 2178, 2186, 2210, 2218, 2259, 2318, 2363, 2387, 2395, 2402, 2412, 2431, 2447, 2463, 2474 |
| (2R,3R,5R)-2,3-Epoxy-6,9-humuladien-5-ol-8-one | 1897 |
| (2R,3S,5R)-2,3-Epoxy-6,9-humuladien-5-ol-8-one | 1897 |
| (2S)-5,7,3′,5′-Tetrahydroxy-8-[3”,8”-dimethylocta-2”(E),7”-dienyl]flavonone | 1008 |
| (2S)-5,7,3′-Trihydroxy-4′-methoxy-8-(3”-methylbut-2”-enyl)-flavonone | 1008 |
| 2-S-Glutathionylcaffeic acid | 2110, 2116 |
| 2-sec-Butylphenol | 1187 |
| 2-Substituted-1,2,3-triazole letrozole-based analogs | 1945 |
| 2-tert-Butyl-4-methylphenol | 1215, 2422 |
| 2-tert-Butyl-9-fluoro-3,6-dihydro-7H-benz(h)imidazo(4,5-f)isoquinoline-7-one | 2051 |
| 2-tert-Butylhydroquinone | 942, 961, 1024, 1096, 1219, 1293, 2104, 2105, 2116, 2308 |
| 2-Thienylidene-3,4-methylenedioxybenzoylhydrazine (LASSBio-294) | 1301 |
| 2-Tolidine | 1332 |
| 2-trans-4-trans-Decadienal | 1103, 1104, 1106 |
| (2-(Trimethylammonium)ethyl)methanethiosulfonate | 1247 |
| 2,2-(2-Chlorophenyl-4′-chlorophenyl)-1,1-dichloroethene | 1187, 2039, 2238, 2314, 2330, 2331 |
| 2,2′-(Hydroxynitrosohydrazono)bis-ethanamine | 1293, 1332, 2177, 2193 |
| 2,2′,3,3′,4,6′-Hexachlorobiphenyl | 1942 |
| 2,2′,3,4,4′,5,5′-Heptachlorbiphenyl (PCB180) | 1278, 1301, 2432 |
| 2,2′,3,4,4′,5′,6-Heptabromodiphenyl ether | 1096, 1187, 1293, 2432 |
| 2,2′,3′,4,4′,5-Hexachlorobiphenyl | 1293, 1345, 2236, 2370 |
| 2,2′,3,4′,5′,6-Hexachlorobiphenyl | 1942, 1978, 2156 |
| 2,2′,3,5′,6-Pentachlorobiphenyl | 2383 |
| 2,2′,4,4′,5-Brominated diphenyl ether | 1096, 1187, 1293 |
| 2,2′,4,4′,5-Pentabromodiphenyl ether (BDE-99)) | 1290 |
| 2,2,4,4-Tetrabromodiphenyl ether | 1096, 1119, 1215, 1293, 1355, 2312 |
| 2,2′,4,4′-Tetrahydroxybenzophenone | 1096, 2039, 2044 |
| 2,2′,4,6,6′-Pentachlorobiphenyl | 2018, 2072, 2278 |
| 2,2,6,6-Tetramethylpiperidine (2,2,6,6-TMPi) | 1636 |
| 2,2′-Azo bis(2-amidinopropane) | 1215, 2078 |
| 2,2-bis(4-Glycidyloxyphenyl)propane | 1060, 2183, 2344, 2445, 2457, 2478, 2483 |
| 2,2-bis(4-Hydroxyphenyl)-1,1,1-trichloroethane | 1187, 1235, 1272, 1978, 2018, 2039, 2044, 2118, 2188, 2314, 2365 |
| 2,2-bis(Hydroxymethyl)-1-azabicyclo(2,2,2,)octan-3-one | 2471, 2519 |
| 2,2-bis(p-Chlorophenyl)-1,1,1-trichloroethane (DDT) | 1277 |
| 2,2-Dichloro-1-(triphenylphosphonio)vinyl formamide perchlorate | 1228 |
| 2,2-Dichloro-1,1,1-trifluoroethane (hydrochlorofluorocarbons-123, HCFC-123) | 1636, 1899 |
| 2,2-Dichloropropane | 2120 |
| 2,2′-Dipyridyl | 2519 |
| 2,3,3′,4,4′,5-Hexachlorobiphenyl | 1096, 1293, 1332, 1942, 2039 |
| 2,3,3′,4,4′-Pentachlorobiphenyl | 1096, 1293, 1332 |
| 2,3,4,2′,3′,4′-Hexachlorobiphenyl | 1096 |
| 2,3′,4,4′,5-Pentachloro-1,1′-biphenyl | 1096 |
| 2,3′,4,4′,5-Pentachlorobiphenyl | 1096, 1278, 1302, 1345, 2237, 2312, 2370 |
| 2,3′,4,4′,5-Pentachlorobiphenyl (PCB 118); (1,1′-Biphenyl, 2,3′,4,4′,5-pentachloro-(9CI); 1,1′-biphenyl, 2,3′,4,4′,5-pentachloro-; 2,3′,4,4′,5-pentachloro-1,1′-biphenyl; 2,4,5,3′,4′-pentachlorobiphenyl; 3,4,2′,4′,5′-pentachlorobiphenyl; biphenyl, 2,3′,4,4′,5-pentachloro-; CB 118) | 1278, 1302 |
| 2,3,4,5,6-Pentabromotoluene | 1096 |
| 2′,3′,4′,5′-Tetrachloro-4-biphenylol | 1187, 2039 |
| 2,3,4,5-Tetrahydro-7,8-dihydroxy-1-phenyl-1H-3-benzazepine | 1265, 1998, 2072 |
| 2,3′,4,5′-Tetramethoxystilbene (resveratrol analog) | 1278, 1336 |
| 2,3,4,7,8-Pentachlorodibenzofuran (2,3,4,7,8-PeCDF) | 1096, 1293, 1332 |
| 2,3,5,6-Tetrachlorohydroquinone | 2457 |
| 2,3,6,2′,3′,6′-Hexachlorobiphenyl | 2383 |
| 2,3,6,7-Tetrachlorobiphenylene | 1293 |
| 2,3,7,8-Tetrabromodibenzo-4-dioxin | 1096 |
| 2,3,7,8-Tetrachlorodibenzo-p-dioxin (TCDD) | 1278, 1302, 1592, 1636, 1945 |
| 2,3-bis(3′-Hydroxybenzyl)butane-1,4-diol | 1978, 2237, 2519 |
| 2,3-bis(3′-Hydroxybenzyl)butyrolactone | 1978, 2039, 2044, 2156, 2237, 2312, 2519 |
| 2,3-bis(4-Hydroxyphenyl)-propionitrile | 2044 |
| 2,3-bis(Palmitoyloxy)-2-propyl-1-palmitoylcysteine | 2200, 2217 |
| 2,3-bis(Palmitoyloxy)-2-propyl-N-palmitoyl-cysteinyl-seryl-seryl-asparaginyl-alanine | 2220 |
| 2,3-Diaminonaphthalene | 2422 |
| 2,3-Diaminotoluene | 1096, 1293, 1332 |
| 2,3-Dichloro-1-propanol | 1611 |
| 2,3-Dimercaptopropane-1-sulfonic acid and meso-2, 3-dimercaptosuccinic acid | 946 |
| 2,3-Dimethoxy-1,4-naphthoquinone | 1043, 1293, 2022, 2050, 2083, 2222, 2457, 2480 |
| 2′,3-Dimethyl-4-aminobiphenyl | 1905 |
| 2,3-Epoxymethacrylic acid | 1592 |
| 2,4,2′,4′-Tetrachlorobiphenyl | 1187, 2370 |
| 2,4,3′,5′-Tetramethoxystilbene (TMS) | 1164, 1182, 1345 |
| 2,4,4′-Trichlorobiphenyl | 1293, 1345, 2237, 2370 |
| 2,4,5,2′,4′,5′-Hexachlorobiphenyl | 1096, 1207, 1293, 1332, 1346, 1978, 2039, 2066, 2156, 2183, 2217, 2237, 2261, 2312, 2314, 2370, 2432, 2457 |
| 2,4,5,2′,5′-Pentachlorobiphenyl | 1293, 1346, 1355, 1942, 1978, 2156, 2237, 2370, 2383, 2489, 2497 |
| 2,4,5-Trichlorophenoxyacetic acid | 961, 1187, 2022, 2039, 2180 |
| 2,4,6-Tribromoanisole | 1096 |
| 2,4,6-Tribromophenol | 1293, 1978 |
| 2,4,6-Trichlorophenol | 2471 |
| 2,4,6-Trichlorophenyl 4-nitrophenyl ether | 1187, 2039, 2457 |
| 2,4,6-Trichlorophenyl-4′-aminophenyl ether | 1187, 2044 |
| 2,4,6-Trichlorophenylhydrazine | 1187 |
| 2,4,6-Trisubstituted N-arylsulfonyl piperidines | 1747 |
| 2,4-Diaminohypoxanthine | 2082 |
| 2,4-Diaminotoluene | 1044, 1096, 1103, 1120, 1293, 1332, 2022, 2094, 2110, 2272 |
| 2,4-Dichloroaniline | 2295 |
| 2′,4′-Dichlorobenzamil amiloride | 2445 |
| 2,4′-Dichlorobiphenyl | 1187 |
| 2,4-Dichlorophenol | 1096, 1187, 2180 |
| 2,4-Dichlorophenoxyacetic acid | 1187, 1293, 1332, 1346, 2022, 2180, 2361, 2408, 2411, 2519 |
| 2,4-Dihydroxybenzophenone | 1187, 2039, 2044 |
| 2,4-Dinitrophenol | 1164, 1182, 2234, 2300 |
| 2,4-Dinitrophenyl-S-glutathione | 832 |
| 2,4-Dinitrotoluene | 1116, 1119, 2072, 2339, 2344 |
| 2,4-Thiazolidinedione | 1221, 1235, 1293, 2344, 2376 |
| 2,5,2′,5′-Tetrachlorobiphenyl | 2383 |
| 2,5-bis(Trifluoromethyl)-7-benzyloxy-4-trifluoromethylcoumarin | 1636 |
| 2,5-Diaminothiophene derivatives | 1302, 1636 |
| 2,5-Diaryl-2,3-dihydro-1,3,4-oxadiazoline analogs of combretastatin-A4 | 832 |
| 2,5-Diaziridinyl-3-(hydroxymethyl)-6-methyl-1,4-benzoquinone | 2308 |
| 2,5-Dihydroxybenzaldehyde | 1104, 1106 |
| 2,5-Dimethoxyamphetamine-derived designer drugs | 1436 |
| 2,5-Dimethyl-3,6-diaziridinyl-1,4-benzoquinone | 2308 |
| 2,5-Dimethylcelecoxib | 2208, 2370, 2430 |
| 2,5-di-tert-Butylhydroquinone | 2116 |
| 2,5-Hexanedione | 2238 |
| 2,6-Diaminotoluene | 1044, 1103, 1120, 2022, 2094, 2110, 2272 |
| 2,6-Diaryl-4-phenacylaminopyrimidines | 1637 |
| 2,6-Dichloro-4-nitrophenol | 2434, 2436 |
| 2,6-Dihydroxyanthraquinone | 1187, 2490 |
| 2,6-Diisocyanatotoluene | 2125 |
| 2,6-Dimethylnaphthalene | 1332 |
| 2,6-Dinitrotoluene | 2072 |
| 2,6-di-tert-Butyl-4-hydroperoxy-4-methyl-2,5-cyclohexadienone | 2072, 2116 |
| 2′,7′-bis-(3-Carboxypropyl)-5-(and-6)-carboxyfluorescein (BCPCF) | 932 |
| 2′,7′-bis(Carboxyethyl)-5(6)-carboxyfluorescein | 942, 970 |
| 2,7-Dichlorodibenzo-4-dioxin | 1293 |
| 2′,7′-Dichlorofluorescein | 1215 |
| 2,8-Dichlorodibenzo-4-dioxin | 1293 |
| (3-(1H-Indol-2-yl)phenyl)(1H-indol-2-yl)methanone | 833, 998 |
| 3-(1,2,5,6-Tetrahydropyrid-4-yl)pyrrolo(3,2-b)pyrid-5-one | 2161 |
| 3-(2-(4-(3-Chloro-2-methylphenyl)1-piperazinyl)ethyl)5,6-dimethoxy-1-(4-imidazolylmethyl)-1H-indazol dihydrochloride 3.5 hydrate | 1332, 1377, 1400, 1423, 1589, 1899 |
| 3-(2-Hydroxy-4-(1,1-dimethylheptyl)phenyl)-4-(3-hydroxypropyl)cyclohexanol | 1258, 2026, 2072, 2183, 2200, 2457, 2468 |
| 3-((2-Methyl-1,3-thiazol-4-yl)ethynyl)pyridine | 1332, 1346 |
| 3-(3-(3-(4,5-Dihydroimidazol-2-ylamino)propyloxylisoxazol-5-yl)carbonylamino)-2-(phenylsulfonylamino)propionic acid | 2227 |
| 3-(3,4-Difluorophenyl)-4-(4-(methylsulfonyl)phenyl)-2(5H)-furanone | 2370 |
| 3-(3-Chloro-4-hydroxyphenylamino)-4-(4-nitrophenyl)-1H-pyrrole-2,5-dione | 2101 |
| 3-(3-Chloro-4-methoxyphenyl)-1,1-dimethylurea | 2183, 2457 |
| 3-(3-Cyano-4-pyridyl)-5-(4-pyridyl)-1,2,4-triazole (FYX-051) | 1637 |
| 3-((3-Trifluoromethyl)phenyl)-5-((3-carboxyphenyl)methylene)-2-thioxo-4-thiazolidinone | 1247 |
| 3-(4-(1,2-Diphenylbut-1-enyl)phenyl)acrylic acid | 2039 |
| 3-((4-(4-Chlorophenyl)piperazin-1-yl)methyl)-1H-pyrrolo(2,3-b)pyridine | 2006 |
| (3-(4-(bis(2-Chloroethyl)amino)phenyl)-3-propyl)carbamic acid 2-(6-(17-hydroxy-13-methyl-3-oxo-2,3,6,7,8,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta(a)phenanthren-11-yl)hexylamino)ethyl ester | 1187 |
| 3-(4-Dimethylamino-benzylidenyl)-2-indolinone | 2331 |
| 3-(4′-Hydroxy-3′-adamantylbiphenyl-4-yl)acrylic acid | 1026, 1049, 1080, 1110, 1219, 1235, 2018, 2062, 2072, 2082, 2147, 2238, 2269, 2302, 2362, 2386, 2472, 2480, 2510, 2521 |
| 3-(4′-Methylbenzylidene)camphor | 1261, 2039, 2044, 2188 |
| (3,4-(Methylenedioxy)benzyl)amino)-6-chloroquinazoline | 2328 |
| 3-(4-Methylphenylsulfonyl)-2-propenenitrile | 2177, 2183, 2208, 2220, 2370, 2430, 2442, 2457 |
| 3-(4-Methylsulfonylphenyl)-4-phenyl-5-trifluoromethylisoxazole | 2370 |
| 3-(4-t-Butylphenyl)-N-(2,3-dihydrobenzo(b)(1,4)dioxin-6-yl)acrylamide | 2478 |
| 3-((5-(6-((3-Chlorophenyl)amino)pyrazinyl)-3-pyridinyl)amino)-1-propanol | 1235, 2237 |
| 3-(5′-Hydroxymethyl-2′-furyl)-1-benzylindazole | 2039 |
| 3-(5-Methyl-2-(2-oxo-1,2-dihydroindol-3-ylidenemethyl)-1H-pyrrol-3-yl)propionic acid | 2018, 2237 |
| 3-Adenin-9-yl-2-hydroxypropanoic acid isobutyl ester | 2442 |
| 3-alpha,6-alpha,7-alpha,12-alpha-Tetrahydroxy-cholanoyl taurine | 833 |
| 3-alpha-6-alpha-Dihydroxy-7alpha-fluoro-5beta-cholanoate (UPF-680) | 1912 |
| 3-Amino-5-((2-((2-methoxyethyl)amino)-6-(4-(trifluoromethyl)phenyl)pyrimidin-4-yl)oxy)quinoxalin-2(1H)-one | 2478 |
| 3-Amino-5,6,7,8-tetrahydro-2-{4-[4-(quinolin-2-yl)piperazin-1-yl]-butyl}quinazolin-4(3H)-one (TZB-30878) | 1436 |
| 3-Aminobenzamide | 1221, 2376 |
| 3-Aminobenzanthrone | 1294, 1637, 2366 |
| 3-Aminopyridine-2-carboxaldehyde thiosemicarbazone (3-AP; Triapine®) | 833 |
| 3-Aminothioacridone | 1235, 2376, 2472 |
| (3b,5b,7a,12a)-7,12-Dihydroxy-3-(2-((4-((11b,17b)-17-hydroxy-3-oxo-17-prop-1-ynylestra-4,9-dien-11-yl)phenyl)(methyl)amino)ethoxy)cholan-24-oic acid | 2317 |
| 3′R,4′R-Disubstituted-2′,2′-dimethyldihydropyrano[2,3-f]chromone (DSP) analogs | 833 |
| 3-beta-Acetyl tormentic acid | 833 |
| 3-Benzylidene camphor | 2044 |
| 3-Benzyloxyfluorenes | 833 |
| 3-Carboxy-4-methyl-5-propyl-2-furanpropanoic acid | 1398 |
| 3-Chlorocarbazole | 1279 |
| 3-Chlorophenol | 1187, 1228, 2183, 2505 |
| 3-Cyanomethyl-4-methyl-DCK | 1302, 1637 |
| 3-(Cyclopentyloxy)-N-(3,5-dichloro-4-pyridyl)-4-methoxybenzamide | 1367 |
| 3-Dinitrobenzene | 926, 1106 |
| 3-Hydroxy fatty acids | 1906 |
| 3-Hydroxybenzaldehyde | 1104, 1106 |
| 3-Hydroxybenzo(a)pyrene | 2432, 2436 |
| 3-Hydroxybutyric acid | 2420 |
| 3-Hydroxydesloratadine | 2490, 2493 |
| 3′-Hydroxy-genistein | 1333, 1612 |
| 3-Hydroxytamoxifen | 1346, 1899, 2445 |
| 3-Hydroxytibolone | 2519 |
| 3-Indoxyl sulfate | 1302, 1398 |
| 3-Iodo-2-propynylbutylcarbamate | 1040 |
| 3-Keto-desogestrel | 1400, 1423, 1899, 2048 |
| 3-Methoxy-4-aminoazobenzene | 1294 |
| 3′-Methoxy-4′-nitroflavone | 1294 |
| 3-Methoxymorphinan | 1589, 1899 |
| 3-Methyl-9-(2-oxa-2l(5)-2H-1,3,2-oxazaphosphorine-2-cyclohexyl)-3,6,9-triazaspiro(5.5)undecane | 1231 |
| 3-Methylcatechol | 2457 |
| 3-Methylcholanthrene | 1094, 1096, 1294, 1302, 1592 |
| 3-Methylindole | 1637, 1903 |
| 3-Methylpyridine | 2105, 2110 |
| 3-Methylquercetin | 942 |
| 3-Methylsulfonyl-DDE | 1934 |
| 3-Morpholino-sydnonimine | 1266, 2326, 2420, 2422, 2445 |
| 3-(N-Nitrosomethylamino)propionaldehyde | 1668 |
| 3-(N-Nitrosomethylamino)propionitrile | 1668 |
| 3-(N-Phenylamino)-1,2-propanediol 1,2-dioleoyl ester | 2072 |
| 3-Nitrobenzanthrone | 1279, 1294, 1303, 1637, 2295, 2308, 2432, 2433 |
| 3-Nitrophenol | 1164, 1182 |
| 3-OH-Desloratadine | 1782 |
| 3-O-Sulfate conjugate of 17alpha-ethinylestradiol | 833 |
| 3-Oxocholan-24-oic acid | 2312, 2516 |
| 3-Phenoxybenzaldehyde | 2039 |
| 3-Phenoxybenzoic acid | 1187, 2039 |
| 3-Phenoxybenzylalcohol | 2039 |
| 3-Phenyl-5-pyridyl-1,2,4-triazole derivatives | 1637 |
| 3-Pyridinecarboxylic acid, 1,4-dihydro-2,6-dimethyl-5-nitro-4-(2-(trifluoromethyl)phenyl)-,methyl ester | 1265, 1942, 2002, 2072 |
| 3-Xylene | 2457 |
| (3Z)-N-(3-Chlorophenyl)-3-((3,5-dimethyl-4-((4-methylpiperazin-1-yl)carbonyl)-1H-pyrrol-2-yl)methylene)-N-methyl-2-oxo-2,3-dihydro-1H-indole-5-sulfonamide) | 2270 |
| 3,3′-Dichlorobenzidine | 1096, 1187, 1905 |
| 3,3′-Diindolylmethane | 1119, 1293, 1332, 1637, 2105, 2308 |
| 3,3-Dimethylallyl pyrophosphate | 2467 |
| 3,3′,4,4′,5,5′-Hexachlorobiphenyl (PCB169) | 1279 |
| 3,3′,4,4′,5-Pentachlorobiphenyl (PCB126) | 1279, 1343 |
| 3,3′,4′,5,6,7,8-Heptamethoxyflavone | 1813 |
| 3,3′,4,5′-Tetrahydroxystilbene | 942, 1164, 1182, 1215, 1293, 1332, 1346, 1992, 2039, 2044, 2177, 2183, 2208, 2370, 2457 |
| 3,3′,5-Trichlorobenzidine | 1096 |
| 3,4-Dichloroacetanilide | 1187 |
| 3,4-Dichloroaniline | 812, 1187, 1294, 2295 |
| 3,4-Dichloro-N-methyl-N-(2-(1-pyrrolidinyl)-cyclohexyl)-benzeneacetamide,(trans)-Isomer | 2212 |
| 3′,4′-Dihydroxyflavone | 942 |
| 3,4-Dihydroxyphenylethanol | 2300, 2457, 2513 |
| 3′,4′-Dimethoxyflavone | 1294, 1346, 1942 |
| 3′,4′-Dimethoxy-alpha-naphthoflavone | 1279 |
| 3,4-Methylendioxy-methamphetamine (MDMA) | 1007, 1303, 1532, 1637 |
| 3,4-Methylenedioxyamphetamine (MDA) | 1436, 1637 |
| 3,4-Methylenedioxy-amphetamine (MDA) and benzodioxolyl-butanamine (BDB) enantiomers | 1637 |
| 3,4-Methylene-dioxyethylamphetamine (MDEA, Eve) | 1637 |
| 3′,4′-Methylenedioxy-alpha-pyrrolidinopropiophenone (MDPPP) | 1436 |
| 3,4,3′,4′-Tetrachloroazobenzene | 1294, 1332 |
| 3,4,3′,4′-Tetrachlorobiphenyl | 1096, 1294, 1346, 1942, 2039, 2044, 2237, 2370 |
| 3,4,4a,10b-Tetrahydro-4-propyl-2H,5H-(1)benzopyrano(4,3-b)-1,4-oxazin-9-ol | 2002, 2004, 2072 |
| 3,4,5-Trihydroxybenzamidoxime | 1215 |
| 3,4,5-Trihydroxystelbin | 1327 |
| 3,4′,5-Trimethoxystilbene | 1164, 1182, 1333, 1611 |
| 3,4,5,3′,4′,5′-Hexachlorobiphenyl | 1096, 1294, 1332, 1346, 1942, 2200, 2237, 2370 |
| 3,4,5,3′,4′-Pentachlorobiphenyl | 961, 964, 979, 1092, 1096, 1294, 1332, 1346, 1942, 1978, 2039, 2066, 2156, 2193, 2237, 2308, 2317, 2370, 2393, 2418 |
| 3,4,5,4′-Tetramethoxystilbene | 2472 |
| 3′,4′,5,6,7,8-Hexamethoxyflavone (Nobiletin) | 1813 |
| 3,5-Dibenzoyl-4-(3-phenoxy-phenyl)-1,4-dihydro-2,6-dimethylpyridine (DP7) | 1637 |
| 3′,5′-Dichloro-2-hydroxy-2-methylbut-3-enanilide | 1187, 2039, 2044, 2317 |
| 3,5-Dichlorobenzidine | 1096 |
| 3,5-Dihydroxy-4′-methoxystilbene | 2039 |
| 3,5-Dihydroxyphenylglycine | 1265 |
| 3,5-Dimethyl-2-(3-pyridyl)thiazolidin-4-one | 1355 |
| 3,5,6-Trichloro-2-pyridinol | 1249 |
| 3,6-Dihydroxy-7-fluorocholanoic acid | 1932, 2400 |
| 3,6-Dinitrobenzo(e)pyrene | 1637 |
| 3,7-Dimethyl-1-propargylxanthine | 1062 |
| 3,7,11,15-Tetramethyl-2,4,6,10,14-hexadecapentaenoic acid | 1221, 2376, 2472 |
| 3,8-Dihydroxy-6H-dibenzo(b,d)pyran-6-one | 2039, 2044, |
| 3,9-bis((Ethylthio)methyl)-K-252a | 2208, 2370, 2422, 2457 |
| 3,N4-Ethenodeoxycytidine | 1592 |
| 4-(1-Adamantyl)phenol | 2039 |
| 4-(1H-Imidazol-1-yl)retinoic acid | 1221, 1235, 1978, 2026, 2039 |
| 4-(1H-Imidazol-4-ylmethyl)piperidine | 1080, 1638 |
| 4-(2-(5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1-propenyl)benzoic acid | 1221, 1978, 2344, 2376 |
| 4-(2-Aminoethyl)benzenesulfonylfluoride | 2072 |
| 4-(2-Chloro-4-(2-piperidin-1-ylethoxy)phenyl)-5-(2,6-dichloro-4-hydroxyphenyl)-2-imidazoline | 2039, 2044 |
| 4-(3-(2-Propyl-3-hydroxy-4-acetyl)phenoxy)propyloxyphenoxy acetic acid | 2341 |
| 4-((3-Bromophenyl)amino)-6,7-dimethoxyquinazoline | 1978, 2018 |
| 4-((4-Bromophenyl)-(ethoxyimino)methyl)-1′-((2,4-dimethyl-3-pyridinyl)carbonyl)-4′-methyl-1,4′-bipiperidine N-oxide | 1228, 1400, 1899 |
| 4-(3-Butoxy-4-methoxybenzyl)-2-imidazolidinone | 2203, 2457 |
| 4-(3-Pentylamino)-2,7-dimethyl-8-(2-methyl-4-methoxyphenyl)pyrazolo(1,5-a)pyrimidine | 961, 1266, 2312, 2314, 2489 |
| 4-(4-(3-(Pyridin-2-yl)-1H-pyrazol-4-yl)pyridin-2-yl)-N-(tetrahydro-2H-pyran-4-yl)benzamide | 1261, 2448 |
| 4-(4-(bis(4-Fluorophenyl)methyl)piperazin-1-ylbut-2-enyloxy)acetic acid | 2154 |
| 4-(4-Chlorophenyl)imidazole | 1359 |
| 4-(4-Cyano-2-(2-(4-fluoronaphthalen-1-yl)propionylamino)phenyl)butyric acid | 2362 |
| 4-(4-Cyclohexyl-2-methyloxazol-5-yl)-2-fluorobenzenesulfonamide | 2370 |
| 4-(4-Fluorophenyl)-2-(4-hydroxyphenyl)-5-(4-pyridyl)imidazole | 1088, 1265, 1294, 2018, 2072, 2183, 2193, 2203, 2220, 2341, 2370, 2376, 2457, 2519 |
| 4-(5-(4-Chlorophenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl)benzenesulfonamide | 1110, 2208, 2276, 2344, 2370 |
| 4-(5-Benzo(1,3)dioxol-5-yl-4-pyridin-2-yl-1H-imidazol-2-yl)benzamide | 2445, 2448 |
| 4-(Acetoxymethylnitrosamino)-1-(3-pyridyl)-1-butanone | 2208 |
| 4-Acetylaminofluorene | 1044, 1103, 1120, 2022, 2094, 2110, 2272 |
| 4-Amino-5-(4-methylphenyl)-7-(tert-butyl)pyrazolo(3,4-d)pyrimidine | 1088, 2018, 2346, 2379 |
| 4-Aminobenzamide | 1612 |
| 4-Aminobenzoic acid | 2295 |
| 4-Aminobenzoyl-glycyl-prolyl-leucyl-alanine hydroxamic acid | 2177, 2193, 2203, 2457, 2513 |
| 4-Aminopyridine (See Dalfampridine) | 198, 2295 |
| 4-and 6-(p-Sulfamoylphenyl)androstenediones | 1946 |
| 4-Anilinoquinazolines (gefitinib, erlotinib and lapatinib)(tyrosine kinase inhibitors) | 998, 1303, 1437 |
| 4-Anisidine | 1164, 1182, 2295, 2468 |
| 4-beta-Anilino-podophyllotoxin derivatives | 833 |
| 4-beta-Hydroxycholesterol | 1637 |
| 4-Biphenylamine | 1294, 2295, 2366, 2370, 2432, 2472, 2495 |
| 4-BP | 1977 |
| 4-Bromoaniline | 2295 |
| 4′-Bromoflavone | 2308 |
| 4-Bromophenacyl bromide | 2183, 2203, 2213 |
| 4-Chloro-2-cresol | 1187 |
| 4-Chloroaniline | 2295 |
| 4-Chlorobenzo(f)isoquinoline | 1247 |
| 4-Chloromercuribenzenesulfonate | 1247 |
| 4-Chloronitrobenzene | 2110, 2116 |
| 4-Coumaric acid | 2300, 2370 |
| 4-Cumylphenol | 2039 |
| 4-Cyano-4-(2,3-dihydro-8-methoxy-1,4-benzodioxin-5-yl)cyclohexanecarboxylic acid | 2193, 2203 |
| 4-Cyclododecyl-2,6-dimethylmorpholine acetate | 2039 |
| 4-Dichlorobenzene | 1215, 1294, 1333, 1589, 1612, 1899, 2072 |
| 4-Diethoxyphosphorylmethyl-N-(4-bromo-2-cyanophenyl)benzamide | 1242, 1243, 1257, 1294, 1333, 1899 |
| 4-(Diethylamino)benzaldehyde | 1103 |
| 4-Dimethylamino-3′,4′-dimethoxychalcone | 2457 |
| 4-Diphenylacetoxy-1,1-dimethylpiperidinium | 1250, 1251, 1252 |
| 4-Ethylphenol | 1187, 2203 |
| 4′-Geranyloxyferulic acid | 1365, 1540 |
| 4-Hexyloxyaniline | 2295 |
| 4-Hydroxy-2-nonenal | 942, 961,1108, 1114, 1164, 1182, 1200, 1204, 1261, 1264, 1265, 1346, 2026, 2028, 2032, 2072, 2091, 2101, 2105, 2110, 2116, 2150, 2211, 2242, 2274, 2276, 2314, 2331, 2337, 2376, 2465, 2468, 2472 |
| 4′-Hydroxy-3′-methoxyacetophenone | 2177, 2457 |
| 4-Hydroxyacetophenone | 1101, 1103 |
| 4-Hydroxybenzophenone | 1187, 2039, 2044 |
| 4-Hydroxychalcone | 1187, 1294, 1346 |
| 4-Hydroxychlorpropham | 2039 |
| 4-Hydroxyclomiphene | 2039 |
| 4-Hydroxycyclophosphamide | 1101, 1103, 1108, 1367, 1400, 1423, 1702, 1899, 2105, 2116 |
| 4′-Hydroxydiclofenac | 1400 |
| 4-Hydroxy-equilenin | 1042, 1207, 2436, 2451, 2472 |
| 4-Hydroxyestradiol | 1638 |
| 4-Hydroxyestradiol-17beta | 1187, 1264, 1346, 2039, 2044, 2370, 2519 |
| 4-Hydroxyestrone | 2490, 2493 |
| 4-Hydroxymephenytoin | 1423 |
| 4-Hydroxymercuribenzoate | 2085, 2337 |
| 4-Hydroxystilbene | 1187 |
| 4-Hydroxytamoxifen (4-OHT) | 1121, 1187, 1222, 1233, 1346, 1355, 1899, 2018, 2026, 2039, 2045, 2086, 2188, 2270, 2312, 2346, 2382, 2468 |
| 4-Hydroxyvalproate | 1355, 1367, 1400 |
| 4-Imidazolylflavans | 1946 |
| 4-Iodo-2,5-dimethoxyphenylisopropylamine | 2072, 2164 |
| 4-Iodoaniline | 2295 |
| 4-Iodo-N-(4-(4-(2-methoxyphenyl)piperazin-1-yl)butyl)cinnamoylamide | 2004 |
| 4-Iodo-tamoxifen | 2105 |
| 4-Ipomeanol | 1333, 1423, 1589, 1638, 1899, 1903, 1906, |
| 4′-Isopentenyloxy-p-coumaric acid | 903, 1540 |
| 4-(Isopropylamino)-2-(2-pyridyl)-2-phenylbutyramide | 1899 |
| 4-Methylcatechol | 2457 |
| 4-Methylhistamine | 2155 |
| 4-Methyl-N-(3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl)-3-((4-pyridin-3-ylpyrimidin-2-yl)amino)benzamide | 1026, 2270 |
| 4-(Methylnitrosamino)-1-(3-pyridyl)-1-butan-1-ol | 1355, 1899, 2489 |
| 4-(Methylnitrosamino)-1-(3-pyridyl)-1-butanone | 1350, 2494 |
| 4-((Methylnitrosoamino)-1-(3-pyridyl)but-1-yl)beta-omega-glucosiduronic acid | 942, 961 |
| 4′-Methoxy-alpha-pyrrolidinopropiophenone (MOPPP) | 1437 |
| 4-Methylthioamphetamine | 1437, 1638 |
| 4-Methylumbelliferone | 961, 1024, 2493 |
| 4-Methylumbelliferyl acetate | 1242, 1243 |
| 4-Methylumbelliferyl heptanoate | 1242 |
| 4′-Methyl-alpha–pyrrolidinobutyrophenone | 1437 |
| 4-(Nitroxy)butanoic acid 4-acetylaminophenyl ester | 1215 |
| 4-(N-Methyl-N-nitrosamino)-1-(3-pyridyl)-1-butanone | 961, 1103, 1218, 1222, 1235, 1243, 1294, 1333, 1346, 1355, 1367, 1423, 1589, 1612, 1899, 1995, 2022, 2104, 2208, 2224, 2241, 2272, 2308, 2370, 2376, 2438, 2472, 2480, 2494, 2495, 2499, 2519, 2509, 2525 |
| 4′-N-Benzoylstaurosporine | 1088, 2370, 2472 |
| 4-Nitrobenzyl chloride | 2105, 2120 |
| 4-Nitrophenethyl bromide | 2120 |
| 4-Nitrophenol | 1243, 1249, 1333, 1423, 1612, 2337, 2432, 2433, 2434, 2435, 2437, 2490, 2493 |
| 4-Nitrophenyl acetate | 1242, 2295 |
| 4-Nitrophenyl butyrate | 1242 |
| 4-Nitrophenyl laurate | 1242 |
| 4-Nitrophenylacetic acid | 1242, 1243 |
| 4-Nitrophenyloctanoate | 1242 |
| 4-Nitroquinoline-1-oxide | 942 |
| 4-Nitrosodimethylaniline | 2272 |
| 4-Nitrotoluene | 2180 |
| 4-Nonylphenol | 1096, 1116, 1119, 1187, 1250, 1253, 1255, 1294, 2026, 2039, 2045, 2292, 2312 |
| 4-Octylphenol | 1187, 1253, 1255, 2039, 2045, 2180 |
| 4-OH-2′,3,3′,4′,5′-Pentachlorobiphenyl | 2436, 2490 |
| 4-OH Estrogens | 937 |
| 4-O-Methyl-12-O-tetradecanoylphorbol 13-acetate | 2200, 2445 |
| 4-Oxo-2-nonenal | 2116 |
| 4-Oxo-4,5,6,7-tetrahydro-1H-indole-3-carboxylic acid (4-methylaminomethyl-phenyl)-amide (GABA partial agonist) | 833 |
| 4-Oxofenretinide | 1231, 2472 |
| 4-Oxoretinoic acid | 1121, 1261, 1986, 2018, 2078, 2110, 2188, 2190, 2193, 2366, 2370 |
| 4-Oxoretinol | 986, 1261 |
| 4-(p-Sulfamoylphenyl)androstenediones | 1946 |
| 4-Phenylbutyric acid | 1241, 1247, 2193, 2208, 2370 |
| 4-Phenylenediamine | 964, 2183, 2203, 2217, 2295, 2308, 2344, 2366, 2370, 2457 |
| 4-Phenylphenol | 1187, 2039 |
| 4-Propylphenol | 2105, 2110, 2116 |
| 4-Substituted methoxybenzoyl-aryl-thiazole | 833 |
| 4-tert-Octylphenol | 1042, 1187, 1946, 2019, 2039, 2045, 2072, 2188, 2224, 2519 |
| 4-Trifluoromethylumbelliferyl iduronide | 2490, 2493 |
| 4-Vinyl-1-cyclohexene dioxide | 1096 |
| 4-Vinylcyclohexene | 1096, 1294, 1638, 2105 |
| 4,4-(1-(4-(1-(4-Hydroxyphenyl)-1-methylethyl)phenyl)ethylidene)bis(phenol) | 1187 |
| 4,4′,4”-(4-Propyl-((1)H)-pyrazole-1,3,5-triyl)tris-phenol | 2039 |
| 4,4′-bis(2-Sulfostyryl)biphenyl | 2039 |
| 4,4′-Butylidenebis(6-t-butyl-m-cresol)(BBBC) | 1187, 1946 |
| 4,4′-Dichlorobiphenyl | 1187 |
| 4,4-Difluoro-4-bora-3a,4a-diaza-s-indacene | 929 |
| 4,4′-Dihydroxybiphenyl | 2039 |
| 4,4′-Dihydroxystilbene | 1187 |
| 4,4′-Diisothiocyanostilbene-2,2′-disulfonic acid | 1247, 2183, 2193, 2393 |
| 4,4′-Diphenylmethane diisocyanate | 2110, 2177, 2295 |
| 4,4′-Dipyridyl disulfide | 2272 |
| 4′,5,6,7,8-Pentamethoxyflavone (Tangeretin) | 1813 |
| 4,5-Dianilinophthalimide (DAPH) | 2302 |
| 4,5-Dihydroorotic acid | 1990 |
| 4,5-Dihydropyrazole-1-carboxylic acid-(4-chlorophenyl amide) | 1638 |
| 4,11-bis[(2-Aminoethyl)amino]anthra(2,3-b)furan-5,10-diones | 833 |
| 5-(1-Aziridinyl)-2,4-dinitrobenzamide | 2308 |
| 5-(2,2-Difluorobenzo(1,3)dioxol-5-ylmethylene)thiazolidine-2,4-dione | 2101 |
| 5-{2-[4-(3,4-Difluorophenoxy)-phenyl]-ethylsulfamoyl}-2-methyl-benzoic acid | 1303, 1638 |
| 5-((3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydro-2-naphthalenyl)methyl)-N-(2,4,6-trimethoxyphenyl)-2-furamide | 2200 |
| 5-{4-[3-(4-Cyclohexyl-2-propylphenoxy)propoxy]phenyl}-1,3-oxazolidine-2,4-dione (compound A) | 1638, 1899 |
| 5-(4-(3-(4-Cyclohexyl-2-propylphenoxy)propoxy)phenyl)-1,3-oxazolidine-2,4-dione | 1333, 1355, 1367, 1377, 1400, 1423, 1589, 1612 |
| 5-(4-Dimethylaminobenzoyl)-aminovaleric acid hydroxamide (4-Me(2)N-BAVAH) | 1279 |
| 5-(4-Phenoxybutoxy)psoralen | 1279, 1393 |
| 5′-Adenylyl(beta, gamma-methylene) diphosphonate | 942 |
| 5-alpha-Androst-16-en-3beta-ol | 1978 |
| 5-alpha-Dihydroprogesterone | 2039, 2101, 2266, 2312 |
| 5-alpha-Dihydrotestosterone | 1303 |
| 5-Aminoimidazole-4-carboxamide-1-beta-ribofuranoside (AICAR) | 1359, 1908 |
| 5-Androstene-3,17-dione | 2105 |
| 5-Aza-2′-deoxycytidine (5-AzadC) | 833 |
| 5-Benzylacyclouridine | 2457 |
| 5-beta-Cholestane-3alpha,7alpha,12alpha-triol | 1638 |
| 5-Bromotetrandrine | 834 |
| 5-Butyl-6-hydroxy-10-chlorobenzo(c)quinolizinium chloride | 1247 |
| 5-Butyl-7-chloro-6-hydroxybenzo(c)quinolizinium | 1247 |
| 5-Carboxamidotryptamine | 2161 |
| 5-Carboxyfluorescein diacetate | 942, 961 |
| 5-Chloromethylfluorescein | 961 |
| 5-Cholesten-3beta,25-diol 3-sulfonate | 1913 |
| 5-Cyclohexylindolyl-2′-deoxyribose (non-natural nucleoside) | 834 |
| 5′-Deoxy-5-fluorocytidine | 1229, 1242, 1243 |
| 5-Dihydrocortisone | 1099 |
| 5-(Dimethylamino)-N-(3,4-dimethyl-5-isoxazolyl)-1-naphthalenesulfonamide | 2014, 2300 |
| 5-Fluoro-2-[4-[(2-phenyl-1H-imidazol-5-yl)methyl]-1-piperazinyl]pyrimidine (SCH 66712) | 1380, 1437 |
| (5-Fluoro-2-methyl-1-(4-pyridyl)methylene-3-(N-benzyl)-indene)-acetamide hydrochloride | 1222, 2328, 2376, 2472 |
| 5-Fluoropyrimidin-2-one beta-ribofuranoside | 2442 |
| 5-Fluoropyrimidine | 1995 |
| 5′-Fluorosulfonylbenzoyl 5′-Adenosine | 834 |
| 5-Fluorouracil | 1102, 1350, 1407, 1638, 1994, 2273, 2286, 2479 |
| 5-HT3 Antagonists | 1639 |
| 5-HT3 Receptor antagonists | 2166 |
| 5-Hydroxyeicosatetraenoic acid lactone | 2337 |
| 5-Hydroxyvalproate | 1355, 1367, 1400 |
| 5-Lipoxygenase inhibitors | 1109 |
| 5-Methoxy 3-(1,2,3,6-tetrahydro-4-pyridinyl)1H indole | 2161 |
| 5-Methoxy-1,2-dimethyl-3-((4-nitrophenoxy)methyl)indole-4,7-dione | 2308 |
| 5-Methoxy-1-methyl-2-(n-propylamino)tetralin | 2002, 2004 |
| 5-Methoxy-N,N-diisopropyltryptamine (Foxy) | 1437, 1639 |
| 5-Methoxy-N,N-dimethyltryptamine | 1437 |
| 5-Methoxytryptamine (5-MT) | 1437 |
| 5-Methyl-1-(3-fluorophenyl)-2-[1H]-pyridone (AKF-PD)(Flourofenidone) | 1381 |
| 5-Methyltetrahydrofolate | 2288, 2291, 2405 |
| 5′-Methylthioadenosine | 1261 |
| 5-n-Butyl-7-(3,4,5-trimethoxybenzoylamino)pyrazolo[1,5-a]pyrimidine(OT-7100) | 1303 |
| 5-n-Butyl-pyrazolo[1,5-a]pyrimidine | 1303 |
| 5-Nitro-2-(3-phenylpropylamino)benzoic acid | 1247 |
| 5-Phenyl-terbenzimidazole | 2467 |
| 5-p-Methylphenyl-5-phenylhydantoin | 2312 |
| 5-Pyridin-2-yl-thiophene-2-hydroxamic acids (histone deacetylase (HDAC) inhibitors) | 1639 |
| (5R)-2,6,9-Humulatrien-5-ol-8-one | 1897 |
| (5R)-N-[1-Ethyl-1-(4-ethylphenyl)propyl]-2,7,7-trimethyl-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide monotosylate (TAK-075) | 1211 |
| 5-S-Glutathionyldopamine | 2105, 2110, 2116 |
| 5-S-Glutathionyl-alpha-methyldopa | 2105, 2110, 2116 |
| 5,5′-bis(8-(Phenylamino)-1-naphthalenesulfonate) | 1203 |
| 5,5-Diphenylbarbituric acid | 834 |
| 5,6,7,8-Tetrahydrofolic acid | 2291, 2405 |
| 5,6-Dihydroxy-1-(2-imidazolinyl)tetralin | 1067 |
| 5,6-Dimethylxanthenone-4-acetic acid (DMXAA) | 1723 |
| 5,6-Dimethylxanthenoneacetic acid | 942,961, 1333, 2208, 2457, 2519 |
| (5,6-Dimethoxyindan-2-yl)dipropylamine | 2002, 2004 |
| 5,7-Dimethoxyflavone | 998, 1294, 1346 |
| 5,7,3′,4′-Tetramethylluteolin | 942 |
| 5,7,3′-Trihydroxy-3,5′-dimethoxy-2′-(3′-methylbut-2-enyl)flavone) | 1008 |
| 5,8,11,14-Eicosatetraynoic acid | 1088, 1242, 2019, 2217, 2220, 2339 |
| 5,10-Methylenetetrahydrofolate | 2288 |
| 5,10,15,20-tetrakis(4-Sulfonatophenyl)porphyrinato iron(III) chloride | 2457 |
| 5,11-Diethyl-5,6,11,12-tetrahydrochrysene-2,8-diol | 2039, 2045 |
| 6-(1,1-Dimethylallyl)naringenin | 2039 |
| 6-((2-(4-Imidazolyl)ethyl)amino)heptanoic acid 4-toluidide | 2154 |
| 6-(2-Fluoroethoxy)-2-(2-(4-methylaminophenil) ethenyl) benzoxazole | 1164, 1182 |
| 6-(2-Fluoroethoxy)-2-(2-(4-methylaminophenil) ethenyl) benzoxazole | 1164, 1182 |
| 6-((3-Chloro)anilino)-2-(isopropyl-2-hydroxyethylamino)-9-isopropylpurine | 1231, 1233, 1241, 2101, 2472 |
| 6-(4-(2,5-Difluorophenyl)oxazol-5-yl)-3-isopropyl-[1,2,4]-triazolo[4,3-a]pyridine | 1639 |
| 6-(4-Chlorophenyl)imidazo(2,1-b)(1,3)thiazole-5-carbaldehyde O-(3,4-dichlorobenzyl)oxime | 1355, 1367, 1377, 1899, 2312, 2314 |
| 6-[(4-Fluorophenyl)(1H-imidazol-1-yl)methyl]-1,3-benzodioxol-5-ol and 6-[(4-methoxyphenyl)(1H-imidazol-1-yl)methyl]-1,3-benzodioxol-5-ol | 1946 |
| 6-Acetyl-3-(4-(4-(4-fluorophenyl)piperazin-1-yl)butyl)benzo[d]oxazol-2(3H)-one (SN79) | 1350, 1437 |
| 6-Aminobenzo[c]phenanthridines | 1438, 1639, |
| 6-Aminochrysene-1,2-dihydrodiol | 2120 |
| 6-Arylpyrrolo[2,1-d][1,5]benzothiazepine derivatives | 1359 |
| 6-beta-Hydroxycortisol | 1639, 1899 |
| 6-beta-Hydroxytestosterone | 1899 |
| 6-beta-Methyl-B-norandrostenedione | 1946 |
| 6-Bromoacetyl-2-dimethylaminonaphthalene | 2116 |
| 6-(Bromomethylene)tetrahydro-3-(1-naphthaleneyl)-2H-pyran-2-one | 1110 |
| 6-Carboxyfluorescein | 942, 961 |
| 6-Chloroacetyl-2-dimethylaminonaphthalene | 2105, 2116 |
| 6-Chrysenamine | 1294 |
| 6-Cyano-4-(N-ethylsulfonyl-N-methylamino)-3-hydroxy-2,2-dimethylchromane | 2229, 2236 |
| 6-Deisopropylatrazine | 2039 |
| 6-Ethylchenodeoxycholic acid | 929, 961, 1261, 1932, 2276, 2340, 2344, 2400, 2445 |
| 6-Formylindolo(3,2-b)carbazole | 1096 |
| 6-Hydroxy-10-chlorobenzo(c)quinolizinium | 1247 |
| 6-Hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid | 926, 1265, 2237, 2445, 2519 |
| 6-Hydroxychlorzoxazone | 1612 |
| 6-Hydroxymelatonin | 2434 |
| 6-Hydroxytaxol | 1377 |
| 6-Ketoprostaglandin F1alpha | 2012, 2370 |
| 6-Mercaptopurine | 966, 2110, 2227, 2411, 2480, 2516 |
| 6-Methoxy-2-napthylacetic acid | 1304, 1381 |
| 6-Methoxy-2-napthylacetic acid and nabumetone (6-MNA) | 1304 |
| 6-Methyl-2-(phenylethynyl)pyridine | 1265, 1346 |
| 6-Methylsulfinylhexyl isothiocyanate | 2105, 2116, 2308 |
| 6-(Methylamino)pyrido(3,4-d)pyrimidine | 1233, 2019, 2026, 2028, 2376 |
| 6-Naltrexamine analogs | 1639 |
| 6-O-Monoacetylmorphine | 1242, 1243 |
| 6-(p-Sulfamoylphenyl)androstenediones | 1946 |
| 6-Prenylchrysin | 926, 942, 1024 |
| 6-Thioguanine | 834, 966 |
| 6′,7′-Dihydroxybergamottin | 1667, 1751, 1899 |
| 6,7-Dihydroxyflavone | 2472 |
| 6,7-Dimethoxy-2-{3-[4-[11C]methoxy-3,4-dihydro-2H-naphthalen-(1E)-ylidene]-propyl}-1,2,3,4-tetrahydro-isoquinoline | 834 |
| 6,8-Diallyl 5,7-dihydroxy-(-allyl-hydroxy-methoxyphenyl)1-H benzo(b)pyran-one | 1027 |
| 6,11-Dihydro-5-thia-11-aza-benzo(a)-fluorene | 2177 |
| 7-(2-(4-(4-Nitrobenzene)piperazinyl)ethyl)-1,3-dimethylxanthine | 2457 |
| 7-(3-(3-Hydroxy-4-(4′-iodophenoxy)-1-butenyl)-7-oxabicyclo(2.2.1)heptan-2-yl)-5-heptenoic acid | 2439 |
| 7-(4-Trifluoromethyl)coumarin propargyl ether | 1640 |
| 7-alpha-(4′-Amino)phenylthio-1,4-androstadiene-3,17-dione (7α-APTADD) | 1946 |
| 7-alpha,11-beta-Dimethyl-19-nortestosterone | 1187 |
| 7-alpha-Methyl-17-alpha-ethynylestradiol | 2039, 2045 |
| 7-Alkoxycoumarins | 1639 |
| 7-Alkoxyresorufins | 1639 |
| 7-Amino-4-chloromethylcoumarin | 2120 |
| 7-Benzyloxy-4-trifluoromethylcoumarin (BFC) | 1438, 1639, 1709, 1899 |
| 7-Benzyloxyquinoline (7BQ) | 1639, 1709, 1899 |
| 7-Benzyloxyresorufin | 1639 |
| 7-Coumarin propargyl ether | 1640 |
| 7-Coumarin propargyl ether and 7-(4-trifluoromethyl)coumarin propargyl ether | 1640 |
| 7-(Deoxyadenosin-N6-yl)aristolactam I | 2366 |
| 7-epi-Paclitaxel | 1640 |
| 7-Ethoxy-4-trifluoromethylcoumarin | 1367, 1423, 1612 |
| 7-Ethoxycoumarin | 1640 |
| 7H-Dibenzo(c,g)carbazole | 1294 |
| 7H-Pyrrolo[2,3-d]pyrimidine derivatives | 1640 |
| 7-Hydroximinoandrost-5-ene steroids | 1946 |
| 7-Hydroxy-2-N,N-dipropylaminotetralin | 2002, 2004, 2072 |
| 7-Hydroxy-4-trifluoromethylcoumarin | 1367, 1423, 1612, 2490 |
| 7-Hydroxycoumarin | 1222, 1355 |
| 7-Hydroxydehydroepiandrosterone | 2317 |
| 7-Hydroxyflavanone | 1978 |
| 7-Hydroxyflavone | 1187, 1978 |
| 7-Hydroxymethotrexate | 946, 999, 1024 |
| 7-Hydroxystaurosporine | 1235, 1238, 2376, 2472 |
| 7-Hydroxy-delta(8)-tetrahydrocannabinol | 1640 |
| 7-Ketocholesterol | 1096, 1913, 2337 |
| 7-Methylguanine | 2110, 2116, 2120 |
| 7-Monohydroxyethylrutoside | 2472 |
| 7-(N,N-Dipropylamino)-5,6,7,8-tetrahydronaphtho(2,3-b)dihydro-2,3-furan | 2002, 2004, 2072 |
| 7-Nitroindazole | 2012, 2370 |
| 7-Xylosyl-10-deacetylpaclitaxel | 834 |
| 7,12-Dimethylbenz(a)anthracene (DMBA) | 1304 |
| 7,4′-Dihydroxyflavone (See Liquiritigenin) | 1319 |
| 7,8-Benzoflavone | 1640 |
| 7,8-Benzoquinoline | 1247, 2236, 2308 |
| 7,8-Dihydro-7,8-dihydroxybenzo(a)pyrene 9,10-oxide | 1294, 1346, 2105, 2110, 2116, 2430 |
| 8-((4-Chlorophenyl)thio)cyclic-3′,5′-AMP | 1247, 2392 |
| 8-(N,N-Diethylamino)octyl-3,4,5-trimethoxybenzoate | 2370 |
| 8-Azapurine | 1233, 2472 |
| 8-Azidoadenosine 5′-triphosphate | 926, 942, 971, 979 |
| 8-Bromo cyclic adenosine monophosphate | 1978, 2039, 2177, 2457 |
| 8-Bromocyclic GMP | 2012, 2039 |
| 8-Bromoguanosino-3′,5′-cyclic monophosphorothioate | 2457 |
| 8-Chlorocarbochromen | 2457 |
| 8-Epi-prostaglandin F2alpha | 2439 |
| 8-Geranyloxypsoralen | 1640 |
| 8-Hydroxy-2-(di-n-propylamino)tetralin | 2159, 2193, 2208, 2220, 2457 |
| 8-Hydroxyeicosatetraenoic acid | 2217, 2220, 2340, 2341 |
| 8-Hydroxymirtazapine | 1321 |
| 8-Isoprostaglandin A2 | 2105, 2110, 2116, 2120 |
| 8-Methoxymethyl-3-isobutyl-1-methylxanthine | 2457 |
| 8-Methoxypsoralen | 1351, 1640 |
| 8-Methyl-2,3,10,11-tetraethoxyberbine | 1363, 1539, 1826 |
| 8-Phenyltheophylline | 1333, 1400, 1589, 1612, 1899 |
| 8-Prenylnaringenin | 834, 942, 1333, 1762, 2039, 2045, 2105, 2208 |
| 9-(2,3-Dihydroxypropyl)adenine | 2442 |
| 9-(4′-Aminophenyl)-9H-pyrido(3,4-b)indole | 1294, 1333, 1346, 1355, 1367, 1400, 1423, 1589, 1612, 1899, 2295 |
| 9-Anilinoacridine | 2457 |
| 9-Anthroic acid | 1247 |
| 9-beta-D-Arabinofuranosylguanine-resistant MOLT-4 cells | 834 |
| 9-cis Retinoic acid | 1946 |
| 9-cis-Retinal | 1054, 1103, 1899, 2312 |
| 9-cis-UAB30 | 1329, 1685 |
| 9-Deoxy-delta(9)-prostaglandin D2 | 1242, 2105, 2110, 2344 |
| 9-Fluorenone | 1294 |
| 9-Nitrocamptothecin | 946, 961 |
| 9,10-Dimethyl-1,2-benzanthracene | 1094, 1187, 1241, 1294, 1333, 1346, 2022, 2039, 2086, 2272, 2370 |
| 9,11-Linoleic acid | 823, 2193, 2337, 2340, 2344, 2370, 2457, 2472, 2513 |
| 10-(Fluoroethoxyphosphinyl)-N-(biotinamidopentyl)decanamide | 1040, 1196 |
| 10-Hydroxywarfarin | 1899 |
| 10,11-Dihydro-10-hydroxycarbamazepine | 1423 |
| [11C]Methyl 4-((4-(2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-yl)ethyl)phenyl)aminocarbonyl)-2-(quinoline-2-carbonylamino)benzoate | 847 |
| [11C]XR9576 | 847 |
| 11-Deoxy-16-phenoxy-17,18,19,20-tetranorprostaglandin E1 | 2300, 2361 |
| 11-Deoxyprostaglandin E1 | 2300, 2362 |
| 11-Ketotestosterone | 1187, 2039 |
| 11-(Dansylamino)undecanoic acid | 1121, 2323 |
| 11,11′-Dideoxyverticilin | 2472 |
| 12-(3-Hexylureido)dodec-8(Z)-enoic acid | 1614 |
| 12-Hydroxy-5,8,10,14-eicosatetraenoic acid | 2341 |
| 12-O-Tetradecanoylphorbol-13-acetate | 1640 |
| 12-Tungstophosphoric acid | 2525 |
| 13-cis Retinoic acid | 1370 |
| 13-cis-Retinal | 1899, 2312 |
| 13-Oxo-9,11-octadecadienoic acid | 2105 |
| 14-Deoxy-11,12-didehydroandrographolide | 1305 |
| 14,15-Epoxyeicosa-5(Z)-enoic acid | 1373 |
| 14,15-Epoxyeicosa-5(Z)-enoic acid 2-[2-(3-hydroxy-propoxy)-ethoxy]-ethyl ester | 1373 |
| 14,15-Epoxyeicosa-5(Z)-enoic-methylsulfonylimide | 1373 |
| 15-Deoxyprostaglandin J2 | 1265, 2193, 2344, 2370, 2453, 2457 |
| 15-Deoxy-delta(12,14)-prostaglandin J2 | 942, 964, 1233, 2110, 2116, 2177, 2183, 2208, 2340, 2341, 2344, 2370, 2376, 2430, 2445 |
| 15-Hydroperoxy-5,8,11,13-eicosatetraenoic acid | 2105, 2177, 2490, 2493, 2495 |
| 15-Hydroxy-11alpha,9alpha-(epoxymethano)prosta-5,13-dienoic acid | 2012, 2439, 2370 |
| (15R)-16-m-[11C]Tolyl-17,18,19,20-tetranorisocarbacyclin methyl ester | 946 |
| 16-alpha-Bromo-17beta-estradiol | 2039, 2156 |
| 16-alpha-Iodoestradiol | 2039 |
| 16E-Arylidenosteroids | 1946 |
| 16-Hydroxyestrone | 2347 |
| 16-Ketoestrone | 2045 |
| 16,16-Dimethylprostaglandin E2 | 2300, 2359, 2360, 2361, 2362, 2370 |
| 17-alpha-Estradiol | 1593 |
| 17-alpha-Ethinylestradiol | 999, 1304, 1640, 1913, 1946 |
| 17-alpha-Ethynylestr-5(10)-ene-3alpha,17beta-diol | 929, 1222, 1233, 1235, 1294, 1346, 1978, 2039 |
| 17-alpha-Hydroperoxypregnenolone | 2312 |
| 17-alpha-Hydroxyprogesterone | 1641, 2457 |
| 17-(Allylamino)-17-demethoxygeldanamycin (NSC 330507) | 1187, 1222, 1235, 1640, 2019, 2026, 2064, 2238, 2308, 2480 |
| 17-beta-Estradiol | 999, 1401, 1593, 1641, 1946 |
| 17-beta-Hydroxymethyl-17alpha-methyl-18-norandrosta-1,4,13-trien-3-one | 1641 |
| 17-(Dimethylaminoethylamino)-17-demethoxygeldanamycin | 1370, 1640, 2308, 2472 |
| 17-Amino-17-demethoxygeldanamycin | 1367 |
| 17-Amino-17-demethoxygeldanamycin-C2-galactose | 2308 |
| 17-Desoxyestradiol | 1187 |
| 17-Hydroxy-4,7,10,13,15,19-docosahexaenoic acid | 1110, 2344, 2457 |
| 17-N-Allylamino-17-demethoxygeldanamycin | 835 |
| 17-Phenyltrinorprostaglandin E2 | 2300, 2359 |
| 18F-Fluoroethyl GF120918 and XR9576 | 869 |
| 18-Hydroxycortisol | 1942 |
| 18-Oxocortisol | 1934, 1942 |
| 18-Perfluoroalkyl compounds | 1903 |
| 20-alpha-Dihydroprogesterone | 1098, 1099 |
| 20-Hydroxy-5,8,11,14-eicosatetraenoic acid | 2490, 2495 |
| 20-Hydroxyeicosatetraenoic acid (20-HETE) | 1907 |
| 20-Hydroxyvitamin D3 | 1980 |
| 20-S-Ginsenoside Rh2 | 835 |
| 20,23-Dihydroxy D3 | 1980 |
| 22-Hydroxycholesterol | 823, 996, 1103, 1161, 1244, 1932, 2150, 2245, 2253, 2385 |
| 23-Hydroxybetulinic acid from Pulsatilla chinensis (Bunge) Regel | 835 |
| 25-Hydroxyvitamin D | 1980 |
| 26,26,26,27,27,27-Hexafluoro-1,25-dihydroxyvitamin D3 | 2516 |
| 27-Hydroxycholesterol | 987, 996 |
| [123I]-4-(2-(bis(4-Fluorophenyl)methoxy)ethyl)-1-(4-iodobenzyl)piperidine | 877 |
| 103 D5R | 2519 |
| 1263W94 | 1641, 1787 |
| A | |
| A 127722 | 2012, 2457 |
| A 182086 | 2014 |
| A 192621 | 2012, 2457 |
| A 419259 | 2019 |
| A 771726 | 1013, 1319, 1990, 2242, 2200, 2212, 2242, 2445, 2457, 2472 |
| A-792611 (HIV protease inhibitor) | 1641 |
| AA 861 | 1215, 2205, 2208, 2422, 2457 |
| A2A adenosine receptor | 987 |
| A3 adenosine receptor agonist | 835 |
| Abacavir | 1, 1270, 2126, 2131, 2133, 2157, 2442 |
| Abacavir and Lamivudine | 1, 1270, 2177 |
| Abacavir, Lamivudine, and Zidovudine | 2 |
| Abamectin | 835, 842, 1365 |
| Abarelix | 2 |
| Abatacept | 3 |
| ABC multidrug transporters | 835 |
| ABC transporters | 1641 |
| Abciximab | 3 |
| Abietic acid | 960 |
| Abiraterone | 1642, 1947 |
| ABT-263 | 835 |
| ABT-378 | 1552, 1642 |
| ABT-737 | 835 |
| ABT-773 | 1642 |
| Acacetin | 1742 |
| Açaí juice | 1125 |
| Acamprosate | 4 |
| Acanthopanax chiisanensis | 1791 |
| Acanthopanax senticosus HARMS extract | 836 |
| Acarbose | 4 |
| ACD-and ABD-ring steroidomimetics | 1642 |
| ACE inhibitors | 1028, 1034, 1084, 1197 |
| ACE2 activators | 1035 |
| Acebutolol | 5, 1069, 1074, 2090 |
| Aceclofenac | 5, 1370, 1381 |
| Acenaphthene | 1094, 1096 |
| Acenaphthylene | 1096, 1294 |
| Acenocoumarol | 6, 836, 926, 1125, 1161, 1210, 1381, 1400, 1401, 1423, 1642, 1893, 1907, 2521 |
| Acephate | 1040, 1100, 1132, 1215, 1294, 1612, 2072 |
| Acetaldehyde | 1026, 1104, 1215, 1235, 2072, 2177, 2445 |
| Acetaminophen (Paracetamol) | 6, 812, 929, 942, 947, 961, 964, 971, 979, 985, 996, 1000, 1024, 1026, 1027, 1042, 1043, 1044, 1045, 1049, 1050, 1062, 1082, 1083, 1093, 1094, 1096, 1100, 1103, 1106, 1108, 1110, 1111, 1114, 1116, 1118, 1161, 1190, 1191, 1193, 1194, 1202, 1204, 1207, 1210, 1215, 1218, 1219, 1220, 1222, 1229, 1235, 1238, 1242, 1243, 1249, 1253, 1264, 1265, 1270, 1273, 1304, 1438, 1502, 1529, 1593, 1606, 1612, 1642, 1819, 1899, 1906, 1932, 1986, 1989, 1990, 1993, 1995, 1996, 2010, 2012, 2022, 2028, 2029, 2039, 2050, 2051, 2053, 2054, 2061, 2062, 2064, 2066, 2067, 2072, 2075, 2082, 2083, 2088, 2093, 2097, 2104, 2105, 2107, 2110, 2113, 2116, 2120, 2129, 2147, 2150, 2153, 2161, 2170, 2183, 2193, 2208, 2213, 2217, 2223, 2227, 2230, 2241, 2247, 2250, 2259, 2261, 2266, 2267, 2270, 2272, 2274, 2278, 2295, 2296, 2298, 2300, 2302, 2304, 2308, 2312, 2314, 2318, 2323, 2324, 2327, 2330, 2331, 2332, 2386, 2400, 2401, 2402, 2403, 2405, 2406, 2408, 2410, 2411, 2412, 2418, 2420, 2422, 2430, 2433, 2434, 2435, 2436, 2439, 2440, 2445, 2449, 2451, 2453, 2457, 2465, 2467, 2480, 2483, 2489, 2490, 2493, 2511, 2513, 2519, 2521, 2523, 2526, 2529 |
| Acetanilides | 1133, 1242 |
| Acetazolamide | 8 |
| Acetic acid | 2478 |
| Acetochlor | 926, 942, 1367, 1686, 1899 |
| Acetohydroxamic Acid | 8 |
| Acetone | 1215, 1222, 1400, 1612 |
| Acetonitrile | 1400, 1762, 1790 |
| Acetosulfam | 2478 |
| Acetovanillone | 2180, 2193, 2247, 2300, 2457 |
| Acetoxyacetylaminofluorene | 2472 |
| Acetyl coenzyme A | 1165, 1182, 2193 |
| Acetyl-11-ketoboswellic acid | 2468 |
| Acetyl-aspartyl-glutamyl-valyl-aspartal | 2420 |
| Acetylcholine | 9, 985, 1037, 1040, 1165, 1182, 1195, 1196, 1250, 1253, 1255, 2082, 2092, 2193, 2198 |
| Acetylcholinesterase | 1165 |
| Acetylcholinesterase inhibitors | 1037, 1439 |
| Acetylcholinesterase oxime-type reactivators | 1304, 1643 |
| Acetylcholinesterase reactivators | 947, 1037 |
| Acetylcysteine | 9, 942, 964, 996, 1088, 1096, 1106, 1215, 2012, 2019, 2072, 2177, 2183, 2193, 2208, 2237, 2272, 2276, 2278, 2300, 2303, 2308, 2317, 2370, 2420, 2422, 2430, 2445, 2448, 2457, 2472, 2519 |
| Acetylenic epoxygenase inhibitors | 1280, 1381 |
| Acetylglucosamine | 2183, 2203 |
| Acetylhydrazine | 2242, 2257, 2335, 2387 |
| Acetylleucyl-leucyl-norleucinal | 1096, 1223, 2392 |
| Acetylmuramyl-alanyl-isoglutamine | 2208, 2183, 2220, 2370, 2453, 2457 |
| Acetylsalicylic Acid (See Aspirin) | 53, 1103, 1215, 1222, 1242, 1243, 1265, 1439, 1448, 1643, 1662, 1951, 2101, 2121, 2138, 2177, 2183, 2193, 2198, 2200, 2208, 2220, 2226, 2256, 2257, 2282, 2309, 2324, 2325, 2340, 2341, 2365, 2366, 2369, 2371, 2385, 2386, 2405, 2408, 2410, 2411, 2420, 2430, 2440, 2457, 2493 |
| Acetylthiocholine | 1040 |
| Acid red | 925, 1355 |
| Acid sphingomyelinase | 1125 |
| Acifluorfenmethyl | 1096, 1187 |
| Acitretin | 10, 1125, 1222, 2430 |
| Acivicin | 1247 |
| Aclarubicin | 2116 |
| Aclidinium bromide | 1439, 1643 |
| Aconitine | 1304, 1439, 1643 |
| Acorus calamus | 1489 |
| Acridine orange | 1182, 2116, 2472 |
| Acridines | 2308 |
| Acridone derivative MBLI-87 | 1000 |
| Acrolein | 942, 1116, 1125, 1161, 1165, 1182, 1252, 1265, 2019, 2105, 2116, 2177, 2183, 2200, 2208, 2217, 2220, 2266, 2272, 2276, 2308, 2331, 2365, 2370, 2420, 2430, 2451, 2457, 2472, 2478 |
| Acrylamide | 1222, 1233, 1235, 1249, 1261, 1593, 1612, 1932, 1992, 2004, 2019, 2026, 2110, 2116, 2120, 2188, 2193, 2229, 2236, 2276, 2361, 2393, 2472, 2478 |
| Acrylamide and acrylamide metabolites | 1593 |
| Acrylic acid | 2203 |
| Acrylodan | 1116, 2116 |
| Acrylonitrile | 1594, 2072, 2308 |
| Acrylonitrile derivatives (YHO-13177 and YHO-13351) | 1000 |
| Actaea racemosa (See Black cohosh) | 1287, 1317, 1415, 1450, 1490, 1491, 1670, 1759, 1913, 2376 |
| Actein (Black cohosh) | 1222, 1235, 1913, |
| Acteoside | 1612 |
| Actin | 947 |
| Activating signal cointegrator-2 (ASC-2) | 988 |
| Activins | 1947 |
| Acyclovir | 10 |
| Acylcarnitine | 1243 |
| Acylcarnitines (lauroylcarnitine, palmitoylcarnitine) | 836 |
| Acyl-coenzyme A:cholesterol acyltransferase | 1913 |
| Acyline | 1947, 2062, 2110, 2183 |
| Acylphloroglucinols | 1762 |
| Adalimumab | 11, 2057, 2455 |
| Adefovir | 11, 1644, 2408, 2411 |
| Adefovir dipivoxil | 967 |
| Adenosine | 12, 1048, 1061, 1062, 1247, 1993, 2217, 2220, 2393, 2457 |
| Adenosine 5′-O-(3-thiotriphosphate) | 2193, 2217, 2220 |
| Adenosine A2A receptor agonists and antagonists | 1061, 1440 |
| Adenosine diphosphate | 1247, 2324 |
| Adenosine monophosphate-activated protein kinase | 988 |
| Adenosine triphosphate | 942, 961, 971, 1247, 2072, 2177, 2324, 2333, 2393, 2483 |
| Adenylate cyclase toxin | 2208, 2217, 2220, 2457 |
| Adenylyl imidodiphosphate | 1247 |
| Adinazolam | 1440 |
| Adlay | 1280 |
| Adrenal cortex hormones | 2220 |
| Adrenaline (See Epinephrine) | 266, 1071, 1081, 1082, 1171, 1259, 2259 |
| Adrenocorticotropic hormone | 2317 |
| Adrenocorticotropin zinc | 1942, 2423 |
| Adriamycin | 836 |
| Advanced glycosylation end products | 2445 |
| Adzuki resistant starch | 1913 |
| AEE788 | 1947, 2019 |
| AFDX 384 | 1251 |
| Aflatoxin B1 | 1101, 1103, 1222, 1235, 1243, 1280, 1304, 1351, 1355, 1644, 1799, 1899, 1947, 1995, 2022, 2104, 2105, 2116, 2121, 2212, 2213, 2272, 2308, 2376, 2438, 2472, 2480, 2519, 2525 |
| Aflatoxin B1-2,3-oxide | 2105, 2110, 2116 |
| Aflatoxin G1 | 1799 |
| Aflatoxins | 2022, 2110, 2472, 2528 |
| Afloqualone | 2493, 2495 |
| African potato (Hypoxis hemerocallidea) | 1645 |
| AG 1879 | 1034, 1265, 2019, 2039, 2072, 2276, 2324, 2480, 2516, 2519 |
| AG494 | 1373 |
| AG1478 (tyrphostin 4-(3-chloroanilino)-6,7-dimethoxyquinazoline) | 932, 1022 |
| AG-045572 (GnRH receptor antagonist) | 1645 |
| Agalsidase Alpha | 13 |
| Agalsidase Beta | 13 |
| AGE inhibitors (alagebrium chloride and pyridoxamine dihydrochloride) | 1125 |
| Aggrecans | 1215 |
| Agkistrodon venoms | 929, 2400 |
| AGN 193109 | 823, 1088, 1161, 2370 |
| AGN 194204 | 1231, 1235, 1238, 2019, 2200, 2203, 2224, 2256, 2270, 2323, 2346, 2352, 2438 |
| Agomelatine | 13, 1305 |
| Agrochemicals | 1305, 1646, 1947 |
| AH 26 | 2370 |
| AICA ribonucleotide | 1027, 1247, 2188 |
| Ajmalicine | 1589, 1684 |
| Ala2-deltorphin II | 2212, 2213 |
| Alachlor | 926, 1040, 1187, 1192, 1294, 1367, 1612, 1646, 1686, 1899, 2039, 2125, 2180, 2276, 2312, 2457 |
| Albendazole | 14, 840, 926, 961, 1024, 1294, 1647, 1666, 2266, 2423 |
| Albendazole sulfoxide | 926, 1024 |
| Albumin | 14, 1647 |
| Albuterol (Salbutamol) | 15, 1040, 1050, 1074, 1079, 2211, 2317 |
| Alclometasone | 16 |
| Alcohol (Ethyl) (See Ethanol) | 16, 933, 964, 1043, 1049, 1053, 1055, 1064, 1101, 1103, 1104, 1108, 1119, 1120, 1216, 1222, 1242, 1248, 1249, 1252, 1259, 1261, 1280, 1351, 1401, 1441, 1467, 1594, 1612, 1614, 1647, 1734, 1762, 1790, 1906, 1913, 1932, 1948, 2013, 2019, 2054, 2066, 2072, 2079, 2083, 2086, 2094, 2096, 2111, 2117, 2121, 2125, 2168, 2177, 2188, 2200, 2204, 2220, 2245, 2247, 2249, 2251, 2270, 2276, 2317, 2319, 2323, 2336, 2345, 2346, 2385, 2420, 2446, 2450, 2519 |
| Alcohols | 1101, 1104, 1351, 1441, 2457 |
| Aldesleukin | 16 |
| Aldicarb | 1040, 1253, 2039, 2180 |
| Aldoketoreductases | 933 |
| Aldophosphamide | 1108 |
| Aldosterone | 837, 926, 1029, 1034, 1084, 1088, 1187, 1934, 1942, 2045, 2317, 2346, 2445 |
| Aldosterone synthase (CYP11B2) inhibitors | 1935 |
| Aldosterone synthase inhibitors (heteroaryl substituted 1,2,5,6-tetrahydropyrrolo[3,2,1-ij]quinolin-4-one derivatives) | 1305 |
| Aldrin | 1187, 1899, 1978, 2039, 2045, 2312 2330 |
| Alefacept | 17 |
| Alemtuzumab | 17 |
| Alendronate | 18, 2276, 2388, 2399, 2405, 2445, 2516 |
| Alexidine | 2266 |
| Alfalfa | 1596 |
| Alfentanil | 19, 1647, 1899, 2322 |
| Alfuzosin | 19 |
| Alglucerase | 20 |
| Alglucosidase Alpha | 20 |
| Aliphatic isothiocyanates (Erucin and Sulforaphane) | 1648 |
| Aliskiren | 21, 837, 1280, 1648 |
| Alismatis rhizome | 1913 |
| Alitretinoin | 823, 979, 996, 1161, 1228, 1244, 1261, 1265, 1899, 1932, 1978, 1986, 2019, 2039, 2078, 2086, 2110, 2116, 2150, 2177, 2183, 2188, 2193, 2200, 2203, 2208, 2217, 2220, 2224, 2245, 2270, 2312, 2314, 2344, 2346, 2366, 2376, 2385, 2393, 2442, 2445, 2457, 2489, 2513, 2516, 2519, 2523 |
| Alizarin | 1294, 1346, 1355, 1423, 1612, 1838, 1899, 2490 |
| Alkalis | 2183, 2200, 2203, 2208, 2217, 2220 |
| Alkaloids from Rubus alceaefolius poiron | 1596 |
| Alkamides (Piper nigrum) | 1489 |
| Alkoxyethers (Methyl t-butyl ether, Ethyl t-butyl ether, t-Amyl methyl ether) | 1648 |
| Alkylating agents | 947, 961, 2116, 2272 |
| Alkylbenzene sulfonate | 837 |
| Alkylphenols | 837 |
| Allethrin | 2039 |
| Allicin | 1648, 2478 |
| Alliin | 2472 |
| Allium sativum L. (See Garlic) | 1921 |
| Allocryptopine | 1288, 1326 |
| Allopurinol | 21, 1215, 2133, 2180, 2410, 2411, 2457, 2525 |
| Allose | 1222, 2472 |
| Alloxan | 1612, 2220 |
| all-trans Retinoic acid | 1126, 1370, 1402, 1648 |
| Allura red | 925, 1355 |
| Allyl alcohol | 967, 1294, 1612, 2110, 2208, 2370, 2445, 2448, 2457 |
| Allyl isothiocyanate | 1197, 2110, 2116 |
| Allyl methyl sulfide | 1612 |
| Allyl sulfide | 964, 1346, 1612, 2072, 2110, 2314 |
| Allylamine | 1093, 1261, 2125, 2223, 2227, 2403, 2423 |
| Allylestrenol | 1187 |
| Allylpyrocatechol | 2366, 2370, 2457, 2519 |
| Almotriptan | 22, 1441, 1649 |
| Alniditan | 2161 |
| Aloe barbadensis Mill. | 1948 |
| Aloe vera juice | 1441, 1649 |
| Alogliptin | 859, 1126 |
| Alosetron | 22, 1639, 1649, 2398 |
| ALOX5-pathway modifiers | 1109 |
| alpha helical Corticotropin-releasing hormone | 2072 |
| alpha1–Proteinase Inhibitor | 23 |
| alpha-2C-Adrenoceptor agonists | 926 |
| alpha-Amanitin | 1612 |
| alpha-and beta-Naphthoflavones | 1404, 1592 |
| alpha-and beta-Thujone | 1650 |
| alpha-Carotene | 2272 |
| alpha-Cyano-(3,4-dihydroxy)-N-benzylcinnamide | 1034, 1088, 2177, 2179, 2180, 2183, 2193, 2208, 2430, 2457 |
| alpha-Cypermethrin | 1365 |
| alpha-Dihydroergocryptine | 1649 |
| alpha-Galactosylceramide | 2183, 2203 |
| alpha-Hederin | 1294, 1612 |
| alpha-Hexachlorocyclohexane | 964, 1101, 1103, 1182, 1187, 1215, 1243, 1294, 1612, 2022, 2039, 2045, 2107, 2116, 2238, 2253, 2308, 2376 |
| alpha-Hydroxyalprazolam | 1899 |
| alpha-Linolenic acid | 929, 1126, 1400, 1423, 1612, 1899, 2183, 2193, 2200, 2203, 2208, 2217, 2340, 2344, 2370 |
| alpha-Lipoic acid | 815 |
| alpha-Naphthoflavone | 1096, 1294, 1649, 1899, 1978, 2039, 2045, 2086, 2116, 2308, 2423 |
| alpha-Naphthyl isocyanate | 1161 |
| alpha-Naphthylthiourea | 2019, 2445 |
| alpha-Pentyl-3-(2-quinolinylmethoxy)benzenemethanol | 2193, 2370 |
| alpha-Secretase analogs | 1180 |
| alpha-Terpinene | 960 |
| alpha-Thujone | 1650 |
| alpha-Tocopherol | 1096, 1215, 1261, 1294, 1596, 2312, 2430, 2445, 2457, 2472 |
| alpha-Tocotrienol | 926, 1899, 2110, 2312, 2489 |
| alpha-Viniferin | 943 |
| Alpinia galanga rhizome | 1492 |
| Alprazolam | 23, 1306,1441, 1482, 1510, 1532, 1557, 1650, 1899 |
| Alprostadil | 24, 971 |
| Alsterpaullone | 2101, 2472 |
| Alteplase | 24 |
| Altretamine | 25 |
| Aluminum | 1040, 1119, 1165, 1182, 1215, 1249, 2078, 2193, 2203, 2208, 2266, 2276, 2370, 2457, 2525 |
| Aluminum chloride | 961, 1212, 2104, 2188, 2200 |
| Aluminum fluoride | 2190 |
| Aluminum Hydroxide | 25, 961, 1215, 2200 |
| Aluminum lactate | 1215 |
| Aluminum maltolate | 2259, 2261, 2457 |
| Aluminum oxide | 2193, 2217, 2457 |
| Aluminum silicates | 2019 |
| Aluminum sulfate | 1182, 2266, 2370 |
| Alvimopan | 26 |
| AM 80 | 1088, 2097, 2208, 2224, 2519 |
| AM 251 | 1259, 2430, 2457 |
| AM 580 | 1049, 2224, 2442 |
| Amantadine | 26, 1487 |
| Amaranth | 925, 1187, 1355 |
| Amaryllidaceae alkaloids | 1650 |
| Ambenonium | 27 |
| Ambenonium chloride | 1167, 1182 |
| Ambrisentan | 27, 838, 864, 1650, 2012, 2014, 2193, 2208, 2300, 2457 |
| Ambroxol | 1650 |
| AMD070 | 1442, 1650 |
| Amide-based inhibitors of p38alpha MAP kinase | 1650 |
| Amides | 2312 |
| Amifampridine | 28 |
| Amifostine | 28 |
| Amikacin | 29 |
| Amiloride | 29, 1247, 2026, 2445 |
| Aminacrine | 2472 |
| Amines | 1346, 2105, 2295, 2432 |
| Aminocaproic Acid | 30 |
| Aminoflavone | 1305, 2432 |
| Aminoglutethimide | 30, 1978 |
| Aminoheterocycles | 1651 |
| Aminolevulinic Acid | 31, 1100, 2278 |
| Aminomethylpyrimidine DPP-IV inhibitor | 1651 |
| Aminophenylnorharman (APNH)(9-(4′-aminophenyl)-9H-pyrido[3,4-b]indole) | 1651 |
| Aminophylline | 31 |
| Aminopyrazine CB1 receptor inverse agonists | 1651 |
| Aminopyrine | 1651 |
| Aminosalicylic Acid | 32 |
| Amiodarone | 32, 947, 1026, 1042, 1065, 1075, 1215, 1218, 1270, 1305, 1371, 1377, 1442, 1510, 1582, 1622, 1651, 1899, 2053, 2066, 2072, 2086, 2177, 2231, 2314, 2357, 2382, 2393, 2418, 2434, 2445, 2493 |
| Amitriptyline | 33, 838, 947, 1407, 1442, 1443, 1502, 1557, 1566, 1569, 1589, 1651, 2053, 2092, 2116 |
| Amitrole | 1088, 1215, 1355, 1612, 2072, 2180, 2457 |
| Amlodipine | 34, 838, 1050, 1084, 1294, 1368, 1652 |
| Ammonium Chloride | 35, 2072, 2423 |
| Ammonium metavanadate | 2208 |
| Amobarbital | 35 |
| Amodiaquine | 36, 1371, 1377, 1443, 2472 |
| Amonafide | 36, 2294 |
| Amosite asbestos | 1261, 2078, 2445, 2457, 2472 |
| Amoxapine | 37, 2092 |
| Amoxicillin | 37, 838 |
| Amoxicillin-Clavulanic acid (Co-amoxiclav) | 1579 |
| Amphetamine | 38, 1007, 1065, 1067, 1368, 1443, 1589, 1899, 1948, 2072, 2394, 2396 |
| Amphotericin B | 39, 1168, 1182, 1899 |
| Ampicillin | 39, 1913, 2370 |
| Amprenavir | 40, 838, 1652, 1899, 2300 |
| Amrubicinol | 838 |
| Amsacrine | 2232, 2472 |
| Amurensin G | 838 |
| Amyl Nitrite | 41 |
| Amyloid A3 | 1948 |
| Amyloid-beta peptides | 838 |
| Amylomyces rouxii strain CBS 438.76 | 1913 |
| AN 204 | 926, 943, 1024 |
| AN 215 | 943 |
| AN 238 | 943, 2427, 2428 |
| AN-7 phosphate CPD | 2472 |
| Anabasine | 2208 |
| Anabolic agents | 2159, 2161 |
| Anabolic steroids (Nandrolone decanoate) | 1652, 1935 |
| Anacetrapib | 988, 1652 |
| Anagrelide | 41 |
| Anakinra | 41 |
| Analgesics | 1443, 1582, 1652 |
| Anandamide (See Arachidonoyl ethanolamide) | 1258, 1259, 1359, 1444, 1652, 1660, 1907, 2072, 2188, 2193, 2220, 2247, 2457, 2478 |
| Anapsos (Polypodium leucotomos L) | 42, 1129 |
| Anastrozole | 42, 1371, 1652, 1948, 1960, 1973, 1978 |
| Ancitabine | 2288, 2451 |
| Androgens | 1184, 1187, 1218, 1612, 1978, 2193, 2208, 2276, 2457, 2472 |
| Andrographis paniculata and Orthosiphon | 2486, 2491 |
| Andrographis paniculata extract (Andrographolide) | 1094, 1096, 1280, 1294, 1305, 1346, 1381, 1407, 1489, 1653, 2072 |
| Andrographolide (See Andrographis paniculata extract) | 1094, 1096, 1280, 1294, 1305, 1346, 1381, 1407, 1489, 1653, 2072 |
| Androstan-3-ol | 1187, 2312, 2314 |
| Androstane-3,17-diol | 1098, 1099, 2039, 2045 |
| Androstan-17-ol | 1187 |
| Androstanes | 1949 |
| Androstanols | 1222, 2312, 2314 |
| Androstenediol | 1187, 2156 |
| Androstenedione | 1187, 1942, 1949, 1978, 2039, 2156, 2314, 2457 |
| Androstenedione derivatives | 1949 |
| Androstenols | 2314 |
| Androsterone | 1187, 2494 |
| Anemonia sulcata (Toxin II) | 2386, 2387 |
| Anesthetics | 1305, 1653 |
| Angelica lactone | 2105, 2110, 2116, 2308 |
| Angelica sinensis | 1490 |
| Angelicae dahuricae radix | 1490, 1653 |
| Angelicae tenuissima radix | 1490, 1653 |
| Angelicae tenuissima radix, Angelicae dahuricae radix and Scutellariae radix extracts | 1305, 1490, 1653 |
| Angelicin | 1096, 1294 |
| Angiopep-2 | 839 |
| Angiotensin II | 1129, 2377 |
| Angiotensin II antagonists | 1085 |
| Angiotensin receptor blockers | 1030 |
| Angiotensin receptor type 1 blockers (telmisartan, candesartan, candesartan-cilexetil, irbesartan, losartan, olmesartan, olmesartan-medoxomil, eprosartan) | 839, 1001 |
| Angiotensin-(1-7) | 1129 |
| Angiotensin-converting enzyme inhibitors | 1261, 2445 |
| Angiotensin-II receptor antagonists | 1444, 1653 |
| An-Gong-Niu-Huang Wan | 1280, 1337 |
| Anidulafungin | 43, 863 |
| Aniline | 1346, 1355, 1368, 1400, 1423, 1589, 1612, 1899, 1978, 2072, 2208, 2295, 2445, 2457 |
| Aniline compounds | 2039, 2295 |
| Anilofos | 1187 |
| Anions | 2236, 2408, 2409, 2410, 2411 |
| Aniracetam | 1242, 1243 |
| Anisomycin (ANI) | 1094, 1096, 1265, 1294, 2072, 2379 |
| Annexin A1 | 839 |
| Annexin A5 | 1129 |
| Anpirtoline | 2161 |
| Antalarmin | 1266 |
| Anthocyanins | 1130, 1653, 2328 |
| Anthocyanins and anthocyanidins (malvidin, malvidin-3-galactoside, malvidin-3,5-diglucoside, cyanidin-3-galactoside, peonidin-3-glucoside, cyanidin-3-glucoside, cyanidin, peonidin, pelargonidin, delphinidin, petunidin, delphinidin-3-glucoside, cyanidin-3-rutinoside, malvidin-3-glucoside, pelargonidin-3,5-diglucoside) | 839, 1001 |
| Anthra(1,9-cd)pyrazol-6(2H)-one (SP600125) | 1096, 1116, 1168, 1182, 1222, 1231, 1265, 1294, 1899, 2082, 2177, 2183, 2193, 2203, 2208, 2220, 2256, 2276, 2278, 2303, 2337, 2341, 2370, 2376, 2423, 2445, 2457, 2472, 2516 |
| Anthracene | 1094, 1096, 2366, 2371 |
| Anthracyclines | 839, 1214, 1294, 2024 |
| Anthralin | 1215, 2445, 2457, 2493 |
| Anthranilamide modulators | 1653 |
| Anthranilic acid | 2183, 2203, 2220 |
| Anthraquinone and Naphthoquinone derivatives | 839 |
| Anthrax toxin | 2317 |
| Anthriscus sylvestris | 1384 |
| Anti-apolipoprotein A-1 | 1130 |
| Antiarrhythmics | 1653, 2229 |
| Antibiotics | 1653 |
| Antibody-based therapy | 2055 |
| Antibody-maytansinoid conjugates | 839 |
| Anticancer drugs | 1001, 1444, 1446, 1653 |
| Antidepressants | 840, 1065, 1263, 1444, 1446, 1654, 2096, 2158, 2166, 2168, 2170, 2260, 2396, 2398 |
| Antidiabetic agents | 2233 |
| Antiepileptic drugs | 839, 840, 926, 947, 961, 1001, 1024, 1446, 1487, 1525, 1654, 1950 |
| Antifolates | 1745 |
| Antifouling biocides (copper pyrithione (CuPT), Sea-Nine 211, dichlofluanid, tolylfluanid) | 840 |
| Antifungal agents | 1407, 1446, 1525, 1560, 1567, 1582, 1655 |
| Antihelmintics (ivermectin, triclabendazole, triclabendazole sulfoxide, closantel, rafoxanide, triclabendazole sulfone, albendazole, mebendazole, oxfendazole, thiabendazole, nitroxynil, levamisole, praziquantel and clorsulon) | 840 |
| Antihemophilic Factor | 44 |
| Antihemophilic Factor/von Willebrand Factor Complex (Human) | 43 |
| Antihistaminics | 1655 |
| Anti-HIV drugs (antiretroviral therapy) | 1656 |
| Antihypertensive drugs | 1935, 2012, 2299, 2402 |
| Anti-infectives | 1381 |
| Anti-Inhibitor Coagulant Complex | 43 |
| Antileukinate | 2212, 2213 |
| Antilymphocyte globulin | 2057 |
| Antimalarial agents | 1177, 1657 |
| Antimicrobial agents | 1657 |
| Antimony | 812, 943, 1043, 2050, 2220, 2480 |
| Antimony oxide | 2308 |
| Antimony potassium tartrate | 812, 961, 1043, 2050, 2480 |
| Anti-MUC1 Antibody AS1402 | 1949, 1951 |
| Antimuscarinic agents | 840 |
| Antimycin | 1088, 2423 |
| Antimycin A | 2082, 2483 |
| Antineoplastic agents | 948, 967, 1001, 1101, 1658, 2030, 2105, 2169 |
| Antineoplastic antibiotics | 2019 |
| Antioxidants | 1215, 2208, 2423, 2457, 2525 |
| Antiparasitic drugs | 1446 |
| Antiparkinsonian drugs | 1487, 1529 |
| Antiprogestins (Lilopristone, Mifepristone, Onapristone) | 1657 |
| Antipsychotic drugs | 840, 1030, 1258, 1305, 1446, 1657, 1997, 1999, 2002, 2005, 2154, 2162, 2253 |
| Antipyrine | 1658, 2366 |
| Antiretrovirals | 841, 933, 948, 1224, 1359, 1658 |
| Antithrombin III | 44 |
| Antithymocyte Globulin | 45 |
| Antivirals | 967 |
| Antofloxacin | 1305, 1447 |
| Antrodia camphorata (Niuchangchih) | 1596 |
| Anxiolytics | 1447, 1658 |
| Apatinib (YN968D1) | 841, 1002 |
| Apaziquone | 2308 |
| Aphidicolin glycinate | 2451 |
| Apicidin | 926, 943 |
| Apigenin | 933, 943, 1096, 1231, 1247, 1286, 1294, 1305, 1978, 2039, 2045, 2072, 2156, 2177, 2183, 2193, 2203, 2432, 2457, 2472, 2489, 2490, 2519 |
| Apixaban | 841, 895, 1305, 1615, 1659, 1812, 2433 |
| Aplaviroc | 1225, 1582, 1659 |
| Aplidine | 1659 |
| Apocarotenal | 1053, 1261, 1400, 2032, 2107 |
| Apometzgerin | 855 |
| Apomorphine | 45, 1999, 2003 |
| Apple polyphenols | 943, 961, 1257, 1659, 1914, 2022, 2116 |
| Apraclonidine | 46 |
| Aprepitant | 46, 1447, 1582, 1659 |
| Aprotinin | 47, 2049 |
| AQ4N | 1368, 1660 |
| Aquaporin-4 | 1592 |
| AR-67 (7-tert-Butyldimethylsilyl-10-hydroxycamptothecin)(DB-67) | 1305 |
| Arachidin-1 | 2371 |
| Arachidonic acid | 823, 929, 996, 1088, 1116, 1215, 1294, 1306, 1346, 1371, 1377, 1400, 1423, 1612, 1899, 1910, 2019, 2072, 2147, 2203, 2220, 2266, 2276, 2337, 2340, 2366, 2371, 2423, 2445, 2457, 2487, 2490, 2493, 2495 |
| Arachidonic acid metabolites | 1660 |
| Arachidonoyl ethanolamide (Anandamide) | 1258, 1259, 1359, 1444, 1652, 1660, 1907, 2072, 2188, 2193, 2220, 2247, 2457, 2478 |
| Arachidonyl dopamine | 1259, 2478 |
| Arachidonyl-2-chloroethylamide | 1259 |
| Arachidonyltrifluoromethane | 1088 |
| Arachidoyl-coenzyme A | 2105 |
| Arbutin | 1047, 1082, 2386 |
| AR-C124910XX | 1660 |
| AR-C133913XX | 1660 |
| Arecoline | 2276, 2371 |
| Arformoterol | 47, 1075 |
| Argatroban | 48, 1660 |
| Argemone oil | 2116 |
| Arginase | 1132 |
| Arginine | 48 |
| Arginine vasopressin | 1247 |
| Arginyl-glycyl-aspartic acid | 2227, 2472 |
| Aripiprazole | 49, 841, 1063, 1448, 1523, 1550, 1660, 1999, 2002, 2003, 2159, 2162, 2164 |
| Aristolochic acid | 1280, 1306 |
| Arjunolic acid | 1215, 2457 |
| Armodafinil | 49, 1660 |
| Aroclor 1221 | 2039 |
| Aroclor 1242 | 2039, 2396 |
| Aroclor 1245 | 1448 |
| Aroclor 1248 | 2039, 2397 |
| Aroclor 1254 | 1306, 1661 |
| Aroclors | 1187 |
| Aromasin | 1973 |
| Aromatase inhibitors | 1950, 1975, 1978 |
| Aromatase inhibitors and antiepileptic drugs | 1950 |
| Aromatic polycyclic hydrocarbons | 1096, 2022, 2116, 2337 |
| Aromatic polyketides | 1951 |
| Aroylguanidine-based factor Xa inhibitors (BMS-344577) | 1661 |
| Arsenates | 1241, 2308 |
| Arsenic | 816, 926, 933, 943, 1002, 1110, 1132, 1222, 1241, 1247, 1249, 1294, 1596, 1612, 2028, 2029, 2030, 2032, 2039, 2110, 2112, 2121, 2145, 2177, 2193, 2198, 2208, 2211, 2232, 2288, 2300, 2308, 2317, 2340, 2371, 2423, 2445, 2457, 2465, 2472, 2528, 2529 |
| Arsenic acid | 943, 1191, 2112 |
| Arsenic disulfide | 1026, 1197, 2380 |
| Arsenic trichloride | 2376 |
| Arsenic Trioxide | 50, 841, 926, 933, 1024, 1026, 1050, 1191, 1197, 1215, 1222, 1241, 1294, 2019, 2022, 2039, 2045, 2072, 2105, 2116, 2135, 2137, 2177, 2183, 2203, 2208, 2213, 2224, 2232, 2257, 2259, 2261, 2276, 2280, 2283, 2317, 2344, 2363, 2403, 2404, 2442, 2457, 2465, 2467, 2472, 2480, 2483, 2519, 2526 |
| Arsenite | 943, 948, 961, 1097, 1108, 1215, 1294, 1346, 1661, 2012, 2039, 2069, 2112, 2116, 2121, 2188, 2200, 2308, 2317, 2344, 2371, 2445, 2457, 2472, 2516, 2519 |
| Arsenous acid | 1191 |
| Artelinic acid | 1661 |
| Artemether | 1359 |
| Artemether and Lumefantrine | 50, 1661 |
| Artemisinin | 1448, 1661 |
| Artemisinine | 926, 964, 1368, 1899, 2105, 2116, 2312, 2314 |
| Artesunate | 926, 943, 1024, 1355 |
| Artesunic acid | 841 |
| Ar-turmerone | 2344 |
| Arvanil | 1259, 2478 |
| Arylamines | 1662, 2294 |
| Arylpiperazine derivatives | 1448, 1662 |
| AS1402 | 1951 |
| AS602868 | 2457 |
| Asbestos | 1052, 1241, 2022, 2072, 2110, 2116, 2121, 2241, 2295, 2446, 2457, 2465, 2472, 2528 |
| Ascorbic Acid (Vitamin C) | 51, 1036, 1040, 1119, 1215, 1247, 1265, 1294, 1355, 1612, 1662, 1891, 1978, 2012, 2066, 2072, 2105, 2110, 2114, 2119, 2152, 2183, 2203, 2272, 2300, 2308, 2317, 2320, 2337, 2410, 2412, 2420, 2423, 2446, 2472, 2513, 2528 |
| Ascorbyl palmitate | 1820 |
| Asenapine | 52 |
| Asian dust storm particles | 1306 |
| Asian plantain (Plantago asiatica) essential oils | 1914 |
| Asiatic acid | 1383 |
| Asiaticoside | 1306, 1383, 1408, 1490, 1662 |
| Asparaginase | 52 |
| Asparagus racemosus | 1596 |
| Aspartame | 1040, 1064, 1294, 1612, 1998, 2002, 2048, 2086, 2159, 2247, 2306, 2404, 2408, 2478 |
| Aspirin (Acetylsalicylic Acid) | 53, 1103, 1215, 1222, 1242, 1243, 1265, 1439, 1448, 1643, 1662, 1951, 2101, 2121, 2138, 2177, 2183, 2193, 2198, 2200, 2208, 2220, 2226, 2256, 2257, 2282, 2310, 2324, 2325, 2340, 2341, 2365, 2366, 2369, 2371, 2385, 2386, 2405, 2408, 2410, 2411, 2420, 2430, 2440, 2457, 2493 |
| Astaxanthin | 1168, 1182, 1215, 1281, 1662, 2249, 2283 |
| Astemizole | 54, 1615, 1662, 2154 |
| Astressin | 1266, 1267 |
| Atazanavir | 55, 842, 1662 |
| Atenolol | 55, 1030, 1035, 1069, 1073, 1075, 1085, 1400, 2012, 2023, 2090, 2092, 2245 |
| ATI-111 | 995 |
| Atlantic killifish (Fundulus heteroclitus) | 955, 1337 |
| Atomoxetine | 56, 1448, 1532, 1533, 1589 |
| Atorvastatin | 57, 842, 926, 929, 933, 961, 964, 1116, 1132, 1269, 1270, 1368, 1382, 1449, 1663, 1899, 1914, 1935, 2012, 2036, 2060, 2146, 2147, 2208, 2217, 2245, 2292, 2300, 2312, 2314, 2337, 2401, 2415, 2417, 2453, 2457, 2465, 2486, 2491 |
| Atovaquone | 58, 1664 |
| Atractylenolide I | 1951 |
| Atractylenolide II | 1951 |
| Atractylenolide III | 1951 |
| Atractylodes macrocephala Koidz (Atractylenolide I, Atractylenolide II, Atractylenolide III) | 1951 |
| Atracurium | 58 |
| Atrasentan | 1664, 2014, 2415 |
| Atrazine | 1040, 1067, 1116, 1187, 1294, 1612, 1951, 1978, 1992, 2002, 2039, 2061, 2072, 2106, 2116, 2125, 2180, 2183, 2259, 2280, 2282, 2340, 2341, 2344, 2427, 2457 |
| Atromentic acid | 1838 |
| Atropa belladona L. (See Belladonna) | 69 |
| Atropine | 59, 1040, 1069, 1242, 1251, 1252, 1253, 1256, 2072, 2371, 2446, 2472 |
| Attapulgite | 59 |
| Atypical antipsychotics | 1117, 1523, 1524, 1550, 1664 |
| Auranofin | 60, 2130, 2136, 2371, 2453 |
| Aurin | 1187 |
| Aurones | 842, 1002 |
| Aurothioglucose | 1191 |
| Auxin transport inhibitors (1-Naphthoxyacetic acids; 1-Naphthylphthalamic acid; 2,3,5-Triiodobenzoic acid) | 900 |
| Avarol | 2371, 2457 |
| Avasimibe | 943, 1294, 1368, 1400, 1423, 1664, 1899 |
| Avermectins (Abamectin and Doramectin) | 842 |
| Averrhoa carambola (See Star fruit juice) | 1864 |
| Avinin | 1791 |
| AWD 12-281 | 2203, 2208 |
| Axitinib (AG-013736) | 842, 1002, 1306, 1664 |
| Ayanin | 1008 |
| Ayurveda Prakriti type | 1408 |
| AZ876 (liver X receptor agonist) | 1133 |
| Azacitidine | 60, 1100, 1108, 1201, 1231, 1233, 1235, 1241, 1359, 1665, 1995, 2183, 2200, 2211, 2266, 2393, 2413, 2430, 2435, 2442, 2446, 2467 |
| Azafluorenone from Polyalthia cerasoides (6,8-Dihydroxy-7-methoxy-1-methylazafluorenone) | 934 |
| Azaguanine | 2266 |
| Azamethiphos | 1040 |
| Azamulin | 1665, 1899 |
| Azasetron | 1855 |
| Azathioprine | 61, 843, 1048, 1111, 1449, 2108, 2227, 2477 |
| AZD0328 | 1449 |
| AZD2624 (neurokinin-3 receptor antagonist) | 1306, 1449, 1665 |
| AZD5438 | 1237 |
| AZD5672 (N-(1-{(3R)-3-(3,5-difluorophenyl)-3-[4-methanesulfonylphenyl]propyl}piperidin-4-yl)-N-ethyl-2-[4-methanesulfonylphenyl]acetamide) | 842 |
| AZD6244 | 1222, 1233, 1235 |
| Azelaic Acid | 61 |
| Azelastine | 62, 843, 1449, 1582, 1665 |
| Azidothymidine | 967 |
| Azilsartan medoxomil (TAK-491) | 1133 |
| Azimilide | 1665 |
| Azinphosmethyl | 1040, 1813 |
| Aziridines | 2208, 2317, 2457 |
| Azithromycin | 62, 843, 885, 1247, 1665, 1899 |
| Azole antifungal agents | 843 |
| Azole antimycotics | 1665 |
| Azole-based heme oxygenase inhibitors | 1596 |
| Azoxymethane | 1114, 1241, 1612, 2341, 2371, 2405 |
| Aztreonam | 63 |
| Abeta oligomerization inhibitors | 835 |
| B | |
| BACE-1 inhibitors | 843, 1666 |
| Bacillus thuringiensis Cry1Ac toxin | 948 |
| Bacitracin | 65 |
| Baclofen | 65, 1247 |
| Baicalein | 843, 902, 943, 948, 1097, 1247, 1978, 2446 |
| Baicalin | 843, 948, 961, 1097, 1281, 1359, 2457 |
| Bakumondo-to | 2525, 2295 |
| BAL8557 (BAL4815) | 1666 |
| Balanced Salt Solution | 66 |
| Balsalazide | 66 |
| Bamboo (Jukcho solution) | 1666 |
| Banxia Houpo (Pinellia) | 1596 |
| BAPA-3 | 1914 |
| BAPA-6 | 1914 |
| Bapineuzumab | 1133 |
| Barbital | 2312 |
| Barbiturates | 1899 |
| Barbituric acid | 843, 1250, 1251, 1252 |
| Barium | 66, 1064, 1210, 1254, 1256, 2002, 2093, 2229, 2236, 2323 |
| Barium chloride | 2229, 2236 |
| Barium sulfate | 2208 |
| BAS 100 | 1666 |
| Basella alba L. | 1951 |
| Basiliximab | 67 |
| Bathocuproine | 2472 |
| Bathocuproine sulfonate | 2072 |
| BAY 11-7085 | 2177, 2204, 2208, 2371, 2446, 2457, 2513, 2519 |
| Bazedoxifene | 67, 843, 2039, 2045, 2250, 2486 |
| BCG Vaccine | 68, 2033, 2401 |
| BCH 1393 | 2183, 2200 |
| BCNU (1,3-bis(2-chloroethyl)-1-nitrosourea) | 1666 |
| Beauvericin | 1666 |
| Becaplermin | 68 |
| Beclomethasone | 69, 1024, 1075, 1080, 2317 |
| Bee venoms | 1978, 2072, 2457 |
| Befloxatone | 1019 |
| Belladonna (Atropa belladona L.) | 69 |
| Benazepril | 70, 1030, 1034, 1051, 1075, 1085, 1089, 2446 |
| Bendamustine | 71, 843, 2472 |
| Bendiocarb | 1040, 1254, 2039 |
| Benidipine | 1294, 1400, 1423, 1589, 1666, 1899, 2012, 2014 |
| Benomyl | 1040, 1106, 1187, 1978, 2039, 2180 |
| Benperidol | 71 |
| Benserazide and Levodopa | 72, 1999 |
| Benthiocarb | 1187 |
| Benz(a)anthracene | 1097, 1187, 1294, 1346, 2022, 2039, 2308 |
| Benzaldehyde | 1106, 1108 |
| Benzalkonium compounds | 2177 |
| Benzamidoxyme | 2489, 2490, 2493 |
| Benzbromarone | 979, 1218, 1382, 2066, 2314, 2382 |
| Benzcyclo-pentane/hexane derivatives | 1951 |
| Benzenaminium, 4,4′-(3-Oxo-1,5-pentanediyl)bis(N,N-dimethyl-N-2-propenyl-),dibromide | 1040 |
| Benzene | 1027, 1047, 1060, 1097, 1103, 1119, 1168, 1182, 1209, 1215, 1222, 1231, 1238, 1261, 1270, 1294, 1589, 1596, 1610, 1612, 1980, 1993, 2019, 2021, 2022, 2030, 2032, 2050, 2062, 2072, 2101, 2110, 2116, 2121, 2125, 2147, 2150, 2153, 2183, 2200, 2204, 2211, 2217, 2220, 2224, 2241, 2253, 2295, 2308, 2317, 2353, 2380, 2432, 2457, 2465, 2472, 2512, 2513, 2516, 2528 |
| Benzidine | 1097, 1903, 1906, 2366, 2371, 2472 |
| Benzimidazole | 2478 |
| Benzimidazole-5-sulfonamides (nonpeptide luteinizing hormone releasing hormone (LHRH) antagonists) | 1666 |
| Benzimidazole-based IGF-IR inhibitors | 1666 |
| Benzimidazoles | 1666, 2291 |
| Benzo(a)pyrene | 843, 926,943, 961,1002, 1094, 1097, 1108, 1187, 1207, 1215, 1222, 1228, 1231, 1265, 1281, 1294, 1306, 1313, 1337, 1346, 1368, 1592, 1942, 1951, 2014, 2022, 2039, 2064, 2106, 2111, 2117, 2125, 2153, 2183, 2188, 2193, 2200, 2204, 2208, 2213, 2217, 2308, 2337, 2344, 2371, 2382, 2420, 2430, 2432, 2433, 2434, 2457, 2465, 2472, 2489, 2490, 2526 |
| Benzo(a)pyrene-3,6-quinone | 2106, 2308, 2430 |
| Benzo(a)pyrene 7,8-dihydrodiol | 1294, 1346, 1666, 2106, 2308, 2366, 2371, 2472 |
| Benzo(a)pyrene 7,8-oxide | 1294, 2022 |
| Benzo(a)pyrene-7,8-dione | 1294, 1346 |
| Benzo(a)pyrene and di-(2-ethylhexyl) phthalate | 1951 |
| Benzo(a)pyrene diolepoxide I | 2472 |
| Benzo(a)quinolizin-4-ones | 844 |
| Benzo(b)fluoranthene | 1097, 1294, 1346 |
| Benzo(c)chrysene | 2117 |
| Benzo(c)phenanthrene | 1294, 2022, 2117 |
| Benzo(f)quinoline | 1247, 2002, 2004, 2308 |
| Benzo(g)chrysene | 1294, 2117 |
| Benzo(k)fluoranthene | 926, 1024, 1097, 1294, 1346, 2022 |
| Benzo-1,2,3-thiadiazole | 2022, 2291 |
| Benzocaine | 73, 2183,2204 |
| Benzodiazepines | 1306, 1408, 1667 |
| Benzodioxolyl-butanamine (BDB) enantiomers | 1637 |
| Benzofuran | 1097, 1978 |
| Benzohydrol | 2039, 2045 |
| Benzoic acid | 2094, 2096, 2106, 2300 |
| Benzonatate | 73 |
| Benzophenone | 1187, 2039, 2045, 2180, 2312 |
| Benzoquinone | 1097, 1215, 1294, 2208, 2217, 2266, 2308, 2472, 2526 |
| Benzothiazole | 1097, 2022, 2111 |
| Benzothiophene | 2039 |
| Benzotriazole | 2111 |
| Benzoxazinorifamycin (KRM-1648) | 1667 |
| Benzoxazoles | 2111 |
| Benzoyl Peroxide | 73, 1215,2208, 2446 |
| Benzoylcarbonyl-aspartyl-glutamyl-valyl-aspartyl-fluoromethyl ketone | 2193 |
| Benzoylecgonine | 1242 |
| Benzoylphenylurea sulfur analogs | 2263 |
| Benzphetamine | 74, 1359, 1368, 1612 |
| Benztropine | 74, 1450, 2396 |
| Benzydamine | 75, 2065,2068 |
| Benzyl isothiocyanate | 2111, 2117 |
| Benzylideneacetone | 1294, 1612 |
| Benzyloxycarbonyl-isoleucyl-glutamyl(O-tert-butyl)-alanyl-leucinal | 2220 |
| Benzyloxycarbonyl-isoleucyl-glutamyl-threonyl-aspartic acid fluoromethyl ketone | 2457 |
| Benzyloxycarbonylleucyl-leucyl-leucine aldehyde | 1024, 1097, 1222, 1261, 1294, 1346, 2012, 2019, 2039, 2072, 2117, 2177, 2183, 2208, 2326, 2344, 2371, 2457, 2480, 2513 |
| Benzyloxycarbonyl-valyl-alanyl-aspartic acid | 1168, 1182, 2019 |
| Benzyloxyresorufin | 1368, 1899 |
| Benzylpenicillin | 948 |
| Benzylpiperazine | 1450, 1667 |
| Bepotastine | 75 |
| Bepridil | 1899 |
| Beractant | 76 |
| Beraprost sodium | 1667 |
| Berberine (Cortidis rhizome) | 817, 844, 854, 904, 990, 1097, 1222, 1233, 1235, 1238, 1294, 1307, 1330, 1450, 1491, 1568, 1667, 1878, 1980, 2193, 2446, 2458 |
| Berberine metabolites (Berberrubine, Thalifendine, Demethyleneberberine, Jatrorrhizine) | 1450 |
| Berberrubine | 1450 |
| Bergamottin | 1097, 1294, 1333, 1346, 1368, 1667, 1751, 1899, 2490 |
| Bergamottin and 6′,7′-dihydroxybergamottin (Furanocoumarins from grapefruit juice) | 1667 |
| Bergapten | 1751 |
| Bergaptol | 1668 |
| Berries | 1338 |
| Berries and Ellagic acid | 1338 |
| Beryllium | 1241 |
| Beryllium fluoride | 926, 979, 985, 2072 |
| Beryllium sulfate | 1241, 2072, 2177, 2183, 2200 |
| Besifloxacin | 76 |
| Besilesomab | 76 |
| beta-1,3-Glucan | 2193, 2208, 2458 |
| beta-2-Adrenoreceptor agonists | 1076 |
| beta-Adrenergic antagonists | 1030, 1075, 2090 |
| beta-Adrenergic blocking agents | 1070 |
| beta-Adrenoceptor blockers | 1450 |
| beta-Arteether | 1668 |
| beta-Blocker agents | 2339 |
| beta-Blocking agents | 2098 |
| beta-Carboline alkaloids (Harmaline, Harmine) | 1668 |
| beta-Carboline alkaloids (Norharman and Harman) | 1307 |
| beta-Carotene | 77, 1053, 1215, 1222, 1261, 1400, 1596, 1597, 1899, 2032, 2039, 2045, 2107, 2253, 2272, 2312, 2384, 2385, 2472 |
| beta-Cyfluthrin | 1838 |
| beta-Glucans | 1914, 2183, 2208, 2217, 2220, 2458 |
| beta-Hexachlorocyclohexane | 1187, 1215, 1222, 2026, 2039 |
| (-)-beta-Pinene | 960 |
| Betahistine | 77, 2154 |
| Betaine | 77, 1215, 1607 |
| beta-Lapachone | 2117, 2458 |
| Betamethasone | 78, 2317 |
| beta-Naphthoflavone | 812, 961, 964, 979, 1097, 1215, 1222, 1294, 1307, 1333, 1346, 1400, 1404, 1423, 1592, 1899, 1906, 2106, 2117, 2121, 2308, 2317, 2366, 2371, 2418, 2423, 2432 |
| beta-Oxa polyunsaturated fatty acid (β-oxa 23:4n-6) | 1161 |
| beta-Penta-O-galloyl-glucose | 2177 |
| beta-Secretase inhibitors | 1180 |
| beta-Solamarine | 2465 |
| beta-Thujone | 1650, 1668 |
| beta-Tocopherol | 2312 |
| beta-Tocotrienol | 926, 1899, 2312, 2489 |
| Betaxolol | 79, 2090 |
| Betel quid-specific N-nitrosamines (3-(N-nitrosomethylamino)propionitrile, 3-(N-nitrosomethylamino)propionaldehyde, N-nitrosoguvacoline) | 1668 |
| Bethanechol | 80 |
| Betti-base derivatives of tylosin | 844 |
| Betulinic acid | 934, 1133, 2019, 2468 |
| Betulinic acid derivatives | 1668 |
| Bevacizumab | 81, 884, 1245, 1951 |
| Bexarotene | 81, 929, 1040, 1042, 1093, 1119, 1120, 1121, 1182, 1187, 1190, 1218, 1222, 1243, 1264, 1333, 1346, 1986, 2039, 2048, 2053, 2061, 2066, 2097, 2153, 2188, 2190, 2224, 2261, 2323, 2337, 2352, 2361, 2362, 2376, 2432, 2437, 2465, 2519 |
| Bezafibrate | 82, 929, 1042, 1043, 1120, 1133, 1235, 1294, 1741, 1932, 2250, 2272, 2339, 2340, 2341, 2385, 2525 |
| BGC638 | 2405, 2480 |
| BGC945 | 2405, 2480 |
| BIBF 1120 | 844, 1002 |
| Bicalutamide | 83, 1043,1185, 1187, 1668, 1952, 2072, 2245, 2270, 2276, 2376, 2442, 2453, 2458, 2516 |
| Bicarbonates | 1247 |
| Bicyclol | 2446, 2458 |
| Bifendate | 1668 |
| Bifenox | 1097, 1187 |
| Bifenthrin | 1838, 1899, 1952, 2312 |
| Bifonazole | 1612, 1899, |
| Bilberry anthocyanin | 1597 |
| Bile acid sequestrants | 1915 |
| Bile acids | 934 |
| Bile acids and salts | 929, 961, 964, 971, 1247, 1932, 2053, 2150, 2312, 2314, 2400, 2401, 2415, 2416, 2516 |
| Bilirubin | 844, 943, 948, 961, 1097, 1333, 1368, 1400, 1899, 2106, 2193, 2312, 2415, 2489, 2490, 2493 |
| Bilirubin glucuronate | 948, 961 |
| Biliverdine | 2183, 2208, 2217, 2458 |
| Bilobalide | 1286 |
| Bimatoprost | 83 |
| Bioallethrin | 1899, 2183, 2204, 2312 |
| Biochanin A | 844, 943, 961, 1215, 1294, 1333, 1338, 1346, 1978, 2039, 2045, 2156, 2204, 2276, 2458, 2490, 2513 |
| Biomass fuel cow dung (kanda) smoke | 1281 |
| Bioresmethrin | 1242, 1243, 1838, 1899, 2312 |
| Biotin (Vitamin B7) | 84, 1346 |
| Biperiden | 84, 1487, 1550 |
| Biphenylmethylene pyridines | 1936 |
| Biphenylmethylenes | 1952 |
| BIRB 796 | 2212, 2213 |
| bis(12)-Hupyridone | 844 |
| bis(3-Hydroxyphenyl) diselenide | 2458 |
| bis(4-Fluorobenzyl)trisulfide | 844 |
| bis(4-Hydroxycinnamoyl)methane | 943, 961, 2344, 2371, 2458 |
| bis(Maltolato)oxovanadium (IV) | 2072, 2278, 2306 |
| bis(Quercetinato)oxovanadium (IV) | 1215 |
| bis(tri-n-Butyltin)oxide | 1207, 1273, 2183, 2200, 2204, 2224, 2317, 2380, 2382, 2420, 2511, 2519 |
| Bisabolol | 1294 |
| Bisacodyl | 85 |
| Bisacurone | 2458, 2513 |
| Bisbibenzyl derivatives | 844 |
| Bisindolylmaleimide | 1942, 1978, 2012, 2019, 2072, 2458 |
| Bisindolylmaleimide I | 1097, 1212, 1247, 1265, 2012, 2019, 2101, 2220, 2324, 2330, 2376, 2411, 2472, 2519 |
| Bisindolylmaleimide IX | 2101, 2324, 2472 |
| Bismuth | 86 |
| Bismuth tripotassium dicitrate | 1190, 1264, 2012, 2082, 2088, 2193, 2270, 2308, 2366, 2417, 2418, 2432, 2450 |
| Bisoprolol | 86, 1030, 1085, 1669, 2090 |
| Bisperoxovanadium | 2238, 2242, 2257, 2371 |
| Bisphenol A (Diphenylolpropane) | 961, 1060, 1097, 1116, 1119, 1187, 1207, 1215, 1231, 1233, 1254, 1256, 1294, 1346, 1355, 1402, 1450, 1669, 1899, 1952, 1978, 1998, 2004, 2039, 2045, 2072, 2085, 2088, 2106, 2112, 2125, 2180, 2188, 2200, 2241, 2292, 2312, 2320, 2333, 2352, 2361, 2365, 2379, 2385, 2408, 2423, 2430, 2436, 2442, 2451, 2472, 2480, 2487, 2491, 2493, 2519 |
| Bisphenol A glycidyl methacrylate | 1669 |
| Bisphenol B | 2039 |
| Bisphosphonates | 1952 |
| Bisvanillyl-hydralazone | 1133 |
| Bitertanol | 1187 |
| Bitumen | 1281 |
| Bivalirudin | 87, 1270 |
| BL1521 | 1235, 2376 |
| Black cohosh (Actaea racemosa) | 1222, 1235, 1287, 1317, 1415, 1490, 1759, 1913, 2376 |
| Black cohosh (Cimicifuga racemosa) | 1450, 1491, 1670 |
| Black pepper (See Piperine) | 858, 900, 1265, 1296, 1396, 1825, 2073, 2195, 2209, 2276, 2462 |
| Black seed | 1670 |
| Blebbistatin | 929 |
| Bleomycin | 88, 1202, 1215, 1256, 1259, 2031, 2075, 2109, 2115, 2119, 2183, 2317, 2371, 2427, 2437, 2446, 2458, 2465, 2467, 2528 |
| Blue cohosh (Caulophyllum thalictroides) | 1670 |
| Blueberry peels | 1915 |
| BMK-152 | 845 |
| BMS 181101 | 2161 |
| BMS-1 (2-{Butyryl-[2′-(4,5-dimethyl-isoxazol-3-ylsulfamoyl)-biphenyl-4-ylmethyl]-amino}-N-isopropyl-3-methyl-butyramide) | 1670 |
| BMS-275183 | 1670 |
| BMS-299897 | 1747 |
| BMS309403 | 1133 |
| BMS-310705 | 1670 |
| BMS-536924 | 1671 |
| BMS-690514 | 845, 1282, 1307, 1451, 1671 |
| BMS-694153 | 1671 |
| BMS-695735 | 1671 |
| BMY7378 | 1064 |
| BN50730 | 2371 |
| BN50739 | 2458 |
| Boar taint | 1451 |
| Boesenbergia pandurata (See Pinocembrin) | 1290, 1606 |
| Bohemine | 1233 |
| Boldenone undecylenate | 1187, 2039 |
| Boletus calopus | 1838 |
| Bolinaquinone | 1109, 1110, 2371, 2458 |
| Bongkrekic acid | 2177 |
| Boropinic acid | 903, 1540 |
| Bortezomib | 89, 845, 934, 1222, 1333, 1400, 1416, 1423, 1460, 1589, 1671, 1899, 2341, 2376, 2422, 2430, 2458, 2472 |
| Boschniakia rossica | 1597 |
| Bosentan | 89, 864, 929, 1047, 1269, 1368, 1398, 1400, 1671, 1899, 2012, 2014, 2417, 2458 |
| Bosutinib | 1026, 1222, 1233, 2019, 2026, 2242 |
| Boswellic acid | 2468 |
| Botryllamides | 1003 |
| Botulinum Toxin Type A | 90 |
| Botulinum Toxin Type B | 91 |
| Botulism Immune Globulin (Intravenous-Human) | 91 |
| BP 897 | 2004 |
| BQ 485 | 2012, 2014, |
| BQ 610 | 2012, 2014, 2247 |
| BQ 788 | 2012, 2247, 2278, 2458 |
| Bradykinin | 1197, 2312, 2465 |
| Brassaiopsis glomerulata | 1954 |
| Brefeldin A | 1088, 1247 |
| Bretazenil | 2079 |
| Brevetoxin | 1116 |
| Brilliant blue FCF | 925, 1355 |
| Brimonidine | 92, 1067, 1247 |
| Brinzolamide | 92 |
| Brivaracetam | 1673 |
| BRL 15572 | 2161 |
| BRL 26830A | 1082 |
| BRL 37344 | 1082 |
| BRL 44408 | 2183, 2193, 2200, 2458, |
| Bromazepam | 93, 1306, 1673 |
| Bromfenac | 94 |
| Bromine | 1228, 1261, 2436 |
| Bromoacetanilide | 2295 |
| Bromoacetate | 2295 |
| Bromobenzene | 985, 1043, 1103, 1120, 1294, 1333, 1612, 2022, 2053, 2066, 2111, 2117, 2121, 2188, 2308 |
| Bromochloroacetic acid | 2072 |
| Bromocriptine | 94, 1003, 1487, 1724, 1899, 1999, 2002, 2446, 2519 |
| Bromodichloromethane | 1333, 1355, 1612, 1673, 1899, 2121 |
| Bromoethane | 2039 |
| Bromophos | 2045 |
| Bromotetrandrine | 847, 926 |
| Bromotriethylstannane | 2111 |
| Bromperidol | 95, 847, 1502, 1569, 1673, 2000 |
| Brompheniramine | 95 |
| Bropirimine | 1674, 2490, 2493 |
| Brotizolam | 96, 1555, 1674, 1899 |
| Brucine | 1308 |
| Brugia malayi | 847 |
| Brussels sprouts | 1282, 1308 |
| Bryostatin-1 | 1237, 2217, 2220 |
| BSF 302146 | 2014 |
| Buagafuran | 847, 1308 |
| Bucindolol | 1068, 2012 |
| Buckwheat sprouts (Fagopyrum esculentum Moench) | 1915 |
| Bucladesine | 929, 1249, 2072, 2393, 2411, 2458 |
| Budesonide | 96, 847, 1075, 1674, 2190, 2193, 2204, 2208, 2366, 2371, 2458, 2513 |
| Bufalin | 2072, 2458 |
| Bufotenine | 1452 |
| Bufuralol | 1333, 1377, 1400, 1423, 1452, 1589, 1674 |
| Bumetanide | 98, 1247, 2366, 2377, 2402, 2409, 2410 |
| Bungarotoxins | 1168, 1182, 1252 |
| Bunitrolol | 1453, 1674 |
| Bupirimate | 2312 |
| Bupivacaine | 98, 1674, 2478, 2519 |
| Bupleuran 2IIc | 2376 |
| Buprenorphine | 99, 1007, 1359, 1377, 1453, 1589, 1674, 1899, 2323, 2490, 2491 |
| Bupropion | 100, 847, 1255, 1263, 1351, 1359, 1368, 1408, 1453, 1478, 1532, 1550, 1558, 1559, 1579, 1675, 2000, 2398 |
| Buserelin | 101 |
| Buspirone | 102, 1453, 1555, 1589, 1675, 1899 |
| Busulfan | 102, 2105, 2106, 2109, 2111, 2117, 2272 |
| Butabarbital | 103 |
| Butachlor | 1368, 1686, 1899 |
| Butamben | 1187 |
| Butaprost | 2360 |
| Butein | 1992 |
| Butenafine | 104 |
| Buthionine sulfoximine | 943, 1215, 1294, 2072, 2104, 2208, 2217, 2220, 2272, 2308, 2420, 2423, 2430, 2448, 2472 |
| Buthionine sulfoximine ethyl ester | 943 |
| Butoconazole | 104 |
| Butorphanol | 104 |
| Butoxamine | 1076, 1080 |
| Butyl phosphorotrithioate | 1259 |
| Butylated hydroxyanisole | 961, 964, 971, 979, 1187, 1615, 2039, 2045, 2106, 2111, 2117, 2121, 2308, 2418, 2423 |
| Butylated hydroxytoluene | 1215, 1368, 1676, 1899, 2117, 2121, 2200, 2204, 2217, 2247, 2337, 2423, 2446, 2458, 2519 |
| Butylbenzyl phthalate | 1097, 1187, 2039, 2045, 2180, 2245, 2393, 2458, 2519 |
| Butylcyclohexane | 1333 |
| Butylhydroxybutylnitrosamine | 2183, 2200 |
| Butylidenephthalide | 1222, 1233, 1235, 1238, 1241, 2376, 2472 |
| Butylparaben | 2039 |
| Butylphen | 1187, 2465 |
| Butyraldehyde | 1105, 1106 |
| Butyrates | 926, 1108, 1222, 1231, 1233, 1235, 1247, 2039, 2106, 2111, 2117, 2121, 2183, 2200, 2204, 2220, 2272, 2344, 2371, 2376, 2423, 2394, 2451, 2478, 2513 |
| Butyric acid | 926, 961,1040, 2208, 2366, 2371, 2423, 2446, 2458, |
| Butyrylthiocholine | 1196 |
| Bu-zhong-yi-qi-tang | 2039, 2045, 2204, 2458 |
| BW A868C | 2300 |
| BXL 628 | 2516 |
| (+)-Byakangelicine | 1316 |
| (+)-Byakangelicol | 869, 1316 |
| BYZX | 1676 |
| C | |
| C-1311 (5-Diethylaminoethylamino-8-hydroxyimidazoacridinone) | 1308 |
| Cabazitaxel | 106, 847 |
| Cabergoline | 106, 1676, 2000 |
| Cacodylic acid | 943, 961, 964, 2111, 2308 |
| Cacospongionolide B | 2371, 2458 |
| Cadmium | 847, 943,1024, 1040, 1042, 1064, 1080, 1100, 1168, 1182, 1187, 1215, 1233, 1270, 1294, 1351, 1400, 1676, 1907, 2022, 2037, 2039, 2045, 2072, 2078, 2088, 2106, 2125, 2147, 2154, 2155, 2183, 2193, 2208, 2217, 2253, 2279, 2294, 2308, 2330, 2340, 2344, 2430, 2458, 2472, 2480, 2526 |
| Cadmium acetate | 2183, 2193, 2217, 2458 |
| Cadmium chloride | 961, 1024, 1040, 1042, 1064, 1080, 1187, 1215, 1233, 1241, 1261, 1270, 1294, 1346, 2022, 2032, 2039, 2045, 2072, 2078, 2086, 2106, 2117, 2147, 2183, 2188, 2253, 2279, 2308, 2330, 2340, 2344, 2352, 2371, 2379, 2423, 2430, 2442, 2458, 2467, 2472, 2480, 2525 |
| CAF protocol | 2026 |
| Cafestol | 1612, 1915, 2106, 2111, 2272, 2308, 2432 |
| Cafestol palmitate | 1294 |
| Caffeic acid | 990, 1034, 1327, 1903, 2111, 2117, 2300, 2432, 2433, 2434, 2435, 2493 |
| Caffeic acid ester analogs (ethyl caffeate, octyl caffeate, benzyl caffeate and phenethyl caffeate) | 1308 |
| Caffeic acid phenethyl ester | 943, 1097, 1215, 1231, 1233, 1241, 2117, 2183, 2193, 2200, 2220, 2376, 2458, 2472 |
| Caffeine | 107, 133, 961, 1044, 1061, 1095, 1187, 1210, 1222, 1235, 1241, 1282, 1308, 1355, 1453, 1589, 1597, 1612, 1676, 2101, 2112, 2294, 2295, 2376, 2383, 2472, 2525 |
| Calcein AM | 926, 929, 943, 962, 964, 971, 979 |
| Calcidiol | 1980 |
| Calcifediol | 1978 |
| Calcimycin | 1110, 1978, 2082, 2183, 2193, 2204, 2300, 2371, 2446, 2458, 2472 |
| Calcineurin | 1936 |
| Calcineurin inhibitors | 848, 1408, 1676 |
| Calcipotriene | 108, 2514, 2516 |
| Calcitonin | 108 |
| Calcitriol (1α,25-Dihydroxyvitamin D3) | 109, 823, 861, 926, 964, 1080, 1111, 1152, 1212, 1222, 1229, 1233, 1235, 1257, 1261, 1294, 1899, 1918, 1933, 1945, 1955, 1978, 1980, 1986, 2013, 2039, 2078, 2086, 2088, 2098, 2165, 2183, 2198, 2199, 2200, 2208, 2217, 2220, 2224, 2247, 2253, 2276, 2278, 2312, 2321, 2333, 2341, 2344, 2346, 2352, 2360, 2362, 2366, 2371, 2376, 2379, 2401, 2414, 2416, 2446, 2451, 2458, 2515, 2516, 2519 |
| Calcium | 1064, 1103, 1161, 1168, 1182, 1197, 1210, 1222, 1250, 1254, 1256, 1259, 1265, 1612, 2002, 2013, 2014, 2088, 2150, 2154, 2188, 2190, 2213, 2247, 2249, 2324, 2333, 2337, 2359, 2361, 2366, 2371, 2381, 2383, 2420, 2446, 2458, 2472, 2478, 2516, 2519 |
| Calcium Acetate | 109 |
| Calcium antagonists | 1582 |
| Calcium Carbonate | 110, 2078 |
| Calcium channel blockers | 848, 1453, 1677 |
| Calcium Chloride | 111, 1212, 1241, 2337 |
| Calcium Citrate | 111 |
| Calcium Glubionate | 111 |
| Calcium Gluconate | 112 |
| Calcium Lactate | 112 |
| Calcium phosphate nanoparticles | 1956 |
| Calcium Phosphate, Tribasic | 113 |
| Calfactant | 113 |
| Calicheamicin-γ1 | 848 |
| Calixarenes | 1247 |
| Calmidazolium | 1942, 2376 |
| Calmodulin | 817 |
| Calpain | 990 |
| Calpain inhibitor III | 2458 |
| Calpeptin | 990 |
| Calphostin C | 1088, 2013, 2465 |
| Calumenin | 1382 |
| Calyculin A | 1212, 1294, 1346, 2072, 2101, 2376 |
| Camellia sinensis (See Green tea) | 873, 1316, 1491, 1602, 1753, 1921 |
| Campesterol | 995 |
| Camphor | 2479 |
| Camphoroquinone | 1187 |
| Camptothecin | 926, 1207, 1209, 1222, 1233, 1995, 2117, 2193, 2266, 2273, 2376, 2379, 2438, 2467, 2468, 2472, 2480, 2519 |
| Camptothecin analog AR-67 (7-tert-Butyldimethylsilyl-10-hydroxycamptothecin) | 1282 |
| Canakinumab | 113 |
| Candesartan | 114, 839,1001, 1030, 1089, 1092, 1382, 1679, 1936, 1942, 2492 |
| Candesartan cilexetil | 839, 1001, 1092, 1377, 1943, 2446 |
| Candoxatrilat | 2305 |
| Candoxin | 2253, 2362, 2366, 2371, 2420, 2451, 2483 |
| Canertinib | 2016 |
| Cangrelor | 2325 |
| Cannabidiol (Cannabis sativa) | 1309, 1325, 1382, 1408, 1453, 1679, 1981, 2200 |
| Cannabinoids | 934, 1679, 2487, 2491 |
| Cannabinol | 1325, 2200 |
| Cantharidin | 115, 2002 |
| Capecitabine | 115, 1083, 1241, 1242, 1243, 1994, 1995, 2115, 2222, 2276, 2286, 2371, 2376, 2382, 2480 |
| Capravirine | 1680 |
| Capreomycin | 116 |
| Caprylic acid | 2408 |
| Capsaicin | 116, 858, 1042, 1044, 1111, 1241, 1247, 1282, 1309, 1454, 1956, 2048, 2072, 2082, 2117, 2161, 2188, 2300, 2304, 2340, 2341, 2344, 2430, 2437, 2446, 2458, 2479, 2483, 2490 |
| Capsazepine | 1956, 2072, 2188, 2305, 2458, 2479 |
| Capsiate | 2188 |
| Capsinoids | 1680 |
| Captan | 2039 |
| Captopril | 116, 1031, 1035, 1085 |
| Carbachol | 117, 1038, 1247, 1252, 2091, 2458 |
| Carbamate-based inhibitors of hormone-sensitive lipase | 1680 |
| Carbamates | 2183, 2208, 2217, 2220, 2458, 2472 |
| Carbamazepine | 118, 849, 926, 949, 1003, 1282, 1309, 1351, 1368, 1377, 1382, 1400, 1454, 1487, 1550, 1579, 1584, 1680, 1899, 2021, 2072, 2109, 2119, 2133, 2208, 2311, 2312, 2317, 2386, 2390, 2414, 2423, 2458 |
| Carbamazepine epoxide | 1377, 1899 |
| Carbamide Peroxide | 119 |
| Carbanilides | 2213 |
| Carbaprostacyclin | 2300 |
| Carbaryl | 1040, 1093, 1187, 1250, 1254, 1256, 1294, 1333, 1365, 1682, 2039, 2045, 2072, 2180 |
| Carbendazim | 1365 |
| Carbenicillin | 119 |
| Carbidopa | 120, 1038, 1263, 1989 |
| Carbidopa and Levodopa | 120, 2000 |
| Carbinoxamine | 121 |
| Carbofuran | 1040, 1196, 1215, 1333, 1423, 1682, 1899 |
| Carbon dioxide | 2479 |
| Carbon disulfide | 2111 |
| Carbon monoxide | 962, 1215, 2101, 2183, 2220, 2300, 2335, 2346, 2423, 2458 |
| Carbon nanotubes | 1222, 1233, 1235, 1238, 1241, 1346, 2364, 2448, 2472 |
| Carbon particles | 1338 |
| Carbon Tetrachloride | 926, 929, 943, 962, 964, 971, 979, 985, 996, 1024, 1026, 1034, 1040, 1042, 1043, 1044, 1045, 1046, 1060, 1062, 1067, 1088, 1100, 1103, 1106, 1111, 1116, 1119, 1120, 1161, 1182, 1191, 1192, 1197, 1207, 1210, 1215, 1222, 1228, 1231, 1235, 1238, 1251, 1252, 1254, 1256, 1259, 1261, 1264, 1267, 1273, 1294, 1301, 1333, 1346, 1400, 1597, 1612, 1622, 1906, 1986, 1988, 1992, 1996, 2002, 2013, 2014, 2019, 2022, 2023, 2029, 2039, 2045, 2048, 2053, 2061, 2066, 2068, 2072, 2088, 2098, 2099, 2106, 2111, 2117, 2121, 2125, 2153, 2161, 2164, 2168, 2170, 2177, 2179, 2183, 2188, 2190, 2193, 2198, 2200, 2204, 2208, 2217, 2224, 2225, 2241, 2247, 2249, 2250, 2251, 2253, 2261, 2266, 2270, 2272, 2276, 2278, 2280, 2283, 2290, 2292, 2298, 2300, 2305, 2308, 2314, 2317, 2318, 2323, 2324, 2328, 2330, 2331, 2337, 2340, 2341, 2344, 2359, 2360, 2362, 2365, 2366, 2371, 2376, 2379, 2382, 2392, 2395, 2397, 2400, 2402, 2403, 2406, 2407, 2408, 2411, 2412, 2420, 2423, 2425, 2430, 2432, 2435, 2438, 2440, 2446, 2451, 2453, 2458, 2465, 2467, 2472, 2480, 2483, 2513, 2519, 2525 |
| Carbonic anhydrase II | 1956 |
| Carbonyl 3-chlorophenylhydrazone | 2326 |
| Carbonyl cyanide p-trifluoromethoxyphenylhydrazone | 1215, 1222, 1294, 2157, 2177, 2371, 2423 |
| Carboplatin | 121, 849, 1101, 1395, 1685, 1995, 2016, 2026, 2029, 2031, 2084, 2106, 2115, 2371, 2407, 2480, 2527 |
| Carboprost Tromethamine | 122 |
| Carboprostacyclin | 2217, 2364, 2458 |
| Carbosulfan | 1682 |
| Carbosulfan II | 1360 |
| Carboxyamidotriazole | 1682 |
| Carboxyatractyloside | 2177 |
| Carboxycinnamic acid bishydroxamide | 2376 |
| Carboxydichlorofluroscein | 949 |
| Carboxylesterases | 1682 |
| Carboxymethylcellulose (Carmellose) | 123 |
| Carcinogens | 1355, 2106 |
| Cardamonin | 1958 |
| Carebastine | 1617, 1726 |
| Carglumic Acid | 123 |
| Cariporide | 2013 |
| Carisoprodol | 123, 1408 |
| Carmellose (See Carboxymethylcellulose) | 123 |
| Carminic acid | 1294, 1333, 1346, 1355, 1423, 1612, 1838, 1899 |
| Carminomycin I | 849 |
| Carmustine | 124, 926, 943, 1088, 1100, 1201, 1978, 2022, 2079, 2106, 2111, 2117, 2119, 2121, 2232, 2251, 2272, 2395, 2400, 2414, 2442, 2472, 2520 |
| Carnitine | 1215, 2411 |
| Carnosic acid | 849, 909, 935 |
| Carnosine | 1215, 1270, 1598, 2072 |
| Carnosol | 909, 935 |
| Carotenoids | 1333, 1683, 2295, 2344 |
| Carpobrotus edulis | 849 |
| Carrageenan | 2072, 2193, 2371, 2446, 2458 |
| Carteolol | 124, 1454, 1582, 1683 |
| Carticaine | 2479 |
| Carvedilol | 125, 849, 1070, 1076, 1269, 1309, 1454, 1478, 1547, 1683, 2276, 2303, 2490 |
| Casimiroin analogs | 1956 |
| Casopitant | 1382, 1455, 1683 |
| Caspofungin | 126, 863, 1683 |
| Castanea crenata (See Chestnut) | 1598 |
| Catalase | 1214, 1683 |
| (+)-Catechin | 894, 902, 1024, 1034, 1215, 1222, 1294, 1333, 1607, 2177, 2217, 2300, 2337, 2423, 2432, 2468 |
| Catechol | 1097, 1215, 2200, 2217, 2308, 2432, 2433, 2434, 2435, 2458 |
| Catechol estrogen quinines | 1683 |
| Catechol estrogens | 1264, 1294, 2111, 2121, 2432, 2490 |
| Catecholamines | 1264, 1683, 1989, 2013, 2259, 2317, 2323, 2434, 2483 |
| Caterpillar fungus | 1598, 1684 |
| Catharanthus roseus (Ursolic acid, Oleanolic acid, Vindoline, Ajmalicine, Serpentine) | 1490, 1684 |
| Catumaxomab | 127 |
| Caulophyllum thalictroides (See Blue cohosh) | 1670 |
| Caveolin | 849, 990, 1003, 1134 |
| CB1093 | 1222, 1233, 1235, 1238, 2039, 2376 |
| CB3717 | 2270 |
| CDK inhibitors | 1237 |
| CDP-choline (See Citicoline) | 166, 1134 |
| Cediranib | 2065 |
| CEF regimen | 2026 |
| Cefaclor | 127 |
| Cefadroxil | 128 |
| Cefazolin | 129 |
| Cefdinir | 129, 1684 |
| Cefditoren | 130, 949 |
| Cefepime | 130 |
| Cefixime | 131, 1684 |
| Cefotaxime | 132 |
| Cefotetan | 132 |
| Cefoxitin | 133 |
| Cefpodoxime | 133 |
| Cefprozil | 134 |
| Ceftaroline Fosamil | 134 |
| Ceftazidime | 135 |
| Ceftibuten | 136 |
| Ceftizoxime | 136 |
| Ceftriaxone | 137 |
| Cefuroxime | 138 |
| Celastrus paniculatus | 1176 |
| Celecoxib | 139, 850, 967, 971, 1169, 1182, 1187, 1215, 1222, 1229, 1240, 1261, 1382, 1400, 1455, 1510, 1684, 1956, 1960, 1978, 2019, 2072, 2117, 2194, 2208, 2212, 2213, 2276, 2317, 2344, 2362, 2365, 2366, 2369, 2371, 2375, 2376, 2423, 2458, 2472, 2519 |
| Celsior | 1294, 1333, 1355, 1368, 1400, 1423, 1589, 1612, 1899 |
| Centella asiatica (Asiaticoside, Asiatic acid and Madecassic acid) | 1176, 1383, 1407 |
| CEP-11004 | 2208, 2217, 2371, 2423, 2458 |
| Cephaeline | 1771 |
| Cephalexin | 140, 2403, 2404 |
| Cephaloridine | 1215 |
| Cephalosporins | 967, 1455 |
| Cepharanthine | 926 |
| Cephradine | 140 |
| Ceramide | 850, 1684, 2326, 2376 |
| Cerebrolysin | 141, 1135, 1169 |
| Cerivastatin | 926, 929, 962, 1024, 1368, 1371, 1377, 1455, 1684, 2048, 2147, 2312, 2314 |
| Cerous chloride | 2423 |
| Certolizumab Pegol | 141 |
| Cesium | 1215 |
| Cesium (137Cs) | 1915 |
| Cetirizine | 142 |
| Cetuximab | 142, 850, 1221, 2016, 2056, 2058, 2239 |
| Cetylpyridinium | 143 |
| Cevimeline | 143, 1455 |
| CGP12177 | 1080, 1082, 1247 |
| CGP20712A | 1073, 1080, 1082 |
| CGP57380 | 2208, 2217, 2458 |
| CGS12066B | 2161 |
| CGS15855A | 2002, 2004 |
| CGS21680 | 1981, 2072, 2276 |
| CGS35601 | 1034, 1088, 2013, 2305 |
| CGS9343B | 2198 |
| Chalcone | 1187, 1294, 1333, 1762, 2177, 2430 |
| Chalepensin | 1351 |
| Chamaelirium luteum (See False unicorn) | 1287, 1317, 1415, 1490, 1759 |
| Chamomile (Matricaria chamomilla L) | 144 |
| Chamomile (Matricaria recutita L.) | 1685 |
| Chan su | 2366, 2371 |
| Changkil saponins (See Platycodon grandiflorum) | 1612 |
| Changweiqing | 850 |
| Charcoal, activated | 144 |
| Chaste tree berry (Vitex agnus-castus) | 1287, 1317, 1415, 1490, 1759 |
| Chebulinic acid | 1040, 2227 |
| Chelating agents | 2349 |
| Chelerythrine | 850, 935, 1004, 1097, 1247, 2479 |
| Chelidonine | 2266 |
| Chemokine receptor antagonists | 1225 |
| Chemopreventive agents (SR13668, 9-cis-UAB30, and pentamethylchromanol) | 1685 |
| Chemotherapy drugs | 1685, 2287 |
| Chenodiol (Chenodeoxycholic Acid) | 145, 929, 1233, 1235, 1261, 1687, 1932, 2013, 2150, 2314, 2340, 2344, 2376 |
| Chestnut (Castanea crenata)(Scoparone and Scopoletin) | 1598 |
| CHF 4056 | 2039, 2045 |
| Chicory root (Cichorium intybus L.) | 1309 |
| Chinese edible mushrooms | 1838 |
| Chinese herbal drugs/medicines | 1215, 1222, 1261, 1294, 1490, 1612, 1685, 1899, 1978, 2039, 2045, 2072, 2177, 2183, 2188, 2194, 2204, 2208, 2217, 2220, 2247, 2249, 2276, 2371, 2442, 2446, 2458 |
| Chiral polychlorinated biphenyls | 850 |
| Chitosan | 1215, 1612, 1916 |
| Chitosan-thioglycolic acid (chitosan-TGA) | 1879 |
| Chloral Hydrate | 145, 2072, 2194, 2208 |
| Chloralose | 2072 |
| Chlorambucil | 146, 926, 943, 949, 962, 1229, 1231, 2106, 2111, 2117, 2272, 2442, 2472, 2480 |
| Chloramine | 2376 |
| Chloramphenicol | 146, 1685, 2410 |
| Chlorcyclizine | 926, 943, 2053 |
| Chlordan | 1187, 1294, 1368, 1899, 1978, 2039, 2045, 2312, 2376 |
| Chlordecone | 1098, 1099, 1187, 1368, 1899, 2039, 2045, 2180, 2312 |
| Chlordiazepoxide | 147, 1306 |
| Chlorella | 1916 |
| Chlorfenvinphos | 1040, 1978 |
| Chlorhexidine Gluconate | 148 |
| Chlorides | 1247, 2048, 2236, 2392 |
| Chlorin e6 | 949 |
| Chlorinated benz(a)anthracene | 1283, 1309 |
| Chlorinated benzenes (1,2-Dichlorobenzene, 1,4-Dichlorobenzene, 1,2,4-Trichlorobenzene, 1,2,3,5-Tetrachlorobenzene, Pentachlorobenzene) | 1685 |
| Chlorinated dibenzofurans | 1095, 1097, 1264, 1294, 1333, 1346, 1943, 1978, 2039 |
| Chlorinated hydrocarbons | 1097, 1215, 1222, 1233, 1235, 1943, 2376 |
| Chlorine | 1043, 1235, 1272, 2072, 2104, 2107, 2170, 2183, 2400, 2448 |
| Chlormadinone acetate | 962, 1187, 2491 |
| Chlormethiazole | 1294, 1612 |
| Chlormethoxynil | 1187 |
| Chloro benztropine analogs | 1450, 1455 |
| Chloroacetaldehyde | 2272 |
| Chloroacetamide | 1368 |
| Chloroacetanilide herbicides (Acetochlor, Alachlor, Butachlor, Metolachlor) | 1686 |
| Chlorobenzene | 1612 |
| Chlorobenzilate | 1187, 1978, 2039 |
| Chlorocresol | 1097, 1187 |
| Chlorodiphenyl (54% chlorine) | 1040, 1097, 1103, 1182, 1187, 1215, 1294, 1333, 1346, 1355, 1368, 1377, 1423, 1612, 1899, 1978, 1992, 2022, 2045, 2066, 2106, 2117, 2150, 2156, 2194, 2208, 2308, 2326, 2344, 2383, 2397, 2420, 2427, 2432, 2458, 2490, 2493, 2494 |
| Chloroform | 926, 929, 964, 1043, 1211, 1215, 1612, 2053, 2066, 2177, 2183, 2204, 2250, 2253, 2261, 2465 |
| Chlorogenic acid | 843, 1034, 2106, 2308, 2493 |
| Chloroguanide | 1423 |
| Chlorophyll-a | 1004 |
| Chlorophyllin | 2183, 2200, 2220, 2430, 2458 |
| Chloroprocaine | 149 |
| Chloropropylate | 1187, 2039, 2045 |
| Chloroquine | 149, 1177, 1377, 1455, 1589, 1686, 1899, 2472 |
| Chlorothiazide | 150, 1031, 1051, 1085, 2092 |
| Chlorotrifluoroethylene | 1294 |
| Chlorpheniramine | 151, 926, 943, 1455, 2154 |
| Chlorproguanil | 1383, 1408 |
| Chlorpromazine | 151, 851, 1027, 1247, 1309, 1355, 1400, 1423, 1455, 1487, 1612, 1899, 2000, 2003, 2053, 2066, 2165, 2247, 2314 |
| Chlorpropamide | 152, 1383, 1686 |
| Chlorpropham | 943, 1097, 2039 |
| Chlorpyrifos | 926, 1040, 1080, 1097, 1196, 1197, 1215, 1251, 1294, 1333, 1360, 1365, 1368, 1418, 1423, 1589, 1612, 1686, 1813, 1899, 1956, 1978, 2039, 2072, 2104, 2107, 2125, 2159, 2164, 2170, 2188, 2194, 2208, 2312, 2327, 2337, 2399, 2423, 2425, 2446 |
| Chlorpyrifos-methyl | 1259 |
| Chlortetracycline | 1975 |
| Chlorthalidone | 153, 1051 |
| Chlortoluron | 1294, 1368 |
| Chlorzoxazone | 154, 1294, 1333, 1598, 1612, 1686, 2295, 2525 |
| Cholates | 929, 964, 1932, 2400, 2405 |
| Cholecalciferol (Vitamin D3) | 154, 924, 1045, 1049, 1088, 1108, 1161, 1187, 1222, 1229, 1233, 1235, 1238, 1294, 1368, 1400, 1899, 1986, 2098, 2153, 2190, 2276, 2283, 2331, 2361, 2362, 2366, 2371, 2446, 2448, 2458, 2516 |
| Cholera toxin | 1247, 1265, 2183, 2208, 2217, 2446, 2458 |
| Cholest-5-en-3beta,7alpha-diol | 1182 |
| Cholestane-3,5,6-triol | 1215 |
| Cholestanols | 929, 1932, 2312 |
| Cholestyramine | 1916 |
| Cholestyramine Resin | 155 |
| Choline | 964, 1249, 2190, 2276, 2332, 2442 |
| Choline Magnesium Trisalicylate | 155 |
| Cholinesterase inhibitors | 1135, 1687 |
| Cholyl-L-lysyl-fluorescein | 929, 949 |
| Chondroitin sulfates | 1215, 2458, 2519 |
| CHOP protocol | 2305 |
| Choriogonadotropin Alpha | 156 |
| Chorionic Gonadotropin (Human) | 156, 990 |
| Chromans | 1097, 1187, 2039, 2045 |
| Chromene amides from Amyris plumieri | 1283, 1309 |
| Chromium | 817, 1024, 1043, 1108, 1215, 1241, 1257, 1283, 1294, 2050, 2083, 2147, 2204, 2217, 2222, 2247, 2249, 2276, 2300, 2308, 2423, 2458, 2480 |
| Chromium alloys | 2194, 2212, 2213, 2458, |
| Chromium hexavalent ion | 1040, 1215, 1295, 2053, 2078, 2208, 2242, 2308, 2430, 2519 |
| Chromium oxide | 1215, 1241, 2032, 2078, 2279, 2379, 2467 |
| Chromous chloride | 1116, 1215, 1241, 2032, 2279, 2379, 2467 |
| Chryosoidine | 2349 |
| Chrysamine G | 1169, 1182 |
| Chrysene | 926, 943, 962, 1187, 1295, 1333, 1346, 2022, 2039, 2111, 2308, 2432, 2433, 2434 |
| Chrysin | 962, 1004, 1024, 1286, 1295, 1309, 1742, 1958, 1978, 2013, 2072, 2177, 2208, 2371, 2432, 2436, 2472, 2490, 2513 |
| Chrysin derivatives | 1956 |
| Chrysoeriol | 943, 1338, 1342 |
| Chuanxiong rhizome | 1135 |
| CI-1033 | 2019, 2519 |
| CI-1034 | 1547, 1687 |
| Cibacron Blue F 3GA | 2111, 2472 |
| Cibenzoline (Cifenline) | 1456, 1687 |
| Cicaprost | 1222, 1233, 1235, 1265, 2376 |
| Cichorium intybus L. (See Chicory root) | 1309 |
| Ciclesonide | 157, 1687, 2317 |
| Ciclopirox | 157, 2266 |
| Cidofovir | 158, 2408 |
| Cifenline (See Cibenzoline) | 1456, 1687 |
| Ciglitazone | 1083, 1242, 2183, 2208, 2317, 2344, 2346, 2371 |
| Cilazapril | 158, 1031 |
| Cilengitide | 2227 |
| Cilnidipine | 2446 |
| Cilomilast | 2194, 2204, 2208 |
| Cilostazol | 159, 817, 851, 990, 1135, 1154, 1247, 1265, 1408, 1456, 1616, 1687, 2204, 2458 |
| Cimetidine | 160, 927, 1024, 1456, 1589, 1688, 1899, 2154, 2155, 2410, 2411, 2458 |
| Cimicifuga extract BNO 1055 | 1261 |
| Cimicifuga racemosa (See Black cohosh) | 1491, 1670 |
| Cinacalcet | 161, 1456 |
| Cinacalcet hydrochloride | 1569, 1688 |
| Cinchocaine (See Dibucaine) | 221 |
| Cineole | 1899 |
| Cinitapride | 1688 |
| Cinnamates | 2328 |
| Cinnamic acid | 1333, 1355, 1377, 1400, 1423, 1589, 1612, 1899, 2300, 2493 |
| Cinnamic aldehyde | 943, 1215, 2072, 2117, 2194, 2308, 2371, 2446 |
| Cinnamomum burmani (Cinnamic aldehyde cyclic syringylglycerol 1,3-acetal; 5′-Hydroxy-5-hydroxymethyl-4”,5”-methylenedioxy-1,2,3,4-dibenzo-1,3,5-cycloheptatriene) | 1688 |
| Cinnamon bark | 1396, 1492 |
| Cinnarizine | 161 |
| Ciprofibrate | 964, 1215, 1295, 1333, 1612, 1741, 2106, 2111, 2117, 2194, 2220, 2308, 2340, 2385, 2400, 2418, 2458 |
| Ciprofibrate-Coenzyme A | 2106 |
| Ciprofloxacin | 162, 1309, 1333, 1556, 1688, 1743, 2183, 2204, 2410, 2446 |
| cis-1R-(4′-pyrrolidinoethoxyphenyl)-2S-phenyl-6-hydroxy-1,2,3,4-tetrahydronaphthalene, tartrate salt | 1187, 2045, 2250, 2276 |
| cis-9, trans-11-Conjugated linoleic acid | 2068, 2458 |
| Cisapride | 163, 1456, 1688, 1899, 2235 |
| Cisatracurium | 164 |
| cis-bis(3-Aminoflavone)dichloroplatinum (II) | 2472 |
| cis-Permethrin | 1838 |
| Cisplatin | 164, 812, 851, 927, 935, 943, 949, 962, 964, 967, 1004, 1044, 1193, 1209, 1215, 1243, 1395, 1400, 1593, 1598, 1899, 1995, 2014, 2017, 2019, 2026, 2029, 2031, 2032, 2072, 2084, 2106, 2111, 2112, 2115, 2117, 2121, 2177, 2194, 2208, 2227, 2272, 2278, 2279, 2303, 2312, 2352, 2366, 2371, 2376, 2379, 2404, 2407, 2423, 2425, 2432, 2433, 2442, 2446, 2458, 2465, 2467, 2471, 2472, 2480, 2483, 2490, 2493, 2519, 2526, 2528 |
| cis-Terpenones | 1690 |
| Citalopram | 165, 851, 935, 1263, 1265, 1333, 1409, 1423, 1443, 1456, 1482, 1497, 1502, 1555, 1569, 1583, 1589, 1690, 1899, 2094, 2096, 2163, 2322, 2398, 2475, 2476 |
| Citicoline (CDP-Choline) | 166, 1134 |
| Citral | 943 |
| Citric acid | 2442 |
| Citrus fruit extracts | 1690 |
| Citrus phytochemicals (auraptene, nobiletin, citral, citronellal, limonene, limonin, and synephrine) | 935 |
| Citrus unshiu (Satsuma mandarin) | 1490 |
| CJ-036878 (N-(3-phenethoxybenzyl)-4-hydroxybenzamide) | 1690 |
| CJ-13610 | 1111, 1691, 2208 |
| CJX1 cpd | 927 |
| CJY compound | 927 |
| CJZ3 | 851 |
| CL316243 | 1082 |
| Cladribine | 167, 2458 |
| Clarithromycin | 167, 852, 885, 1691, 1899, 2184, 2204, 2229 |
| Class III antiarrhythmic drugs | 1691 |
| Clasto-lactacystin beta-lactone | 2117 |
| Clazosentan | 2014 |
| Clemastine | 168, 1457 |
| Clenbuterol | 1080, 1295, 1333, 2458 |
| Clerodane-type diterpenoid from Sindora sumatrana | 852 |
| Clevidipine | 1691 |
| Clindamycin | 169, 1691 |
| Clioquinol | 1169, 1182, 1187, 2171, 2276, 2278, 2349, 2519 |
| Clobazam | 170, 1409, 1691 |
| Clobenpropit | 1080, 2155 |
| Clobetasol | 170, 943 |
| Clocortolone | 171 |
| Clodronate | 171 |
| Clodronic acid | 2177, 2184 |
| Clofarabine | 172, 1004 |
| Clofenapate | 1042, 2272 |
| Clofibrate | 812, 964, 979, 1042, 1097, 1215, 1218, 1243, 1295, 1741, 1978, 2022, 2061, 2066, 2121, 2147, 2177, 2250, 2253, 2282, 2298, 2312, 2314, 2340, 2382, 2385, 2418, 2446, 2525 |
| Clofibric acid | 812, 929, 962, 964, 979, 996, 1042, 1083, 1088, 1093, 1097, 1103, 1182, 1192, 1220, 1222, 1236, 1241, 1242, 1261, 1270, 1333, 1355, 1377, 1400, 1899, 1911, 1990, 1993, 1995, 1996, 2050, 2066, 2068, 2112, 2188, 2224, 2237, 2249, 2256, 2257, 2272, 2312, 2332, 2335, 2337, 2340, 2347, 2376, 2385, 2400, 2413, 2418, 2423, 2436, 2490, 2493, 2513, 2521, 2525 |
| Clomifene (See Clomiphene) | 172, 1187, 1457, 1692, 2039, 2227 |
| Clomiphene (Clomifene) | 172, 1187, 1457, 1692, 2039, 2227 |
| Clomipramine | 173, 1409, 1443, 1457, 1482, 1502, 1551, 1558, 1579, 1692, 2053, 2117, 2398 |
| Clonazepam | 174, 1306, 2294 |
| Clonidine | 175, 1066, 1067, 1068, 1247, 1457, 1478, 1555, 2072, 2092, 2184, 2194, 2200, 2217, 2458 |
| Clopidogrel | 175, 852, 1265, 1310, 1360, 1367, 1383, 1409, 1457, 1692, 2176, 2177, 2325, 2366, 2446 |
| Cloprostenol | 2237, 2245, 2519 |
| Clorazepate | 176, 1532 |
| Clorgyline | 1019, 2415 |
| Clorsulon | 840 |
| Closantel | 840 |
| Clothianidin | 1803 |
| Clotrimazole | 177, 927, 943, 962, 1295, 1333, 1368, 1377, 1612, 1899, 1932, 1956, 1978, 2150, 2311, 2312, 2314, 2317, 2432, 2490 |
| Cloxacillin | 178, 929 |
| Clozapine | 178, 1117, 1120, 1121, 1310, 1327, 1333, 1457, 1478, 1482, 1523, 1532, 1550, 1556, 1558, 1589, 1694, 1899, 2000, 2003, 2005, 2009, 2053, 2092, 2101, 2154, 2163, 2165, 2167, 2170, 2318, 2380, 2455, 2494 |
| (-)-Clusin | 1791 |
| CM108 | 1917 |
| CMF regimen | 2019, 2026 |
| CMV423 (2-chloro 3-pyridine 3-yl 5,6,7,8-tetrahydroindolizine I-carboxamide) | 1695 |
| CNI 1493 | 2371 |
| Cnidiadin | 927 |
| Coal Tar | 179, 1295, 1333, 1346, 1404, 2308, 2371 |
| Cobalamin | 935 |
| Cobalt | 979, 1080, 1193, 2072, 2106, 2190, 2458 |
| Cobaltiprotoporphyrin | 2184, 2208, 2217, 2458 |
| Cobaltous chloride | 1215, 1222, 1355, 2013, 2177, 2184, 2188, 2194, 2208, 2225, 2227, 2371, 2446, 2519 |
| Cocaethylene | 1007, 1242 |
| Cocaine | 179, 1007, 1195, 1242, 1383, 1458, 2072, 2270, 2465, 2467 |
| Cocoa butter and safflower oil | 1917 |
| Codeine | 180, 1458, 1502, 1569, 1589, 1695, 1899 |
| Coenzyme Q10 | 2420 |
| Coffee (caffeic acid and ferulic acid) | 990, 1283, 1310, 1333, 2106, 2308 |
| Colchiceine | 1695 |
| Colchicine | 181, 852, 927, 929, 943, 964, 1695, 1899, 1917, 2266, 2317, 2446, 2472 |
| Colesevelam | 182, 1270, 1917 |
| Colestipol | 182 |
| Colistimethate | 183 |
| Colistin | 853 |
| Collagen Hemostat | 183 |
| Collagenase | 183 |
| Colominic acid | 1696 |
| Coloring agents | 2241 |
| Colupulone | 1696 |
| Combretastatin-A4 (Combretum caffrum) | 854 |
| Combretum caffrum (See Combretastatin-A4) | 854 |
| Compactin | 1899, 2147 |
| Compound 26 (C26)(1-[4-(vinyl) phenyl]-4-[4-(diphenyl-hydroxymethyl)-piperidinyl]-butanone hydrochloride) | 1616 |
| Compound A (N-[2R-hydroxy-1S-indanyl-5-[2S-(1,1-dimethylethylaminocarbonyl)-4-[(furo[2,3-b]pyridin-5-yl)-methyl]piperazin-1-yl]-4S-hydroxy-2R-phenylmethylpentanamide) | 1698 |
| Compound S4 [S-3-(4-acetylamino-phenoxy)-2-hydroxy-2-methyl-N-(4-nitro-3-trifluoromethyl-phenyl)-propionamide] | 1698 |
| Conazole antifungals | 1383, 1699 |
| Conazoles (Azole fungicides) | 1383, 1699 |
| Concanavalin A | 854 |
| Conestat Alpha | 184 |
| Congo red | 1182 |
| Conivaptan | 184, 1699 |
| Conjugated estrogens | 1034, 1270, 2039, 2045, 2051, 2086, 2184, 2188, 2200, 2300, 2472, 2516 |
| Conjugated linoleic acid isomers | 991, 2344, 2472 |
| Cooked meat carcinogens (2-amino-3,8-dimethylimidazo[4,5-f]quinoxaline and 2-amino-1-methyl-6-phenylimidazo[4,5-b]pyridine) | 1311 |
| Copolymer 1 | 2204, 2217 |
| Copper | 1040, 1080, 1100, 1119, 1170, 1182, 1187, 1193, 1215, 1250, 2072, 2078, 2217, 2276, 2278, 2352, 2420, 2423, 2425, 2458, 2472, 2479, 2519 |
| Copper histidine | 2458 |
| Copper N-(2-hydroxyacetophenone) glycinate | 854, 943, 1215, 2111, 2117 |
| Copper sulfate | 1040, 1215, 2337, 2352, 2479 |
| Coproporphyrins | 949 |
| Coptis chinensis | 1176 |
| Coptisine | 844, 854, 904, 1491 |
| Corbicula fluminea | 1917 |
| Corifollitropin Alpha | 185 |
| Corilagin | 2458 |
| Coriolus versicolor (See I’m-Yunity) | 1766 |
| Corn oil | 1103, 1222, 1932, 2054, 2061, 2147, 2371, 2386, 2483 |
| Cornuside | 1599 |
| Corticoids | 854 |
| Corticorelin | 185 |
| Corticosteroids | 854, 1274 |
| Corticosterone | 812, 1024, 1034, 1080, 1187, 1222, 1233, 1236, 1241, 1943, 2066, 2098, 2164, 2188, 2306, 2312, 2317, 2323, 2366, 2371, 2382, 2432, 2446, 2519 |
| Corticotropin | 185 |
| Corticotropin-releasing hormone | 1267 |
| Cortisol | 854, 1700 |
| Cortisone | 186, 2317 |
| Cortivazol | 2317 |
| Cortodoxone | 1943, 2317 |
| Corydaline | 1383, 1411, 2487 |
| Corydalis yanhusuo (protoberberine) | 1957 |
| Corydine | 1363, 1539, 1826 |
| Corynoline | 1384 |
| Cosyntropin (Tetracosactide) | 187 |
| Cotinine | 1333, 1355, 1368, 2495 |
| Cotrimoxazole | 1384, 2255 |
| Cotylenin A | 1111, 2366 |
| Coumadin (R/S-Warfarin) | 1700, 2487 |
| Coumaran | 1333 |
| Coumarin | 929, 964, 1103, 1111, 1190, 1218, 1339, 1351, 1355, 1400, 1932, 2066, 2106, 2121, 2147, 2194, 2208, 2308, 2413, 2436, 2458, 2521 |
| Coumarins | 2039, 2521 |
| Coumestrol | 1187, 1222, 1700, 2039, 2045, 2200 |
| COX-2 inhibitors | 1170, 1207, 1510 |
| CP-31398 | 2072, 2472 |
| CP-55244 | 1259 |
| CP-105696 | 2208 |
| CP-122721 | 1700 |
| CP-195543 | 1701 |
| CP-533536 | 1701 |
| CP-654577 | 2376 |
| CP-673451 | 2331 |
| C-Phycocyanin | 855 |
| CPS 11 | 2430 |
| CPS 49 | 2208, 2430, 2519 |
| CPX (8-Cyclopentyl-1,3-dipropylxanthene) | 1247 |
| CQA 206-291 | 1701, 1899 |
| CR3294 | 2371 |
| CRA1000 | 1267 |
| Crampbark (Viburnum opulus) | 1287, 1317, 1415, 1490, 1759 |
| Cranberry juice | 1384, 1701 |
| Crataegus oxyacantha L (See Hawthorn) | 355 |
| Cremophor EL | 855, 1371, 1393 |
| Cremophor RH 40 | 1393 |
| Crocidolite asbestos | 927, 1067, 1080, 1097, 1200, 1207, 1215, 1261, 1265, 2019, 2072, 2078, 2154, 2188, 2194, 2208, 2217, 2242, 2270, 2304, 2341, 2346, 2371, 2376, 2380, 2381, 2418, 2423, 2425, 2446, 2458, 2472, 2520 |
| Cromolyn | 187 |
| Crossostephium chinense-related flavonoids | 855 |
| Crotalid venoms | 1250, 1251, 1252 |
| Crotamiton | 188 |
| Cruciferous and apiaceous vegetables | 1311 |
| Crufomate | 1040 |
| CRx-102 (dipyridamole+prednisolone) | 1701 |
| Cryptotanshinone | 916, 1330, 1714, 1723 |
| Cryptoxanthin | 1261 |
| CT52923 | 2238, 2330, 2331 |
| Cumene hydroperoxide | 1215, 1612, 2078, 2106, 2111, 2117, 2121, 2331, 2446 |
| Cupric chloride | 1193, 1215, 2352, 2420 |
| Cuprizone | 2458 |
| Cuprous chloride | 2308 |
| Curcuma aromatica Salisb | 1384 |
| Curcuma comosa Roxb | 1599 |
| Curcumenol | 1701 |
| Curcumin (Curcuma longa) | 858, 927, 935, 943, 949, 962, 996, 1024, 1034, 1050, 1095, 1097, 1114, 1170, 1176, 1182, 1187, 1216, 1222, 1231, 1236, 1241, 1238, 1247, 1261, 1272, 1284, 1295, 1333, 1346, 1400, 1490, 1599, 1612, 1701, 1899, 1917, 2019, 2026, 2039, 2072, 2078, 2104, 2117, 2179, 2180, 2184, 2188, 2190, 2194, 2200, 2208, 2212, 2245, 2256, 2272, 2276, 2300, 2308, 2312, 2331, 2344, 2371, 2376, 2414, 2423, 2430, 2442, 2446, 2448, 2451, 2453, 2458, 2465, 2467, 2472, 2513, 2519, 2525 |
| Curcumin analogs | 1702 |
| Curcumin and curcuminoids | 855, 1702 |
| CX 659S | 2204 |
| Cyamemazine | 1702 |
| Cyanamide | 2072 |
| Cyanazine | 1040, 1067, 2002, 2039 |
| Cyanides | 1216 |
| Cyanidin | 839, 855, 1001, 2300, 2430 |
| Cyanidin-3,5-diglucoside | 1001 |
| Cyanidin-3-galactoside | 1001 |
| Cyanidin-3-glucoside | 839, 1001 |
| Cyanidin-3-O-beta-glucoside | 1138 |
| Cyanidin-3-rutinoside | 839, 1001 |
| Cyanocobalamin (Vitamin B12) | 188, 1270, 2210, 2291 |
| Cyanoginosin LR | 962, 1216, 1218, 1219, 1222, 1333, 2104, 2107, 2111, 2308, 2330, 2400, 2410, 2423 |
| Cyanophenphos | 2040, 2045 |
| Cyanophos | 1187 |
| Cyanopindolol | 1082, 2161 |
| Cyanuric acid diets | 954 |
| Cyclamates | 2479 |
| Cyclic prodrugs of opioid peptides | 1702 |
| Cyclizine | 189, 1459 |
| cyclo(Trp-Asp-Pro-Val-Leu) | 2013, 2014, 2247, 2278, 2306, 2458 |
| Cyclobarbital | 1333 |
| Cyclobenzaprine | 189, 1459, 1478, 1702 |
| Cyclodextrins | 1333, 1400, 1423, 1589, 1702, 1899 |
| Cyclohexanols | 1053, 1612, 2117 |
| Cycloheximide | 964, 1095, 1097, 1207, 1209, 1222, 1233, 1261, 1295, 1612, 1978, 2019, 2026, 2028, 2072, 2177, 2179, 2180, 2184, 2188, 2208, 2247, 2308, 2371, 2379, 2458, 2472, 2480, 2483, 2490, 2513 |
| Cyclooxygenase (COX) inhibitors | 1547, 1807 |
| Cyclopentenone | 2376 |
| Cyclopentolate | 190 |
| Cyclophilin A | 1138 |
| Cyclophosphamide | 190, 856, 927, 943, 950, 968, 1005, 1024, 1101, 1103, 1106, 1107, 1108, 1161, 1216, 1229, 1267, 1346, 1360, 1368, 1400, 1411, 1423, 1460, 1685, 1702, 1815, 1899, 2019, 2025, 2026, 2028, 2029, 2032, 2040, 2045, 2072, 2106, 2115, 2117, 2177, 2184, 2194, 2198, 2200, 2204, 2208, 2217, 2220, 2259, 2266, 2272, 2274, 2278, 2279, 2308, 2311, 2371, 2382, 2422, 2423, 2446, 2458, 2472, 2513 |
| Cyclopiazonic acid | 1799 |
| Cyclopropapyrroloindole | 2458 |
| Cyclopropylbenzene | 1883 |
| CycloProvera | 2051, 2353 |
| Cycloserine | 191 |
| Cyclosporine | 191, 878, 927, 929, 943, 950, 962, 964, 996, 1005, 1024, 1207, 1274, 1460, 1599, 1899, 2013, 2019, 2184, 2188, 2194, 2200, 2204, 2217, 2220, 2311, 2317, 2371, 2382, 2419, 2420, 2446, 2448, 2458, 2519 |
| Cyclosporine A (Ciclosporin) | 854, 856, 929, 1703, 1937, 1982 |
| Cyclosporine G | 1704 |
| Cyclosporins | 943, 1024, 2317 |
| Cyfluthrin | 1187, 1197, 1899, 2040, 2208, 2312, 2386, 2387 |
| Cyhalothrin | 1295, 1899, 2040, 2045, 2312 |
| Cylindrospermopsin | 1284 |
| CYP inhibitors | 1312, 1384, 1712 |
| Cypermethrin | 1040, 1116, 1119, 1161, 1187, 1216, 1242, 1243, 1365, 1599, 1838, 1899, 1978, 2002, 2040, 2072, 2259, 2266, 2312, 2314, 2387 |
| Cyprinid fish | 856 |
| Cyproheptadine | 192, 1482, 2154, 2494 |
| Cyproterone | 193, 2037 |
| Cyproterone acetate | 1187, 1228, 1229, 1270, 1899, 2188, 2312, 2317 |
| Cystamine | 1261 |
| Cysteamine (Mercaptamine) | 194, 2066, 2067 |
| Cysteine | 194, 1222, 1712, 2111, 2117, 2331, 2376, 2446 |
| Cytarabine | 194, 856, 927, 943, 1229, 1713, 1987, 1988, 2111, 2288, 2420, 2451, 2472, 2477, 2480, 2516 |
| Cytisine | 922, 2184, 2439, 2458 |
| Cytochalasin D | 2212, 2213 |
| Cytomegalovirus Immune Globulin (Intravenous-Human) | 195 |
| Cytotoxic drugs | 2017 |
| Cytotoxins | 2180, 2220 |
| D | |
| D,D-T80-prallethrin | 2040 |
| D,L-threo-1-phenyl-2-decanoylamino-3-morpholino-1-propanol and tetrandrine | 859 |
| D0870 | 1713 |
| D-65476 | 2064 |
| DA-8159 | 1714 |
| Dabequin | 2472 |
| Dabigatran | 196, 857, 895, 1714, 1812 |
| Dacarbazine | 196, 1295, 1312, 1333, 2179, 2184, 2208, 2224, 2272, 2273, 2279, 2458, 2519 |
| Daclizumab | 197 |
| Dactinomycin | 197, 927, 943, 962, 1034, 1116, 1222, 1242, 1295, 1346, 1612, 1899, 2019, 2072, 2078, 2117, 2179, 2180, 2184, 2194, 2208, 2217, 2224, 2247, 2257, 2312, 2371, 2430, 2446, 2458, 2472, 2513, 2519 |
| Dahuang zhechong pill | 2446 |
| Daidzein | 824, 858, 943, 971, 1012, 1097, 1187, 1207, 1216, 1222, 1233, 1265, 1270, 1346, 1714, 1978, 2013, 2040, 2045, 2072, 2156, 2177, 2194, 2204, 2208, 2225, 2300, 2312, 2371, 2434, 2490, 2513 |
| Dalcetrapib | 1312, 1714, 1942 |
| Dalfampridine (4-Aminopyridine) | 198, 2295 |
| Dalteparin | 198, 1261, 2446 |
| Danaparoid | 199 |
| Danazol | 200, 1187, 2208, 2217, 2458 |
| Dandelion | 1599 |
| Danggui | 1312 |
| Danofloxacin | 1005 |
| Danshen (radix Salvia miltiorrhiza) | 857, 1176, 1327, 1330, 1490, 1723 |
| Danshen extract components (Danshensu, Protocatechuic aldehyde, Protocatechuic acid, Salvianolic acid B, Tanshinone I, Tanshinone IIA, Cryptotanshinone) | 1714 |
| Danshensu (3,4-dihydroxyphenyllactic acid) | 1384, 1714 |
| Dantrolene | 200, 2013 |
| Danusertib (Aurora kinase inhibitor) | 857 |
| Danusertib (PHA-739358) | 1005 |
| Dapagliflozin (BMS-512148) | 857 |
| Dapsone | 201, 962, 1240, 1295, 1333, 1346, 1361, 1400, 1403, 1404, 1423, 1589, 1612, 1622, 1714, 1899, 1906, 2295, 2423 |
| Daptomycin | 201 |
| Darbepoetin Alpha | 202 |
| Darifenacin | 202, 1251, 1252, 1460 |
| Darunavir | 203, 1005, 1714 |
| Darusentan | 864 |
| Dasatinib | 204, 1026, 1196, 1460, 1715, 2068, 2238 |
| Daunorubicin (Hydrochloride) | 204, 857, 927, 929, 943, 1216, 1218, 1295, 1333, 1339, 2019, 2111, 2266, 2412, 2438, 2480, 2487, 2516 |
| DB289 [2,5-bis(4-amidinophenyl)furan-bis-O-methylamidoxime] | 1617 |
| DBM-819 | 1715 |
| DDOH | 2040 |
| DDT (2,2-bis(p-chlorophenyl)-1,1,1-trichloroethane) | 927, 1038, 1040, 1080, 1097, 1187, 1216, 1247, 1295, 1312, 1346, 1368, 1612, 1715, 1899, 2040, 2045, 2072, 2075, 2078, 2156, 2194, 2200, 2204, 2312, 2314, 2423, 2446, 2458, 2465 |
| DE-71 | 1977 |
| Deacylcortivazol | 2317 |
| Deamino arginine vasopressin | 1247 |
| Debrisoquine | 1295, 1461, 1589 |
| Decabromodiphenyl ether (BDE-209) | 1097, 1295, 1312, 1333, 2312 |
| Decamethrin | 1040, 1187, 1899, 2002, 2040, 2312, 2397 |
| Decan-4-olide | 1333, 2338 |
| Decanaldehyde | 1106 |
| Decanoic acid | 1612, 2493 |
| Dechloroethylcyclophosphamide | 1368, 1899 |
| Dechloroethylifosfamide | 1368 |
| Decitabine | 205, 1231, 1241, 1987, 1995, 2019, 2072, 2082, 2107, 2152, 2177, 2180, 2184, 2190, 2200, 2211, 2272, 2274, 2276, 2279, 2300, 2308, 2320, 2376, 2380, 2394, 2413, 2420, 2423, 2425, 2442, 2446, 2450, 2451, 2468, 2472 |
| DEET (N,N-diethyl-m-toluamide) | 1038, 1040, 1196, 1249, 1251, 1333, 1355, 1368, 1423, 1589, 1612, 1715, 1805, 1899 |
| Deferasirox | 205, 950, 1233, 1372, 1715 |
| Deferiprone | 2458 |
| Deferoxamine | 206, 1222, 1233, 1261, 2331, 2376, 2395, 2446, 2458, 2472, 2519 |
| Degarelix | 207, 1312, 1461 |
| Deglycosylated ginsenosides | 1284 |
| Deguelin | 1222, 1236, 2072, 2177, 2333, 2376, 2430 |
| Dehydroepiandrosterone (DHEA) | 1042, 1043, 1187, 1222, 1241, 1250, 1252, 1715, 1899, 1918, 1978, 2013, 2040, 2045, 2121, 2156, 2317, 2323, 2423, 2472, 2525 |
| Dehydroepiandrosterone sulfate (DHEAS) | 1384, 2040, 2410 |
| Dehydroleucodine | 1957 |
| Dehydroxymethylepoxyquinomicin | 2459 |
| Delapril | 1242, 1243 |
| Delavirdine | 207, 1400, 1423, 1461, 1552, 1715 |
| Delphinidin | 839, 1001, 2300 |
| delta(4)-Tibolone | 2520 |
| delta(5,6)delta(12,13)-Jatrophane diterpenes | 1024 |
| delta(9)-Tetrahydrocannabinol (THC) | 1007, 1325, 1400 |
| delta8(14)-15-Ketoergostane derivatives | 1986 |
| delta8(14)-15-Ketosterol | 1986 |
| delta-Hexachlorocyclohexane | 1187, 1216, 2040, 2045 |
| Deltamethrin | 1365, 1838 |
| delta-Tocotrienol | 1899, 2312, 2490 |
| delta-Viniferin | 2366 |
| Demeclocycline | 208 |
| Demethoxycurcumin | 943, 950, 962, 2344, 2371, 2459 |
| Demethyleneberberine | 1450 |
| Demeton-S-methyl | 1040 |
| Denatonium benzoate | 2072 |
| Dendrochrysanene | 2217, 2459 |
| Denileukin Diftitox | 208 |
| Denopamine | 1071, 1073 |
| Denosumab | 209, 1958, 1972 |
| Dentinol | 1216, 2371 |
| Deoxycholic acid | 964, 1272, 1899, 1932, 2019, 2111, 2117, 2253, 2314, 2347, 2362, 2404, 2411 |
| Deoxyglucose | 927, 1170, 1182, 2300 |
| Deoxymiroestrol | 1339, 2040 |
| Deoxynivalenol | 1799, 2022, 2072, 2101, 2177, 2179, 2180, 2184, 2194, 2200, 2204, 2208, 2217, 2220, 2446, 2453, 2459 |
| Deoxypodophyllotoxin | 1384, 1716 |
| Deoxyribozyme | 857 |
| Dephostatin | 1027 |
| Depleted uranium | 1918 |
| Depsipeptides | 2393 |
| Deramciclane | 1461, 1716 |
| Derlin-1 | 1006 |
| Dermatan sulfate | 2048, 2519 |
| Dermatophagoides antigens | 2194, 2220, 2459 |
| Desacetyl-diltiazem | 1716 |
| Desethylamiodarone | 1716 |
| Desethylamodiaquine | 1377 |
| Desferioxamine | 857 |
| Desflurane | 209 |
| Desipramine | 209, 857, 1355, 1400, 1423, 1461, 1482, 1533, 1552, 1558, 1567, 1589, 1612, 1899, 2062, 2072, 2159, 2179, 2194, 2317, 2327 |
| Desisobutyrylciclesonide | 2317 |
| Desloratadine | 210, 1461, 1478, 1589, 1716, 1782, 2487, 2492 |
| Desmethoxyyangonin | 1775 |
| Desmethyl-thiamethoxam | 1803 |
| Desmodium gangeticum extract | 1040, 1216, 2147 |
| Desmopressin | 211 |
| Desmos cochinchinensis (hybrid flavan-chalcones, desmosflavan A, desmosflavan B, cardamonin, pinocembrin, and chrysin) | 1958 |
| Desmosdumotin B analogs | 858 |
| Desmosflavan A | 1958 |
| Desmosflavan B | 1958 |
| Desogestrel | 962, 1216, 1270, 1400, 1423, 1716, 2040, 2061, 2153, 2245, 2338, 2513 |
| Desonide | 212 |
| Desoximetasone | 212 |
| Desoxycorticosterone | 1216, 1943, 2317 |
| Desvenlafaxine | 213, 858, 1331, 1412, 1461, 1533, 1716 |
| Dexamethasone | 213, 812, 858, 927, 929, 936, 943, 950, 962, 964, 979, 1006, 1024, 1034, 1042, 1043, 1082, 1085, 1103, 1116, 1119, 1187, 1211, 1216, 1222, 1233, 1242, 1243, 1264, 1272, 1295, 1333, 1346, 1355, 1361, 1368, 1377, 1400, 1404, 1423, 1589, 1612, 1622, 1717, 1899, 1906, 1932, 1978, 1985, 2013, 2019, 2028, 2040, 2048, 2053, 2061, 2062, 2066, 2072, 2086, 2088, 2121, 2139, 2141, 2147, 2150, 2154, 2156, 2176, 2190, 2194, 2198, 2199, 2204, 2208, 2212, 2213, 2217, 2220, 2250, 2259, 2272, 2278, 2300, 2305, 2311, 2312, 2314, 2317, 2344, 2366, 2371, 2385, 2393, 2400, 2401, 2406, 2418, 2423, 2430, 2432, 2433, 2435, 2446, 2449, 2459, 2465, 2487, 2490, 2513, 2516, 2519 |
| Dexamethasone 21-tributylacetate | 1368, 1899, 2312 |
| Dexamethasone acetate | 2312 |
| Dexamethasone oxetanone | 2317 |
| Dexchlorpheniramine | 215 |
| Dexfenfluramine | 1203, 1462 |
| Dexlansoprazole | 215, 1313 |
| Dexloxiglumide | 1717 |
| Dexmedetomidine | 216, 959, 1066, 1067, 1295 |
| Dexmethylphenidate | 216 |
| Dexpanthenol | 217 |
| Dexrazoxane | 217 |
| Dextran | 218 |
| Dextran sodium sulfate | 1301 |
| Dextran sulfate | 1114, 2371 |
| Dextroamphetamine | 218 |
| Dextromethorphan | 219, 1333, 1412, 1423, 1462, 1589, 1612, 1718, 1899, 2295, 2525 |
| Dextropropoxyphene | 1242, 1243, 1718 |
| Dextrorphan | 1589, 1899 |
| Dextrose (D-Glucose) | 219 |
| di-(2-Ethylhexyl)phthalate | 1720, 1937, 1951 |
| Diacetylcurcumin | 2072 |
| Diacetyldichlorofluorescein | 2459 |
| Diacetylene falcarindiol | 1599 |
| Diallyl disulfide | 1231, 1295, 1333, 1612, 2472 |
| Diallyl phthalate | 1187, 1216, 2423 |
| Diallylsulfide | 1599 |
| Diallylsulfone | 1612, 2086 |
| Diallyl trisulfide | 1295, 1333, 1599, 1612 |
| Diamide | 943, 1248, 2423, 2472 |
| Dianicline | 922 |
| Diarctigenin | 2208, 2194, 2459 |
| Diarylalkyl-imidazole and diarylalkyl-triazole derivatives | 1958 |
| Diarylpropionitrile | 2045, 2300 |
| Diazepam | 220, 1259, 1306, 1412, 1423, 1718, 1899, 2072, 2079, 2208, 2459 |
| Diazepinone riboside | 1229 |
| Diazinon | 136, 858, 927, 1040, 1249, 1251, 1289, 1333, 1400, 1423, 1719, 1813, 1899, 2107, 2159, 2164, 2168, 2170, 2184, 2200, 2327, 2338, 2399, 2423, 2425 |
| Diaziquone | 2308, 2266 |
| Diazoxide | 221, 2208, 2217, 2459 |
| Diazoxon | 1259, 2338 |
| Dibenzacridine | 1097 |
| Dibenzo(a,l)pyrene | 927, 1097, 1295, 1333, 1346, 2022, 2106, 2111, 2117 |
| Dibenzofuran | 1333 |
| Dibenzothiazyl disulfide | 2184, 2204 |
| Dibenzoylmethane | 1024, 1219, 1222, 2022, 2040, 2111, 2371, 2442 |
| Dibromoacetic acid | 2040 |
| Dibucaine (Cinchocaine) | 221 |
| Dibutyldichlorotin | 2072, 2423 |
| Dibutylnitrosamine | 1040, 1295, 1612 |
| Dibutylphthalate | 1042, 1062, 1064, 1097, 1187, 1212, 1252, 1259, 1267, 1295, 1346, 1989, 2002, 2040, 2045, 2165, 2180, 2188, 2190, 2245, 2276, 2292, 2312, 2314, 2324, 2359, 2360, 2362, 2363, 2376, 2385, 2393, 2427, 2436, 2439 |
| Dichlobanil | 1355 |
| Dichlofenthion | 1187, 2040, 2045 |
| Dichlorfo-p-methyl | 1216, 2040, 2340 |
| Dichloroacetate | 2190, 2340 |
| Dichlorodiphenyl ethylene | 1963 |
| Dichlorodiphenyldichloroethane | 1187, 2040, 2045, 2238, 2330, 2331 |
| Dichlorodiphenyldichloroethylene | 927, 1097, 1187, 1295, 1346, 1978, 2040, 2045, 2086, 2204, 2238, 2245, 2312, 2314, 2317, 2330, 2331, 2459 |
| Dichloroethylenes | 962 |
| Dichloromethane (Methylene chloride) | 1599, 2119 |
| Dichlororibofuranosylbenzimidazole | 1261, 2208, 2459 |
| Dichlorphenamide | 222 |
| Dichlorvos | 187, 1040, 1170, 1182, 1196, 1216, 1249, 1254, 1256, 1259, 2002, 2184, 2423 |
| Diclofenac | 222, 950, 1006, 1170, 1222, 1372, 1384, 1400, 1403, 1423, 1462, 1583, 1612, 1719, 1899, 2013, 2125, 2194, 2203, 2204, 2215, 2217, 2308, 2311, 2366, 2371, 2394, 2406, 2408, 2410, 2420, 2459, 2472, 2490, 2493, 2495 |
| Dicloxacillin | 223 |
| Dicofol | 1187, 1600, 1978, 2040, 2045, 2180 |
| Dicrotophos | 1040 |
| Dicumarol | 2194, 2308, 2376, 2459, 2472 |
| Dicyclanil | 1042, 1103, 1190, 1216, 1222, 1295, 1333, 1400, 2022, 2106, 2111, 2438, 2490 |
| Dicyclohexyl phthalate | 1187, 1267, 2040, 2045, 2161, 2180, 2362, 2363 |
| Dicyclomine | 224 |
| Didanosine | 224, 2413 |
| Dieldrin | 1187, 1216, 1295, 1333, 1346, 1368, 1899, 2040, 2045, 2168, 2170, 2194, 2208, 2238, 2312, 2314, 2330, 2331, 2397, 2420, 2423, 2446, 2459 |
| Dienestrol | 2040, 2436 |
| Dienogest | 1270, 1958, 2048, 2051, 2061, 2188, 2353, 2459 |
| Diesel | 1284 |
| Diesel exhaust particle extract | 1138, 1313 |
| Dietary calcium | 1918, 2054, 2371, 2516 |
| Dietary carbohydrates | 1346, 2198, 2208, 2217, 2223, 2451, 2465 |
| Dietary cholesterol | 824, 929, 1103, 1932, 2213, 2253, 2312 |
| Dietary cholesterol oxidation products | 1918 |
| Dietary fats | 824, 929, 979, 1024, 1042, 1043, 1044, 1046, 1050, 1058, 1060, 1073, 1082, 1093, 1100, 1108, 1120, 1139, 1161, 1196, 1203, 1212, 1222, 1231, 1233, 1245, 1252, 1259, 1261, 1264, 1267, 1270, 1272, 1273, 1346, 1612, 1906, 1932, 1995, 2053, 2054, 2062, 2066, 2082, 2086, 2101, 2106, 2111, 2147, 2153, 2165, 2188, 2194, 2223, 2233, 2234, 2237, 2250, 2253, 2257, 2278, 2292, 2298, 2302, 2304, 2308, 2314, 2320, 2323, 2340, 2341, 2344, 2346, 2347, 2361, 2365, 2381, 2385, 2420, 2423, 2397, 2402, 2408, 2410, 2418, 2425, 2432, 2446, 2453, 2459, 2465, 2475, 2483, 2490, 2525 |
| Dietary fish protein | 1918 |
| Dietary flavonoids (Acacetin, Diosmetin, Eupatorin, Chrysin, Quercetin, Myricetin) | 1284, 1361, 1720 |
| Dietary ingredients | 858 |
| Dietary iron | 1024, 1193, 2194, 2208, 2259, 2276, 2331, 2446, 2459 |
| Dietary nucleotide supplements | 858 |
| Dietary phosphorus | 1264, 1295, 2188, 2208 |
| Dietary sodium | 1612, 1943, 2111, 2121, 2300, 2377 |
| Dietary sucrose | 2188, 2314 |
| Diethofencarb | 1097 |
| Diethyl maleate | 1042, 1222, 2072, 2104, 2272, 2340 |
| Diethyl phthalate | 1346, 1187, 2040, 2045, 2180 |
| Diethylamine | 2184, 2204 |
| Diethyldithiocarbamate | 1313, 1600 |
| Diethyldithiocarbamate methyl ester (DDTC-Me) | 1720 |
| Diethylhexyl phthalate | 927, 964, 1062, 1064, 1069, 1097, 1187, 1216, 1259, 1295, 1346, 1978, 2006, 2022, 2034, 2040, 2045, 2072, 2125, 2180, 2245, 2308, 2312, 2340, 2341, 2344, 2347, 2360, 2362, 2385, 2393, 2418, 2427, 2437, 2519, 2525 |
| Diethylhexyladipate | 2180 |
| Diethylnitrosamine | 929, 964, 979, 996, 1042, 1088, 1103, 1111, 1170, 1182, 1192, 1216, 1220, 1222, 1233, 1236, 1241, 1242, 1270, 1295, 1318, 1355, 1612, 1911, 1932, 1990, 1993, 1995, 1996, 2022, 2050, 2066, 2068, 2072, 2111, 2117, 2179, 2184, 2188, 2200, 2208, 2237, 2249, 2256, 2257, 2272, 2276, 2295, 2335, 2338, 2347, 2371, 2376, 2385, 2413, 2423, 2425, 2430, 2436, 2446, 2459, 2472, 2480, 2513, 2521, 2525 |
| Diethylpropion | 225 |
| Diethylstilbestrol | 927, 1046, 1060, 1069, 1095, 1097, 1161, 1187, 1190, 1222, 1236, 1248, 1254, 1256, 1261, 1295, 1346, 1372, 1385, 1978, 1995, 2019, 2022, 2026, 2040, 2045, 2066, 2072, 2075, 2082, 2104, 2112, 2156, 2157, 2184, 2188, 2208, 2224, 2237, 2259, 2266, 2272, 2274, 2276, 2305, 2308, 2312, 2376, 2420, 2430, 2436, 2446, 2459, 2480, 2519, 2525 |
| Diethylthiourea | 1612 |
| Difenoconazole | 1978 |
| Diflomotecan | 1006, 1721 |
| Diflorasone | 225 |
| Diflorasone diacetate | 2204, 2208 |
| Diflubenzuron | 1216, 1295, 2312 |
| Diflunisal | 226, 2194, 2208, 2459, 2490, 2493 |
| Difluorinated-curcumin | 1006 |
| Difluprednate | 227 |
| Digestible and non-digestible carbohydrates | 1721 |
| Diglycerides | 1333 |
| Digoxin | 227, 858, 927, 929, 1024, 1547, 1721, 2416 |
| Diheptylphthalate | 2040, 2045 |
| Dihydroalprenolol | 1076, 1080 |
| Dihydrocapsaicin | 1216, 2188 |
| Dihydrocodeine | 1462 |
| (-)-Dihydroclusin | 1791 |
| (-)-Dihydrocubebin | 1791 |
| Dihydroergotamine | 228, 1730, 2160 |
| Dihydroethidine | 2161 |
| Dihydrofluorescein | 929 |
| Dihydrofolate | 2296, 2405 |
| Dihydroisocoumarin (from Xyris pterygoblephara) | 1721 |
| Dihydrokawain | 1775 |
| Dihydromethysticin | 1400, 1423, 1775 |
| Dihydropyridine compounds | 1175 |
| Dihydrotachysterol | 228 |
| Dihydrotanshinone I | 916, 1330 |
| Dihydroxyethyldithiocarbamate | 2072 |
| Dihydroxyphenylalanine | 1182 |
| Dihydro-beta-agarofuran sesquiterpenes from Celastrus vulcanicola | 858 |
| Dihydro-beta-erythroidine | 1254, 1256 |
| Diindolylmethane | 1222 |
| Diisobutylphthalate | 1188, 2040 |
| Diisodecylphthalate | 1097, 2393 |
| Diisopropanolnitrosamine | 2184, 2241, 2200, 2400, 2436, 2438 |
| Diloxanide Furoate | 229 |
| Diltiazem | 229, 848, 1462, 1721, 1899, 2220 |
| Dimaprit | 2072, 2155, 2459 |
| Dimemorfan | 1361, 1462, 1721 |
| Dimenhydrinate | 230 |
| Dimercaprol | 230 |
| Dimethoate | 1040, 1216, 1250, 1251, 1252, 1721, 2040 |
| Dimethoxon | 1040 |
| Dimethyl benzoylphenylurea | 1552, 1721 |
| Dimethyl mercaptosuccinate | 2446 |
| Dimethyl Sulfoxide | 231, 812, 927, 1261, 1295, 1313, 1333, 1346, 1355, 1612, 1722, 1790, 1899, 1943, 1986, 2106, 2111, 2177, 2442, 2459, 2465 |
| Dimethyl-4,4′-dimethoxy-5,6,5′,6′-dimethylenedioxybiphenyl-2,2′-dicarboxylate (DDB) | 1463, 1722 |
| Dimethylarsine | 1191, 2072 |
| Dimethylarsinous acid | 1261, 2227, 2276, 2312 |
| Dimethyldithiocarbamate | 2072 |
| Dimethylformamide | 1295, 1333, 1612, 2111, 2117 |
| Dimethylhistaprodifen | 2154 |
| Dimethylnitrosamine | 812, 927, 985, 1024, 1043, 1088, 1103, 1222, 1236, 1238, 1243, 1261, 1270, 1333, 1355, 1612, 1995, 2022, 2050, 2053, 2066, 2083, 2088, 2104, 2147, 2153, 2177, 2180, 2190, 2194, 2208, 2217, 2222, 2224, 2247, 2270, 2272, 2276, 2300, 2308, 2345, 2376, 2400, 2436, 2438, 2446, 2448, 2459, 2465, 2519, 2525 |
| Dimethyl-W84 | 1251 |
| di-n-Butyl adipate | 1188 |
| di-n-Hexyl phthalate | 1188, 2040, 2045, 2180 |
| Dinitrobenzenesulfonic acid | 2459 |
| Dinitrochlorobenzene | 2053, 2106, 2111, 2117, 2121, 2177, 2184, 2194, 2200, 2204, 2208, 2217, 2220, 2272, 2308, 2423, 2451, 2459 |
| Dinitrofluorobenzene | 2184, 2200, 2204, 2217, 2446 |
| Dinitrophenylhydrazine | 2331 |
| Di-n-octyl phthalate | 1188, 2040, 2045, 2393 |
| Dinoprost | 1978, 2194, 2276, 2410, 2411, 2459 |
| Dinoprostone | 231, 1116, 1182, 1216, 1229, 1261, 1265, 1978, 2013, 2019, 2177, 2184, 2194, 2204, 2217, 2220, 2305, 2323, 2360, 2361, 2366, 2371, 2410, 2411, 2446, 2459 |
| Dinotefuran | 1803 |
| di-n-Pentyl phthalate | 1188, 2040, 2045, 2180, 2245 |
| di-n-Propylphthalate | 2040, 2045 |
| Dinuclear copper(II) complexes with 6-(benzylamino)purine derivatives | 1722 |
| Dioctanoylphosphatidic acid | 2371 |
| Dioctyl adipate | 1188 |
| Dioleoyl ethylene glycol | 1116 |
| Dioscin | 858 |
| Dioscorea nipponica | 1937 |
| Diosgenin | 929, 962, 964, 1222, 1932, 2312, 2371, 2459 |
| Diosmetin | 943, 1372, 1385, 1742 |
| Dioxin (Tetrachlorodibenzo-p-dioxin, Tetrabromodibenzo-p-dioxin) | 1339, 1722 |
| Dioxins | 1095, 1097, 1285, 1295, 1313, 1333, 1899, 1978, 2459 |
| Dioxybenzone | 2040, 2045 |
| Dipeptidyl peptidase IV inhibitors | 859, 1761 |
| Diphenhydramine | 232, 1463, 1510, 1579, 2154 |
| Diphenyl | 1333 |
| Diphenyleneiodonium | 2013, 2019, 2194, 2276, 2303, 2446, 2459 |
| Diphenyliodonium | 2013, 2446 |
| Diphenylpyraline | 2154 |
| Diphenylthiourea | 1285 |
| Diphtheria-tetanus-acellular pertussis vaccines | 2208 |
| Dipiperamides D and E (White pepper)(Piper nigrum) | 1722 |
| Dipivefrin | 233 |
| Dipropyl sulfide | 1612 |
| Dipyridamole | 233, 859, 971, 2328 |
| Dipyrone (Metamizole) | 234, 1789, 2130, 2134, 2140, 2194, 2208, 2366, 2459 |
| Diquat | 1295, 2106, 2111, 2117, 2423 |
| Dirofilaria immitis | 859 |
| Disodium ascorbyl phytostanol phosphate | 1918 |
| Disopyramide | 235, 1071, 1463, 1722, 1899, 2231, 2235 |
| Disorazole C1 and A1 | 859 |
| Disubstituted adamantyl derivatives | 1722 |
| Disulfiram | 235, 859, 1040, 1105, 1106, 1108, 1463, 1600, 1612, 1722, 2086 |
| Ditekiren | 929 |
| Diterpenoid tanshinones (Tanshinone I, Tanshinone AII, Cryptotanshinone) from Danshen (Radix salvia miltiorrhiza) | 1723 |
| Dithiolethiones (3H-1,2-Dithiole-3-thione; 4-Methyl-5-pyrazinyl-3H-1,2-dithiole-3-thione; 5-tert-Butyl-3H-1,2-dithiole-3-thione) | 1313, 1918 |
| Dithionite | 1723 |
| Dithiothreitol | 1191, 1248, 2208, 2317, 2430, 2459, 2472 |
| Ditiocarb | 1108, 1216, 1355, 1423, 1612, 2111, 2177, 2420, 2483 |
| Diuretics | 2093, 2235 |
| Diuron | 1097, 1116, 1188, 1295, 1723, 1978, 2040, 2061, 2125, 2184, 2259, 2280, 2282, 2459 |
| Dizocilpine maleate | 1170, 1182, 1259, 2072 |
| DMU 212 | 2371 |
| DNA methyltransferase inhibitors | 1995 |
| Dobutamine | 236, 1071, 1073, 1076, 2090, 2446 |
| Docetaxel | 236, 860, 927, 943, 950, 962, 977, 1006, 1193, 1231, 1257, 1340, 1346, 1352, 1372, 1463, 1723, 1875, 1899, 1904, 1995, 2026, 2117, 2149, 2208, 2261, 2273, 2294, 2296, 2311, 2333, 2341, 2345, 2347, 2362, 2366, 2371, 2376, 2400, 2416, 2425, 2435, 2472, 2480, 2519 |
| Docosahexaenoic acid (DHA) | 929, 1111, 1119, 1139, 1222, 1236, 1270, 1333, 1400, 1423, 1612, 1899, 1910, 2184, 2194, 2200, 2204, 2208, 2217, 2247, 2338, 2349, 2371, 2376, 2459, 2487 |
| Docosanol | 238 |
| Docusate | 238 |
| Dofequidar fumarate | 936 |
| Dofetilide | 238, 1463, 1724, 2231, 2235 |
| Dolasetron | 239, 1099, 1724, 1855 |
| Domperidone | 239, 861, 1333, 1368, 1377, 1463, 1589, 1724, 1899 |
| Donepezil | 240, 861, 1038, 1139, 1195, 1463, 1724 |
| Dopamine | 241, 1071, 1256, 1265, 2000, 2002, 2072, 2106, 2111, 2117, 2154, 2168, 2259, 2266, 2326, 2397, 2412, 2419, 2420, 2434, 2435, 2446 |
| Dopamine D3 receptor-selective fluorenyl-(NGB 2904 [N-(4-(4-(2,3-dichlorophenyl)piperazin-1-yl)butyl)-9H-fluorene-2-carboxamide] fumarate; JJC 4-077 [N-(4-(4-(2,3-dichlorophenyl) piperazin-1-yl)-3-hydroxybutyl)-9H-fluorene-2-carboxamide hydrochloride]); 2-yridylphenyl amides (CJB 090 [N-(4-(4-(2,3-dichlorophenyl)piperazin-1-yl)butyl)-4-(pyridine-2-yl)benzamide hydrochloride]; PG 01037 [N-(4-(4-(2,3-dichlorophenyl)piperazin-1-yl)-trans-but-2-enyl)-4-(pyridine-2-yl)benzamide hydrochloride]) | 861 |
| Dopamine receptor agonists (Bromocriptine, Pergolide, Pramipexole, Ropinirole) | 1724 |
| Dopaminergic agonists | 1464 |
| Dopaminergic ergot derivatives (Lisuride, Terguride) | 1725 |
| Doramectin | 842, 861, 880 |
| Doripenem | 241 |
| Dornase Alpha | 242 |
| Dorzolamide | 242 |
| Doxacurium | 243 |
| Doxapram | 244 |
| Doxazosin | 244, 861, 1051, 1063, 1064, 1067, 2305, 2376, 2519 |
| Doxepin | 245, 861, 927, 1385, 1412, 1464, 1725, 2117 |
| Doxercalciferol | 246, 861, 1918 |
| Doxifluridine | 1995, 2179, 2184, 2222, 2382, 2459, 2480 |
| Doxorubicin | 246, 861, 927, 936, 943, 951, 962, 964, 1006, 1024, 1071, 1073, 1076, 1080, 1111, 1116, 1170, 1182, 1207, 1209, 1216, 1218, 1222, 1231, 1233, 1236, 1241, 1242, 1243, 1248, 1259, 1285, 1295, 1313, 1333, 1340, 1361, 1368, 1600, 1617, 1725, 1993, 2013, 2019, 2022, 2023, 2026, 2028, 2040, 2045, 2051, 2062, 2072, 2078, 2083, 2091, 2101, 2106, 2111, 2115, 2117, 2129, 2149, 2179, 2184, 2188, 2194, 2200, 2208, 2232, 2266, 2270, 2272, 2273, 2276, 2283, 2291, 2300, 2303, 2305, 2311, 2340, 2341, 2352, 2353, 2366, 2371, 2376, 2392, 2393, 2411, 2412, 2422, 2423, 2430, 2432, 2442, 2446, 2449, 2451, 2452, 2459, 2465, 2467, 2471, 2472, 2481, 2516, 2519 |
| Doxycycline | 248, 927, 1139, 1727, 2194, 2276, 2278, 2408, 2410, 2411 |
| Doxylamine | 248 |
| DP155 | 1171, 2371 |
| DPC681 | 1725 |
| DPC963 | 1725 |
| D-penicillamine (2,5)-Enkephalin | 962 |
| DPP4 inhibitors | 1993 |
| DPPE | 1516 |
| Dracorhodin | 2473 |
| DRF-4367 | 1464 |
| Dronabinol | 249, 1263 |
| Dronedarone | 249, 862, 1385, 1510, 1725 |
| Droperidol | 250, 1478, 1725 |
| Drospirenone | 1188, 2317 |
| Drotrecogin Alpha | 251, 2049 |
| Duloxetine | 251, 862, 1313, 1362, 1464, 1533, 1958 |
| DuP 697 | 2371 |
| Duroquinone | 2308 |
| Dust | 1106, 1216, 1229, 1236, 1264, 1295, 1346, 2022, 2073, 2104, 2177, 2184, 2208, 2217, 2220, 2272, 2308, 2345, 2371, 2385, 2423, 2465, 2467, 2473, 2519 |
| Dutasteride | 252, 1188, 1222, 1943, 2026, 2156, 2427, 2513 |
| DY131 | 1958 |
| DY-9760e | 1725 |
| Dyclonine | 253 |
| Dydrogesterone | 2184, 2204, 2217 |
| Dynorphins | 2323 |
| Dyphylline | 253 |
| Dysadherin | 862 |
| D-alpha-Tocopheryl polyethylene glycol succinate | 1393 |
| E | |
| (E)-2-(2-Substituted benzylidene)-and 2-(2-substituted benzyl)-6-methoxy-tetralones | 1983 |
| (E)-3-(Pyridin-2-ylethynyl)cyclohex-2-enone O-2-(2-18F-fluoroethoxy)ethyl oxime | 862 |
| (E)-4-((2-N-(4-Methoxybenzenesulfonyl)amino)stilbazole)1-oxide | 2442 |
| E2101 | 1726 |
| E3040 | 962, 1024 |
| E3330 | 2317 |
| E-4-((2-N-(4-methoxybenzenesulfonyl)amino)stilbazole)1-oxide | 2519 |
| E6201 | 1313 |
| E7070 | 1726 |
| Ebastine | 254, 862, 1617, 1726 |
| Ebrotidine | 2155 |
| Ebselen | 1111, 2073, 2106, 2111, 2117, 2184, 2300, 2308, 2366, 2446 |
| Ecallantide | 254 |
| Ecdysterone | 2473 |
| Echinacea (Echinacea purpurea (L) Moench) | 255, 863, 1314, 1385, 1490, 1726 |
| Echinacea purpurea (L) Moench (See Echinacea) | 255, 863, 1314, 1385, 1490, 1726 |
| Echinocandin antifungal drugs | 863 |
| Echis carinatus snake venom | 1285 |
| Echothiophate Iodide | 255, 1040, 1196 |
| Econazole | 256, 1383, 1612, 1899 |
| Ecstasy (3,4-Methylenedioxy-methamphetamine; MDMA) | 1532, 1600, 1726 |
| Ecteinascidin 743 | 1727 |
| Eculizumab | 256 |
| Edetate Calcium Disodium | 257 |
| Edetic acid | 2479 |
| Edrophonium | 257, 1038, 1040, 1252 |
| Efalizumab | 258 |
| Efavirenz | 258, 863, 936, 1352, 1362, 1368, 1400, 1423, 1727, 1899, 2311 |
| Eflornithine | 259 |
| EGFR tyrosine kinase inhibitors | 863, 1022 |
| Eicosapentaenoic acid (EPA) | 824, 996, 1088, 1119, 1222, 1270, 1333, 1400, 1423, 1612, 1899, 1910, 2054, 2184, 2194, 2200, 2204, 2208, 2217, 2220, 2247, 2365, 2371, 2376, 2446, 2487 |
| Eicosatrienoic acid | 1910 |
| Elacridar (GF120918) | 863, 1007 |
| Elagolix | 1727 |
| Eleostearic acid | 2345, 2473 |
| Eletriptan | 259, 1465, 1728, 2093, 2161 |
| Eleutherosides | 1749 |
| Eliglustat tartrate (Genz-112638) | 1465 |
| Ellagic acid | 1338, 2341, 2425 |
| Ellipticine | 1231, 1285, 1295, 1340, 1728 |
| ELR510444 | 863 |
| Eltrombopag | 260, 1314, 1728 |
| Elvitegravir | 1768 |
| Emblica officinalis Gaertn (Amla) | 1600 |
| Emedastine | 2154 |
| Emetine | 1771, 2266 |
| Emodin | 863, 1097, 1236, 1261, 1295, 1340, 1346, 2117, 2177, 2208, 2266, 2331, 2376, 2446 |
| Empenthrin | 2040 |
| Emtricitabine | 261, 942 |
| ENA actimineral resource A | 1600 |
| Enalapril | 261, 1032, 1034, 1077, 1086, 1090, 2411 |
| Endobiotics | 1728 |
| Endocannabinoids | 2194, 2208 |
| Endocrine disruptors | 1958 |
| Endomorphin 1 | 2323 |
| Endomorphin 2 | 2212, 2323 |
| Endosulfan | 927, 1038, 1040, 1188, 1216, 1261, 1295, 1346, 1362, 1368, 1728, 1899, 1978, 2040, 2045, 2078, 2125, 2147, 2154, 2194, 2208, 2312, 2430, 2442 |
| Endothelial nitric-oxide synthase | 1139, 1618, |
| Endothelin receptor antagonists | 864, 2014 |
| Endothelin-A receptor antagonist ZD4054 | 1728 |
| Endotoxins | 927, 929, 962, 2209, 2312 |
| Endoxifen | 864, 1465, 1729, 1976 |
| Endrin | 1368, 1899, 2040, 2045, 2312, 2345 |
| Enflurane | 2184 |
| Enfuvirtide | 262, 1333, 1423, 1465, 1547, 1552, 1589, 1612, 1729, 1899 |
| Enkephalin, Ala2-MePhe4-Gly5 | 2225, 2323 |
| Enkephalin-Leu, Ala2-melphalan methyl ester | 927, 962 |
| Enniatin and Beauvericin (Fusariotoxins) | 936 |
| Enniatin B | 1314, 1413, 1729 |
| Enoxacin | 1323, 1333, 1482 |
| Enoxaparin | 263, 2058, 2226, 2449 |
| Entacapone | 263, 2493 |
| Entecavir | 264, 864 |
| Enterotoxins | 1248, 2220 |
| Entinostat | 1959 |
| Environmental chemicals | 1465, 1729 |
| Enzastaurin | 864 |
| Enzymatically modified rice starch | 1919 |
| Enzyme inducers | 1465 |
| Eomediol | 1932 |
| EP224283 (idraparinux and tirofiban) | 1140 |
| Eperisone | 1618, 1729 |
| Ephedra | 1314 |
| Ephedrine | 265 |
| Epibatidine | 1254, 1256 |
| Epiberberine | 904, 1491 |
| Epicatechin gallate | 873, 1216, 1264, 1295, 1978, 2423 |
| Epichlorohydrin | 2111 |
| Epidermal growth factor | 1729 |
| Epigallocatechin | 2519 |
| Epigallocatechin gallate | 864, 873, 902, 927, 962, 996, 1024, 1043, 1097, 1222, 1236, 1238, 1241, 1264, 1285, 1295, 1333, 1600, 1607, 1612, 1978, 2017, 2019, 2104, 2106, 2111, 2117, 2157, 2184, 2194, 2200, 2237, 2272, 2274, 2276, 2312, 2317, 2371, 2376, 2423, 2451, 2473, 2511 |
| Epimedii herba | 1492 |
| Epinastine | 265, 1466, 1730, 2154 |
| Epinephrine (Adrenaline) | 266, 1081, 1082, 1171, 1259, 2259, 2434 |
| Epipodophyllotoxins | 1730 |
| Epirubicin | 267, 865, 927, 943, 1024, 1218, 1995, 2019, 2026, 2273, 2307, 2422, 2423 |
| Epitestosterone | 1188, 2040 |
| Eplerenone | 267, 1730, 1937, 2300 |
| Epoetin Alpha | 268 |
| Epoetin Theta | 269 |
| Epomediol | 2147 |
| Epoprostenol | 269, 1086, 1088, 2217, 2364, 2371 |
| Epoxiconazole | 1383 |
| Epoxide hydrolase inhibitors | 1285 |
| Epoxomicin | 2326 |
| Epoxy compounds | 2184 |
| Epoxybergamottin | 1730 |
| Epoxyeicosatrienoic acid | 1372, 1618, 1730 |
| Epoxyeicosatrienoic acid (EET) antagonists (AG494; LY294002; 14,15-epoxyeicosa-5(Z)-enoic acid; 14,15-epoxyeicosa-5(Z)-enoic acid 2-[2-(3-hydroxy-propoxy)-ethoxy]-ethyl ester; 14,15-epoxyeicosa-5(Z)-enoic-methylsulfonylimide; N-methylsulfonyl-6-(2-propargyloxyphenyl)hexanamide) | 1373 |
| Eprinomectin | 885 |
| Eprosartan | 270, 839, 1001, 1090 |
| epsilon-Viniferin | 943, 1295, 1333, 1346, 1355, 1368, 1612, 1730, 1899, 2366 |
| EPTC | 1040, 1106, 1254, 1256 |
| Eptifibatide | 270, 2226 |
| Eptotermin Alpha | 271 |
| Equiguard | 1188, 1222, 2376 |
| Equilin | 2040 |
| Equine gonadotropins | 2045, 2075 |
| Equol | 1188, 2040, 2045, 2204, 2300, 2371 |
| Ergocalciferol (Vitamin D2) | 271 |
| Ergoloid Mesylates | 272, 2417 |
| Ergometrine (See Ergonovine) | 273, 1730 |
| Ergonovine (Ergometrine) | 273, 1730 |
| Ergotamine | 273, 1063, 1730, 2073 |
| Eribulin Mesylate | 274, 865, 1730 |
| Eriodictyol | 943, 1742, 2117 |
| Erlotinib | 274, 865, 951, 1007, 1222, 1286, 1314, 1730, 2017, 2240, 2270 |
| Ertapenem | 275 |
| Ertythritol anhydride | 2121 |
| Erucic acid | 2338 |
| Erucin | 962, 1648, 2308, 2490 |
| Erythritol anhydride | 1612, 2022, 2295, 2473 |
| Erythromycin | 276, 866, 885, 927, 929, 951, 964, 1043, 1211, 1216, 1413, 1466, 1551, 1731, 1899, 2053, 2061, 2066, 2232, 2250, 2253, 2261, 2410, 2414, 2416, 2430, 2465 |
| Erythropoietin | 991, 2128 |
| Erythrosine | 925, 1355, 1754 |
| Escherichia coli 0111 B4 lipopolysaccharide | 1092, 2194, 2209, 2366, 2371, 2513 |
| Escherichia coli endotoxin | 1182, 2194, 2300, 2371 |
| Escherichia coli Nissle 1917 | 1286 |
| Escherichia coli Nissle 1917 O6:K5:H1 (EcN) | 1314, 1833 |
| Escherichia coli O55-B5 lipopolysaccharide | 962, 1996, 2177, 2180, 2184, 2194, 2200, 2209 |
| Escitalopram | 277, 1413, 1466, 1573, 1731, 2062, 2094, 2163, 2316 |
| Esculeoside A | 1140 |
| Esculetin | 2473 |
| Eslicarbazepine | 278, 2494 |
| Esmirtazapine | 1466 |
| Esmolol | 279, 1071 |
| Esomeprazole | 279, 1413, 1416, 1731 |
| Estazolam | 280, 1333, 1355, 1400, 1423, 1589, 1612, 1732, 1899 |
| Estradiol | 281, 927, 929, 943, 962, 964, 1024, 1027, 1042, 1043, 1060, 1067, 1069, 1073, 1082, 1086, 1088, 1090, 1092, 1097, 1099, 1100, 1106, 1111, 1119, 1121, 1190, 1204, 1207, 1216, 1229, 1231, 1233, 1245, 1248, 1254, 1256, 1259, 1261, 1264, 1265, 1270, 1272, 1286, 1295, 1314, 1333, 1340, 1346, 1355, 1423, 1732, 1899, 1906, 1978, 1992, 1993, 2019, 2022, 2026, 2032, 2037, 2040, 2044, 2045, 2049, 2061, 2062, 2066, 2068, 2073, 2082, 2085, 2086, 2099, 2101, 2104, 2112, 2121, 2125, 2129, 2156, 2184, 2188, 2194, 2198, 2200, 2204, 2209, 2213, 2226, 2227, 2237, 2238, 2241, 2242, 2247, 2249, 2250, 2253, 2259, 2261, 2269, 2270, 2276, 2278, 2300, 2308, 2312, 2314, 2323, 2330, 2333, 2346, 2347, 2361, 2362, 2366, 2371, 2375, 2376, 2380, 2381, 2382, 2385, 2393, 2397, 2402, 2404, 2410, 2423, 2425, 2430, 2432, 2434, 2436, 2442, 2446, 2450, 2451, 2465, 2467, 2468, 2473, 2481, 2490, 2493, 2513, 2516, 2519, 2525 |
| Estradiol 3-benzoate | 1097, 1188, 1978, 2002, 2019, 2040, 2045, 2164, 2188, 2399 |
| Estradiol 3,17-disulfate | 2106 |
| Estradiol-17beta | 1732 |
| Estradiol-17beta-3-methyl ether | 1423, 1899 |
| Estradiol-17beta-benzoate | 2188, 2190, 2270 |
| Estradiol 17beta-glucuronide | 2415 |
| Estradiol 17beta-D-glucuronide | 929, 943, 951, 962, 964, 968, 2040 |
| Estradiol derivatives | 1188 |
| Estradiol dipropionate | 2040 |
| Estradiol valerate | 1222, 1270, 2040, 2086, 2188, 2270 |
| Estradiol valerate-dienogest | 1222, 2048, 2051, 2061, 2353 |
| Estramustine | 282, 1263, 1732, 2156 |
| Estrenes | 2040 |
| Estriol | 1188, 1092, 2040, 2045, 2300, 2436, 2490, 2493, 2513 |
| Estrogens | 936, 943, 951, 1008, 1024, 1099, 1176, 1185, 1188, 1193, 1216, 1222, 1248, 1249, 1264, 1286, 1295, 1314, 1333, 1341, 1346, 1362, 1466, 1612, 1733, 1919, 1959, 1978, 2019, 2026, 2037, 2040, 2044, 2045, 2048, 2073, 2194, 2209, 2300, 2317, 2392, 2423, 2432, 2436, 2490, 2516, 2519 |
| Estrogens (Conjugated) | 282, 2048, 2276 |
| Estrone | 927, 936, 962, 1024, 1188, 1295, 1346, 1401, 1641, 1733, 1978, 2040, 2045, 2156, 2314, 2408, 2410, 2411, 2415, 2434, 2436, 2490, 2493 |
| Eszopiclone | 283, 1733 |
| ET-743 (Trabectidin, Yondelis) | 1733 |
| Etanercept | 284, 866, 1965, 2058, 2143, 2197, 2215, 2445, 2455, 2465, 2466 |
| Ethacrynic Acid | 285, 943, 1218, 1295, 2106, 2111, 2117, 2121 |
| Ethambutol | 285, 1381 |
| Ethanol (See Alcohol (Ethyl)) | 16, 933, 964, 1043, 1049, 1053, 1055, 1064, 1101, 1103, 1104, 1108, 1119, 1120, 1216, 1222, 1242, 1248, 1249, 1252, 1259, 1261, 1280, 1351, 1401, 1441, 1467, 1594, 1612, 1614, 1647, 1734, 1762, 1790, 1932, 1948, 2013, 2019, 2054, 2066, 2073, 2079, 2083, 2086, 2094, 2096, 2111, 2117, 2121, 2125, 2168, 2177, 2188, 2200, 2204, 2220, 2245, 2247, 2249, 2251, 2270, 2276, 2317, 2319, 2323, 2336, 2345, 2346, 2385, 2391, 2401, 2405, 2420, 2434, 2435, 2436, 2438, 2446, 2450, 2519 |
| Ethephon | 1196 |
| Ethinyl estradiol | 812, 929, 943, 951, 962, 964, 996, 1026, 1042, 1043, 1044, 1045, 1046, 1049, 1052, 1060, 1080, 1082, 1086, 1088, 1097, 1100, 1103, 1111, 1116, 1118, 1119, 1161, 1182, 1188, 1190, 1191, 1204, 1216, 1218, 1222, 1229, 1231, 1236, 1238, 1245, 1248, 1254, 1256, 1261, 1267, 1270, 1272, 1295, 1314, 1333, 1346, 1368, 1377, 1400, 1423, 1734, 1899, 1906, 1932, 1978, 1986, 1989, 1990, 1992, 1993, 2010, 2013, 2019, 2022, 2032, 2040, 2045, 2048, 2050, 2051, 2053, 2054, 2061, 2066, 2073, 2075, 2078, 2082, 2086, 2088, 2101, 2104, 2106, 2111, 2112, 2125, 2129, 2147, 2150, 2153, 2156, 2157, 2184, 2188, 2190, 2194, 2198, 2200, 2204, 2209, 2211, 2217, 2227, 2232, 2237, 2242, 2245, 2249, 2250, 2251, 2253, 2261, 2266, 2276, 2278, 2279, 2291, 2298, 2302, 2308, 2312, 2314, 2317, 2320, 2323, 2330, 2331, 2332, 2338, 2340, 2347, 2352, 2353, 2360, 2362, 2363, 2365, 2367, 2376, 2377, 2379, 2380, 2385, 2387, 2388, 2399, 2400, 2402, 2403, 2404, 2405, 2406, 2410, 2413, 2420, 2423, 2425, 2427, 2430, 2432, 2434, 2436, 2440, 2446, 2450, 2451, 2467, 2483, 2490, 2511, 2513, 2516, 2519, 2521, 2523, 2525, 2528 |
| Ethinyl estradiol glucuronide | 965 |
| Ethinyl estradiol-desogestrel combination | 812, 1216, 1270, 2050, 2051, 2055, 2061, 2153, 2338, 2353, 2513 |
| Ethinyl estradiol-norgestrel combination | 2040, 2177, 2300, 2513 |
| Ethion | 1188, 2040, 2045 |
| Ethionamide | 286, 2066 |
| Ethionine | 979, 1218, 2066, 2314, 2382 |
| Ethiprole | 1734 |
| Ethofenprox | 1188 |
| Ethohexadiol | 1188 |
| Ethosuximide | 286, 1737 |
| Ethotoin | 287, 2312 |
| Ethoxyquin | 962, 965, 971, 979, 1188, 1295, 2111, 2117, 2308, 2418 |
| Ethyl 2-(4-chlorophenyl)-5-(2-furyl)-4-oxzoleacetate | 2490, 2493 |
| Ethyl 2-amino-6-bromo-4-(1-cyano-2-ethoxy-2-oxoethyl)-4H-chromene-3-carboxylate | 1222 |
| Ethyl 6-(N-(2-chloro-4-fluorophenyl)sulfamoyl)cyclohex-1-ene-1-carboxylate | 2209 |
| Ethyl bromophos | 1188, 2040, 2045 |
| Ethyl carbamate | 1601 |
| Ethyl Chloride | 287 |
| Ethyl cinnamate | 2040, 2045 |
| Ethyl octylphosphonofluoridate | 2253 |
| Ethyl tert-butyl ether | 1355, 1648 |
| Ethyl(E,E,E)-7-(2-n-propoxy-5,5,8,8-tetramethyl-5,6,7,8-tetrahydro-naphthalen-3-yl)-6-fluoro-3-methylocta-2,4,6-trienoate | 2253, 2340, 2341, 2345 |
| Ethylbenzene | 1601, 2086 |
| Ethylcholine aziridinium | 1251, 1252 |
| Ethylene | 1612 |
| Ethylene bromohydrin | 1612 |
| Ethylene dibromide | 1612, 2121, 2272 |
| Ethylene dichloride | 1216, 2106 |
| Ethylene dimethanesulfonate | 2376 |
| Ethylene glycol | 2086 |
| Ethylene glycol ether | 1107 |
| Ethylene oxide | 2022, 2121 |
| Ethylenethiourea | 1040, 1216, 2067, 2393, 2423 |
| Ethyleniminequinone | 2376 |
| Ethylisopropylamiloride | 1295, 1333, 1346, 2446 |
| Ethylmaleimide | 1248 |
| Ethylmercuric chloride | 2111 |
| Ethylmorphine | 1737 |
| Ethylnitrosourea | 1114, 1222, 1241, 2019, 2022, 2026, 2075, 2091, 2121, 2174, 2229, 2234, 2236, 2238, 2241, 2249, 2256, 2267, 2272, 2279, 2320, 2323, 2326, 2376, 2380, 2397, 2399, 2473 |
| Ethylparaoxon | 1040 |
| Ethynylestradiol | 1737 |
| Etidronate Disodium | 287, 1261, 2515 |
| Etiracetam (See Levetiracetam) | 423, 882, 927, 1474, 1501, 1583, 1779, 1977 |
| Etizolam | 1414, 1555, 1737 |
| Etodolac | 288, 1114, 1737, 2371, 2493 |
| Etomidate | 289, 1937, 2079 |
| Etonogestrel | 289 |
| Etoperidone | 1737 |
| Etoposide | 290, 866, 927, 943, 951, 962, 965, 1044, 1045, 1083, 1108, 1207, 1233, 1355, 1368, 1377, 1400, 1737, 1899, 2019, 2026, 2028, 2073, 2111, 2115, 2117, 2194, 2209, 2308, 2312, 2352, 2376, 2438, 2473, 2481, 2487, 2490, 2493, 2515, 2516, 2519, 2523 |
| Etoricoxib | 290, 1738, 2177, 2371, 2452 |
| Etravirine | 291, 867, 1008, 1387, 1414, 1738 |
| Eugenol | 1601, 2106, 2111, 2117 |
| Eupatilin | 1315, 1388, 1474 |
| Eupatorin | 1492, 1814 |
| Euphorbia factor L1 | 867 |
| Euphorbiasteroid | 867 |
| Eutigoside C | 2209 |
| Everolimus | 292, 878, 1222, 1738, 2376 |
| Evodia fruit extract (Evodia rutaecarpa Bentham, Evodia officinalis Dode) | 1176, 1739 |
| Evodiamine | 927, 1095, 1222, 1286, 2177, 2194, 2371 |
| Exatecan mesylate (DX-8951f) | 1739 |
| Excitatory amino acid agonists | 1216, 2213 |
| Exemestane | 293, 1315, 1363, 1739, 1960, 1978 |
| Exenatide | 293 |
| Exochelins | 2519 |
| Ezetimibe | 294, 824, 867, 951, 1140, 2385, 2415 2487, 2493 |
| Ezlopitant | 1474, 1739 |
| Ezrin | 952 |
| F | |
| F 11356 | 2161 |
| F2-Isoprostanes | 2446 |
| Factor IX Complex (Human) | 295 |
| Factor VIIa (Recombinant) | 295 |
| FAD286 and Metyrapone | 1938 |
| Fadrozole | 1355, 1943, 1960, 1978 |
| Fallypride | 1019 |
| False unicorn (Chamaelirium luteum) | 1287, 1317, 1415, 1490, 1759 |
| Famciclovir | 296 |
| Famotidine | 296, 1216, 1414, 2073, 2411 |
| Fangchinoline | 868 |
| Farglitazar | 2345 |
| Farnesiferol A (Ferula persica) | 868 |
| Farnesoid X receptor (FXR) | 968, 1140, 1919, 1961 |
| Farnesol | 1295, 1333, 1612, 1978, 2308, 2493, 2495 |
| Farnesyl pyrophosphate | 2338 |
| Farnesyl-protein transferase inhibitors | 1739 |
| Farnesylthiosalicylic acid | 1222, 1231, 2276, 2376 |
| Fasudil | 936, 2300 |
| Fat-soluble vitamins A and D | 1919 |
| Fatty acid analogs | 1601 |
| Fatty acid bile acid conjugate (Aramchol) | 1140 |
| Fatty acid bile acid conjugates | 1919 |
| Fatty acid epoxides | 1908 |
| Fatty acids | 824, 1058, 1060, 1248, 1295, 1469, 2111, 2249, 2340 |
| Febuxostat | 297, 1474 |
| FEC protocol | 2184, 2026, 2200, 2204, 2371, 2473 |
| Felbamate | 297, 868, 1739 |
| Felodipine | 298, 1377, 1739 |
| Fenamic acid | 1248 |
| Fenamiphos | 1040 |
| Fenarimol | 1188, 1295, 1333, 1612, 1961, 1978, 2040, 2045, 2188, 2312 |
| Fenbendazole | 927, 952, 962, 1008, 1024, 2266 |
| Fenbuconazole | 1978, 2040, 2045, 2312 |
| Fenfluramine | 1474, 2398 |
| Fenhexamid | 1216 |
| Fenitrothion | 943, 1365, 1188, 1289, 1295, 2125 |
| Fennel (Foeniculum vulgare) | 1492, 1740 |
| Fenofibrate | 299, 818, 1032, 1042, 1117, 1119, 1140, 1741, 1919, 2052, 2054, 2339, 2384 |
| Fenofibric acid | 1377, 1899, 2312, 2340, 2385, 2490, 2492 |
| Fenoldopam | 300, 1997 |
| Fenoprofen | 300, 1474, 2340, 2345, 2446, 2493 |
| Fenoterol | 2014 |
| Fenoxycarb | 1040, 1254, 1256 |
| Fenpropathrin | 2386, 2387 |
| Fenproporex | 1333, 1368, 1589, 1740, 1899 |
| Fenpyroximate | 2420 |
| Fenretinide | 1093, 1209, 1222, 1229, 1231, 1241, 1373, 1899, 2019, 2029, 2121, 2188, 2209, 2224, 2245, 2261, 2266, 2272, 2276, 2302, 2308, 2312, 2345, 2367, 2371, 2376, 2473, 2516, 2519, 2528 |
| Fentanyl | 301, 868, 1740, 2073, 2322 |
| Fenthion | 1040, 1188, 1813, 1899, 2066 |
| Fenugreek seed polyphenols | 1601 |
| Fenvalerate | 1040, 1188, 1216, 1365, 1368, 1899, 1961, 2022, 2040, 2045, 2078, 2156, 2259, 2312, 2386, 2387 |
| Ferric Gluconate | 302 |
| Ferric nitrilotriacetate | 927, 1216, 1612, 2446 |
| Ferric oxide | 1295 |
| Ferric-sorbitol-citrate | 2473 |
| Ferrocene amino acid derivative (HUNI 068) | 868 |
| Ferroquine | 1475 |
| Ferrous chloride | 2420 |
| Ferrous-dioxygen | 1740 |
| Ferrous Fumarate | 302 |
| Ferrous Sulfate | 303, 1216, 1270, 2078, 2204, 2209, 2338, 2479 |
| Ferula persica (See Farnesiferol A) | 868 |
| Ferula szowitsiana (See Galbanic Acid) | 868 |
| Ferulic acid | 990, 991, 1222, 1295, 1333, 2300, 2371, 2376, 2487, 2492, 2493 |
| Ferumoxtran | 2194, 2209, 2217, 2220 |
| Ferumoxytol | 303 |
| Feselol | 868 |
| Fesoterodine | 304, 1475, 1740 |
| Fetuin | 978 |
| Fexofenadine | 304, 868, 1008, 1741, 2154, 2177, 2414, 2415, 2417 |
| FG020326 | 937, 1741 |
| Fibrates | 1741 |
| Fibraurea tinctoria | 1741 |
| Filgrastim | 305 |
| Finasteride | 305, 1185, 1741, 1961, 2425, 2492 |
| Fingolimod | 306, 1475, 1908 |
| Fipronil | 1742, 2312 |
| Fisetin | 1992, 2204, 2300 |
| Fish oils | 1058, 1060, 1932, 2026, 2054, 2251, 2340, 2345, 2391, 2435 |
| FK 565 | 2184, 2220 |
| FK1706 | 1742 |
| FK228 | 1742 |
| FK778 | 1990 |
| Flame retardants | 1188 |
| Flavangenol | 1141 |
| Flavanones | 1286, 1188, 1978 |
| Flavocoxid | 307, 1110 |
| Flavone-8-acetic acid | 1315 |
| Flavones | 943, 1008, 1024, 1188, 1216, 1286, 1295, 1346, 1742, 1961, 1978, 2338 |
| Flavones and flavonones (Luteolin, Hesperetin) | 1097, 1961 |
| Flavones from Hippophae rhamnoides L | 868 |
| Flavonoids (Apigenin, Chrysin, Flavone, Flavanone, Galangin, Luteolin, and Naringenin) | 868, 943, 965, 985, 1008, 1034, 1044, 1060, 1062, 1069, 1082, 1092, 1093, 1097, 1111, 1116, 1119, 1121, 1174, 1190, 1194, 1196, 1197, 1207, 1210, 1222, 1236, 1252, 1255, 1274, 1286, 1295, 1306, 1315, 1341, 1352, 1368, 1475, 1482, 1490, 1491, 1742, 1900, 1906, 1932, 1978, 2006, 2008, 2040, 2082, 2091, 2117, 2188, 2204, 2217, 2220, 2232, 2234, 2256, 2257, 2261, 2290, 2308, 2312, 2314, 2320, 2325, 2328, 2347, 2367, 2376, 2380, 2381, 2385, 2387, 2395, 2400, 2403, 2405, 2418, 2420, 2427, 2438, 2439, 2446, 2453, 2468, 2473, 2490, 2492, 2525, 2528 |
| Flavonoids and proanthocyanidins from Sorghum bicolor bran | 1961 |
| Flavonones | 1961 |
| Flavopiridol | 952, 1008, 1222, 1231, 1233, 1236, 1237, 1475, 2376, 2473 |
| Flavoring agents | 1295, 1333 |
| Flavoxate | 307 |
| Flecainide | 308, 1315, 1476, 1533, 2053 |
| Florbetaben | 1141 |
| Flos carthami | 1490 |
| Flourofenidone | 1315, 1381, 1476 |
| Floxacillin (See Flucloxacillin) | 309, 1742, 2126, 2135 |
| Floxuridine | 308, 1995, 1996, 2115, 2288, 2451, 2471, 2473, 2481 |
| FLT3 tyrosine kinase inhibitors | 2064 |
| Fluazifop-butyl | 2040 |
| Flubendazole | 869 |
| Flucloxacillin (Floxacillin) | 309, 1742, 2126, 2135 |
| Fluconazole | 309, 843, 868, 1243, 1333, 1388, 1400, 1423, 1533, 1743, 1900, 2111 |
| Flucythrinate | 1188, 2040 |
| Flucytosine | 310 |
| Fludarabine | 311, 869, 1008, 1222, 2473, 2519 |
| Fludrocortisone | 311 |
| Flufenamic acid | 1248, 2209, 2340, 2345, 2371 |
| Fluindione | 1908 |
| Flumazenil | 312, 1019, 2079 |
| Flunarizine | 313 |
| Flunisolide | 313, 1266 |
| Flunitrazepam | 1423, 1553, 1742, 1900, 2490, 2493 |
| Fluo-3 | 962 |
| Fluocinolone | 314 |
| Fluocinonide | 314 |
| Fluometuron | 1316, 1743 |
| Fluoranthene | 1188, 2040 |
| Fluorene | 1097, 1295, 1333 |
| Fluorescein-methotrexate | 962 |
| Fluorexon | 943, 962 |
| Fluoride | 315, 1195, 2446 |
| Fluorinated hydrocarbons | 2359 |
| Fluoroaluminum | 927, 1194 |
| Fluoroelacridar | 869 |
| Fluorometholone | 315, 2316, 2317 |
| Fluoropyrimidine | 869, 1352, 1961, 1996 |
| Fluoroquinolone | 1008 |
| Fluoroquinolone antibiotics | 1743 |
| Fluorotelomer alcohol 8:2 FTOH | 1938 |
| Fluorouracil | 316, 869, 927, 943, 962, 968, 979, 1009, 1024, 1050, 1102, 1103, 1197, 1207, 1220, 1222, 1229, 1231, 1233, 1241, 1243, 1254, 1273, 1295, 1355, 1900, 1988, 1995, 1996, 2008, 2019, 2022, 2026, 2028, 2029, 2032, 2048, 2062, 2073, 2097, 2115, 2117, 2121, 2125, 2179, 2180, 2184, 2188, 2194, 2209, 2212, 2220, 2224, 2241, 2266, 2272, 2274, 2276, 2278, 2279, 2280, 2288, 2320, 2335, 2345, 2352, 2371, 2376, 2380, 2381, 2382, 2404, 2410, 2411, 2430, 2438, 2442, 2446, 2467, 2468, 2473, 2480, 2481, 2490, 2519 |
| Fluoxetine | 317, 1377, 1388, 1414, 1476, 1487, 1497, 1522, 1524, 1551, 1553, 1555, 1589, 1743, 1961, 2053, 2062, 2101, 2158, 2159, 2161, 2163, 2165, 2179, 2259, 2317, 2320, 2398, 2475, 2476 |
| Fluoxymesterone | 318 |
| Flupenthixol | 318, 1997, 2000 |
| Fluphenazine | 319, 1355, 1400, 1423, 1479, 1612, 1900 |
| Flurazepam | 320 |
| Flurbiprofen | 320, 1121, 1171, 1182, 1190, 1388, 1479, 2073, 2112, 2209, 2217, 2308, 2367, 2371, 2420, 2460, 2481, 2493, 2495 |
| Flutamide | 321, 1043, 1046, 1116, 1188, 1272, 1744, 2040, 2045, 2086, 2088, 2156, 2188, 2245, 2311, 2423 |
| Fluticasone | 322, 812, 1744, 2317 |
| Fluvastatin | 323, 929, 962, 1009, 1032, 1141, 1244, 1368, 1388, 1479, 1547, 1583, 1744, 1900, 2147, 2245, 2250, 2299, 2300, 2312, 2314, 2338, 2404, 2415, 2416, 2418 |
| Fluvoxamine | 324, 869, 1316, 1333, 1480, 1502, 1525, 1551, 1569, 1583, 1744, 2158, 2163, 2164, 2398 |
| Fly ash | 2194, 2460 |
| Foeniculum vulgare (See Fennel) | 1492, 1740 |
| FOLFOX combination chemotherapy | 952 |
| FOLFOX protocol | 2019, 2026, 2032, 2371, 2481 |
| Folic Acid (Vitamin B9) | 325, 329, 869, 943, 952, 1040, 1103, 1119, 1188, 1196, 1222, 1241, 1270, 1388, 2084, 2085, 2200, 2209, 2270, 2272, 2287, 2288, 2291, 2296, 2317, 2340, 2345, 2405, 2425, 2460, 2473, 2481, 2513, 2519 |
| Folic acid analogs | 2031 |
| Folinic Acid (See Leucovorin) | 421, 882, 939, 962, 969, 1231, 1233, 2008, 2013, 2029, 2032, 2273, 2288 |
| Follitropin Alpha | 325 |
| Follitropin Beta | 326 |
| Fomepizole | 326, 1612 |
| Fondaparinux | 327, 1483, 1745 |
| Fonofos | 1333, 1900 |
| Food additives | 869 |
| Food natural products | 1316 |
| Formaldehyde | 1050, 1105, 1106, 1209, 2121, 2184, 2194, 2200, 2209, 2217 |
| Formestane | 1961, 1978, 2156 |
| Formic acid | 2174 |
| Formononetin | 1295, 1346, 2040, 2045, 2204 |
| Formoterol | 327, 1077, 2317 |
| Forskolin | 927, 1044, 1082, 1088, 1188, 1248, 1265, 1295, 1333, 1746, 1943, 1978, 2079, 2147, 2177, 2184, 2217, 2220, 2346, 2371, 2393, 2446, 2460, 2479 |
| Fosamprenavir | 328, 869, 1533, 1746 |
| Fosaprepitant | 329 |
| Foscarnet | 330 |
| Fosfomycin | 330 |
| Fosinopril | 331, 1032, 1086, 2327 |
| Fosphenytoin | 332, 869,1414 |
| Fossil fuels | 1612, 2423 |
| Fotemustine | 2272 |
| FPEPIR regimen | 927 |
| FR 173657 | 1197 |
| FR 190997 | 1197 |
| Fraxetin | 1216, 2423 |
| Free radicals | 2184 |
| Freund’s adjuvant | 1265, 1270, 2019, 2153, 2184, 2188, 2190, 2194, 2200, 2204, 2209, 2217, 2220, 2247, 2300, 2359, 2446, 2460, 2479, 2519 |
| Frovatriptan | 332 |
| Fructose | 1270, 2177, 2280, 2446 |
| Fructus Schisandrae chinensis derivatives (Schisandrol A, Gomisin A) | 1746 |
| FTI 277 | 1233, 2376 |
| Fucoidan | 2194, 2276, 2278, 2376, 2473 |
| Fucophlorethols from the brown alga Fucus vesiculosus L. | 1961 |
| Fufang Jiangzhi No.3 | 1920 |
| Fufang Zhenzhu Tiao Zhi (FTZ) | 1920 |
| Fulvestrant (ICI 182,780) | 965, 1121, 1188, 1207, 1265, 1295, 1346, 1355, 1746, 1962, 1978, 2026, 2040, 2045, 2073, 2082, 2086, 2194, 2209, 2253, 2264, 2300, 2312, 2330, 2338, 2382, 2460, 2468, 2473, 2490, 2513, 2516, 2519 |
| Fumarates | 2410 |
| Fumigaclavine C | 2184, 2194, 2200, 2460 |
| Fumitremorgin C | 1009 |
| Fumonisin B1 | 1799 |
| Fundulus heteroclitus (See Atlantic killifish) | 955, 1337 |
| Fungicides in the grey mould fungus Botrytis cinerea | 869 |
| Furafylline | 1295, 1333, 1612 |
| Furan | 812, 930, 1120, 1216, 1270, 1602, 1612, 1932, 2188, 2308, 2338, 2432, 2483 |
| Furanocoumarin derivatives | 869 |
| Furanocoumarins (Furocoumarins)(Grapefruit juice, Citrus paradisi Macf.) | 1746 |
| Furanocoumarins (Isoimperatorin, Imperatorin, (+)-Oxypeucedanin, (+)-Byakangelicol, and (+)-Byakangelicine) | 1316 |
| Furosemide | 333, 962, 965, 968, 971, 1261, 2073, 2079, 2179, 2188, 2209, 2217, 2256, 2276, 2300, 2330, 2331, 2362, 2367, 2371, 2377, 2391, 2402, 2408, 2410, 2446, 2448, 2460, 2465, 2467, 2493, 2513, 2519 |
| Furyl-1,4-quinones | 1602 |
| Fusidic acid | 930, 952, 962 |
| Fuzi (FPS) | 1920 |
| G | |
| G(M3) Ganglioside | 1233, 1236 |
| GA2-50 | 1458 |
| GABA agents | 2079 |
| Gabapentin | 334, 870, 927, 2232, 2387 |
| Gabexate | 2194, 2460 |
| Gadolinium chloride | 1333, 1612, 2209, 2446, 2460, 2483 |
| Galactosamine | 2184, 2194, 2209, 2217, 2460 |
| Galactose | 2283 |
| Galangin | 943, 1286, 2117, 2490 |
| Galantamine | 334, 1038, 1040, 1195, 1254, 1256, 1483, 1747 |
| Galanthus nivalis | 1176 |
| Galanthus woronowii (See Galantamine) | 334, 1038, 1040, 1195, 1254, 1256, 1483, 1747 |
| Galbanic Acid (Ferula szowitsiana) | 868 |
| Galectin-1 | 870 |
| Galectin-9 | 870 |
| Gallamine triethiodide | 1251 |
| Gallic acid | 894, 902, 1034, 2300 |
| Gallium arsenide | 2184, 2194, 2209, 2217, 2256, 2460 |
| Gallium Nitrate | 335 |
| Gallocatechol | 962, 1034, 1216, 1295, 1333, 2423 |
| Gallopamil | 1484, 1747 |
| Galsulfase | 336 |
| Gambogic acid | 2481 |
| Gamisopoonghwanghyul-tang | 2194, 2204, 2209, 2217, 2460 |
| Gamitrinibs | 870 |
| gamma-Aminobutyric acid | 2079 |
| gamma-Glu-S-BzCys-PhGly diethyl ester | 2117 |
| gamma-Glutamyl-glutathione | 2117 |
| gamma-Hexachlorocyclohexane (See Lindane) | 965, 1040, 1046, 1097, 1119, 1188, 1216, 1243, 1270, 1295, 1334, 1346, 1368, 1604, 1613, 1900, 1943, 1978, 2041, 2045, 2078, 2150, 2156, 2184, 2188, 2247, 2279, 2312, 2317, 2376, 2446, 2460 |
| gamma-Linolenic acid | 1231, 2345, 2371 |
| gamma-Oryzanol | 1484, 1747 |
| gamma-Secretase inhibitors | 1181, 1747, 2302 |
| gamma-Secretase modulators | 1181 |
| gamma-Tocopherol | 1747, 2312 |
| gamma-Tocotrienol | 927 |
| gamma-Valerolactone | 1333 |
| Ganciclovir | 336, 870 |
| Ganirelix | 337 |
| Ganoderma species (See Lingzhi) | 1341, 2460 |
| Ganoderol B | 1188 |
| Garlic (Allium sativum L.) | 870, 1388, 1490, 1602, 1747, 1921 |
| Garlic oil | 1316 |
| Gas-metal arc stainless steel welding fume | 1141 |
| Gasoline | 1612, 2423 |
| Gastrins | 2073 |
| Gastrodia elata Blume (See Gastrodin) | 871 |
| Gastrodin (Gastrodia elata Blume) | 871 |
| Gatifloxacin | 337, 871, 1009 |
| GBR-12935 | 1484, 2397 |
| GDC-0449 | 871 |
| Gedunin | 1188, 1219, 1233, 1295, 2019, 2064, 2198, 2245 |
| Gefitinib | 337, 871, 1009, 1024, 1334, 1400, 1423, 1484, 1510, 1547, 1589, 1748, 1900, 2017, 2019, 2026, 2040, 2240, 2249, 2270, 2274, 2467, 2481 |
| Ge-gen (Puerarin) | 1326, 1545 |
| Geldanamycin | 937, 1222, 1295, 2026, 2040, 2171, 2174, 2194, 2209, 2272, 2308, 2460, 2473 |
| Gemcitabine | 338, 871, 978, 1010, 1083, 1222, 1229, 1444, 1987, 1995, 2019, 2157, 2177, 2209, 2272, 2298, 2367, 2380, 2382, 2413, 2442, 2460, 2468, 2471, 2473, 2510, 2519, 2520 |
| Gemfibrozil | 339, 871, 1032, 1042, 1097, 1141, 1243, 1244, 1248, 1373, 1377, 1400, 1485, 1583, 1741, 1748, 1900, 1932, 2194, 2220, 2253, 2312, 2339, 2340, 2385, 2415, 2490, 2460 |
| Gemifloxacin | 339 |
| Gemtuzumab Ozogamicin | 340 |
| Genipin | 872 |
| Geniposide | 2106, 2111 |
| Genistein | 824, 858, 943, 962, 1012, 1024, 1034, 1044, 1069, 1097, 1116, 1119, 1188, 1190, 1196, 1208, 1209, 1216, 1218, 1222, 1231, 1233, 1248, 1261, 1270, 1295, 1305, 1316, 1334, 1346, 1908, 1962, 1978, 1989, 2013, 2019, 2022, 2032, 2040, 2045, 2073, 2078, 2085, 2086, 2088, 2104, 2112, 2156, 2177, 2184, 2194, 2204, 2217, 2225, 2241, 2259, 2269, 2272, 2276, 2300, 2308, 2312, 2320, 2352, 2361, 2365, 2371, 2376, 2379, 2408, 2423, 2430, 2432, 2434, 2436, 2446, 2451, 2460, 2481, 2490, 2493, 2513, 2516, 2519, 2525, 2528 |
| Gentamicin | 341 |
| Gentamicins | 962, 1248 |
| Gentiana manshurica Kitagawa | 1602 |
| Gentuzumab ozogamicin | 848 |
| Gepirone | 1485, 1748 |
| Geraniin | 2460 |
| Geraniol | 2481 |
| Geranylcoumarin | 1749 |
| Geranylgeranyl pyrophosphate | 2338 |
| Geranylgeranylacetone | 2013 |
| Germander | 1749 |
| Gestodene | 1270, 1334, 1749, 1900, 2048, 2051, 2061, 2353 |
| Gestrinone | 1977 |
| GF120918 | 872, 927, 1010, 1024 |
| Ghanaian medicinal plants | 1491, 1749 |
| Ghrelin | 818, 2460 |
| Gigantol | 2460 |
| Gimatecan (ST1481) | 937 |
| Gimeracil | 1995 |
| Ginger (Zingiber officinale Roscoe) derivatives | 872, 1396 |
| Gingerol | 1236, 2345, 2372, 2376, 2460 |
| Ginkgo biloba (Ginkgo biloba L) | 342, 818, 1176, 1341, 1363, 1414, 1485, 1749 |
| Ginkgo biloba extract (Kaempferol, Quercetin, Isorhamnetin, Ginkgolides and Bilobalide) | 1286 |
| Ginkgo biloba extract 761 | 1334, 1400, 1612, 1900 |
| Ginkgolide A | 1491, 2312 |
| Ginkgolide B | 1491, 2312 |
| Ginkgolides | 1286, 1491 |
| Ginsan | 1602 |
| Ginseng (Panax ginseng CA Meyer) | 342, 1749 |
| Ginsenoside M1 | 2204, 2184, 2194, 2372, 2460 |
| Ginsenoside Rb1 | 1491, 2041, 2045, 2232 |
| Ginsenoside Rd | 872, 1142, 1491 |
| Ginsenoside Re | 2232 |
| Ginsenoside Rf | 843, 2232 |
| Ginsenoside Rg1 | 1233, 2041, 2045, 2232 |
| Ginsenosides | 1316, 1334, 1491 |
| Ginsenosides Rb2 | 1491 |
| Ginsenosides Rc | 1491 |
| Glafenine | 1415, 1485, 1750 |
| Glatiramer Acetate | 343, 1171, 2143 |
| Glibenclamide (See Glyburide) | 346, 872, 876, 930, 937, 943, 983, 985, 1010, 1097, 1248, 1295, 1373, 1388, 1389, 1396, 1485, 1486, 1583, 1750, 1751, 2194, 2233, 2234 |
| Gliclazide | 344, 983, 1388, 1415, 1485, 2233 |
| Glimepiride | 344, 1389, 1396, 2311 |
| Gliotoxin | 1996 |
| Glipizide | 345, 1389, 1396, 1400 |
| Globotriaosylceramide | 2460 |
| Glucagon | 346, 1295, 1334, 1921 |
| Glucagon-like peptide 2 | 952 |
| Glucan phosphate | 2200, 2217, 2220 |
| Glucocorticoids | 812, 872, 1077, 1086, 1110, 1233, 1236, 1241, 1750, 2121, 2217, 2317, 2372, 2376 |
| Glucoerucin | 1341 |
| Gluconic acid | 1272, 1267, 2253, 2404, 2411 |
| Glucoraphanin | 1341 |
| Glucosamine | 1316, 2184, 2200, 2204, 2460 |
| Glucose | 943, 1216, 1265, 1921, 1943, 2041, 2045, 2073, 2300, 2305, 2317, 2340, 2345, 2423, 2446, 2510, 2511 |
| Glucosinolates (Glucoraphanin and Glucoerucin) | 1316, 1341, 1491, 2106, 2111, 2308 |
| Glucosylceramide synthase inhibitors | 873 |
| Glucosylceramides | 2184, 2217 |
| Glucuronides | 1024 |
| Glucuronoxylomannan | 1274, 2217, 2220 |
| Glufosfamide | 1815 |
| Glutamine | 1602 |
| Glutarates | 2408, 2410 |
| Glutathione | 943, 962, 965, 971, 979, 1010, 1042, 1045, 1191, 1220, 1236, 1248, 1331, 1334, 1602, 1612, 1750, 1900, 2019, 2073, 2082, 2102, 2106, 2111, 2117, 2121, 2150, 2177, 2209, 2416, 2418, 2423, 2430, 2435, 2446, 2460, 2473 |
| Glutathione conjugates | 953 |
| Glutathione disulfide | 943, 1248, 2423, 2473 |
| Glutathione-conjugated catechol metabolites (5-(glutathion-S-yl)-N-methyl-alphamethyldopamine) | 937 |
| Glutathione-enriched yeast and rice embryo/soybean extracts | 1602 |
| Glutethimide | 2073 |
| Glutoxime | 873 |
| Glyburide (Glibenclamide) | 346, 872, 876, 930, 937, 943, 983, 985, 1010, 1097, 1248, 1295, 1373, 1388, 1389, 1396, 1485, 1486, 1583, 1750, 1751, 2194, 2233, 2234, 2397 |
| Glycerol | 1116, 1286, 1602, 2473 |
| Glyceryl Trinitrate (See Nitroglycerin) | 532, 1072, 1088, 1103, 1106, 1116, 1259, 1613, 1943, 2013, 2066, 2073, 2093, 2125, 2161, 2195, 2209, 2261, 2276, 2301, 2303, 2430, 2461 |
| Glycidamide | 1218, 1219, 1295, 1346, 1593, 1622, 1906, 2022, 2078, 2111, 2121, 2308, 2432, 2434, 2451, 2473 |
| Glycine agents | 1116, 1248, 2061, 2125, 2259, 2280, 2292, 2446 |
| Glycine max (L.) Merrill (See Soybean) | 1930 |
| (Glycyl-glycyl)GLP-2 | 2184, 2217, 2460 |
| Glycitein | 824, 1097, 2041, 2516 |
| Glycochenodeoxycholic acid | 930, 2400 |
| Glycocholic acid | 930, 2400 |
| Glycolates | 2106, 2111, 2121 |
| Glycolipids | 2194, 2209, 2446 |
| Glycolytic pyruvate | 873 |
| Glycopyrrolate | 347 |
| Glycosphingolipids | 1921 |
| Glycosylphosphatidylinositols | 2188 |
| Glycoursodeoxycholic acid | 930, 2400 |
| Glycyrol | 2194, 2209, 2372 |
| Glycyrrhetic acid | 960, 1389 |
| Glycyrrhetinic acid | 1308 |
| Glycyrrhiza glabra (Glycyrrhizin, Licorice) | 883, 1491, 1779 |
| Glycyrrhiza inflata and Kansui | 873 |
| Glycyrrhiza uralensis Fisher (See Licorice) | 883, 1491, 1751, 1779 |
| Glycyrrhizic acid | 1943, 2220, 2372, 2460 |
| Glycyrrhizin (See Glycyrrhizae glabra) | 883, 1491, 1779 |
| Glyoxal | 2266 |
| Glyoxylic acid | 2078 |
| Glyphosate-based herbicides (roundup formulations) | 1316, 1751 |
| GM 6001 | 1171, 1182, 1265, 2013, 2019 |
| GM3 Ganglioside | 1222 |
| GnRH agonists and GnRH antagonists | 1962 |
| Go 6976 | 1231, 2019, 2200, 2372, 2516 |
| Go 6983 | 1097 |
| Goitrin | 2117 |
| Gold Sodium Thiomalate | 347 |
| Goldenseal (Hydrastis canadensis) | 1491, 1751 |
| Golimumab | 348 |
| Gomisin A | 910, 1746 |
| Gomisins | 1854 |
| Gonadal steroid hormones | 1142, 1346, 1978, 2184, 2194, 2200, 2209, 2217, 2460 |
| Gonadorelin | 348 |
| Gonadotropin-releasing hormone | 2041 |
| Gonadotropins | 2106 |
| Goserelin | 349, 1948, 1962, 2041, 2473 |
| (-)-Gossypol | 1978 |
| GPS2 | 991 |
| GR46611 | 2159, 2161 |
| GR127935 | 2161 |
| GR218231 | 2002, 2004 |
| GR87442 I | 1639 |
| Gramicidin | 2266 |
| Granisetron | 349, 873, 1486, 1751, 1855, 1900 |
| Granzyme B | 1142 |
| Grape seed proanthocyanidin | 1921, 2328 |
| Grapefruit (Citrus paradisi Macf.) juice | 873, 1286, 1316, 1491, 1751 |
| Green tea (Catechins) [(-)-Epicatechin gallate; (-)-Epigallocatechin-3-gallate; (-)-Epigallocatechin; (-)-Epicatechin] | 873, 1316, 1491, 1602, 1753, 1921 |
| Green tea extract AR25 | 2073 |
| Grepafloxacin | 943, 2490, 2493 |
| Griseofulvin | 350, 1355, 2340, 2341, 2345 |
| Growth hormone (GH) | 1486, 1753, 1921, 1938 |
| GSK0660 | 2341 |
| GSK3987 | 824, 2209 |
| GSK2126458 | 1968 |
| GS-Succ-BP | 2106 |
| Guaifenesin | 351 |
| Guanabenz | 351 |
| Guanfacine | 352, 874, 1067 |
| Guanidine | 2412 |
| Guanxinkang | 1142 |
| Guanylin | 1248 |
| Guggulsterone | 874, 1921 |
| Guggulu extract | 930, 1900, 1932, 2312 |
| GW0072 | 2184, 2194, 2460 |
| GW707 | 2245 |
| GW0742 | 2341 |
| GW3965 | 824, 996, 1161, 1932, 2147, 2209 |
| GW4064 | 930, 962, 965, 1261, 1921, 1932, 2013, 2338, 2340, 2400 |
| GW7604 | 2041 |
| GW9662 | 992 |
| GW347845 | 992 |
| GW501516 | 2341 |
| H | |
| H1 Receptor antagonists | 1493, 1655 |
| H1 Tetrandrine derivative | 874 |
| H1-Antihistamine R-dimethindene | 1493 |
| H2 Receptor antagonists | 1656 |
| H89 | 927, 1248, 1265, 1978, 2013, 2229, 2236, 2320, 2346, 2372, 2411, 2446, 2476, 2516 |
| H259/31 | 1754 |
| Hachimijiogan | 2217, 2220 |
| Haemophilus b Conjugate Vaccine | 353 |
| Hair dyes | 1334, 2296 |
| Haishengsu (Tegillarca granosa extract) | 874 |
| Halcinonide | 353 |
| Halobetasol | 353 |
| Halofantrine | 1486, 1754 |
| Halofuginone | 1261, 2022, 2156, 2276, 2278, 2330, 2386, 2446, 2519 |
| Halogenated diphenyl ethers | 1097, 1188, 1943, 1978, 2156, 2432 |
| Halogenated hydrocarbons | 2121 |
| Halogenated organic compounds (Dichlorodiphenyl ethylene, Polychlorinated biphenyls, Polybrominated diphenylethers) | 1963 |
| Halogenated xanthene food dyes | 1754 |
| Haloperidol | 354, 874, 927, 943, 1478, 1486, 1533, 1551, 1579, 1589, 1754, 2002, 2009, 2073, 2101, 2163, 2172, 2197 |
| Halothane | 355, 1355, 1612, 1755, 1900, 2014, 2073, 2177, 2184, 2194, 2383, 2460 |
| Hamamelis virginiana L. (See Witch Hazel) | 798 |
| Haptens | 2194, 2460 |
| Harmaline (Harmidine; 3H-Pyrido(3,4-b)indole, 4,9-dihydro-7-methoxy-1-methyl-)) | 1488, 1668 |
| Harmalol | 1488 |
| Harmane | 1488 |
| Harmine | 1488, 1668 |
| Harmine derivatives (Peganum harmala)(Harmine, Harmaline, Harmalol, Harmol and Harmane) | 1488 |
| Harmol | 1488, 2434 |
| Harpagophyti radix (devil’s claw) | 1317 |
| Hatomarubigin | 1963 |
| Hawthorn (Crataegus oxyacantha L.) | 355 |
| Heavy metals | 953, 968, 1241 |
| Helenalin | 2177, 2209, 2217, 2220, 2453 |
| Helioxanthin | 1791 |
| Hemagglutinins | 2200 |
| Heme arginate | 1756 |
| Hemin | 356, 1106, 2111, 2117, 2300, 2460 |
| Hempa | 1355 |
| Heparan sulfate proteoglycans | 2213 |
| Heparin | 356, 943, 1171, 1182, 2056, 2058, 2226, 2519 |
| Heparitin sulfate | 2519 |
| Hepatitis A Vaccine | 357, 2215 |
| Hepatitis B Immune Globulin | 357 |
| Hepatitis B Vaccine | 358, 2215 |
| HEPES buffer | 875 |
| Heptachlor | 1188, 1978, 1989, 2041, 2045, 2376, 2397, 2432, 2446, 2473 |
| Heptachlor epoxide | 1295, 1188, 2026, 2041, 2045 |
| Heptanol | 1248 |
| Heptenophos | 1040 |
| Herbal compound 861 | 2117 |
| Herbal extracts | 1011 |
| Herbal medicines | 875, 1317, 1757 |
| Herbal products | 1489 |
| Herbal supplements | 1287, 1317, 1415, 1759, 2488 |
| Herbicides | 1295, 2106, 2111, 2121, 2340 |
| Herbimycin | 1295, 2177, 2184, 2194 |
| Herceptin | 1961 |
| Heroin | 875, 1242, 1243, 2160 |
| Hesperidin (Hesperitin) | 943, 953, 971, 1011, 1097, 1287, 1372, 1385, 1961, 1978 |
| Hesperitin (See Hesperidin) | 943, 953, 971, 1011, 1097, 1287, 1372, 1385, 1961, 1978 |
| HET0016 (N-hydroxy-N’-(4-butyl-2-methylphenyl)-formamidine) | 1759 |
| Heteroaryl substituted 1,2,5,6-tetrahydropyrrolo[3,2,1-ij]quinolin-4-one derivatives | 1939 |
| Heteroaryl-substituted dihydronaphthalenes and indenes | 1759 |
| Heterocyclic amines | 1759 |
| Heterocyclic aromatic amines (2-Amino-1-methyl-6-phenylimidazo[4,5-b]pyridine, 2-amino-3-methylimidazo[4,5-f]quinolone, and 2-amino-3,8-dimethylimidazo[4,5-f]quinoxaline | 1317 |
| Heterocyclic compounds | 1334, 2106, 2296, 2432 |
| Hexabrominated diphenyl ether 153 | 1097, 1188, 1295 |
| Hexabromocyclododecane | 1097, 1216, 1295, 1334 |
| Hexachlorobenzene | 1097, 1100, 1188, 1216, 1295, 1334, 1346, 1612, 2019, 2022, 2073, 2101, 2111, 2117, 2153, 2177, 2184, 2194, 2200, 2204, 2209, 2217, 2224, 2323, 2423, 2425, 2432, 2436, 2446, 2465, 2513 |
| Hexaconazole | 1978 |
| Hexadecyl-N-methylpiperidinium | 1171, 1182 |
| Hexanols | 2168 |
| Hexanones | 1222, 1233, 1236 |
| Hexestrol | 2436 |
| Hexobarbital | 1423, 2194 |
| Hexoprenaline | 1077 |
| Hexylglutathione | 2106, 2111 |
| HhAntag691 (GDC-0449)(Hedgehog pathway inhibitor) | 938 |
| HI-6 [1-(4-carbamoylpyridinium)-3-(2-hydroxyimino methylpyridinium) oxapropane dichloride] | 947, 1040, 1196, 1612, 1643 |
| High-amylose cornstarch | 1922 |
| (-)-Hinokinin | 1791 |
| Hippuric acid | 1398 |
| Hippuryl-histidyl-leucine | 1034 |
| Hispidulin | 855 |
| Histamine | 1073, 1080, 2154, 2204, 2220, 2460 |
| Histamine H1 receptor antagonists | 1487 |
| Histamine trifluoromethyl-toluidide | 2155 |
| Histaprodifen | 2155 |
| Histidine | 1598 |
| Histone deacetylase inhibitors (Valproic acid, Phenylbutyrate, and Trichostatin A) | 1363 |
| Histone methyltransferase MLL1 | 875 |
| Histrelin | 358 |
| HIV protease inhibitors | 876, 937, 1011, 1761, 1922 |
| HLo 7 | 1040 |
| HM-30181 | 876, 1761 |
| HMG-CoA reductase inhibitors | 1143 |
| HMR 1098 | 2490 |
| HMR 1556 | 2229, 2236 |
| HMR1766 (nitric oxide (NO)-independent activator of soluble guanylyl cyclase) | 1603 |
| HNF4Alpha | 938 |
| Hoechst 33342 | 1011, 1022 |
| Homatropine | 359, 1242 |
| Homoeriodictyol | 1742 |
| Homopiperazine derivatives | 1761 |
| Homosalate | 1188 |
| Honey | 1494, 1761 |
| Honghua | 1312 |
| Honokiol (Magnolia officinalis extract) | 819, 992, 2204, 2372 |
| Honokiol and Flavonoids | 876 |
| Hoodia gordonii (Oxypregnane steroidal glycoside P57AS3) | 1761 |
| Hoodigogenin A | 1761 |
| Hop-containing products | 1389, 1762 |
| Hops (Humulus lupulus L) | 359, 1762, 1932 |
| Houttuynia cordata plant extract | 2460 |
| HS 142-1 | 1943 |
| HS 1030 | 1222, 1233, 1236, 1238, 2376 |
| HS 1183 | 1222, 1233, 1236, 1238, 2376 |
| HS 1199 | 1222, 1233, 1236, 1238, 2376 |
| HS 1200 | 1222, 1233, 1236, 1238, 2376 |
| Ht31 | 820 |
| HU 211 | 1259, 2460 |
| Huanglian [Rhizoma coptidis L.] (Coptisine, Epiberberine, Berberine, Jateorrhizine, Palmatine and Magnoflorine) | 1318, 1491 |
| Human papillomavirus quadrivalent (types 6, 11, 16, and 18) vaccine, recombinant | 359 |
| Humulene | 2460 |
| Humulus lupulus L. (See Hops) | 359, 1762, 1932 |
| Huperzia serrata Thunb (See Huperzine A) | 360, 1038, 1040, 1176, 1334, 1612, 2473 |
| Huperzine A (Huperzia serrata Thunb) | 360, 1038, 1040, 1176, 1334, 1612, 2473 |
| Hyaluronan | 1011, 1143 |
| Hyaluronic acid | 2194, 2276, 2333, 2425, 2446, 2460 |
| Hyaluronidase (Human Recombinant) | 360, 1144 |
| Hybrid flavan-chalcones | 1958 |
| Hydantoin | 876 |
| Hydralazine | 361, 1083, 1088, 1099, 1114, 1236, 1241, 1252, 1261, 2006, 2041, 2117, 2125, 2129, 2135, 2177, 2209, 2217, 2259, 2272, 2295, 2296, 2317, 2331, 2395, 2402, 2412, 2460, 2473 |
| Hydramethylnon | 927, 2397 |
| Hydrastis canadensis (See Goldenseal) | 1491, 1751 |
| Hydratropic acid | 2493 |
| Hydratropic aldehyde | 2106, 2111, 2117 |
| Hydrazine | 1118, 1120, 1161, 1216, 1218, 1222, 1264, 1295, 1612, 2041, 2053, 2242, 2245, 2249, 2250, 2335, 2338, 2340, 2345, 2362, 2394, 2395 |
| Hydrazones | 1943 |
| Hydrocarbons | 1216, 2259 |
| Hydrochloric acid | 2209, 2460, 2479 |
| Hydrochlorothiazide | 361, 971, 1032, 1035, 1051, 1086, 1939, 2372, 2377, 2408, 2522 |
| Hydrocinchonine and Cinchonine | 876 |
| Hydrocodone | 362, 1494, 1762 |
| Hydrocortisone | 363, 930, 962, 965, 1088, 1188, 1248, 1900, 2041, 2045, 2106, 2177, 2194, 2209, 2317, 2372, 2393, 2446, 2453, 2483, 2513 |
| Hydrocotarnine | 1762 |
| Hydrodolasetron | 1762 |
| Hydrogen | 2312 |
| Hydrogen peroxide | 1026, 1027, 1088, 1114, 1182, 1208, 1216, 1233, 1241, 1264, 1267, 1295, 1346, 1900, 2013, 2026, 2066, 2073, 2078, 2088, 2091, 2106, 2111, 2117, 2137, 2147, 2150, 2180, 2194, 2209, 2217, 2220, 2238, 2245, 2254, 2274, 2276, 2296, 2300, 2305, 2308, 2320, 2345, 2347, 2352, 2365, 2372, 2376, 2420, 2423, 2425, 2430, 2442, 2446, 2460, 2465, 2473, 2513, 2519, 2528 |
| Hydrolyzable tannins | 1295, 1334, 1612, 2308 |
| Hydromorphone | 364, 1762 |
| Hydrophilic organic solvents | 1762 |
| Hydroquinone | 365, 1097, 1106, 1261, 1295, 1603, 2073, 2109, 2111, 2117, 2121, 2194, 2200, 2204, 2209, 2217, 2220, 2276, 2278, 2308, 2423, 2460, 2473 |
| Hydroxocobalamin(Vitamin B12a) | 365 |
| Hydroxyacetylaminofluorene | 1216, 2434, 2436 |
| Hydroxybupropion | 1368 |
| Hydroxycarbamide (See Hydroxyurea) | 367, 1222, 1494, 1762, 2125, 2212, 2241, 2272, 2420, 2468, 2473 |
| Hydroxychalcones | 1318 |
| Hydroxychloroquine | 366, 1510, 2287 |
| Hydroxycinnamic acids | 953 |
| Hydroxyebastine | 1617, 1726 |
| Hydroxyeicosatetraenoic acid | 1110, 1111 |
| Hydroxyeicosatetraenoic acids | 1111, 2204 |
| Hydroxyflutamide | 1188 |
| Hydroxyhydroquinone | 943, 1346, 1986, 2139, 2209, 2217, 2227 |
| Hydroxylamine | 1216 |
| Hydroxymethyltolbutamide | 1400 |
| Hydroxyphenytoin | 2312, 2490, 2494, 2495 |
| Hydroxypropyl Cellulose | 367 |
| Hydroxypropyl Methylcellulose (Hypromellose) | 367, 1922 |
| Hydroxytamoxifen | 965, 2026, 2041, 2045, 2073, 2279, 2490 |
| Hydroxytryptophol | 2434 |
| Hydroxyurea (Hydroxycarbamide) | 367, 1222, 1494, 1762, 2125, 2212, 2241, 2272, 2420, 2468, 2473 |
| Hydroxywarfarin metabolites | 1389 |
| Hydroxyzine | 368, 876, 1494 |
| Hymecromone | 2490, 2493 |
| Hyoscyamine | 368 |
| Hypaconitine | 1318 |
| Hyperforin (See St. John’s Wort) | 701, 876, 914, 927, 1178, 1295, 1400, 1420, 1491, 1494, 1762, 1868, 1900, 1910, 2178, 2312 |
| Hypericin | 914, 927, 1011, 1295, 1900, 2106, 2117 |
| Hypericum perforatum L. (See St. John’s Wort) | 701, 876, 914, 927, 1178, 1178, 1295, 1400, 1420, 1491, 1494, 1762, 1868, 1900, 1910, 2178, 2312 |
| Hyperoside | 2300 |
| Hypnosedatives | 1495, 1763 |
| Hypnotics | 1658 |
| Hypochlorous acid | 1040, 2338 |
| Hypocretins | 1940 |
| Hypoglycemic drugs | 876 |
| Hypophyllanthin | 1492 |
| Hypoxanthine | 2291 |
| Hypoxia inducible factor 1-alpha inhibitor YC-1 | 877 |
| Hypromellose (See Hydroxypropyl Methylcellulose) | 367, 1922 |
| Hypsiziprenol A9 | 1222, 2376 |
| HZ08 | 877 |
| I | |
| I’m-Yunity (Coriolus versicolor) | 1766 |
| I-387 | 877 |
| Ibandronate | 370 |
| Ibogaine | 1007, 1495 |
| Ibritumomab | 370 |
| Ibrolipim (NO-1886) | 820, 992, 1763, 1925 |
| Ibudilast | 2184, 2204, 2217, 2220 |
| Ibuprofen | 371, 1088, 1171, 1182, 1222, 1259, 1318, 1373, 1377, 1390, 1400, 1495, 1763, 1963, 1978, 2073, 2121, 2184, 2188, 2194, 2198, 2204, 2209, 2217, 2256, 2278, 2300, 2308, 2317, 2340, 2345, 2361, 2367, 2369, 2372, 2376, 2377, 2385, 2394, 2403, 2404, 2406, 2408, 2410, 2411, 2420, 2423, 2439, 2460, 2490, 2493, 2513, 2519 |
| Ibutilide | 372 |
| IC261 | 1273, 2473 |
| IC87114 | 2101, 2204 |
| Icariin | 877, 2073, 2423, 2446 |
| Icatibant | 1088, 1197, 2377 |
| ICI89406 | 1073 |
| ICI118551 | 1080, 1082, 2232 |
| ICI164384 | 1188, 2041 |
| ICID7114 | 1082 |
| Idarubicin | 372, 943 |
| Idebenone | 373, 1318, 1495, 2422 |
| IDN 5109 | 2519 |
| Idoxuridine | 2481 |
| Ifetroban | 2439 |
| Ifosfamide | 374, 1102, 1355, 1368, 1390, 1415, 1763, 1815, 1900, 2111, 2115, 2117, 2121, 2194, 2209, 2311, 2460 |
| IG9 | 886 |
| IH636 grape seed proanthocyanidin extract | 1612 |
| IL-2-granzyme A chimeric protein | 877 |
| Ilaprazole | 1416 |
| Iloperidone | 374, 1495 |
| Iloprost | 375, 2194, 2209, 2364, 2372, 2446 |
| Imatinib | 375, 877, 927, 1024, 1026, 1196, 1197, 1271, 1374, 1390, 1495, 1553, 1764, 2182, 2188, 2238, 2242, 2329, 2330, 2331, 2376, 2379, 2416, 2519 |
| Imazalil | 927, 962, 1097, 1188, 1295, 1765, 1978, 2312 |
| Imidacloprid | 1765, 1803 |
| Imidafenacin | 1765 |
| Imidapril | 1032, 1087, 1242, 1243 |
| Imidaprilat | 1034, 1087, 1088 |
| Imidazoles | 1080, 1383, 1612, 2101, 2111, 2492, 2494 |
| Imidazolium-bis(imidazole)dimethyl sulfoxideimidazotetrachlororuthenate(III) | 812 |
| Imidazolyl derivatives of 4,7-disubstituted coumarins (7-(3,4-difluorophenoxy)-4-imidazolylmethyl coumarin 24) | 1963 |
| Imiglucerase | 376 |
| Imipenem and Cilastatin | 377 |
| Imipramine | 378, 1077, 1334, 1416, 1423, 1478, 1482, 1496, 1524, 1533, 1558, 1569, 1579, 1589, 1765, 1900, 2053, 2065, 2066, 2073, 2117, 2494, 2495 |
| Imiquimod | 378, 2179, 2184, 2209, 2217, 2446, 2460 |
| Immune Globulin, Intramuscular | 379 |
| Immune Globulin, Intravenous | 379 |
| Immunomycin | 2266 |
| Immunosuppressants | 878, 1766 |
| Imperatorin | 1295, 1316, 1334, 1346 |
| IN1130 | 1498, 1766 |
| IN2001 | 1766 |
| Inamrinone | 380 |
| Inchin-ko-to | 953, 1261, 2331, 2446 |
| Incomplete Freund’s adjuvant | 2200 |
| Indacaterol | 381 |
| Indan | 1097, 1334 |
| Indanone | 1334 |
| Indans | 1097, 1188, 1943, 1978, 2041, 2045 |
| Indapamide | 381, 1766 |
| Indazole piperazine and indazole piperidine inhibitors of ROCK-II | 1767 |
| Indene | 2493 |
| Indenestrol | 2041, 2045 |
| Indeno(1,2,3-cd)pyrene | 1097 |
| Indigo | 1097, 1295, 1355 |
| Indigo carmine | 925 |
| Indinavir | 382, 878, 953, 1551, 1553, 1767, 1900, 2200, 2323, 2460, 2488 |
| Indiplon | 1498 |
| Indirubin | 1097, 1233, 1287, 2184, 2209, 2212, 2376 |
| Indisulam (E7070) | 1237 |
| Indole | 1097, 1216, 1355, 2267 |
| Indole-3-acetic acid | 1398 |
| Indole-3-carbaldehyde | 1216 |
| Indole-3-carbinol | 927, 1024, 1097, 1119, 1188, 1208, 1209, 1216, 1222, 1233, 1236, 1238, 1287, 1295, 1318, 1327, 1334, 1346, 2041, 2106, 2111, 2121, 2194, 2308, 2372, 2460 |
| Indoleacetic acid | 1097 |
| Indolealkylamines | 1498 |
| Indoles | 2041, 2045, 2376 |
| Indoline | 1498, 1767 |
| Indolo(3,2-b)carbazole | 1024, 1097 |
| Indomethacin | 383, 878, 943, 962, 965, 1012, 1091, 1092, 1114, 1172, 1182, 1216, 1218, 1220, 1222, 1233, 1236, 1295, 1334, 1346, 1368, 1390, 1498, 1583, 1612, 1978, 1986, 1992, 2013, 2019, 2073, 2078, 2091, 2101, 2111, 2121, 2178, 2184, 2194, 2198, 2200, 2204, 2209, 2217, 2220, 2253, 2256, 2276, 2278, 2301, 2305, 2308, 2330, 2331, 2340, 2341, 2345, 2360, 2365, 2366, 2367, 2369, 2372, 2376, 2405, 2406, 2407, 2408, 2410, 2423, 2432, 2446, 2448, 2449, 2453, 2460, 2465, 2473, 2483, 2490, 2493, 2495, 2519, 2525 |
| Indomethacin phenethylamide (LM-4108) | 1498, 1589, 1767, 1900, 2372 |
| Indonesian medicinal plants (Alpinia galanga rhizome; Cinnamomum burmannii bark; Foeniculum vulgare seed; Melaleuca leucadendron leaf; Piper nigrum fruit; Strychnos ligustrina wood; Tinospora crispa stem; Zingiber cassumunar rhizome): | 1492 |
| Indoprofen | 2493 |
| Inducers (CYP inducers) | 938 |
| Industrial fungicides | 1097, 1216 |
| Inflammatory cytokines (TNF-alpha, IL-6, and IL-1beta) | 953 |
| Infliximab | 384, 1318, 1965, 2058, 2455, 2466 |
| Influenza immunization | 1768 |
| Influenza Virus Vaccine | 385 |
| Ingenol dibenzoate | 2345 |
| Ingenol-3-angelate (PEP005) | 878 |
| Inhaled corticosteroids | 1093 |
| Inhibins | 1947 |
| Inhibitors (CYP inhibitors) | 953 |
| Inositol | 2078 |
| Inositol 1,4,5-trisphosphate | 2013 |
| Insecticides | 2106, 2111, 2121, 2338 |
| Insecticides in Helicoverpa armigera | 878 |
| Insulin | 385, 992, 1058, 1145, 1923, 2208 |
| Integrase inhibitors | 1768 |
| Interesterified oils | 1923 |
| Interferon | 1227, 1984 |
| Interferon alpha | 1768, 2093, 2201, 2204, 2217, 2398 |
| Interferon Alpha-2a | 386, 2321, 2215 |
| Interferon Alpha-2b | 387, 879, 1318, 1498 |
| Interferon Alphacon-1 | 388 |
| Interferon Alpha-n3 | 388 |
| Interferon Beta | 2144 |
| Interferon Beta-1a | 388 |
| Interferon Beta-1b | 389, 1145 |
| Interferon Gamma (IFNG) | 1012 |
| Interferon Gamma-1b | 390 |
| Interferons | 1498 |
| Interleukin 1 (IL-1) | 1547, 1923 |
| Interleukin 1 receptor antagonist protein | 1261 |
| Interleukin-1beta | 1145, 1768 |
| Interleukin-1alpha | 1145 |
| Interleukin-2 | 879, 1012, 1768 |
| Interleukin-4 | 1603 |
| Interleukin-6 | 879, 1145, 1319, 1604, 1768 |
| Interleukin-8 | 1145 |
| Interleukin-10 | 992 |
| Interleukin-17 | 1145 |
| Intravenous fat emulsions | 2194 |
| Iodides | 2392, 2393 |
| Iodine | 2073, 2201, 2372, 2393, 2460 |
| Iodipamide Meglumine | 390 |
| Iodixanol | 390 |
| Iodoacetamide | 1242, 1900, 2111, 2296 |
| Iodoacetates | 927, 2073 |
| Iodoacetic acid | 2296 |
| Iodocyanopindolol | 1071, 1073, 1080 |
| Iodoquinol | 391 |
| Iodoresiniferatoxin | 2479 |
| Iohexol | 391 |
| Ionomycin | 1248, 1978, 1995, 2073, 2184, 2194, 2201, 2209, 2217, 2241, 2266, 2460 |
| Ionophores | 2212, 2213 |
| Iopamidol | 391 |
| Iothalamate Meglumine | 392 |
| Ioversol | 392 |
| Ioxaglate Meglumine and Ioxaglate Sodium | 392 |
| Ipecac alkaloids | 1771 |
| Ipecac Syrup | 393 |
| IPP | 1942 |
| Ipratropium | 393 |
| Ipriflavone | 1319, 1771, 2041, 2045 |
| Iprodione | 1097, 1978, 2041 |
| Iproplatin | 2106 |
| Irbesartan | 394, 839, 1001, 1063, 1087, 1091, 1092, 1119, 1146, 1197, 1377, 1390, 1400, 1498, 1583, 1771, 1939, 2023, 2305 |
| Ircinin-1 | 1222, 1236, 1238, 2376 |
| Irinotecan | 394, 879, 927, 938, 943, 953, 962, 968, 971, 1012, 1024, 1027, 1088, 1103, 1114, 1115, 1197, 1231, 1238, 1242, 1243, 1334, 1355, 1368, 1377, 1400, 1423, 1444, 1498, 1589, 1613, 1771, 1900, 1995, 2008, 2019, 2028, 2073, 2115, 2135, 2145, 2184, 2188, 2194, 2201, 2209, 2272, 2273, 2274, 2279, 2280, 2308, 2317, 2363, 2405, 2415, 2460, 2468, 2473, 2481, 2488, 2490, 2528 |
| Iron | 943, 1161, 1172, 1216, 1222, 1355, 1469, 1772, 2078, 2106, 2111, 2129, 2184, 2194, 2209, 2220, 2308, 2338, 2402, 2420, 2442, 2446, 2460, 2473 |
| Iron chelate (iron N-(2-hydroxy acetophenone) glycinate) | 879 |
| Iron chelating agents | 2184, 2204, 2220, 2519 |
| Iron Dextran Complex | 395, 1216, 2473 |
| Iron Sucrose | 396 |
| Irosustat | 1374, 1964 |
| Irsogladine | 1772 |
| Isobutyl nitrite | 2519 |
| Isocarboxazid | 396 |
| Isocoumarins and phthalides from the endophytic fungus Colletotrichum sp. | 1964 |
| Isocyanates | 2184, 2194, 2209, 2220, 2460, 2473 |
| Isocyanides | 1773 |
| Isocytisoside | 1216 |
| Isoeugenol | 1188 |
| Isofenphos | 1188, 2041 |
| Isoflavones | 943, 1012, 1044, 1111, 1261, 1964, 1993, 2041, 2045, 2078, 2107, 2188, 2245, 2259, 2308 |
| Isoflurane | 397, 959, 1172, 1183, 1201, 1930, 1964, 2073, 2178, 2194, 2209, 2301, 2460, 2465 |
| Isoflurane-chlorodifluoroethene interaction | 1773 |
| Isoflurophate | 1040 |
| Isoimperatorin | 1097, 1295, 1316, 1346 |
| Isolevuglandins | 1984 |
| Isoliquiritigenin | 2490 |
| Isomethyleugenol | 2106, 2111, 2117 |
| Isoniazid | 397, 812, 979, 1242, 1377, 1381, 1498, 1604, 1613, 1773, 1900, 2121, 2295, 2296, 2423 |
| Isonicotinamide | 2345 |
| Isopentenyl pyrophosphate | 1229, 2184, 2516 |
| Isopimpinellin | 1097, 1295, 1334, 1346, 2106, 2117, 2312, 2314 |
| Isoprene | 1773 |
| Isopropyl 4,4′-dibromobenzilate | 1188, 1978, 2041, 2045 |
| Isoproterenol | 398, 1072, 1077, 1080, 1081, 1082, 1216, 1248, 1295, 1334, 2073, 2098, 2198, 2213, 2229, 2236, 2446, 2460 |
| Isoproturon | 1116, 1365, 2061, 2125, 2259, 2280, 2282, 2312 |
| Isoquercitrin | 2301 |
| Isoquinoline alkaloids | 854, 1288, 1319, 1363 |
| Isoquinolines | 2317 |
| Isorhamnetin | 1286, 1342 |
| Isorhapontigenin | 1088, 2073 |
| Isosafrole | 927, 1097, 1295, 1334, 1604, 1900, 2121 |
| Isosilybin A | 959 |
| Isosilybin B | 959 |
| Isosorbide Dinitrate | 398, 1773, 1939, 2013, 2301 |
| Isosorbide Mononitrate | 399 |
| Isothiocyanates | 1319, 1492, 1773, 2106, 2117, 2121, 2308 |
| Isotocin | 1248 |
| Isotretinoin | 400, 1060, 1146, 1222, 1261, 1265, 1900, 1986, 2019, 2078, 2111, 2188, 2194, 2201, 2204, 2209, 2217, 2224, 2247, 2276, 2312, 2367, 2372, 2442, 2446, 2460, 2488, 2492, 2519 |
| Isovaleric acid | 2493 |
| Isoxanthohumol | 942, 1762, 2041 |
| Isoxsuprine | 401 |
| Isradipine | 401, 1900 |
| Istradefylline | 1773 |
| Itopride hydrochloride | 1773 |
| Itraconazole | 402, 843, 879, 927, 1416, 1487, 1499, 1551, 1773, 1900, 1978, 2184, 2201, 2204, 2312 |
| Ivabradine | 403, 1774 |
| Ivermectin | 403, 840, 880, 885, 927, 1012, 1774 |
| Ixabepilone | 404, 880, 1012, 1774 |
| J | |
| J 104132 | 2014 |
| Jaceosidin | 1315, 1319, 1388, 1474 |
| Japanese Encephalitis Virus Vaccine (Inactivated) | 405 |
| Jateorrhizine | 844, 904, 1318, 1450, 1491 |
| JBT 3002 | 2460 |
| Jiang-Zhi-Ning | 1923 |
| Jiawei Sanleng | 1964 |
| JK1624F2-1 | 2041, 2045 |
| JM216 (Bis-acetato-ammine-dichloro-cyclohexylamine-platinum IV) | 1774 |
| JM 3100 | 1229, 2212, 2213, 2301 |
| JTE 607 | 2209, 2460 |
| Jukcho solution (See Bamboo) | 1666 |
| Juzentaihoto | 2220, 2453 |
| JYL1421 | 2479 |
| K | |
| K02 (Morpholine-urea-Phe-Hphe-vinylsulfone) | 1774 |
| K11777 (N-Methyl-piperazine-Phe-homoPhe-vinylsulfone-phenyl) | 1775 |
| K14/K5 | 1012 |
| K-2-11 (Amphiphilic dihydropyridine antioxidant derivative) | 880 |
| Kaempferol | 880, 939, 943, 1013, 1034, 1097, 1216, 1231, 1248, 1270, 1286, 1295, 1306, 1775, 1992, 2041, 2045, 2073, 2117, 2178, 2194, 2312, 2314, 2346, 2460, 2490 |
| Kaempferol glycosides from the fern Neocheiropteris palmatopedata (Palmatosides A, B, C; Multiflorins A, B; Afzelin) | 1964 |
| Kaempferol-3-O-(2,3-di-O-acetyl-alpha-L-rhamnopyranoside) | 1897 |
| Kaempferol-3-O-(2,3,4-tri-O-acetyl-alpha-L-rhamnopyranoside | 1897 |
| Kahweol | 1613, 1295, 2111, 2272, 2308, 2432 |
| Kahweol palmitate | 2106, 2111, 2308 |
| Kainic acid | 1267, 2073, 2194, 2460 |
| Kamebakaurin | 2460 |
| Kampo medicines | 880, 1775 |
| Kanamycin | 406 |
| Kava kava (Piper methysticum) | 880, 1491, 1751, 1775 |
| Kavain (See Kawain) | 881, 927, 1775 |
| Kavalactone pharmacophores | 881, 1775 |
| Kawain (Kavain) | 881, 927, 1775 |
| KBH-A42 | 881 |
| KBR7785 | 2019, 2194 |
| KBR8301 | 2465 |
| KC500 | 2314 |
| KCC009 | 2101 |
| Kenpaullone | 2073 |
| Ketamine | 406, 1007, 1250, 1251, 1252, 1295, 1353, 1363, 1390, 1499, 1613, 1775, 2194, 2209, 2306, 2367, 2372, 2395, 2460 |
| Ketamine and Norketamine | 1353 |
| Ketanserin | 2164 |
| Ketobemidone | 1390, 1500, 1776 |
| Ketoconazole | 407, 881, 927, 962, 1097, 1295, 1334, 1346, 1368, 1377, 1383, 1400, 1423, 1500, 1533, 1551, 1579, 1589, 1613, 1776, 1900, 1911, 1943, 2053, 2184, 2201, 2204, 2317 |
| Ketoconazole derivatives | 1776 |
| Ketone bodies | 1027, 1043, 1044, 1161, 1173, 1183, 1989, 2014, 2061, 2097, 2242, 2249, 2257, 2296, 2302, 2308, 2386, 2403, 2418, 2511 |
| Ketopiperazine-based renin inhibitors | 1776 |
| Ketoprofen | 408, 1173, 1374, 1391, 1500, 2209, 2212, 2217, 2406, 2408, 2410, 2420, 2460, 2490, 2493, 2495 |
| Ketoprolac | 1194 |
| Ketorolac | 409 |
| Ketotifen | 410, 2155 |
| Keyhole-limpet hemocyanin | 2204 |
| KF58333 | 2026 |
| KH1060 | 1233, 1236, 1238, 2376, 2516 |
| Klebsiella pneumoniae endotoxin | 1604 |
| KMUP 1 | 2460 |
| KN62 | 2013, 2073, 2305 |
| KN93 | 1222, 1943, 2376 |
| KNG-I-322 (Desmosdumotin B derivative) | 881 |
| KNI-272 | 1776 |
| Kojic acid | 1047, 1082, 1173, 1183, 1924, 2209 |
| Kolaviron | 1216 |
| Korean herbal medicines | 1492 |
| KR-31543 | 1776 |
| KR-32570 | 1776 |
| KR-33028 | 1776 |
| KR-60436 | 1776 |
| KR-62980 | 1828 |
| KR-63198 | 1828 |
| KR66222 | 859 |
| KR66223 | 859 |
| KRN 7000 | 2220 |
| Kruppel-like factor 5 | 1013 |
| KT5720 | 927, 2305, 2418 |
| KT5823 | 2013 |
| Kuguacin J | 881 |
| L | |
| L165041 | 992 |
| L245976 | 1188 |
| L364373 | 2229, 2236 |
| L663536 | 1111, 2217, 2340 |
| L663581 | 2079 |
| L694247 | 2161 |
| L741626 | 2002, 2004 |
| L742694 | 962, 965, 979, 1103, 1116, 1243, 1334, 2066, 2156, 2312, 2314, 2401, 2432, 2433, 2435, 2490 |
| L748337 | 1082 |
| L748706 | 2372 |
| L754394 | 1501, 1777 |
| L775606 | 1777 |
| L779976 | 2427 |
| L826141 | 1248 |
| LAAM | 1403 |
| L-Lysine | 411 |
| Labetalol | 411, 1072, 1078, 2490 |
| Lacidipine | 412 |
| Lactacystin | 1173, 1183, 2292, 2420, 2460 |
| Lactase | 412 |
| Lactates | 2301 |
| Lactic acid | 2301, 2394 |
| Lactobacillus | 412 |
| Lactobacillus acidophilus ATCC 43121 | 1924 |
| Lactobacillus bulgaricus OLL1181 | 1288 |
| Lactobacillus plantarum KCTC3928 | 1924 |
| Lactobacillus rhamnosus | 1777 |
| Lactones | 2174, 2338 |
| Lactose | 2243 |
| Lactostatin | 1924 |
| Lactosylceramide | 881 |
| Lactulose | 413, 2243 |
| Lafutidine | 2155, 2479 |
| lambda-Cyhalothrin | 1365 |
| Laminin | 1146 |
| Lamivudine | 413, 968, 2128, 2446, 2456 |
| Lamotrigine | 414, 882, 927, 2134, 2232, 2387, 2492, 2494 |
| Landomycin E (Anthracycline-related angucycline) | 939 |
| Lanreotide | 414 |
| Lansoprazole | 415, 882, 1216, 1295, 1334, 1346, 1416, 1525, 1544, 1777 |
| Lanthanum | 416, 2190 |
| Lanthanum carbonate | 1146 |
| Lapachenole | 1778 |
| Lapachol [2-Hydroxy-3-(3-methyl-2-butenyl)-1,4-naphthoquinone] | 884 |
| Lapatinib | 416, 882, 1013, 1222, 1233, 1778, 1964, 2018, 2019, 2025, 2026, 2041 |
| LAQ824 | 2376 |
| Laquinimod | 1778, 1900 |
| Lard | 2446 |
| Laromustine (Cloretazine, VNP40101M) | 1319, 1778 |
| Laronidase | 417 |
| Laropiprant | 1374, 1583 |
| Lasalocid | 2266 |
| Laserpitin from Angelica keiskei | 1924 |
| Lasofoxifene | 417, 1501, 1533, 1778, 2488, 2492 |
| Latanoprost | 418, 2363 |
| Laurates | 1613 |
| Lauric acid | 1400, 1613, 1778, 1904, 1906, 2493 |
| Lauroylcarnitine | 836 |
| Lauroyl-coenzyme A | 2106 |
| LBT-999 | 1019 |
| LCI699 | 1939 |
| LE 540 | 2372 |
| Lead | 1040, 1100, 1183, 1216, 1907, 2019, 2125, 2184, 2270, 2317, 2338, 2423, 2516 |
| Lead acetate | 1216, 1241, 2019, 2032, 2106, 2111, 2117, 2270, 2279, 2330, 2379, 2467 |
| Lead chloride | 2013 |
| Lead chromate | 2528 |
| Lead nitrate | 1295, 1932, 2073, 2150, 2194, 2460, |
| LE-Cl2MDP | 962 |
| Leflunomide | 419, 1013, 1319, 1391, 1416, 1990, 2038, 2204 |
| Lemon juice | 1778 |
| Lenalidomide | 419, 1013, 2194, 2198, 2201, 2220, 2446, 2448, 2460, 2465, 2467 |
| Lentinan | 1295, 2460 |
| Lepirudin | 420 |
| Lepisorus contortus | 1964 |
| Leptomycin B | 1097, 2041, 2473 |
| Leptophos | 1188, 2041, 2045 |
| Lercanidipine | 1778 |
| Letrozole | 420, 1222, 1353, 1778, 1962, 1964, 1965, 1978, 2376 |
| Leucine-2-alanine enkephalin | 1248 |
| Leucorovin calcium | 2287 |
| Leucovorin (Folinic Acid) | 421, 882, 939, 962, 969, 1231, 1233, 2008, 2013, 2029, 2032, 2273, 2288, 2408, 2411, 2481 |
| Leukotriene B4 | 939, 969, 1909, 2184, 2204, 2217, 2220, 2340 |
| Leukotriene C4 | 939, 969, 943, 962, 2257 |
| Leukotriene D4 | 2178, 2446 |
| Leupeptin | 2198 |
| Leuprolide | 422, 1978, 2075, 2188, 2227, 2515 |
| Leu-Ser-Lys-Leu peptide | 2446 |
| Levalbuterol | 422, 1078 |
| Levallorphan | 1779 |
| Levamisole | 840, 2372 |
| Levetiracetam | 423, 882, 1474, 1501, 1583, 1779, 1977 |
| Levobunolol | 423, 1072 |
| Levobupivacaine | 424, 882,1779 |
| Levocabastine | 424 |
| Levocarnitine | 425 |
| Levocetirizine | 425 |
| Levodopa | 1032, 1263, 1989, 2003, 2260, 2322, 2326, 2420, 2434 |
| Levofloxacin | 426, 1319, 1416, 1478, 1497, 1779 |
| Levomepromazine (See Methotrimeprazine) | 474, 1482, 1502 |
| Levonorgestrel | 426, 883, 962, 1088, 1119, 1188, 1207, 1216, 1270, 1416, 1734, 1779, 2045, 2050, 2051, 2061, 2086, 2188, 2245, 2338, 2353, 2460, 2513, 2515, 2516, 2519 |
| Levormeloxifene | 2276 |
| Levorphanol | 427, 1263 |
| Levosimendan | 1779 |
| Levosulpiride | 883 |
| Levothyroxine | 428, 1779, 1991 |
| Levo-alpha-acetyl-methadol | 1779 |
| Lewisite | 2460 |
| LF 16-0687 | 1197 |
| LG 100268 | 930, 1222, 1233, 2345, 2376 |
| LG 100815 | 2379, 2423 |
| LG 268 | 1992 |
| Licochalcone A | 2194, 2209, 2367, 2372 |
| Licofelone | 2209, 2492 |
| Licorice (Glycyrrhiza uralensis Fisher) | 883, 1779 |
| Lidocaine | 428, 1319, 1334, 1779, 1900, 2073, 2209, 2412, 2479, 2519 |
| Lignan phytoestrogen | 1965 |
| Lignans | 939, 2026, 2312 |
| Lignocaine | 1780 |
| Ligusticum chuanxiong Hort (See Tetramethylpyrazine) | 918, 1120, 1248, 1490, 2074 |
| Ligustilide | 1319 |
| Ligustrazine | 883 |
| Lilopristone | 1657 |
| Limonene | 1780 |
| Limonin | 1739 |
| Linagliptin | 859, 883, 1374, 1391 |
| Lincomycin | 430 |
| Lindane (γ-Hexachlorocyclohexane) | 965, 1040, 1046, 1097, 1119, 1188, 1216, 1243, 1270, 1295, 1334, 1346, 1368, 1604, 1613, 1900, 1943, 1978, 2041, 2045, 2078, 2150, 2156, 2184, 2188, 2247, 2279, 2312, 2317, 2376, 2432, 2446, 2460, 2490 |
| Linezolid | 430, 1780 |
| Lingzhi (Ganoderma species) | 1341, 2460 |
| Linoleic acid | 824, 996, 1059, 1060, 1116, 1334, 1400, 1423, 1613, 1900, 2184, 2194, 2201, 2204, 2209, 2217, 2338, 2340 |
| Linoleic acid Hydroperoxide | 2106 |
| Linolenic acids | 2340 |
| Linoleoyl-Coenzyme A | 2106 |
| Linoleylanilide | 1040, 1261 |
| Linuron | 1097, 1188, 1295, 1346, 1978, 2019, 2041, 2188, 2451 |
| Liothyronine | 431 |
| Liotrix | 431 |
| Lipoarabinomannan | 2212, 2213, 2220 |
| Lipofundin | 2194 |
| Lipoic acid | 993 |
| Lipopeptidophosphoglycan | 2217, 2220, 2453, 2460 |
| Lipopolysaccharides | 812, 824, 883, 930, 943, 962, 965, 979, 996, 1026, 1042, 1062, 1080, 1083, 1161, 1183, 1188, 1216, 1248, 1252, 1259, 1267, 1270, 1295, 1319, 1334, 1613, 1984, 2041, 2053, 2073, 2106, 2117, 2129, 2150, 2165, 2168, 2178, 2180, 2184, 2188, 2190, 2194, 2198, 2201, 2204, 2209, 2212, 2213, 2217, 2220, 2224, 2236, 2245, 2247, 2249, 2256, 2257, 2276, 2302, 2303, 2305, 2308, 2312, 2314, 2317, 2321, 2323, 2327, 2331, 2340, 2341, 2345, 2346, 2346, 2352, 2357, 2359, 2363, 2367, 2372, 2376, 2400, 2406, 2410, 2411, 2423, 2430, 2439, 2446, 2448, 2453, 2460, 2465, 2467, 2483, 2513, 2516, 2519, 2523, 2526 |
| Lipostabil | 2461 |
| Lipoteichoic acid | 2185, 2204, 2212, 2213, 2217, 2453, 2461 |
| Lipoxin A4 | 2195, 2204, 2461 |
| Liquiritigenin (7,4′-Dihydroxyflavone) | 1319 |
| Liquiritin | 1308 |
| Liquorice | 1314 |
| Liraglutide | 432, 1146 |
| Lisdexamfetamine | 432, 1263, 1273, 1780 |
| Lisdexamfetamine dimesylate | 1502 |
| Lisinopril | 433, 883, 1033, 1052, 1087, 1091, 1781 2278 |
| Lisofylline | 887, 1781 |
| Lisuride | 434, 1725, 2002 |
| Lithium | 434, 1196, 1210, 1997, 2101, 2223, 2317, 2319, 2266, 2398 |
| Lithium chloride | 1013, 1097, 1222, 1265, 2041, 2101, 2185, 2201, 2376, 2473 |
| Lithocholic acid | 824, 930, 962, 965, 971, 1781, 1875, 1900, 1924, 1984, 2106, 2312, 2314, 2385, 2400, 2516 |
| Liu wei di huang wan | 1319, 1353 |
| Local anesthetics | 1781 |
| Lodoxamide | 435 |
| Lomefloxacin | 435 |
| Lomeguatrib | 2272 |
| Lomerizine derivative | 851 |
| Lomustine | 436, 927, 2272 |
| Lonafarnib | 1222, 1782, 2372, 2376, 2461 |
| Lonidamine | 1248 |
| Loperamide | 436, 883, 1019, 1242, 1503, 1782 |
| Lopinavir | 884, 954, 1216, 1553, 1560, 1583, 1782, 1900, 2323, 2415 |
| Loprazolam | 437 |
| Loracarbef | 437 |
| Loratadine | 438, 884, 1188, 1320, 1377, 1503, 1589, 1782, 1900, 2041, 2053, 2155 |
| Lorazepam | 439, 1306 |
| Lormetazepam | 439 |
| Lornoxicam | 440, 1391, 1584, 1783, 2209, 2367, 2372 |
| Losartan | 440, 839, 993, 1001, 1033, 1052, 1087, 1088, 1091, 1092, 1391, 1416, 1504, 1783, 2013, 2073, 2276, 2301, 2331, 2377, 2446, 2461, 2492 |
| Losigame | 1355 |
| Loteprednol | 441, 2317 |
| Lotronex | 1478, 1555 |
| Lovastatin | 442, 884, 927, 962, 1014, 1117, 1377, 1504, 1783, 1900, 1909, 1916, 2146, 2147, 2240, 2245, 2338, 2376, 2415, 2473 |
| Low molecular weight heparin | 1147 |
| Loxapine | 442, 1320, 1504, 1784 |
| Loxoribine | 2179, 2180, 2221 |
| Loxtidine | 2155 |
| LP-261 | 884 |
| LQB-118 | 884 |
| Lu 25-109 | 1784 |
| Lubiprostone | 443, 1248 |
| Luciferin-isopropyl acetal | 1784 |
| Lumiracoxib | 1173, 1391 |
| Lupane | 2185, 2221 |
| Lupeol (Lup-20(29)-en-3beta-ol) | 1014, 1216 |
| Lurasidone | 443 |
| Lutein | 2117 |
| Luteinizing hormone | 1288, 1342, 1965 |
| Luteinizing hormone-releasing hormone agonists | 1965 |
| Luteolin | 927, 943, 1014, 1216, 1233, 1248, 1286, 1327, 1742, 1961, 2041, 2045, 2073, 2178, 2180, 2185, 2204, 2461, 2468 |
| Luteolin 7-O-beta-glucoside | 1327 |
| Lutropin Alpha | 444 |
| LXR-623 | 993 |
| LXR-agonists (TO901317) | 996, 1103, 1924 |
| LY117018 | 2041 |
| LY171883 | 2340 |
| LY294002 | 1373 |
| LY320135 | 1259 |
| LY333531 | 1785 |
| Ly335979 | 1504 |
| LY344864 | 2073 |
| LY353381 | 2045, 2188, 2308 |
| LY2066948 | 2041, 2045 |
| Lycopene | 820, 1052, 1097, 1185, 1188, 1204, 1222, 1231, 1236, 1342, 1900, 2041, 2045, 2073, 2188, 2209, 2245, 2274, 2279, 2376, 2430, 2473 |
| Lycoris radiate | 1176 |
| Lynestrenol | 1785 |
| Lysophosphatidic acid | 1194, 2519, 2212, 2338 |
| Lysophosphatidylcholines | 2338 |
| Lysophosphatidylglycerol | 2338 |
| Lysophosphatidylinositol | 2338 |
| Lysophosphatidylserine | 2338 |
| L-alpha-acetylmethadol (LAAM) | 1403 |
| L-alpha-acetylmethadol (LAAM) and norLAAM | 1403 |
| M | |
| M17055 | 1785 |
| mAb-3A4a monoclonal antibody | 1786 |
| Mace | 1396 |
| Macelignan | 885 |
| Macrocyclic lactones | 885 |
| Macrocyclic pyridyl polyoxazoles | 885, 1014 |
| Macrolide antibiotics | 885, 1786 |
| Madecassic acid | 1383 |
| Madecassoside | 1306, 1408, 1490, 1662 |
| Mafenide | 445 |
| Mafosfamide | 1815 |
| Magnesium | 1103, 1116, 1212, 1786, 2155, 2465, 2516 |
| Magnesium carbonate | 978 |
| Magnesium Chloride | 445, 979, 1103 |
| Magnesium Citrate | 445 |
| Magnesium Glucoheptonate | 446 |
| Magnesium Gluconate | 446 |
| Magnesium Hydroxide | 446 |
| Magnesium L-Aspartate Hydrochloride | 447 |
| Magnesium L-lactate | 447 |
| Magnesium Oxide | 448 |
| Magnesium Salicylate | 448 |
| Magnesium Sulfate | 448 |
| Magnesium supplements | 1965 |
| Magnetic Fe3O4 nanoparticles | 886 |
| Magnoflorine | 1491 |
| Magnolia officinalis | 1176 |
| Magnolin | 1374 |
| Magnolol | 1320 |
| Malabaricone B | 2019, 2367, 2372 |
| Malabaricone C | 2019, 2367, 2372 |
| Malachite green | 1222, 1236, 2473 |
| Malaoxon | 1040 |
| Malassezin | 1097 |
| Malathion | 449, 1038, 1040, 1196, 1216, 1334, 1365, 1368, 1813, 1900, 2041, 2180, 2185, 2423, 2473 |
| Maleic hydrazide | 1100 |
| Maleimide | 2473 |
| Malondialdehyde | 1088, 2266 |
| Maltodextrin | 449 |
| Malvidin | 839, 1001, 2301, 2328 |
| Malvidin-3-galactoside | 839, 1001 |
| Malvidin-3-glucoside | 839, 1001, 2328 |
| Mancozeb | 1040, 1106, 1295, 2185, 2195, 2201, 2423, 2461 |
| Maneb | 1040, 1106, 1289, 1320, 1613, 2397, 2423 |
| Manganese | 449, 979, 1103, 1190, 1193, 1265, 2073, 2185, 2209, 2253, 2276, 2397, 2423, 2446, 2461 |
| Manganese chloride | 1265, 2209, 2379, 2397 |
| Manganese sulfate | 2446 |
| Mangifera indica extract | 1334, 2185 |
| Mangiferin | 902, 1026, 1216, 1334, 1613, 2178, 2179, 2185, 2442, 2446 |
| Manidipine | 1400, 1589, 1786 |
| Mannans | 2372 |
| Mannitol | 450, 927 |
| Manumycin | 2185, 2447 |
| Maprotiline | 450, 1504, 1786 |
| Maraviroc | 451, 1227, 1786 |
| Maribavir | 1504, 1584, 1787 |
| Marine macro-and microorganisms | 1966 |
| Marine sponge-derived sipholane triterpenoids | 886, 1014 |
| Masou salmon (Oncorhynchus masou) | 1924 |
| Mastoparan | 824, 1116 |
| Matricaria chamomilla L. (See Chamomile) | 144 |
| Matricaria recutita L. (See Chamomile) | 144, 1685 |
| Matrine and Oxymatrine (Sophora flavescens Ait) | 1604, 2473 |
| Maxacalcitol | 1980, 2376 |
| Mazaticol | 1487 |
| MB07811 | 1787 |
| MC70 | 886 |
| MC89 | 886 |
| MDL 100907 | 886 |
| MDR modulating agents | 886 |
| ME 3229 | 1024 |
| ME 3277 | 1024 |
| Measles Virus Vaccine (Live) | 451, 2134, 2138, 2140, 2144, 2200, 2216, 2219, 2452 |
| Measles, Mumps, and Rubella Vaccines (Combined) | 452, 2138, 2144, 2207, 2255, 2456 |
| Measles, Mumps, Rubella and Varicella Virus Vaccine | 452 |
| Mebendazole | 453, 840, 1295, 1334, 1666, 2266 |
| Mecamylamine | 453, 1173, 1183, 1200, 1254, 1256, 2209 |
| Mecarzole | 1188, 1978, 2041 |
| Mecasermin | 454 |
| Mechlorethamine | 454, 2026, 2213, 2279, 2473 |
| Meclizine (Meclozine) | 454, 1364, 1504, 2314, 2379 |
| Meclofenamate | 455, 1110 |
| Meclofenamic acid | 1173, 2013, 2306, 2420, 2461 |
| Meclozine (See Meclizine) | 454, 1364, 1504, 2314, 2379 |
| Mecoprop | 2185, 2461 |
| Medazepam | 1306 |
| Medetomidine | 1067, 1248 |
| Medium Chain Triglycerides | 456 |
| Medroxyprogesterone | 456, 1188, 1216, 1377, 2312 |
| Medroxyprogesterone acetate | 962, 1099, 1188, 1222, 1270, 1346, 1504, 1787, 1900, 2048, 2178, 2185, 2195, 2201, 2209, 2276, 2301, 2312, 2461, 2473, 2513, 2516, 2519 |
| Medrysone | 456 |
| Mefenacet | 1188, 1368 |
| Mefenamic Acid | 457, 1173, 1400, 1505, 2406, 2408, 2410, 2434, 2493 |
| Mefloquine | 457, 886, 943, 969, 971, 1787, 1900, 2236 |
| Megestrol | 458, 1264, 1966, 2379 |
| Meglitinide derivatives (Glinides) | 1788 |
| Melaleuca leucadendron leaf | 1492 |
| Melamine | 954 |
| Melatonin | 1173, 1183, 1188, 1216, 1295, 1320, 1334, 1346, 1423, 1482, 1604, 1965, 1966, 1978, 2041, 2045, 2185, 2195, 2201, 2209, 2217, 2276, 2289, 2290, 2312, 2317, 2423, 2461, 2476 |
| Melengestrol acetate | 2041 |
| Meloxicam | 459, 886, 927, 1183, 1249, 1391, 1505, 1788, 2372 |
| Melperone (Metylperon) | 1505, 1551, 1579 |
| Melphalan | 460, 886, 943, 1229, 1788, 2106, 2116, 2117, 2120, 2272, 2178, 2461, 2481 |
| Memantine | 460, 1040, 1788, 2097 |
| MEN 11270 | 1197 |
| MEN 11420 | 2437 |
| Menadione | 2497, 2504 |
| Menatetrenone | 2083 |
| Menhaden oil | 2185, 2221 |
| Meningococcal Group C-CRM197 Conjugate Vaccine | 461 |
| Meningococcal Polysaccharide (Groups A/C/Y and W-135) Diphtheria Toxoid Conjugate Vaccine | 461 |
| Meningococcal Polysaccharide Vaccine (Groups A/C/Y and W-135) | 461 |
| Menotropins | 462, 2038, 2075 |
| Menthofuran | 1788 |
| Menthol | 1353, 2073, 2468, 2479 |
| Mepenzolate | 462 |
| Meperidine (Pethidine) | 463, 1242, 1243, 1364, 1417, 1505, 1788 |
| Mephenytoin | 1334, 1364, 1368, 1423, 1505, 1861, 2312 |
| Mephobarbital (Methylphenobarbital) | 463, 1364, 1417, 1423, 1505, 1862, 2312 |
| Mepifiline | 2155 |
| Mepirodipine | 1368, 1400, 1423, 1589, 1862, 1900 |
| Mepivacaine | 464, 2479 |
| Meprobamate | 464 |
| Mepyramine | 1505 |
| Mequindox | 1940 |
| Mequitazine | 1505, 1589, 2155 |
| Mercaptamine (See Cysteamine) | 194, 2066, 2067 |
| Mercaptopurine | 465, 966, 969, 1049, 1505, 2110, 2227, 2411, 2477, 2480, 2576 |
| Mercuric chloride | 943, 962, 1248, 1270, 1295, 2078, 2106, 2111, 2185, 2188, 2204, 2217, 2221, 2425, 2447 |
| Mercury | 812, 943, 954, 962, 996, 1024, 1043, 1248, 1270, 1295, 2045, 2050, 2059, 2078, 2079, 2083, 2141, 2217, 2222, 2232, 2249, 2481 |
| Meropenem | 465 |
| Mesaconitine | 1320, 1505, 1789 |
| Mesalamine (Mesalazine) | 466, 2296 |
| Mesalazine (See Mesalamine) | 466, 2296 |
| Mesigyna | 2051, 2353 |
| Mesna | 467, 886 |
| Mesoridazine | 1483 |
| meso-Zeaxanthin | 1289, 1320 |
| Mestranol | 1505, 2041 |
| Metaldehyde | 1216 |
| Metalloprobes | 887 |
| Metalloproteinases (ADAM10, ADAM17) | 1180 |
| Metals | 1174, 2111 |
| Metamizole (See Dipyrone) | 234, 1507, 1789, 2130, 2134, 2140 2194, 2208, 2366, 2459 |
| Metanil yellow | 1222, 1236 |
| Metaproterenol (Orciprenaline) | 467, 1078, 1080 |
| Metaxalone | 468 |
| Metazachlor | 927 |
| Metergoline | 2161 |
| Metformin | 468, 876, 887, 994, 1027, 1270, 1966, 1978, 2195, 2209, 2406, 2407, 2418 |
| Methacholine | 469, 2213, 2312 |
| Methacholine compounds | 1250 |
| Methadone | 469, 875, 887, 1007, 1200, 1320, 1364, 1374, 1482, 1507, 1533, 1789, 1900, 1967, 1978, 2000, 2322 |
| Methamidophos | 1041, 1100, 1196, 1216, 2073 |
| Methamphetamine | 470, 1259, 1334, 1508, 1613, 1900, 2111, 2117, 2259, 2322, 2326, 2396 |
| Methanandamide | 1259 |
| Methanol | 1041, 1049, 1508, 1762, 1790, 1979, 2041, 2095, 2204 |
| Methapyrilene | 812, 1120, 1220, 1222, 1236, 1995, 2022, 2053, 2101, 2104, 2261, 2272, 2308, 2312, 2314, 2376, 2400, 2432, 2481, 2519, 2525 |
| Methaqualone | 1790 |
| Methazolamide | 470, 2379 |
| Methenamine | 471 |
| Methimazole (Thiamazole) | 471, 1183, 1190, 1267, 1579, 1814, 2054, 2066, 2067, 2068, 2125, 2276, 2306, 2320, 2333, 2335, 2338, 2345, 2393, 2451 |
| Methiocarb | 1188, 2041, 2045 |
| Methionine | 965, 1261, 2185, 2331, 2447 |
| Methiothepin | 2161 |
| Methocarbamol | 472 |
| Methoctramine | 1250, 1252 |
| Methohexital | 472, 2195, 2241 |
| Methomyl | 1041, 1216, 1979, 2041, 2180 |
| Methotrexate | 473, 820, 887, 927, 939, 943, 954, 962, 964, 969, 971, 1014, 1024, 1042, 1049, 1061, 1110, 1111, 1191, 1192, 1220, 1231, 1264, 1334, 1900, 1932, 1984, 2053, 2069, 2085, 2111, 2131, 2178, 2195, 2209, 2242, 2250, 2278, 2288, 2291, 2296, 2300, 2308, 2312, 2314, 2323, 2338, 2375, 2376, 2400, 2405, 2408, 2410, 2411, 2414, 2447, 2452, 2461, 2473, 2480, 2481, 2515, 2516 |
| Methotrimeprazine (Levomepromazin) | 474, 1482, 1502 |
| Methoxamine | 2372, 2440 |
| Methoxsalen | 474, 1097, 1295, 1334, 1355, 1613, 1790 |
| Methoxyacetic acid | 1043 |
| Methoxychlor | 943, 1042, 1188, 1216, 1236, 1265, 1272, 1295, 1321, 1334, 1342, 1346, 1355, 1368, 1377, 1400, 1404, 1423, 1589, 1613, 1790, 1900, 1967, 1979, 2019, 2041, 2045, 2156, 2180, 2188, 2195, 2209, 2237, 2312, 2314, 2430, 2461, 2490, 2493, 2519 |
| Methoxyflavones | 1791 |
| Methoxyflavonoids (Chrysoeriol and Isorhamnetin) | 1321, 1342 |
| Methoxyflurane | 1355 |
| Methoxylamine | 1331, 1508 |
| Methoxymorpholinyl doxorubicin (Nemorubicin) | 943, 1791, 1802, 1900 |
| Methscopolamine | 475 |
| Methsuximide | 475 |
| Methyclothiazide | 476 |
| Methyl 2-cyano-3,12-dioxoolean-1,9-dien-28-oate | 2185, 2430 |
| Methyl bromide | 2121 |
| Methyl chloride | 2121 |
| Methyl demeton | 1041 |
| Methyl donors | 1604 |
| Methyl isocyanate | 1233, 2185, 2201, 2204, 2217, 2272, 2473 |
| Methyl isothiocyanate | 2217, 2221 |
| Methyl methanesulfonate | 2125, 2272, 2473 |
| Methyl parathion | 1041, 1188, 1216, 1250, 1251, 1979, 2041, 2073, 2106, 2121 |
| Methyl salicylate | 1188, 2493 |
| Methyl tert-butyl ether | 1355, 1648 |
| Methyl-3beta-hydroxy-5alpha,6alpha-epoxycholanate | 821, 1148 |
| Methylarsine oxide | 2073 |
| Methylated benzo[a]pyrenes | 1289 |
| Methylazoxymethanol | 2511 |
| Methylcellulose | 476 |
| Methylcholanthrene | 927, 1094, 1097, 1222, 1242, 1243, 1295, 1302, 1334, 1346, 1368, 1613, 1900, 2041, 2106, 2241, 2308, 2317, 2338, 2432, 2519 |
| Methyldithiocarbamate | 1216, 2185, 2195, 2209, 2217, 2221, 2352, 2423, 2461, 2526 |
| Methyldopa | 476, 1066, 1078, 1263, 1364, 1791, 2106, 2117, 2111 |
| Methylene Blue | 477, 1261, 2078, 2266, 2461 |
| Methylene bromide | 2121 |
| Methylene chloride | 1216, 2121, 2185, 2209, 2217, 2461 |
| Methylene imidazole substituted biphenyls | 1791 |
| Methylenebis(chloroaniline) | 1334, 1355, 1900, 2367, 2372 |
| Methylenedioxymethamphetamine (MDMA) | 887, 1478, 1508, 1532 |
| Methylenedioxyphenyl compounds | 1508, 1584, 1791 |
| Methylenedioxyphenyl lignans (Avinin, Helioxanthin, and 3-(3”,4”-Dimethoxybenzyl)-2-(3′,4′-methylenedioxybenzyl)butyrolactone from Acanthopanax chiisanensis) | 1791 |
| Methylenedioxyphenyl lignans of Piper cubeba [(-)-Clusin, (-)-Dihydroclusin, (-)-Dihydrocubebin, (-)-Yatein, (-)-Hinokinin] | 1791 |
| Methylergonovine | 477, 1091, 2093 |
| Methylethylketone | 1608 |
| Methylethylnitrosamine | 1613 |
| Methyleugenol | 2106, 2111, 2117 |
| Methylfolate | 2288 |
| Methylformamide | 1111, 1222, 1613, 2019, 2073, 2147, 2223 |
| Methylhistaprodifen | 2155 |
| Methylmercuric chloride | 2188 |
| Methylmercury compounds | 930, 1042, 1088, 1093, 1188, 1979, 2019, 2054, 2078, 2096, 2147, 2201, 2270, 2330, 2353, 2423, 2447 |
| Methylmercury cysteine | 2161, 2223 |
| Methylmercury hydroxide | 2261 |
| Methylmercury II | 1052, 1238, 1261, 2410, 2465 |
| Methylnitronitrosoguanidine | 1114, 1115, 1208, 1209, 2026, 2028, 2104, 2145, 2238, 2270, 2272, 2274, 2279, 2453, 2473 |
| Methylnitrosourea | 1115, 1218, 1222, 1231, 1233, 2041, 2073, 2086, 2125, 2185, 2188, 2195, 2201, 2204, 2212, 2217, 2224, 2241, 2247, 2272, 2274, 2278, 2279, 2345, 2376, 2423, 2461 |
| Methylparaben | 1188 |
| Methylparaoxon | 1041 |
| Methylphenidate | 478, 1066, 1242, 1243, 1263, 1478, 1533, 1555, 2000, 2005, 2395, 2396, 2418 |
| Methylphenobarbital (See Mephobarbital) | 463, 1364, 1417, 1423, 1505, 2312 |
| Methylprednisolone | 479, 887, 1024, 1791, 1900, 2013, 2055, 2204, 2278, 2317 |
| Methylprednisolone acetate | 2317, 2372, 2447, 2451 |
| Methylprednisolone hemisuccinate | 1243 |
| Methylselenic acid | 1044, 1100, 1231, 1233, 1236, 1238, 1241, 2101, 2266, 2268, 2352, 2376, 2382, 2447 |
| Methyltestosterone | 479, 1188, 1391, 1979, 2317 |
| Methylxanthines | 887, 1321, 1792 |
| Methyl-beta-cyclodextrin | 1984, 2516 |
| Methysergide | 480, 2161 |
| Methysticin | 1400, 1423, 1775 |
| Metipranolol | 480, 1072 |
| Metoclopramide | 481, 887, 1041, 1509, 1526 |
| Metolachlor | 927, 1188, 1295, 1334, 1368, 1686, 1900, 1979, 2312 |
| Metolazone | 481 |
| Metoprolol | 482, 887, 1072, 1073, 1454, 1482, 1509, 1532, 1533, 1589, 2098, 2232 |
| Metribolone | 971, 1044, 1188, 1208, 1209, 1265, 2019, 2062, 2078, 2104, 2147, 2209, 2245, 2256, 2259, 2276, 2280, 2283, 2298, 2323, 2362, 2473, 2511 |
| Metribuzin | 2180 |
| Metrifonate | 1174 |
| Metronidazole | 483, 888, 1792 |
| Metsulfuron methyl | 1188 |
| Metylperon (See Melperone) | 1505, 1551, 1579 |
| Metyrapone | 484, 1188, 1792, 1900, 1938, 1943, 2041, 2045, 2312, 2314, 2317 |
| Metyrosine | 484 |
| Mevalonic acid | 2147, 2338 |
| Mevinphos | 1041 |
| Mexazolam | 1792 |
| Mexiletine | 484, 1321, 1482, 1487, 1510, 1558, 1569, 1792, 2388 |
| Mezerein | 1216, 2447 |
| MF101 extract | 1222, 2041, 2045 |
| MG 262 | 2345 |
| mGluR5 antagonists (2-Methyl-6-(phenylethenyl) pyridine (SIB-1893), 2-Methyl-6-(phenylethynyl) pyridine (MPEP), 3-[2-Methyl-1,3-thiazol-4-yl) ethynyl]-pyridine (MTEP)) | 1792 |
| Mianserin | 485, 1067, 1511, 1570, 1792, 2155 |
| Mibefradil | 1792, 1900 |
| Mibolerone | 1188, 2393 |
| Micafungin | 485, 863, 888, 927, 955, 1793, 1900 |
| Miconazole | 486, 1295, 1321, 1334, 1346, 1383, 1391, 1400, 1404, 1423, 1589, 1613, 1622, 1900, 1906, 2185, 2201, 2204 |
| Microcystin LR | 1600 |
| Microsomal enzyme inducers | 1793 |
| Midazolam | 487, 927, 1306, 1511, 1709, 1793, 1900, 2311, 2494 |
| Midecamycin | 930, 962 |
| Midodrine | 488 |
| Mifamurtide | 488 |
| Mifepristone | 489, 930, 955, 962, 965, 985, 1034, 1188, 1231, 1248, 1355, 1657, 1794, 1900, 1906, 1932, 1965, 1992, 2041, 2101, 2106, 2150, 2178, 2188, 2195, 2201, 2204, 2209, 2217, 2221, 2259, 2278, 2301, 2308, 2312, 2317, 2332, 2364, 2367, 2376, 2423, 2425, 2432, 2461, 2465, 2513, 2520 |
| Miglitol | 489 |
| Miglustat | 490 |
| Milbemycin compounds | 888 |
| Milk | 1795 |
| Milk thistle (Silybum marianum) | 1374, 1751, 1795 |
| Milnacipran | 490, 1321, 1511, 1795 |
| Milrinone | 491, 1248, 1975 |
| Miltefosine | 927 |
| Mineral fibers | 2461 |
| Minerals | 2185, 2201, 2204, 2209, 2217, 2221 |
| Minocycline | 491, 2069, 2173, 2195, 2276, 2326, 2409, 2410, 2411 |
| Minoxidil | 492, 2434 |
| Miocamycin | 1795 |
| Mipafox | 1041 |
| Mipomersen | 1321, 1512, 1560, 1795 |
| Mirabegron | 1512 |
| Mirex | 1188, 1613, 2041, 2317 |
| Mirodenafil | 1321, 1796 |
| Mirtazapine | 493, 927, 1321, 1482, 1512, 1570, 1796, 2163, 2259, 2396, 2399 |
| Misoprostol | 494, 1965, 2372 |
| Mistletoe | 888 |
| Mithramycin A | 2473 |
| Mitomycin | 494, 888, 927, 1043, 1044, 1108, 1111, 1229, 1233, 1334, 2073, 2117, 2137, 2195, 2272, 2308, 2352, 2372, 2376, 2423, 2473, 2481 |
| Mitotane | 495, 1188, 2041 |
| Mitoxantrone | 495, 824, 888, 927, 1015, 1024, 1044, 1106, 1243, 1513, 2082, 2274, 2380, 2438 |
| Mitozolomide | 2272 |
| Mitragyna speciosa | 1513, 1796 |
| Mivacurium | 496, 1195, 1196 |
| Mizolastine | 2155 |
| MJ-III-65 | 2468 |
| MK-0457 | 1796 |
| MK-0731 | 889 |
| MK-0767 | 1797 |
| MK-0869 | 1797 |
| MK-3207 | 889 |
| MK-639 | 1796 |
| MKC-963 | 1797 |
| ML3403 | 1797 |
| MLN3897 | 1797 |
| Moclobemide | 497, 1417, 1423, 1513, 1525, 1556, 1570 |
| Modafinil | 497, 1263, 1513, 1797 |
| MOERAS115 (4-((5-Phenyl-1H-imidazol-1-yl)methyl)benzonitrile) | 1934 |
| Moexipril | 498 |
| Mofarotene | 1797 |
| Mofezolac | 2372 |
| Molindone | 499 |
| Molybdenum trioxide | 2308 |
| Mometasone | 499, 1377 |
| Monafram | 2226 |
| Monensin | 2073 |
| mono-(2-Ethylhexyl)phthalate | 1720, 2013, 2067, 2068, 2073, 2312, 2340, 2341, 2345 |
| Monoamine oxidase inhibitors | 2259, 2260 |
| Monobenzone | 500, 1188 |
| Monobromobimane | 2117 |
| Monobutyl phthalate | 2204, 2312, 2314, 2340, 2341, 2345 |
| Monocrotophos | 1041, 1289, 1967, 2041 |
| Monodansylcadaverine | 2101 |
| Monoethylglycinexylidide | 1900 |
| Mono-hydroxy methoxychlor | 1967 |
| Monomethylarsonic acid | 943, 962, 965, 2111, 2112 |
| Monomethylarsonous acid | 1261, 2112, 2227, 2276, 2312, 2447 |
| Monomethylhydrazine | 2259, 2261 |
| Monophosphoryl lipid A | 2461 |
| Monorden | 2026, 2041, 2195 |
| Monounsaturated fatty acids | 1270, 2338 |
| Montelukast | 500, 889, 939, 1110, 1216, 1321, 1374, 1377, 1513, 1798, 2177, 2256, 2257, 2311, 2418 |
| Moricizine | 501, 1368, 1900 |
| Morin | 943, 1174, 1183, 1216, 1286, 1798, 2276, 2372, 2447, 2490 |
| Moringa oleifera leaf extracts | 1798 |
| Morphine | 889, 955, 964, 1007, 1078, 1227, 1243, 1265, 1513, 1556, 1573, 1589, 1798, 2002, 2006, 2073, 2095, 2098, 2195, 2212, 2213, 2218, 2221, 2266, 2301, 2322, 2323, 2367, 2372, 2420, 2461, 2490, 2493 |
| Morphine Sulfate | 501, 1264 |
| Morpholine N-arylsulfonamides gamma-secretase inhibitors | 1798 |
| Morrhuate Sodium | 502 |
| Mosapride | 1798 |
| Motesanib | 1515, 1798 |
| Motexafin gadolinium | 1798 |
| Moxestrol | 1188, 2041, 2195 |
| Moxidectin | 885 |
| Moxifloxacin | 503, 2185, 2195, 2461, 2490, 2493 |
| MPV 2213ad | 1979 |
| MRS 1191 | 1265 |
| Mupirocin | 503 |
| Muraglitazar | 2012, 2377, 2490, 2493 |
| Muromonab-CD3 | 504 |
| Muscarinic agonists | 1334, 1355, 1368, 1377, 1423, 1589, 1900 |
| Muscarinic receptor antagonists | 1799 |
| Mustard compounds | 2473 |
| Mustard gas | 1183, 1190, 1216, 1229, 1265, 1295, 1346, 1613, 1993, 2028, 2073, 2078, 2088, 2104, 2111, 2157, 2165, 2178, 2185, 2188, 2195, 2198, 2204, 2209, 2211, 2213, 2218, 2221, 2225, 2229, 2232, 2236, 2237, 2276, 2320, 2330, 2331, 2365, 2367, 2372, 2376, 2382, 2397, 2423, 2430, 2440, 2447, 2453, 2461, 2465, 2467, 2473, 2475, 2513, 2520 |
| Mustard oil | 2479 |
| MY 5445 | 2328 |
| Mycophenolate | 504, 878, 955, 1149, 1374, 2223 |
| Mycophenolic acid | 890, 956, 962, 1015, 1377, 1799, 1900, 2185, 2201, 2204, 2218, 2266, 2447, 2461 |
| Mycotoxins | 1799 |
| Myricetin | 890, 943, 962, 1216, 1392, 2073, 2301, 2372 |
| Myristicin | 1799 |
| N | |
| N’-((1E)-(4-(Diethylamino)phenyl)methylene)-4-hydroxybenzohydrazide | 2041, 2045 |
| N-((2′-(((4,5-Dimethyl-3-isoxazolyl)amino)sulfonyl)-4-(2-oxazolyl)(1,1′-biphenyl)-2-yl)methyl)-N,3,3-trimethylbutanamide | 2014 |
| N-((2-(Hydroxyaminocarbonyl)methyl)-4-methylpentanoyl)-3-(2′-naphthyl)alanylalanine, 2-aminoethylamide | 2019 |
| N-((4-(((3-(6-((2-Amino-1,3-benzothiazol-4-yl)oxy)pyrimidin-4-yl))-6-(trifluoromethyl)pyridin-2-yl)amino)methyl)-2-fluorophenyl)methanesulfonamide | 2479 |
| N-((4-(5,9-Diethoxy-6-oxo-6,8-dihydro-7H-pyrrolo(3,4-g)quinolin-7-yl)-3-methylbenzyl)sulfonyl)-2-(2-methoxyphenyl)acetamide | 2361, 2362, 2363, 2372 |
| N-((8-Hydroxy-5-substituted-quinolin-7-yl)(phenyl)methyl)-2-phenyloxy/amino-acetamide inhibitors of ADAMTS-5 | 1799 |
| N-(1-(2,3-Dihydro(1,4)dioxin-5-yl)piperidi-4-yl)indan-2-ylamine | 2161 |
| N-(1-(3-Morpholin-4-ylphenyl)ethyl)-3-phenylacrylamide | 2229, 2236 |
| N-(1-(4-Fluoro-3-morpholin-4-ylphenyl)ethyl)-3-(4-fluorophenyl)acrylamide | 1900 |
| N-(1-Phenylcyclohexyl)-2-ethoxyethanamine (PCEEA) | 1799 |
| N-(1-Phenylcyclohexyl)-2-methoxyethanamine (PCMEA) | 1799 |
| N-(1-Pyrenyl)iodoacetamide | 1900 |
| N-(2-Acetyl-4,6-dimethylphenyl)-3-(3,4-dimethylisoxazol-5-ylsulfamoyl)thiophene-2-carboxamide | 2014 |
| N-(2-Aminophenyl)-4-(N-(pyridin-3-ylmethoxycarbonyl)aminomethyl)benzamide | 1222 |
| N-(2-Chlorophenylpropyl)-1-(3-methoxyphenyl)ethylamine | 1212 |
| N-(2-Cyclohexyloxy-4-nitrophenyl)methanesulfonamide | 1216, 1233, 1254, 1255, 1979, 2185, 2195, 2360, 2367, 2372, 2423, 2461, 2473, 2520 |
| N-(2-Methoxyphenyl)hydroxylamine | 1605 |
| N-(2-Methoxyphenyl)hydroxylamine, 2-Methoxyaniline (O-anisidine) and 2-Methoxynitrobenzene (O-Nitroanisole) | 1605 |
| N-(3-(2-Dimethylamino)ethoxy-4-methoxyphenyl)-2′-methyl-4′-(5-methyl-1,2,4-oxadiazol-3-yl)-(1,1′-biphenyl)-4-carboxamide | 2161 |
| N-(3-(4-Chlorophenyl)-2-(3-cyanophenyl)-1-methylpropyl)-2-methyl-2-((5-(trifluoromethyl)pyridin-2-yl)oxy)propanamide | 1259 |
| N-(3-(Aminomethyl)benzyl)acetamidine | 1295, 1334, 1368, 2013, 2301 |
| N-(3-(Aminosulfonyl)-4-chloro-2-hydroxyphenyl)-N’-(2,3-dichlorophenyl)urea | 2213, 2461 |
| N-(3,4-Dimethoxyphenethyl)-4-(6,7-dimethoxy-3,4-dihydroisoquinolin-2[1H]-yl)-6,7-dimethoxyquinazolin-2-amine (CP-100356) | 956 |
| N-(3-Chloro-4-morpholin-4-yl) phenyl-N’-hydroxyimido formamide | 1334, 1400, 1423, 1589, 1900 |
| N-(3-Chloro-7-indolyl)-1,4-benzenedisulfonamide | 2376 |
| N-(3-Fluoro-4-nitronaphthyl)-5-norbornene-2,3-dicarboxylic imide | 1188 |
| N-(3-Iodobenzyl)-adenosine-5′-N-methylcarboxamide (A3 adenosine receptor (A3AR) agonist) | 890 |
| N-(3-Methoxyphenyl)-4-chlorocinnamanilide | 2305, 2461, 2479 |
| N-(3-Nitratopivaloyl)cysteine ethyl ester | 2178 |
| N-(4-((4,5-Dichloro-2-fluorophenyl)amino)quinazolin-6-yl)acrylamide | 2019 |
| N-(4-(3-Chloro-4-fluorophenylamino)quinazolin-6-yl)acrylamide | 2019 |
| N-(4-Bromo-2-fluorophenyl)-6-methoxy-7-((1-methylpiperidin-4-yl)methoxy)quinazolin-4-amine | 2019, 2237, 2379 |
| N-(4-Chloro-2-((1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl)phenyl)-2-hydroxybenzamide | 1265 |
| N-(4-Cyano-benzo(b)thiophene-2-carbonyl)guanidine | 1334, 1423, 1900 |
| N-(4-Hydroxy-3-methoxybenzyl)-7-hydroxy-8-methyl-5-nonenamide | 2479 |
| N-(4-Hydroxyphenyl)arachidonylamide | 1259, 2073 |
| N-Methanocarba-2MeSADP | 2189 |
| N-(4-Methoxy-3-(4-methylpiperazin-1-yl)phenyl)-3-methyl-4-(4-pyridyl)benzamide | 2161 |
| N-(4-Methoxyphenyl)retinamide | 2121, 2209, 2302 |
| N-(4-O-glycerol-3-methoxybenzyl)nonivamide | 2461 |
| N-(4-tert-Butylphenyl)-4-(3-chloropyridin-2-yl)tetrahydropyrazine-1(2H)-carboxamide | 2479 |
| N-(6-Methylamino-3-nitrophenyl)-3-(3-indolyl)acrylamide | 2185, 2201 |
| N-(7-Hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-3-(2-(piperidin-1-yl)-6-(trifluoromethyl)pyridin-3-yl)acrylamide | 2479 |
| N-(Methylsulfonyl)-2-(2-propynyloxy)-benzenehexanamide (MS-PPOH) | 1280 |
| (N-N’-bis-(2-(1H-Indol-3-yl)-ethyl)-N,N’-bis-(3-thiomorpholin-4-yl-propyl)-phthalamide) | 2437 |
| N-(N-(3,5-Difluorophenacetyl)alanyl)phenylglycine tert-butyl ester (DAPT) | 1174, 1183 |
| N-(Pyridin-3-yl)benzamides (selective aldosterone synthase (CYP11B2) inhibitors) | 1940, 1968 |
| N,N,N’,N’-Tetrakis(2-pyridylmethyl)ethylenediamine | 2078, 2106, 2185, 2209, 2218, 2461, 2520 |
| N,N,N’,N’-Tetramethyl-4,4′-methylenedianiline | 1188 |
| N,N-bis(Alkanol)amine aryl esters | 893 |
| N,N-bis(Cyclohexanol)amine aryl esters | 893 |
| N,N-Diacetylcystine | 2301, 2461 |
| N,N-Diethyl-2-[4-(phenylmethyl)phenoxy]ethanamine | 1806 |
| N,N-Diethyl-2-[4-(phenylmethyl)phenoxy]ethanamine HCl (DPPE) | 1516 |
| N,N-Diethyl-3-hydroxymethylbenzamide | 1334, 1368, 1589, 1613 |
| N,N-Diethyl-m-toluamide (DEET) | 1333, 1589, 1715, 1805 |
| N,N-Dimethyl-4-(6-benzothiazolylazo)aniline | 2117 |
| N,N-Dimethylamphetamine (DMA) | 2065 |
| N,N-Dimethylaniline | 2066, 2067 |
| N,N-Dimethylformamide | 1605, 1762 |
| N,N-Dipropyl-2-[4-methoxy-3-(2-phenylethoxy)phenyl] ethylamine monohydrochloride (NE-100) | 1516, 1570, 1806 |
| N-[(4R)-6-(4-Chlorophenyl)-7-(2,4-dichlorophenyl)-2,2-dimethyl-3,4-dihydro-2Hpyrano[2,3-b]pyridin-4-yl]-5-methyl-1H-pyrazole-3-carboxamide (MK-5596) | 891 |
| N-[2(R)-Hydroxy-1(S)-indanyl-5-[2(S)-(1,1-dimethylethylaminocarbonyl)-4-[(furo[2,3-b]pyridin-5-yl)-methyl]piperazin-1-yl]-4(S)-hydroxy-2(R)-phenylmethylpentanamide | 1799 |
| N1-(2-Aminophenyl)-N8-phenyloctanediamide | 2473 |
| N1,N11-Diethylnorspermine | 2473 |
| N-1H-Benzimidazol-5-ylbenzenesulfonamide derivatives | 1799 |
| N2-((2S)-2-(3,5-Difluorophenyl)-2-hydroxyethanoyl)-N1-((7S)-5-methyl-6-oxo-6,7-dihydro-5H-dibenzo(b,d)azepin-7-yl)-L-alaninamide | 1174, 1183, 2357 |
| N2-(2-Aminocyclohexyl)-N6-(3-chlorophenyl)-9-ethyl-9H-purine-2,6-diamine | 2473 |
| n-3 Polyunsaturated fatty acids (PUFAs) | 1584 |
| N-3-Benzylnirvanol | 1423 |
| N4-(2,2-Dimethyl-3-oxo-4H-pyrid(1,4)oxazin-6-yl)-5-fluoro-N2-(3,4,5-trimethoxyphenyl)-2,4-pyrimidinediamine | 2185, 2204 |
| N6-(3-Iodobenzyl)-5′-N-methylcarboxamidoadenosine | 2073, 2221, 2453 |
| N6-Cyclopentyladenosine | 1041, 2073 |
| N6-Methyl-2′-deoxyadenosine 3′,5′-diphosphate | 2324 |
| Nabilone | 506 |
| Nabumetone | 506, 1304, 1321, 1381, 1515, 1799, 2121, 2372 |
| N-Acetyl-4-benzoquinoneimine | 2308 |
| N-Acetylcysteine | 1620 |
| N-Acetyl-D-glucosamine | 1174 |
| N-Acetyl-S-(1,2-dichlorovinyl)-L-cysteine | 956 |
| N-Acetyl-S-(1-carbamoyl-2-hydroxyethyl)-cysteine | 1593 |
| N-Acetyl-S-(2-carbamoyl-2-hydroxyethyl)-cysteine) | 1593 |
| N-Acetyl-S-(2-carbamoylethyl)-cysteine | 1593 |
| N-Acetylsphingosine | 1248, 2237 |
| Nadolol | 507, 1072, 1073, 1078, 1080, 1082, 2218, 2221 |
| Nafadotride | 2002, 2004 |
| Nafarelin | 508, 2515 |
| Nafcillin | 508, 1800 |
| Nafenopin | 1252 |
| Nafenopin-Coenzyme A | 2106 |
| Nafoxidine | 1188 |
| Naftifine | 508 |
| Nalbuphine | 509 |
| Nalidixic Acid | 509 |
| (-)-N-3-Benzyl-phenobarbital | 1515 |
| N-Alkyl-1,2,3,4-tetrahydroquinoline | 1800 |
| N-Alkylnitrosamines | 1800 |
| N-Alkylprotoporphyrin IX | 1800 |
| Nalmefene | 509 |
| Naloxone | 510, 927, 965, 1007, 1216, 1242, 2073, 2250, 2322, 2323, 2461, 2465 |
| Naltrexone | 510, 1099, 1515, 2322 |
| Nandrolone | 511, 1116, 1119, 1935, 1967, 1979, 2041, 2073, 2159, 2338 |
| Naphazoline | 511 |
| Naphthalene | 812, 1097, 1103, 1106, 1216, 1334, 1800, 1900, 1979, 2073, 2111, 2117, 2267, 2461, 2473 |
| Naphthazarin | 2308 |
| Naphthopyrones | 1015 |
| Naphthyridines | 2237 |
| Naproxen | 512, 1174, 1222, 1392, 1400, 1515, 1801, 2195, 2340, 2345, 2367, 2372, 2385, 2407, 2409, 2410, 2461, 2490, 2493 |
| Naratriptan | 513, 2093 |
| Naringenin | 821, 904, 943, 971, 994, 1015, 1097, 1286, 1322, 1742, 1751, 1979, 2041, 2045, 2308, 2338, 2434, 2490 |
| Naringin | 1188, 1295, 1751, 1801, 1900 |
| N-Aryl-3,3,3-trifluoro-2-hydroxy-2-methylpropionamides | 994 |
| Natalizumab | 513 |
| Natamycin | 514 |
| Nateglinide | 514, 984, 1392, 1401, 1516, 1788, 1801, 1900, 2415 |
| Natural inhibitors | 1322 |
| NB-506 | 2468 |
| N-Benzyloxycarbonyl-valyl-leucyl-leucinal | 1174, 1183 |
| N-Bromoacetamide | 2296 |
| N-Bromotaurine | 2209, 2218, 2221, 2461 |
| n-Butylbenzene | 1188 |
| N-Butyl-N-(4-hydroxybutyl)nitrosamine | 1904 |
| N-Caproylsphingosine | 2178 |
| N-Chlorotaurine | 2209, 2218, 2221, 2461 |
| NCOA6 | 1392 |
| NCX 4040 | 2308 |
| N-Decyl alcohol | 1248 |
| N-Desmethyl imatinib | 891 |
| N-Desmethyl-loperamide | 891 |
| N-Desmethylmirtazapine | 1321 |
| N-Desmethyltamoxifen | 1900 |
| N-Desmethyltoremifene | 1355, 1367 |
| NE-100 | 1516, 1570 |
| Nebivolol | 515, 1072, 1516, 1940 |
| Nedocromil | 516, 1189, 2055, 2204, 2439 |
| Nefazodone | 516, 930, 1063, 1516, 1801, 2159 |
| Neferine | 892, 1330, 1568, 1878 |
| Nefiracetam | 1802, 2372, |
| Nelarabine | 517, 1049 |
| Nelfinavir | 518, 892, 927, 943, 962, 1016, 1024, 1417, 1517, 1548, 1553, 1802, 2209, 2461 |
| Nemadectin | 861 |
| Nemorubicin | 1802 |
| Neomycin | 518 |
| Neo-Nicotinoids | 1803 |
| Neoral | 1803 |
| Neostigmine | 519, 1041 |
| Nepafenac | 520 |
| Nesiritide | 520 |
| N-Ethyl-3-toluamide | 1355, 1423, 1900 |
| Netoglitazone | 1188, 2345 |
| Neurokinin A | 2437 |
| Neuroleptics | 1117, 1803, 2003 |
| Neuropeptide Y | 1150 |
| Neurosteroids | 1517, 1967 |
| Neurotensin | 2073 |
| Neurotoxins | 2117 |
| Nevirapine | 521, 892, 1364, 1401, 1417, 1423, 1517, 1803, 2134, 2136, 2144 |
| New coccine | 925, 1355 |
| N-Formylmethionine leucyl-phenylalanine | 2195, 2209, 2372, 2461 |
| n-Hexanal | 1106, 1108 |
| N-Hydroxy-4-acetylaminobiphenyl | 2296 |
| N-Hydroxy-4-aminobiphenyl | 2296, 2432, 2433, 2434, 2435, 2473 |
| N-Hydroxyphenacetin | 1216 |
| Niacin (Nicotinic Acid; Vitamin B3) | 521, 988, 994, 1150, 1804, 2249, 2301, 2385 |
| Niacinamide (Nicotinamide) | 522, 1027, 1060, 1261, 1804, 2073, 2198, 2209, 2213, 2297, 2345, 2473 |
| Nicardipine | 522, 1295, 1322, 1334, 1377, 1401, 1423, 1518, 1589, 1900 |
| Nicergoline | 523, 1063 |
| Nickel | 979, 1043, 1080, 1174, 1183, 1193, 2073, 2106, 2107, 2168, 2276, 2308, 2352, 2423, 2520 |
| Nickel chloride | 1043, 1346, 2050, 2083, 2178, 2195, 2209, 2520 |
| Nickel subsulfide | 1346 |
| Nickel sulfate | 943, 965, 1062, 1161, 1993, 2019, 2178, 2195, 2198, 2209, 2227, 2259, 2266, 2278, 2308, 2345, 2360, 2361, 2372, 2423, 2447, 2451, 2461, 2467 |
| Nickel sulfide | 1241 |
| Nicorandil | 1150 |
| Nicotiana tabacum | 1604 |
| Nicotinamide (See Niacinamide) | 522, 1027, 1060, 1261, 1804, 2073, 2198, 2209, 2213, 2297, 2345, 2473 |
| Nicotine | 524, 943, 962, 965, 1007, 1063, 1100, 1111, 1174, 1183, 1208, 1216, 1222, 1229, 1253, 1254, 1256, 1265, 1289, 1295, 1334, 1353, 1355, 1364, 1368, 1470, 1518, 1605, 1613, 1968, 1989, 2001, 2014, 2064, 2068, 2073, 2195, 2209, 2213, 2218, 2318, 2320, 2376, 2397, 2420, 2440, 2465, 2473, 2493, 2495, 2520 |
| Nicotinic Acid (See Niacin) | 521, 988, 994, 1150, 1804, 2249, 2301, 2385, 2394 |
| Nifedipine | 524, 848, 927, 962, 1033, 1036, 1334, 1377, 1709, 1804, 1900, 1943, 2002, 2013, 2073, 2276, 2311, 2312, 2390, 2403, 2423, 2473 |
| Nifedipine and Diltiazem analogs | 892 |
| Niflumic acid | 1248, 1979, 2372, 2490 |
| Nifurtimox | 892 |
| Nigella sativa | 1322 |
| Nigericin | 892 |
| Nile Red | 1804 |
| Nilestriol | 2013 |
| Nilotinib | 525, 940, 1026, 1196, 1392, 1518, 1804, 2489 |
| Nilutamide | 526, 1188, 1984 |
| Nilvadipine | 1150, 1518, 1804, |
| Nimesulide | 527, 1216, 1979, 2185, 2195, 2209, 2358, 2367, 2372, 2423, 2461, 2520 |
| Nimesulide analog JCC76 | 1968 |
| Nimesulide-related aromatase suppresors | 1968 |
| Nimodipine | 528, 1175, 1183, 2002 |
| Nimustine | 2272, 2438, 2473 |
| N-Isobutyldodeca-2E,4E,8Z,10Z-tetraenamide | 1392 |
| Nisoldipine | 528, 1805 |
| Nitazoxanide | 529, 1584 |
| Nitenpyram | 1803 |
| Nithiazine | 1803 |
| Nitidine | 940 |
| Nitisinone | 529 |
| Nitrates | 1248, 2392 |
| Nitrazepam | 530, 1306, 1805 |
| Nitrendipine | 530, 1016, 1900, 2190 |
| Nitric Oxide | 531, 892, 943, 1034, 1150, 1175, 1183, 1259, 1267, 1805, 1925, 2013, 2185, 2195, 2204, 2218, 2221, 2300, 2301, 2305, 2345, 2447, 2461, 2473 |
| Nitric oxide donor V-PROLI/NO(O2-Vinyl 1-[2-(carboxylato)pyrrolidin-1-yl]diazen-1-ium-1,2-diolate) | 1289 |
| Nitric oxide donors | 1267, 2013, 2185, 2218, 2221, 2461 |
| Nitric oxide-aspirin 2 | 1322 |
| Nitrites | 2185, 2195, 2218, 2461 |
| Nitroaspirin | 2308, 2372 |
| Nitrofen | 1188, 2041, 2178, 2180, 2189, 2190, 2301, 2305, 2367, 2372, 2432, 2434, 2447, 2461 |
| Nitrofural (See Nitrofurazone) | 532 |
| Nitrofurantoin | 531, 892, 1016, 2078, 2430 |
| Nitrofurazone (Nitrofural) | 532 |
| Nitrogen dioxide | 1216, 2447, 2461 |
| Nitrogen mustard compounds | 1097, 1208, 1209, 2026, 2473 |
| Nitrogen oxides | 2473 |
| Nitroglycerin (Glyceryl Trinitrate) | 532, 1072, 1088, 1103, 1106, 1116, 1259, 1613, 1943, 2013, 2066, 2073, 2093, 2125, 2161, 2195, 2209, 2261, 2276, 2301, 2303, 2430, 2461 |
| Nitroprusside | 533, 1106, 1183, 1197, 1231, 1249, 2013, 2073, 2078, 2185, 2372, 2473, |
| Nitropyrenes | 1805 |
| Nitrosamines | 1355, 1613, 1805 |
| Nitrosobenzene | 2185, 2218 |
| Nitrosobenzylmethylamine | 996, 1046, 1103, 1106, 1108, 1111, 1121, 1161, 1190, 1192, 1220, 1222, 1242, 1355, 1613, 2013, 2068, 2082, 2104, 2107, 2169, 2195, 2253, 2272, 2317, 2352, 2357, 2359, 2367, 2372, 2438, 2481, 2520, 2528 |
| Nitrosobis(2-oxopropyl)amine | 2372 |
| Nitrosodiamylamine | 1806 |
| Nitrosodibutylamine | 1806 |
| Nitrosodiethylamine | 1806 |
| Nitrosodimethylamine | 1806 |
| Nitrosodipropylamine | 1806 |
| Nitrosomethylamylamine | 1806 |
| Nitrosomethylbutylamine | 1806 |
| Nitrosomethylethylamine | 1806 |
| Nitrosomethylpropylamine | 1806 |
| Nitrous oxide | 2430 |
| Nitroxynil | 840 |
| Niuchangchih (See Antrodia camphorata) | 1596 |
| Nivalenol | 2185, 2201 |
| Nizatidine | 534 |
| NK 104 | 927, 930, 962, 1024, 2147, 2180, 2209, 2247, 2301, 2338, 2415, 2461 |
| NL-71-101 | 1060 |
| N-Methyl,N-propargyl-2-phenylethylamine (MPPE) | 1516 |
| N-Methyl-3,4-methylenedioxyamphetamine | 1007, 1589 |
| N-Methyl-7H-dibenzo(c,g)carbazole | 1295, 1334 |
| N-Methyl-benzodioxolyl-butanamine (MBDB, Eden) | 1322, 1417, 1516, 1805 |
| N-Methyl-imidacloprid | 1803 |
| N-Methyl-N-2-(methylsulfinyl)ethylpropionic acid amide | 1295, 1334, 1346, 1355 |
| N-Methyl-N-benzylnitrosamine | 1334, 1589 |
| N-Methyl-N-nitrosoaniline | 1613 |
| N-Methylscopolamine | 1250, 1251 |
| N-Methylsulfonyl-6-(2-propargyloxyphenyl)hexanamide | 1373 |
| NNC55-0396 | 1805 |
| N-Nitrosamines | 1806 |
| N-Nitroso(di-n-propyl)amine | 1355, 1368, 1613, 1900 |
| N’-Nitrosoanabasine | 1295, 1355, 1900, 2490, 2495 |
| N’-Nitrosoanatabine | 2490, 2495 |
| N-Nitrosobenzylmethylamine (NBzMA) | 1516, 1806 |
| N-Nitroso-bis(2-oxopropyl)amine (BOP) | 1806 |
| N-Nitrosodialkylamines | 1516, 1806 |
| N-Nitrosodibutylamine | 1800 |
| N-Nitrosodiethylamine | 1800 |
| N-Nitrosodimethylamine | 1605, 1800, 1806 |
| N-Nitrosodipropylamine | 1800 |
| N-Nitrosoethylbutylamine | 1800 |
| N-Nitrosoguvacoline | 1355, 1668 |
| N-Nitrosomethylaniline | 1605 |
| N-Nitrosomethylbutylamine | 1800 |
| N-Nitrosomethylethylamine | 1800 |
| N-Nitrosomethylpropylamine | 1800 |
| N-Nitrosomorpholine | 1355, 1613, 2473 |
| N’-Nitrosonornicotine | 1255, 1295, 1355, 2490, 2495 |
| N-Nitrosopiperidine | 1356, 1613 |
| N-Nitrosopyrrolidine | 1356, 1613 |
| N-N-Propylnorapomorphine | 2002 |
| NO-1886 | 1806, 1925 |
| NO-Aspirin (NCX-4016) | 1620 |
| Nobiletin | 902, 1289, 1322, 1342, 1807 |
| NOC 18 | 1368, 1613, 1900 |
| Nocardioazines | 893 |
| Nocodazole | 962, 965, 1248, 2212, 2213, 2266, 2473 |
| N-Octyl-O-sulfate chitosan (NOSC) micelles | 893 |
| Nolatrexed | 2473 |
| N-Oleoyldopamine | 2479 |
| Nomegestrol | 1270 |
| Nomifensine | 1323, 1364, 1417, 1518, 1807, 2397 |
| Nonachlor | 1188, 1368, 1900, 2041, 2045, 2312, 2314 |
| Non-ionic surfactants (Cremophor® EL, Cremophor® RH 40, Polysorbate 80, Vitamin E TPGS 1000, Pluronic® PE 10300 and Sucrose ester L-1695) | 893, 1393 |
| Nonivamide | 2189, 2479 |
| Non-nucleoside reverse transcriptase inhibitors | 893, 1584 |
| Non-steroidal anti-inflammatory drugs (NSAIDs) | 969, 1170, 1175, 1323, 1393, 1518, 1547, 1583, 1584, 1606, 1807, 1979, 2256, 2345, 2370, 2372 |
| Non-steroidal aromatase inhibitors (Xanthone scaffold) | 1968 |
| Non-taxane microtubule-stabilizing agents | 1807 |
| Nonoxynol 9 | 534 |
| Nonylphenol | 1060, 1069, 1097, 1119, 1188, 1212, 1251, 1259, 1295, 1520, 1977, 1979, 2002, 2041, 2045, 2125, 2180, 2312, 2314, 2323, 2324, 2331, 2360, 2362, 2363, 2409, 2430, 2437, 2473 |
| Noradrenaline (See Norepinephrine) | 534, 1063, 1064, 1067, 1072, 1073, 1078, 1080, 1081, 1082, 1091, 2013, 2073, 2195, 2259, 2346 |
| Norathyriol | 902, 2342 |
| Norbuprenorphine | 1007, 1589, 1900, 2491 |
| Norcantharidin | 2520 |
| Norcisapride | 1900 |
| Norclozapine | 2165 |
| Nordihydrocapsaicin | 2189 |
| Nordihydroguaiaretic acid | 893, 1188, 1241, 2073, 2189, 2195, 2213, 2301, 2372, 2376, 2423, 2490 |
| Norendoxifen | 1365 |
| Norendoxifen and Tamoxifen-derived aromatase inhibitors | 1968 |
| Norepinephrine (Noradrenaline) | 534, 1063, 1064, 1067, 1072, 1073, 1078, 1080, 1081, 1082, 2013, 2073, 2195, 2259, 2346, 2434 |
| Norethindrone (Norethisterone) | 535, 962, 1188, 1270, 1965, 2041, 2045, 2051, 2061, 2266, 2353, 2513, 2520 |
| Norethisterone (See Norethindrone) | 535, 962, 1188, 1270, 1965, 2041, 2045, 2051, 2061, 2266, 2353, 2513, 2520 |
| Norethynodrel | 1188, 2041, 2045 |
| Norfloxacin | 535, 1323, 1743 |
| Norflurazone | 1368 |
| Norfuraneol | 1807 |
| Norgestimate | 962, 1188, 1270, 1334, 1423, 2051, 2061, 2353 |
| Norgestomet | 2041 |
| Norgestrel | 2041, 2045 |
| Norharman | 1295, 1334, 1346, 1356, 1368, 1401, 1423, 1520, 1589, 1613, 1900 |
| Norketamine | 1353, 1363, 1775 |
| NorLAAM | 1403 |
| Norlevorphanol | 1589 |
| Norlignans | 939 |
| Noroxycodone | 893 |
| Nortriptyline | 536, 894, 1377, 1520, 1534, 1547, 1558, 1567, 1569, 1589, 1651, 1808, 2093, 2161, 2317, 2395, 2399 |
| Nor-ursodeoxycholic acid | 1925, 2492 |
| Norverapamil | 1900 |
| Noscapine | 1393, 1808, 2520 |
| Notopterol | 869 |
| n-Pentanol | 2095 |
| N-Phenylpropenoyl-L-amino acid amides | 1808 |
| n-Propyl disulfide | 1613 |
| NPS R-467 | 1212 |
| NRF2 | 1605 |
| NS 004 | 1248 |
| NS-21 | 1808 |
| NS398 | 1984 |
| NSC 613060 | 1815 |
| NSC 674495 | 1097, 1295, 1346 |
| NSC 680410 | 1222, 1231, 2101, 2376 |
| NSC77037 | 893 |
| N-Substituted glycines | 943 |
| N-Tylosil-1-alpha-amino-(3-bromophenyl)-methyl-2-naphthol | 844 |
| NU2058 | 1231, 1233, 2376 |
| NU6102 | 1233, 1236 |
| Nuciferine | 1323 |
| Nutlin 3 | 2473 |
| Nutlin-1 | 894 |
| Nutmeg | 1396 |
| Nutriose6 | 1926 |
| Nutritive peptides | 1926 |
| NuvaRing | 2051 |
| NVP ADW742 | 2189, 2520 |
| NVP-BEZ235 and GSK2126458 | 1968 |
| Nylestriol | 2013, 2209 |
| Nystatin | 537, 2178, 2195, 2209 |
| N-ω-Nitro-L-arginine methyl ester | 1940 |
| O | |
| (+)-Oxypeucedanin | 1316 |
| O-(4-Ethoxyl-butyl)-berbamine | 894 |
| O-(Chloroacetylcarbamoyl)fumagillol | 1222, 2376, 2473 |
| O,O-Diethyl O-3,5,6-trichloro-2-pyridyl phosphate | 1041, 1080, 1242, 1251, 1259, 1296, 2338 |
| o,p’-DDT | 1097, 1188, 1296, 1368, 1900, 2026, 2041, 2045, 2086, 2195, 2209, 2312, 2461 |
| O2-Vinyl-1-(pyrrolidin-1-yl)diazen-1-ium-1,2-diolate | 1222, 2073, 2178, 2407, 2465 |
| O6-(4-Bromothenyl)guanine | 2272 |
| O6-Benzylguanine | 1088, 1295, 1334, 1809, 2272, 2473 |
| O6-Methylguanine-DNA methyltransferase | 894 |
| o-Aminoazotoluene | 1097, 1296, 1334 |
| Obestatin | 818 |
| Obidoxime | 947, 1041, 1251, 2338 |
| OC144-093 | 1809 |
| OC144-193 | 1809 |
| Ochratoxin A | 962, 1043, 1088, 1119, 1323, 1365, 1393, 1809, 2048, 2104, 2150, 2189, 2406, 2407, 2409, 2414, 2432 |
| Ocotillol II | 1327 |
| Octa-2,4,6-Trienoic acid | 1222, 2013, 2078, 2224, 2345, 2379, 2423 |
| Octachlorostyrene | 1097, 1296, 1323, 1334, 2111, 2180, 2308, 2314, 2432 |
| Octadecaenoic acids | 1926 |
| Octamer 4 (Oct4) | 1016 |
| Octamethylcyclotetrasiloxane | 1296, 1334 |
| Octanols | 2168, 2169 |
| Octocrylene | 2041, 2045 |
| Octopamine | 1073, 1080, 1082 |
| Octreotide | 539, 2427, 2428, 2447 |
| Octylmethoxycinnamate | 2041, 2045, 2189 |
| Octylphenol | 2041 , 2427 |
| O-Desmethylangolensin | 2045, 2041 |
| Oenothera paradoxa defatted seed extract | 894 |
| Ofatumumab | 540 |
| Ofloxacin | 540, 2490, 2493 |
| Oil fly ash | 2178, 2195, 2209, 2461 |
| Okadaic acid | 1248, 1296, 1346, 1809, 2041, 2073, 2266, 2312, 2340, 2376, 2461, 2516 |
| Okara | 1926 |
| Olanzapine | 541, 894, 1082, 1117, 1120, 1264, 1323, 1334, 1478, 1497, 1523, 1551, 1566, 1584, 1809, 2001, 2003, 2005, 2093, 2099, 2154, 2163, 2165, 2247, 2249, 2380, 2395, 2430, 2494 |
| Oleandomycin | 2312 |
| Oleanolic acid | 1216, 1261, 1334, 1613, 1684, 1809, 1900, 2430, 2468 |
| Oleic acid | 824, 996, 1116, 1119, 1151, 1270, 2054, 2111, 2117, 2247, 2340, 2345, 2376 |
| Oleic acid anilide | 1926 |
| Oleoylanilide | 1041, 1261 |
| Oleuropein | 1979 |
| Oleylamide | 1261 |
| Oleylethanolamide | 2026, 2340 |
| Oligofectamine | 1111, 2029, 2270 |
| Oligomycins | 1222, 1233, 1236, 1241, 2376 |
| Oligosaccharides | 2204 |
| Olivacine | 1097, 1296, 1334, 1356, 1368, 1377, 1401, 1423, 1589, 1613, 1900, 2068 |
| Olive oil | 1151, 1245, 1932, 2019, 2249, 2298, 2323, 2338, 2372 |
| Olivetol | 1524 |
| Olmesartan | 542, 839, 1001, 1036, 1091, 1092, 1151 |
| Olomoucine | 1026, 1233, 1323, 1393, 1809, 2376, 2473 |
| Olopatadine | 543, 1809, 2155 |
| Olsalazine | 543, 2477 |
| Oltipraz | 962, 965, 971, 979, 1296, 1334, 1346, 1365, 2106, 2111, 2117, 2121, 2272, 2308, 2418 |
| Olvanil | 2479 |
| Omacor | 2338 |
| Omalizumab | 544 |
| Omapatrilat | 1034, 2013, 2305 |
| OMDM-1 cpd | 2195, 2221 |
| OMDM-2 cpd | 2195 |
| omega-3 Fatty acids | 1042, 1222, 1611, 1932, 2026, 2111, 2117, 2185, 2221, 2247, 2249, 2474, 2520 |
| omega-3-Acid Ethyl Esters | 544 |
| omega-6 Fatty acids | 1222 |
| omega-Agatoxin IVA | 1183 |
| omega-Conotoxin GVIA | 2323, 2420 |
| omega-Conotoxin-MVIIC | 1183 |
| omega-Hydroxy-very-long-chain fatty acids | 1911 |
| omega-N-Heterocyclic derivatives of vitamin E [(R)-2-(9-(1H-Imidazol-1-yl)nonyl)-2,5,7,8-tetramethylchroman-6-ol] | 1911 |
| Omeprazole | 545, 894, 979, 1016, 1056, 1096, 1097, 1108, 1218, 1248, 1296, 1323, 1334, 1346, 1368, 1404, 1417, 1423, 1524, 1613, 1810, 1900, 2066, 2276, 2312, 2314, 2382 |
| Onapristone | 1657, 2317, 2372 |
| Oncorhynchus masou (See Masou salmon) | 1924 |
| Oncorhynchus mykiss (See Rainbow trout) | 906 |
| Oncostatin M | 943, 965, 971, 1016, 1152, 1811, 2245, 2430 |
| Ondansetron | 546, 894, 1289, 1334, 1526, 1556, 1575, 1589, 1639, 1811, 1855, 1900, 2168, 2169 |
| Onion | 1926 |
| ONO 3708 | 2440 |
| ONO AE 1-329 | 2461 |
| ONO AE 248 | 2361 |
| ONO NT 012 | 2361 |
| ONO-AE1-329 | 2218, 2362 |
| O-Phenylphenol | 1823 |
| O-Phthalaldehyde | 1606 |
| Opioid analgesics | 894 |
| Opioid receptor agonists | 895 |
| Opioids | 1526, 1534, 1812 |
| Oprelvekin | 546 |
| OR486 | 1264 |
| Oracine | 1218 |
| Oral anticoagulants | 895, 1812 |
| Oral antidiabetic drugs | 1812 |
| Oral contraceptives | 1334, 1525, 1526, 1584, 1812, 2048, 2050, 2353 |
| Orange juice flavones | 1813 |
| Orbofiban | 2226 |
| Orciprenaline (See Metaproterenol) | 467, 1078, 1080 |
| Oren gedoku to | 2195, 2218, 2372 |
| Orexins/Hypocretins | 1940 |
| Org 4060 | 1813 |
| Org 31710 | 2178, 2227, 2301, 2513 |
| Organic anions | 956 |
| Organic cations | 1016 |
| Organic pollutants (Polychlorinated biphenyls (PCB), Dichlorodiphenyltrichloroethanes (DDT), and Polybrominated diphenyl ethers (PBDE)) | 1196, 1289 |
| Organic solvents | 1526, 1813 |
| Organochlorine insecticides | 895 |
| Organometallic compounds | 2101, 2473 |
| Organophosphate ester compounds | 1195 |
| Organophosphate pesticides | 1527 |
| Organophosphorothionate insecticides/pesticides | 1497, 1813 |
| Organophosphorus compounds | 1039, 1041, 1334, 1423, 1900, 2338 |
| Organophosphorus pesticides (Chlorpyrifos and Parathion)(Fenitrothion, Diazinon, 2-Isopropyl-6-methyl-4-pyrimidinol) | 1196, 1251, 1289, 1365, 1418 |
| Organoselenium compounds | 2461 |
| Organosulfur compounds | 1814 |
| Orlistat | 547 |
| Orotic acid | 1042, 2340 |
| Orphan Nuclear Receptors | 895 |
| Orphenadrine | 547, 1334, 1365, 1368, 1613, 1814 |
| Ortho Evra | 1270 |
| Orthosiphon stamineus | 1407, 1492, 1814 |
| Oseltamivir | 548, 895, 1242, 2296, 2411 |
| OSI-461 | 1814 |
| Osteoprotegerin | 1152 |
| Osthol (Cnidium monnieri L. Cusson) | 1043, 1375, 1814, 1926 |
| Ouabain | 2013, 2014, 2301, 2393, 2405 |
| Ovalbumin | 1190, 1229, 2178, 2447, 2513 |
| Oxaborole 6-carboxamides (AN3520, SCYX-6759) | 896 |
| Oxacillin | 548 |
| Oxadiazon | 1900, 1979, 2312 |
| Oxaliplatin | 549, 896, 957, 969, 1017, 1049, 1093, 1222, 1229, 1231, 1233, 1395, 1995, 2018, 2019, 2029, 2031, 2032, 2116, 2117, 2212, 2213, 2357, 2376, 2381, 2407, 2468, 2473, 2480, 2481, 2520, 2526, 2528 |
| Oxamyl | 2041 |
| Oxandrolone | 550 |
| Oxaprozin | 550, 1527 |
| Oxatomide | 551, 1527, 1815 |
| Oxazaphosphorines | 969, 1815 |
| Oxazepam | 552, 1306, 1323, 1527 |
| Oxazolone | 2053, 2185, 2195, 2201, 2221 |
| Oxcarbazepine | 552, 1527, 1815, 2387 |
| Oxfendazole | 840, 927, 1024 |
| Oxiconazole | 553 |
| Oxidopamine | 2006, 2306, 2326, 2331, 2397, 2425 |
| Oxophenylarsine | 2019, 2430, 2479 |
| Oxprenolol | 553, 1073, 1079, 1082 |
| Oxybenzone | 1188, 2041, 2045 |
| Oxybutynin | 554, 896, 1242, 1243, 1251, 1252, 1377, 1527, 1816 |
| Oxychlordane | 1188 |
| Oxycodone | 555, 896, 1017, 1527, 1573, 1816 |
| Oxygen | 556, 1216, 1261, 2041, 2045, 2073, 2185, 2283, 2338, 2423, 2447, 2461, 2520 |
| Oxygen supplementation | 1324 |
| Oxymatrine | 896, 1604, 2185, 2201, 2218, 2447, 2461 |
| Oxymetazoline | 556, 1418 |
| Oxymetholone | 556 |
| Oxymorphone | 557, 1816 |
| Oxytetracycline | 557, 1289, 1324, 1975, 2409, 2410, 2411 |
| Oxytocin | 558 |
| Ozagrel | 1529, 1589 |
| Ozone | 824, 1024, 1043, 1216, 1231, 1236, 1272, 1334, 1906, 2066, 2073, 2082, 2104, 2107, 2111, 2170, 2185, 2195, 2209, 2213, 2249, 2279, 2338, 2359, 2372, 2400, 2423, 2425, 2447, 2448, 2450, 2453, 2461, 2465, 2467 |
| P | |
| p,p’-DDE (1,1-Dichloro-2,2-bis(p-chlorophenyl)ethylene (p,p’-dichlorodiphenyldichloroethylene)) | 1312 |
| P1,P5-di(Adenosine-5′-)pentaphosphate | 1248 |
| p38alpha Inhibitor CMPD1 | 2073 |
| Paclitaxel | 559, 896, 927, 930, 943, 957, 962, 964, 971, 1017, 1111, 1208, 1216, 1222, 1229, 1231, 1334, 1342, 1368, 1375, 1377, 1529, 1816, 1875, 1900, 1932, 1969, 1979, 1995, 2018, 2019, 2028, 2061, 2111, 2117, 2121, 2157, 2178, 2221, 2222, 2246, 2264, 2266, 2268, 2272, 2274, 2311, 2312, 2362, 2372, 2376, 2410, 2413, 2442, 2453, 2461, 2468, 2471, 2473, 2481, 2513, 2520 |
| Pactimibe | 1529, 1817 |
| Paeonol (Paeonia moutan) | 1324, 1606 |
| Pafuramidine | 1620, 1817 |
| PAK 104P | 943 |
| Palifermin | 560 |
| Paliperidone | 560, 897, 1529, 1534, 1818 |
| Palivizumab | 561 |
| Palm oil | 1044, 1046, 1050, 1060, 1082, 1100, 1108, 1161, 1196, 1203, 1212, 1222, 1231, 1233, 1245, 1252, 1261, 1264, 1272, 1273, 1346, 1613, 1906, 1995, 2062, 2066, 2101, 2153, 2157, 2189, 2223, 2234, 2237, 2257, 2278, 2298, 2302, 2304, 2308, 2323, 2345, 2346, 2347, 2361, 2365, 2380, 2381, 2402, 2408, 2418, 2420, 2432, 2425, 2447, 2453, 2465, 2475, 2483, 2490, 2525 |
| Palmatine | 844, 854, 904, 1491 |
| Palmidrol | 1119 |
| Palmitic acid | 996, 1188, 1334, 1401, 1423, 1589, 1613, 1900, 2180, 2190, 2209, 2247, 2340, 2345, 2461, 2483 |
| Palmitoleic acid | 824, 1116, 2338 |
| Palmitoyl coenzyme A | 1242, 2106, 2111, 2117 |
| Palmitoylcarnitine | 836 |
| Palonosetron | 561, 1324, 1855 |
| Pam3CSK4 peptide | 2185, 2195, 2221, 2372 |
| Pamidronate | 561 |
| p-Aminohippuric acid | 2409, 2410, 2411 |
| p-Aminosalicylic acid | 2296 |
| Panax ginseng CA Meyer (See Ginseng) | 342, 1749 |
| Panax notoginseng (Burk.) | 821, 1324, 1342, 1927, 2195, 2276 |
| Panaxadiol | 2232 |
| Panaxydol | 2376 |
| Pancreatin | 562 |
| Pancrelipase | 562 |
| Pancuronium | 563 |
| Panduratin A | 1222, 1231, 1233, 1236, 1238 |
| Panitumumab | 563, 2018, 2240, 2333 |
| Panobinostat (LBH589) | 1969 |
| Pantoprazole | 564, 897, 962, 1024, 1296, 1334, 1346, 1418, 1819 |
| Pantothenic Acid (Vitamin B5) | 565 |
| PAP-1 (5-(4-phenoxybutoxy)psoralen) | 1393, 1529, 1819 |
| PAPA NONOate | 1248 |
| Papaverine | 565, 1248, 2320 |
| Papyriferic acid derivatives | 897 |
| Para Red | 1354 |
| Paracetamol (See Acetaminophen) | 6, 812, 929, 942, 947, 961, 964, 971, 979, 985, 996, 1000, 1024, 1026, 1027, 1042, 1043, 1044, 1045, 1049, 1050, 1062, 1082, 1083, 1093, 1094, 1096, 1100, 1103, 1106, 1108, 1110, 1111, 1114, 1116, 1118, 1133, 1161, 1190, 1191, 1193, 1194, 1202, 1204, 1207, 1210, 1215, 1218, 1219, 1220, 1222, 1229, 1235, 1238, 1242, 1243, 1249, 1253, 1264, 1265, 1270, 1273, 1304, 1438, 1502, 1529, 1593, 1606, 1612, 1642, 1819, 1899, 1906, 1932, 1986, 1989, 1990, 1993, 1995, 1996, 2010, 2012, 2022, 2028, 2029, 2039, 2050, 2051, 2053, 2054, 2061, 2062, 2064, 2066, 2067, 2072, 2075, 2082, 2083, 2088, 2093, 2097, 2104, 2105, 2107, 2110, 2113, 2116, 2120, 2129, 2147, 2150, 2153, 2161, 2170, 2183, 2193, 2208, 2213, 2217, 2223, 2227, 2230, 2241, 2247, 2250, 2259, 2261, 2266, 2267, 2270, 2272, 2274, 2278, 2295, 2296, 2298, 2300, 2302, 2304, 2308, 2312, 2314, 2318, 2323, 2324, 2327, 2330, 2331, 2332, 2335, 2337, 2340, 2344, 2346, 2357, 2359, 2364, 2365, 2366, 2370, 2380, 2382, 2383, 2420, 2422, 2430, 2439, 2440, 2445, 2449, 2451, 2453, 2457, 2465, 2467, 2511, 2513, 2519, 2521, 2523, 2526, 2529 |
| Paraoxon | 1039, 1041, 1196, 1242, 1243, 1251, 1259, 2338 |
| Paraquat | 943, 971, 1024, 1034, 1039, 1041, 1043, 1062, 1064, 1088, 1100, 1103, 1196, 1208, 1216, 1222, 1248, 1256, 1261, 1264, 1265, 1272, 1289, 1296, 1320, 1346, 1613, 2002, 2006, 2014, 2019, 2034, 2062, 2073, 2078, 2088, 2091, 2106, 2111, 2112, 2117, 2125, 2164, 2178, 2185, 2189, 2195, 2201, 2209, 2253, 2270, 2274, 2278, 2282, 2301, 2308, 2312, 2330, 2340, 2347, 2352, 2361, 2388, 2397, 2407, 2409, 2413, 2420, 2423, 2425, 2430, 2447, 2451, 2461, 2473, 2483, 2520, 2525, 2528 |
| Parathion | 927, 1039, 1041, 1188, 1334, 1365, 1368, 1377, 1401, 1418, 1423, 1589, 1613, 1813, 1819, 1900, 2159, 2164, 2338, 2432, 2473 |
| Parecoxib | 1510, 1819 |
| Paregoric | 565 |
| Parfumine | 1363, 1539, 1826 |
| Paricalcitol | 566, 1152, 1161, 1242, 1261, 1346, 1368, 1900, 2195, 2198, 2209, 2345, 2367, 2372, 2425, 2449, 2516 |
| Paromomycin | 566 |
| Paroxetine | 567, 897, 927, 1324, 1497, 1510, 1522, 1531, 1551, 1553, 1555, 1556, 1567, 1573, 1589, 1819, 2161, 2163, 2164, 2174, 2430, 2461 |
| Parthenolide | 965, 2179, 2257, 2473 |
| Particulate matter | 1261, 2209, 2447, 2461 |
| Party pill drugs | 1324, 1819 |
| Pasireotide | 2427, 2428 |
| Patulin | 1799 |
| Patupilone | 897, 1393, 1418, 1820 |
| Pazopanib | 568, 897, 1324, 1375, 1536, 1820, 2489 |
| PB28 | 886 |
| PC-14AG50R | 1022 |
| PCB 180 | 1208, 1296, 1346 2237, 2314, 2372 |
| PCB126 (3,3′,4,4′,5-Pentachlorobiphenyl) | 1343 |
| PCBs | 1969 |
| p-Cresol | 1398 |
| PD 98059 | 962, 1024, 1026, 1097, 1188, 1231, 1234, 1236, 1248, 1262, 1265, 1270, 1296, 1927, 1943, 1978, 1979, 2013, 2026, 2041, 2073, 2178, 2185, 2195, 2201, 2209, 2213, 2218, 2221, 2247, 2257, 2276, 2278, 2301, 2303, 2308, 2320, 2372, 2376, 2430, 2447, 2461, 2473, 2483, 2490, 2516, 2520 |
| PD 123319 | 1088, 2073 |
| PD 142893 | 2013, 2306 |
| PD 151242 | 2014 |
| PD 156252 | 2014 |
| PD 168393 | 2019, 2473 |
| PD 169316 | 1296, 2073, 2372 |
| PD 173074 | 1222 |
| PD 178390 | 1820 |
| PD 0332991 | 1237 |
| PE2I | 1019 |
| Pegademase Bovine | 568 |
| Peganum harmala L. (Zygophyllaceae) | 1324 |
| Pegaptanib | 569 |
| Pegaspargase | 569 |
| Pegfilgrastim | 570 |
| Peginterferon Alpha-2a | 570 |
| Peginterferon Alpha-2b | 571 |
| Pegloticase | 572 |
| Pegvisomant | 572, 2086 |
| Pegylated phosphotidylethanolamine | 897 |
| Pelargonic acid | 2180, 2195, 2201, 2221, 2461 |
| Pelargonidin | 839, 1001 |
| Pemetrexed | 573, 2085, 2405, 2473, 2481 |
| Penciclovir | 573 |
| Pencycuron | 1188 |
| Pendimethalin | 1188, 1368, 2041, 2045 |
| Penicillamine | 573 |
| Penicillin G Benzathine | 574 |
| Penicillin G Procaine | 574 |
| Penicillin G (Parenteral/Aqueous) | 575, 962 |
| Penicillin V Potassium | 575 |
| Penicillins | 962 |
| Penicillium minioluteum dextranase | 1820 |
| Pentaacetyl geniposide | 1222, 1236, 2073, 2473 |
| Pentabrominated diphenyl ether 100 | 1097, 1188, 1296, 2432 |
| Pentabromodiphenyl ether | 1097, 1296, 2041, 2045, 2189, 2312 |
| Pentachlorobenzene | 1097, 1334, 1589, 1613, 1685, 1900, 2073, 2117, 2209 |
| Pentachlorophenol | 1188, 1216, 1229, 1234, 1236, 1296, 1368, 1900, 1979, 2041, 2073, 2180, 2312, 2376, 2432, 2461 |
| Pentaerythritol tetranitrate | 1106, 2301 |
| Pentagalloylglucose | 894 |
| Pentamethylchromanol | 1329, 1685 |
| Pentamidine | 576, 1418, 2053, 2232 |
| Pentanols | 2168, 2169 |
| Pentastarch | 577 |
| Pentazocine | 577 |
| Pentobarbital | 577, 1183, 1201, 1259, 1267, 1334, 2073, 2079, 2178, 2189, 2195, 2232, 2241, 2305, 2306, 2312, 2314, 2367, 2372, 2461, 2465 |
| Pentosan Polysulfate Sodium | 578 |
| Pentostatin | 578 |
| Pentoxifylline | 579, 887, 1216, 1262, 1334, 2195, 2209, 2218, 2461, 2513, 2520 |
| Pentylenetetrazole | 1183, 2073 |
| Peonidin | 839, 1001, 2301 |
| Peonidin-3-glucoside | 839, 1001 |
| Peppermint oil | 1820, 1927 |
| Peppermint oil and ascorbyl palmitate | 1820 |
| Pepstatin A | 1969 |
| Peptide nucleic acids | 2026 |
| Peptides and peptidomimetics | 1820 |
| Peptidoglycan | 2195, 2209, 2218, 2221, 2321, 2372, 2423, 2461 |
| Peptidomimetic inhibitors | 897 |
| Perazine | 1324, 1401, 1536, 1820, 1900, 2068 |
| Perchlorate | 1183, 1190, 1216, 1267, 2054, 2125, 2276, 2306, 2320, 2333, 2335, 2345, 2393, 2423, 2451 |
| Perfluorinated carboxylic acids | 940 |
| Perfluorinated compounds (Perfluorooctane sulfonate, Perfluorooctanoic acid, Perfluorononanoic acid) | 1044, 1216, 1969, 2019, 2249, 2292 |
| Perfluoroactane sulfonic | 1290 |
| Perfluoroactane sulfonic or perfluorooctane carboxylic acids | 1290 |
| Perfluoroalkyl sulfonates | 1152 |
| Perfluorobutyric acid | 1042, 2340 |
| Perfluorododecanoic acid | 1912, 1927 |
| Perfluorononanoic acid | 1969 |
| Perfluorooctane carboxylic acids | 1290 |
| Perfluorooctane sulfonate | 1927, 1969, 1971 |
| Perfluorooctane sulfonic acid | 979, 1043, 1103, 1243, 1932, 2073, 2113, 2147, 2308, 2340, 2342, 2345 |
| Perfluorooctanoic acid | 824, 962, 996, 1027, 1042, 1044, 1045, 1046, 1103, 1116, 1118, 1119, 1120, 1243, 1296, 1334, 1368, 1404, 1589, 1613, 1906, 1932, 1969, 1979, 1986, 2053, 2054, 2062, 2106, 2147, 2246, 2253, 2282, 2308, 2332, 2333, 2338, 2340, 2342, 2383, 2385, 2410, 2411, 2432, 2525 |
| Perfosfamide | 1088, 1103, 2438 |
| Pergolide | 579, 1724 |
| Perhexiline | 1534, 1536, 1820, 2053 |
| Periciazine (Propericiazine) | 580 |
| Perindopril Erbumine | 581, 1092 2276, 2447 |
| Periodate-oxidized adenosine | 1986 |
| Permethrin | 581, 1039, 1041, 1188, 1196, 1216, 1242, 1243, 1249, 1250, 1251, 1296, 1715, 1838, 1900, 2026, 2041, 2073, 2086, 2180, 2185, 2314, 2386, 2387, 2397, 2420, 2461 |
| Permethyl ningalin B analogs | 897 |
| Perospirone | 1537, 1821 |
| Peroxiredoxin I | 1606 |
| Peroxynitrous acid | 2073, 2296 |
| Peroxyvanadate | 2430 |
| Perphenazine | 582, 1064, 1534, 1537, 1821, 2001, 2381 |
| Persimmon fruits (Fuyu-kaki and Hachiya-kaki) | 1927 |
| Pertussis toxin | 1234, 1248, 1259, 2041, 2073, 2155, 2190, 2195, 2221, 2317, 2461 |
| Pertuzumab | 1976 |
| Pervanadate | 2430 |
| Pesticides (Chlorpyrifos, Fenitrothion, Profenofos, Malathion, Phenthoate, Pyrethroids, Deltamethrin, Fenvalerate, lambda-Cyhalothrin, Carbendazim, alpha-Cypermethrin, Cypermethrin, Isoproturon, Carbaryl, Abamectin) | 899, 1039, 1041, 1080, 1100, 1196, 1290, 1365, 1821, 2111, 2117, 2121, 2338 |
| Pethidine (See Meperidine) | 463, 1242, 1243, 1364, 1417, 1505, 1788 |
| Petrosaspongiolide M | 2195, 2372, 2462 |
| Petunidin | 839, 1001 |
| PF-04971729 | 1537, 1821 |
| PFL protocol | 2474 |
| P-glycoprotein inhibitors | 898 |
| PH-302 (Pyrimidineimidazole) | 1821 |
| PHA-568487 | 1537 |
| Phalloidine | 899, 927, 930, 962 |
| Pharmaceutical excipients | 1822 |
| Phenacetin | 1296, 1324, 1334, 1538, 1613, 1822, 2306, 2367, 2372, 2409, 2410, 2513, 2526 |
| Phenanthrene | 1096, 1097, 1296, 1325, 1334, 1346, 1589, 2041, 2045, 2111, 2308, 2367, 2372 |
| Phenazopyridine | 583, 2078 |
| Phencyclidine | 1368, 1377, 1401, 1423, 1589, 1900 |
| Phendimetrazine | 583 |
| Phenelzine | 583, 1377, 1900 |
| Phenethyl isothiocyanate | 927, 962, 1296, 1325, 1334, 1492, 1538, 1584, 1773, 1822, 1969, 2085, 2106, 2111, 2117, 2195, 2308, 2372, 2474 |
| Phenetidine | 2372 |
| Phenindamine | 584, 2155 |
| Phenindione | 2474 |
| Phenobarbital | 584, 899, 927, 930, 957, 962, 965, 970, 971, 979, 1041, 1045, 1060, 1097, 1116, 1161, 1216, 1219, 1220, 1222, 1229, 1242, 1243, 1264, 1296, 1334, 1356, 1365, 1368, 1393, 1401, 1404, 1423, 1613, 1822, 1900, 1906, 1927, 1932, 1984, 1989, 1993, 2022, 2061, 2062, 2073, 2082, 2086, 2091, 2098, 2106, 2107, 2111, 2117, 2121, 2150, 2195, 2209, 2213, 2247, 2249, 2250, 2270, 2298, 2308, 2311, 2312, 2314, 2317, 2346, 2357, 2359, 2372, 2376, 2386, 2400, 2406, 2432, 2435, 2440, 2447, 2462, 2490 |
| Phenobarbital quinidine | 965, 1368, 1401, 1900, 2079, 2106, 2195, 2314, 2415, 2490 |
| Phenol | 585, 1188, 1211, 1257, 1270, 1613, 2308, 2345 |
| Phenol estrogen | 1977 |
| Phenolphthalein | 962, 1099 |
| Phenols | 2041 |
| Phenolsulfonphthalein | 957, 962, 1188 |
| Phenothiazines | 899, 1309, 1497 |
| Phenothrin | 2041, 2045 |
| Phenoxybenzamine | 585 |
| Phenoxypropoxybiguanide analogs | 1823 |
| Phenprocoumon | 1153, 1161, 1393, 1401, 1823, 1893, 1909, 2521 |
| Phentermine | 586 |
| Phenthoate | 1041, 1365, 2041 |
| Phentolamine | 586, 1067, 2306, 2435 |
| Phenyl caffeate | 1194, 1216, 1613, 2462 |
| Phenylacetic acid | 2338 |
| Phenylahistin | 1823 |
| Phenylalanyl-prolyl-arginine methyl chloride | 2048, 2073 |
| Phenylbenzoquinone | 2367, 2372 |
| Phenylbutazone | 1222, 1900, 2317, 2372, 2462 |
| Phenylbutyrate | 2185 |
| Phenylcinnamides | 899 |
| Phenyldiazene | 1823 |
| Phenylephrine | 587, 1033, 1064, 1067, 1216, 1222, 1234, 1236, 2073, 2107, 2300, 2312, 2342, 2365, 2376, 2411, 2447, 2448 |
| Phenylhydrazine | 2296, 2306, 2513 |
| Phenylhydroquinone | 1216, 1823, 2474 |
| Phenylmethylpyrazolone | 1265, 2178, 2195, 2204, 2209, 2218, 2462 |
| Phenylmethylsulfonyl fluoride | 1242, 1243 |
| Phenyl-N-tert-butylnitrone | 2185, 2312 |
| Phenylphosphonothioic acid, 2-ethyl 2-(4-nitrophenyl) ester | 1188, 2041, 2045 |
| Phenylpropylene oxide | 2111 |
| Phenylsaligenin cyclic phosphate | 1196 |
| Phenylsulfone-substituted quinoxaline (WYE-672) | 821 |
| Phenylsulfonylfuroxans | 899 |
| Phenylthiourea | 2073, 2340 |
| Phenylurea compounds | 1188, 2237, 2330 |
| Phenytoin | 588, 824, 899, 927, 957, 962, 996, 1041, 1097, 1116, 1161, 1222, 1262, 1368, 1375, 1394, 1401, 1403, 1418, 1423, 1482, 1497, 1534, 1538, 1584, 1613, 1823, 1900, 2021, 2073, 2086, 2106, 2107, 2113, 2134, 2190, 2195, 2209, 2225, 2272, 2276, 2278, 2311, 2312, 2314, 2317, 2338, 2385, 2386, 2387, 2432, 2447, 2462, 2474, 2490 |
| Phloretin | 1248, 2041, 2045 |
| Phloxine | 1754 |
| Phorbol 12,13-dibutyrate | 2221 |
| Phorbol 12-phenylacetate 13-acetate 20-homovanillate | 2479 |
| Phorbol esters | 930 |
| Phorbol-12-myristate | 1248, 2312 |
| Phorbolol myristate acetate | 1212, 2367, 2372 |
| Phorone | 2317, 2430 |
| Phortress | 1296 |
| Phosalone | 1188 |
| Phosphamidon | 1041, 1216 |
| Phosphates | 2212, 2247, 2516 |
| Phosphatidic acid | 1088, 1222, 1248, 2195, 2209, 2323, 2372, 2381, 2430, 2462 |
| Phosphatidylbutanol | 2195, 2237, 2462, 2520 |
| Phosphatidylcholine | 821, 927, 930, 1153, 1262, 1270, 1334, 1932, 2147, 2189, 2276, 2447, 2462 |
| Phosphatidylcholine hydroperoxide | 2106 |
| Phosphatidylethanolamine | 1334 |
| Phosphatidylinositol | 1116, 1248, 1927, 2048, 2155, 2352, 2381 |
| Phosphatidylinositol 3-kinase inhibitor GDC-0941 (2-(1H-Indazol-4-yl)-6-(4-methanesulfonylpiperazin-1-ylmethyl)-4-morpholin-4-yl-thieno[3,2-d]pyrimidine) | 900 |
| Phosphatidylserines | 1900 |
| Phosphine | 900, 927 |
| Phosphoadenosine phosphosulfate | 2432, 2435 |
| Phosphodiesterase inhibitors | 1248, 1824, 2221 |
| Phosphomannopentaose sulfate | 2520 |
| Phosphoramidon | 1175, 1183, 2013, 2019, 2247 |
| Phosphoric acid esters | 1041, 2338 |
| Phosphorodiamidate morpholino antisense oligomers | 1824 |
| Phosphorus | 1161, 1212, 1242, 1262, 1346, 1368, 2195, 2198, 2209, 2345, 2367, 2372, 2381, 2425, 2449, 2516 |
| Phosphorylcholine | 1270 |
| Photomirex | 1188 |
| Phoxim | 1188, 2041 |
| Phroxine | 925, 1355 |
| Phthalazine | 2462 |
| Phthalic acid | 996, 1045, 1106, 1111, 1188, 1296, 1900, 1989, 2022, 2041, 2045, 2106, 2113, 2147, 2185, 2195, 2204, 2209, 2312, 2331, 2340, 2385, 2423, 2425, 2513 |
| Phthalic anhydride | 2185, 2204 |
| Phthalimide derivatives | 1395 |
| Phycocyanin | 927 |
| Phycoerythrin | 1216 |
| Phyllanthin | 1492 |
| Phyllanthus amarus (Phyllanthin and Hypophyllanthin) | 1325, 1492, 1824 |
| Physostigmine | 589, 1039, 1041, 1243, 1254, 1256 |
| Phytanic acid | 1910 |
| Phytic acid | 2376, 2474 |
| Phytocannabinoids (Δ9-Tetrahydrocannabinol, Cannabidiol and Cannabinol) | 1325 |
| Phytochemicals | 900, 1969 |
| Phytoene | 2041, 2045 |
| Phytoestrogens | 1188, 1969, 2041, 2046, 2209 |
| Phytofluene | 2041, 2046 |
| Phytohormones (Indole-3-acetic acid; Brassinosteroid) | 900 |
| Phytonadione (Vitamin K1) | 589, 2210 |
| Phytostanols | 1985 |
| Phytosterols | 821, 995, 1161, 1985, 2147, 2462 |
| Pibenzimol (Hoechst 33258) | 2468 |
| Picolines | 2106, 2111 |
| Picropodophyllin | 1231 |
| Picrorhiza kurvoa | 1176 |
| Picrotoxin | 2013 |
| Picryl chloride | 2185, 2195, 2204, 2209, 2453 |
| Pifithrin | 1097, 1231, 1290, 1296, 2267, 2359, 2474 |
| Pilocarpine | 589, 1251, 1354, 1356, 1538, 1824, 2073, 2094 |
| Pimagedine | 1034, 1216, 1262, 1368, 2106, 2111, 2185, 2308, 2312, 2423, 2447, 2465 |
| Pimecrolimus | 590, 1824 |
| Pimobendan | 1334, 1825, 1900 |
| Pimozide | 591, 1538, 1825 |
| Pinacidil | 1825, 2234 |
| Pinaverium | 591 |
| Pindolol | 592, 1073, 1082, 2159, 2161 |
| Pinellia (See Banxia Houpo) | 1596 |
| Pinocembrin (5,7-Dihydroxyflavanone)(Boesenbergia pandurata) | 1290, 1606, 1958, 2435 |
| Pinoline | 1538 |
| Pinosylvin | 2041 |
| Pioglitazone | 593, 1021, 1059, 1153, 1176, 1183, 1234, 1325, 1368, 1374, 1375, 1377, 1538, 1548, 1825, 1900, 1941, 1972, 2178, 2185, 2195, 2204, 2303, 2344, 2345, 2372, 2376, 2447, 2462, 2513 |
| Pipecuronium | 593 |
| Piper cubeba | 1492, 1825 |
| Piper methysticum (See Kava kava) | 880, 1491, 1751, 1775 |
| Piper nigrum fruit | 1492 |
| Piperacillin | 594, 2195, 2462 |
| Piperazine | 594, 1538, 2201 |
| Piperazinylimidazo[1,2-a]pyridines | 1825 |
| Piperidines | 1176, 1183, 2201, 2212, 2427 |
| Piperine (Black pepper) | 858, 900, 1265, 1296, 1396, 1825, 2073, 2195, 2209, 2276, 2462 |
| Piperonyl butoxide | 965, 1097, 1222, 1236, 1296, 1334, 1995, 2022, 2104, 2111, 2117, 2185, 2204, 2272, 2308, 2376, 2481, 2520, 2525, 2528 |
| Piperophos | 1188 |
| Pipotiazine | 595 |
| Piracetam | 595, 1041 |
| Pirarubicin | 900, 965, 2026, 2474 |
| Pirbuterol | 596, 1079 |
| Pirenzepine | 1250, 2073 |
| Pirfenidone | 1262, 2276, 2447 |
| Piribedil | 2002, 2004 |
| Pirimicarb | 1041, 1979, 2041 |
| Pirimiphos methyl | 1041, 2041 |
| Pirinixic acid | 812, 824, 965, 971, 979, 996, 1024, 1027, 1043, 1044, 1045, 1046, 1049, 1050, 1052, 1064, 1067, 1083, 1097, 1103, 1116, 1118, 1161, 1176, 1183, 1188, 1191, 1196, 1202, 1216, 1218, 1222, 1229, 1231, 1234, 1236, 1249, 1262, 1264, 1272, 1296, 1906, 1932, 1986, 1995, 2019, 2022, 2053, 2054, 2062, 2066, 2091, 2097, 2104, 2107, 2117, 2150, 2153, 2157, 2195, 2198, 2221, 2223, 2224, 2242, 2243, 2249, 2253, 2256, 2259, 2270, 2272, 2284, 2288, 2292, 2306, 2312, 2314, 2323, 2324, 2330, 2331, 2340, 2345, 2352, 2362, 2363, 2376, 2382, 2385, 2392, 2394, 2397, 2399, 2406, 2409, 2412, 2413, 2425, 2430, 2447, 2462, 2481, 2483, 2520, 2525, 2529 |
| Pirinixic acid derivative LP105 | 1153 |
| Piroxicam | 596, 1241, 1395, 1401, 1539, 1979, 2121, 2274, 2367, 2372, 2407, 2409, 2410, 2462 |
| Pitavastatin | 597, 900, 1018, 1826, 2415 |
| Pithecellobium dulce | 1606 |
| Pittsburgh cocktail | 1325 |
| Pittsburgh compound B (PIB) | 1019 |
| Pivampicillin | 598 |
| Pizotifen (Pizotyline) | 598 |
| PKC412 | 900, 927, 2238 |
| PKD2 | 900 |
| PKI 166 | 930, 962, 1222, 2026, 2415 |
| Plant extracts | 901, 927, 943, 962, 1041, 1097, 1176, 1183, 1188, 1196, 1197, 1216, 1222, 1229, 1234, 1238, 1257, 1270, 1296, 1325, 1334, 1401, 1423, 1589, 1613, 1900, 2041, 2046, 2106, 2111, 2117, 2178, 2185, 2195, 2201, 2204, 2209, 2218, 2221, 2296, 2301, 2308, 2313, 2317, 2367, 2372, 2376, 2423, 2447, 2462, 2468, 2474, 2479, 2483, 2525, 2528 |
| Plant isoquinoline alkaloids (Corydine, Parfumine and 8-Methyl-2,3,10,11-tetraethoxyberbine) | 1325, 1539, 1826 |
| Plant oils | 2073, 2195, 2338, 2474 |
| Plant preparations | 1103, 1216, 1334, 1900, 2013, 2041, 2046, 2178, 2189, 2195, 2246, 2276, 2301, 2338, 2372, 2382, 2432, 2447, 2475 |
| Plant stanols | 1154, 1980 |
| Plant sterols (beta-Sitosterol, Campesterol, Stigmasterol, Fucosterol, and z-Guggulsterone) | 940, 1927 |
| Plasma Protein Fraction | 599 |
| Plastochromanol 8 | 901, 927, 1900, 2313, 2490 |
| Plastoquinone-Decylrhodamine 19 conjugate (SkQR1) | 901 |
| Platinum | 957, 962, 1018, 1193, 2029, 2085, 2117, 2372, 2526, 2528 |
| Platinum complexes (Cisplatin, Oxaliplatin, Carboplatin, Transplatin, and trans-[PtCl2(NH3)(2-Methylbutylamine or sec-butylamine)]) | 812, 1325, 1395, 1539, 1826 |
| Platinum compounds | 2117 |
| Platinum derivatives | 1995 |
| Platycodi radix | 1607 |
| Platycodon grandiflorum(Changkil saponins) | 1612 |
| Plaunotol | 2462 |
| PLD118 | 1334, 1356, 1368, 1401, 1423, 1589, 1613 |
| Plerixafor | 599 |
| Pleurotus cornucopiae mushroom | 1607 |
| Plicamycin | 2185, 2259, 2338 |
| Plitidepsin (See Aplidine) | 1659, 1826 |
| Pluronic block copolymer p85 | 927, 943, 962, 2474 |
| Pluronic F68 block copolymer | 1826 |
| PM00104 | 942 |
| p-Methoxy-N-methylphenethylamine | 2159 |
| p-MPPF | 1019 |
| Pneumococcal Conjugate Vaccine (7-Valent) | 600 |
| p-Nitrophenol | 1290, 2433 |
| PNU 109291 | 2161 |
| PNU-106893 | 1826 |
| PNU-109165 | 1826 |
| PNU-109166 | 1826 |
| PNU-109167 | 1826 |
| PNU-288034 (N-({(5S)-3-[4-(1,1-Dioxidothiomorpholin-4-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl)acetamide) | 901 |
| PNU-96391 | 1539 |
| Podofilox | 600 |
| Podophyllotoxin | 2266 |
| Podophyllotoxin derivatives (4-[4″-(2″, 2″, 6″, 6″-Tetramethyl-l”-piperidinyloxy) amino]-4′-demethyl epipodophyllotoxin)(GP7)(YB-1EPN) | 901 |
| Podophyllum Resin | 600 |
| Podoplanin | 1018 |
| Policosanol | 1385 |
| Poliovirus Vaccine (Inactivated) | 601 |
| Poly (ethylene oxide)-poly (propylene oxide)-poly (ethylene oxide) micelles | 1018 |
| Poly-L-Lactic Acid | 601 |
| Poly(acrylic acid)-cysteine (PAA-cysteine) | 1879 |
| Poly(ethylene glycol)-conjugated multi-walled carbon nanotubes | 901 |
| Poly(propyleneimine) | 1111, 1231, 1236, 2270 |
| Poly[ethylene oxide]-poly[propylene oxide] [PEO-PPO] amphiphiles | 901 |
| Polybrominated diphenylethers (2,2′,4,4′-Tetrabromodiphenyl ether (BDE-47) | 1290, 1826, 1963 |
| Polycarbophil | 601 |
| Polychlorinated biphenyl (PCB) congeners | 1041, 1042, 1097, 1196, 1217, 1231, 1234, 1264, 1290, 1296, 1325, 1334, 1346, 1827, 1941, 1943, 1963, 1979, 2041, 2046, 2053, 2085, 2153, 2185, 2201, 2209, 2218, 2241, 2361, 2423, 2432, 2436, 2447, 2451, 2462, 2481, 2490, 2493 |
| Polychlorinated dibenzo-p-dioxins (PCDDs) | 1827 |
| Polychlorodibenzo-4-dioxin | 1097, 1264, 1296, 1334, 1346, 1943, 2041 |
| Polycyclic aromatic hydrocarbons | 1096, 1290, 1296, 1325, 1334, 1346, 1827, 1943, 2111, 2117, 2121, 2209, 2296, 2308, 2376, 2432, 2528 |
| Polydatin | 962, 2243, 2328, 2490 |
| Polyestradiol phosphate | 1270 |
| Polyethylene | 2462 |
| Polyethylene Glycol 3350 | 601, 1762, 2073 |
| Polygala tenuifolia | 1176 |
| Polyinosinic/polycytidylic acid | 901 |
| Polyisohexylcyanoacrylate | 927 |
| Polymeric inhibitors | 901 |
| Polymethyl methacrylate | 2209 |
| Polymethyoxyflavonoids | 902 |
| Polymyxin B | 602, 2209, 2218, 2462 |
| Polyphenolic compounds from Solanum torvum | 1607 |
| Polyphenols | 943, 962, 996, 1064, 1093, 1119, 1120, 1161, 1197, 1209, 1217, 1222, 1244, 1296, 1334, 1613, 1827, 1932, 2004, 2023, 2054, 2061, 2117, 2161, 2178, 2180, 2185, 2195, 2201, 2204, 2209, 2218, 2221, 2230, 2250, 2253, 2261, 2331, 2386, 2406, 2417, 2423, 2425, 2427, 2433, 2462, 2468, 2528 |
| Polyphenols from Mangifera indica (Mango stem bark extract) | 902 |
| Polypodium leucotomos L. (See Anapsos) | 42, 1129 |
| Polysaccharide peptides from Coriolus versicolor | 1395 |
| Polysaccharide-Iron Complex | 602 |
| Polysaccharides | 1334, 1613, 2178, 2218, 2221, 2376 |
| Polysorbate 80 | 1393 |
| Polyunsaturated fatty acids (PUFAs) | 1326, 1539, 1827 |
| Pomalidomide | 2201, 2218 |
| Pomegranate Ellagitannins, Punicalins, Punicalagins, and Urolithins | 1343, 1970 |
| Pomelo | 1827 |
| Poractant Alpha | 602, 2185 |
| Porfimer | 603, 2245 |
| Posaconazole | 603, 843, 1539, 1827 |
| Potassium | 985, 1176, 1183, 1941, 1943, 2012, 2013, 2073, 2155, 2229, 2230, 2232, 2234, 2236, 2323 |
| Potassium Acetate | 604 |
| Potassium Acid Phosphate | 604 |
| Potassium Bicarbonate | 605 |
| Potassium Chloride | 605, 1259, 1265, 1943, 2266 |
| Potassium Citrate | 606 |
| Potassium cyanide | 1331, 2073 |
| Potassium diazoacetate | 2474 |
| Potassium dichromate | 943, 1024, 1043, 1217, 1257, 2050, 2083, 2125, 2147, 2209, 2222, 2242, 2430, 2481 |
| Potassium ferricyanide | 2301 |
| Potassium Gluconate | 606 |
| Potassium Iodide | 606 |
| Potassium nitrate | 2520 |
| Potassium p-Aminobenzoate | 607 |
| Potassium perfluorooctanesulfonate | 1928 |
| Potassium Phosphate | 607 |
| Povidone-Iodine | 607 |
| PPAR alpha Agonists | 940 |
| PPAR gamma Agonists | 1828 |
| Pradefovir | 1828 |
| Pralatrexate | 608 |
| Pralidoxime | 608, 1041, 1196 |
| Pramipexole | 609, 2001, 2003, 2002, 2004, 2006 |
| Pramlintide | 610 |
| Pramoxine | 610 |
| Pranidipine | 1539, 1828 |
| Pranlukast | 1334, 1401, 1423, 1585, 1589, 1613, 1828, 1900 |
| Prasugrel | 610, 902, 1365, 1367, 1395, 1418, 1539, 1828 |
| Pravastatin | 611, 822, 902, 927, 929, 930, 957, 962, 1018, 1024, 1033, 1103, 1154, 1244, 1291, 1539, 1900, 1928, 2061, 2146, 2147, 2180, 2210, 2245, 2247, 2276, 2278, 2301, 2314, 2415, 2416, 2418, 2453, 2462, 2474 |
| Praziquantel | 612, 840, 902, 1326, 1334, 1423, 1829, 1900 |
| Prazosin | 612, 927, 1064, 1067, 1296, 2073, 2346 |
| Prebiotic fibre supplementation | 1928 |
| Prednicarbate | 613 |
| Prednisolone | 613, 1188, 1829, 1900, 2062, 2185, 2195, 2201, 2204, 2210, 2213, 2218, 2317 |
| Prednisone | 614, 902, 965, 1234, 1236, 1241, 1829, 2111, 2117, 2121, 2216, 2376, 2447, 2481, 2516 |
| Pregabalin | 615 |
| Pregna-4,17-diene-3,16-dione | 930, 1222, 1900, 1932, 2041, 2195, 2313, 2314, 2372, 2462, 2520 |
| Pregnane X receptor (PXR) agonists | 1291 |
| Pregnanolone | 2101, 2266 |
| Pregnenolone | 1188, 1250, 1252, 1900, 2313 |
| Pregnenolone carbonitrile | 824, 927, 930, 957, 962, 965, 1334, 1900, 1906, 1928, 1932, 2150, 2313, 2314, 2317, 2385, 2418, 2490, 2493, 2494 |
| Prenyloxycinnamic acids (Boropinic acid, 4′-Isopentenyloxy-p-coumaric acid, 4′-Geranyloxyferulic acid) | 903, 1365, 1540 |
| Prestige-like heavy fuel oil and perfluorooctane sulfonate | 1971 |
| Pretilachlor | 1900, 2313 |
| Prexige | 2372 |
| Prilocaine | 616 |
| Primaquine | 616, 1177, 1248, 1296, 1326, 1334, 1346, 1540, 1589, 1832, 2078 |
| Primidone | 617, 2313 |
| Prinomastat | 2276, 2278 |
| Proadifen | 1334, 1356, 1368, 1540, 1613 |
| Proanthocyanidin | 1229, 1344 |
| Proanthocyanidins | 1034 |
| Proanthocyanidins from Sorghum bicolor bran/td> | 1961 |
| Probenecid | 617, 943, 958, 962, 965, 1377, 1900, 2078, 2313, 2394, 2409 |
| Probiotics | 903, 958, 1833 |
| Probucol | 618, 1119, 1120, 1154, 1540, 1833, 2420, 2462, 2513 |
| Procainamide | 618, 1540, 1833, 2295, 2296, 2390, 2412 |
| Procaine | 619, 1242, 1243, 2479 |
| Procarbazine | 619, 2259, 2272, 2274 |
| Procaterol | 1079, 1080 |
| Procetofen | 1042, 1043, 1183, 1222, 1270, 1272, 1377, 1911, 1932, 2195, 2210, 2221, 2305, 2338, 2340, 2357, 2385, 2462 |
| Prochloraz (Spartakus) | 1097, 1188, 1217, 1383, 1971, 1979, 2041, 2046, 2313 |
| Prochlorperazine | 620 |
| Procyanidin | 894, 1231, 2376, 2474 |
| Procyclidine | 620 |
| Procymidone | 1188, 1222, 1267, 1979, 2150, 2174, 2296, 2301 |
| Prodigiosin | 943 |
| Profenofos | 1196, 1365 |
| Progesterone | 621, 812, 962, 965, 979, 996, 1018, 1024, 1043, 1060, 1067, 1079, 1080, 1082, 1099, 1103, 1108, 1121, 1183, 1188, 1190, 1222, 1229, 1231, 1248, 1249, 1250, 1252, 1254, 1256, 1259, 1262, 1296, 1346, 1404, 1613, 1833, 1906, 1979, 1992, 1993, 2013, 2019, 2041, 2046, 2062, 2073, 2086, 2091, 2101, 2121, 2125, 2147, 2153, 2178, 2185, 2189, 2195, 2204, 2210, 2227, 2242, 2246, 2247, 2253, 2259, 2261, 2266, 2276, 2278, 2301, 2306, 2313, 2314, 2317, 2323, 2330, 2345, 2346, 2352, 2357, 2360, 2362, 2363, 2367, 2372, 2376, 2380, 2381, 2382, 2392, 2404, 2423, 2425, 2447, 2449, 2453, 2462, 2474, 2481, 2490, 2513, 2520 |
| Progesterone congeners | 2520 |
| Progesterone-Adenine hybrids | 903 |
| Progestins | 1222, 1234, 2520, 2474 |
| Progestogens | 1176 |
| Progranulin | 1154 |
| Proguanil | 622, 1419, 1541, 1833 |
| Promazine | 1541, 1833 |
| Promegestone | 1043, 1188 |
| Promethazine | 622, 1482, 1541, 2155 |
| Prometone | 1188 |
| Pronamide | 1979 |
| Propachlor | 1296, 1334 |
| Propafenone | 623, 1478, 1482, 1534, 1541, 1545, 1547, 1558, 1579, 1585, 1833 |
| Propamocarb | 1979, 2423 |
| Propanil | 1188, 1097, 2185, 2201, 2462 |
| Propantheline | 624 |
| Proparacaine | 624 |
| Propargyl alcohol | 1613 |
| Propazine | 1979 |
| Propiconazole | 927, 962, 1046, 1052, 1102, 1103, 1188, 1243, 1296, 1334, 1383, 1613, 1979, 2022, 2106, 2111, 2308, 2313, 2317, 2357 |
| Propidium | 1041 |
| Propineb | 1252 |
| Propionaldehyde | 1106, 2365 |
| Propiverine | 1834 |
| Propofol | 624, 959, 1250, 1251, 1252, 1368, 1585, 1834, 1930, 2073, 2453, 2462 |
| Propolis | 1613 |
| Propoxur | 1041, 1254, 2041 |
| Propoxyphene | 625, 1510, 1543 |
| Propranolol | 626, 903, 1073, 1079, 1080, 1082, 1111, 1264, 1296, 1334, 1423, 1497, 1543, 1580, 1589, 1835, 2073, 2091, 2161, 2195, 2230, 2232, 2306, 2346, 2372, 2462 |
| Propyl gallate | 1217 |
| Propyl pyrazole triol | 2041, 2301 |
| Propylene glycol | 965, 1762, 2086 |
| Propylene oxide | 2121 |
| Propylparaben | 1188 |
| Propylthiouracil | 627, 979, 1177, 1183, 1190, 1218, 1267, 2066, 2125, 2276, 2306, 2314, 2320, 2333, 2335, 2338, 2345, 2382, 2451 |
| Prostaglandin A2 | 2106, 2111 |
| Prostaglandin D2 | 2195, 2301 |
| Prostaglandin D3 | 2195, 2372 |
| Prostaglandin E2 | 1155, 1344 |
| Prostaglandin E3 | 2195, 2372 |
| Prostaglandin H2 | 2440 |
| Prostaglandin I3 | 2195, 2372 |
| Prostaglandins | 1248, 2367, 2372 |
| Prostaglandins E | 943, 970, 971 |
| Prostasin | 1941 |
| Protamine Sulfate | 627 |
| Protease inhibitors | 903, 943 |
| Proteasome inhibitors | 903, 958, 1607 |
| Protein C Concentrate (Human) | 627, 2353 |
| Proteoglycans | 2189 |
| Proteolipid protein 139-151 | 2041 |
| Prothiophos | 1188, 2041, 2046 |
| Prothrombin Complex (Human) | 628 |
| Protirelin | 628 |
| Protoberberine alkaloids from Coptidis Rhizoma | 904 |
| Protocatechualdehyde | 2447 |
| Protocatechuic acid | 1138, 1155, 1296, 1334, 1613, 1714, 2308 |
| Protocatechuic aldehyde | 1714 |
| Proton pump inhibitors | 904, 1395, 1410, 1419, 1525, 1544, 1560, 1836 |
| Protons | 1024, 2479, 2483 |
| Protopine | 1288, 1326 |
| Protoporphyrinogen | 2447 |
| Protriptyline | 628, 1479, 1545 |
| Prucalopride | 629 |
| Prulifloxacin | 927, 962 |
| Prunetin | 1106 |
| PSC-833s | 904 |
| Pseudoephedrine | 630, 1067, 1079 |
| Pseudohypericin | 1296 |
| Psoralen | 1837, 1900 |
| Psychotropic drugs | 1403, 1471, 1483, 1488, 1497, 1837 |
| Psyllium | 631 |
| Pterostilbene | 1334, 2340, 2423 |
| p-tert-Amylphenol | 1188 |
| PTK787/ZK222584 | 1972 |
| Pueraria lobata (Willd) Ohwi | 1545 |
| Puerarin (Ge-gen, Radix Puerariae, Pueraria lobata (Willd) Ohwi) | 904, 1326, 1545, 1613, 1972, 2073 |
| Puerarin glycosides (Kudzu) | 1928 |
| Pulegone | 2462 |
| Pulvinic acid derivatives | 1838 |
| Punicalagins | 1343 |
| Punicalins | 1343 |
| Puromycin | 1261, 1296, 2246 |
| Purpurin | 1838 |
| PXD101 | 2274 |
| PXR Activators | 1838 |
| Pycnogenols | 1217 |
| Pyralene | 1296 |
| Pyrantel | 1589 |
| Pyrantel Pamoate | 631 |
| Pyrazinamide | 631, 1381, 2121 |
| Pyrazines | 2106, 2111 |
| Pyrazoles | 1219, 1356, 1607, 1613, 1932, 2022, 2029, 2104, 2106, 2107, 2111, 2121, 2201, 2309, 2345, 2346, 2423, 2432 |
| Pyrazoline analogs | 1838 |
| Pyrazoloacridine (NSC 366140) | 1838 |
| Pyrazolyl propionyl cyclohexenamide derivatives | 1375 |
| Pyrene | 943, 962, 1097, 1217, 1296, 1334, 1346, 1356, 1377, 1401, 1423, 1589, 1613, 1622, 1838, 2117, 2125, 2280, 2283, 2309, 2432, 2433, 2435 |
| Pyrethrins | 1838, 2340, 2073 |
| Pyrethroid insecticides/pesticides | 1365, 1838 |
| Pyridaben | 2420 |
| Pyridate | 1188, 2041 |
| Pyridine | 1296, 1334, 1613, 1900, 2073 |
| Pyridine-substituted 3,4-dihydro-1H-quinolin-2-one derivatives | 1327, 1941 |
| Pyridostigmine | 632, 1041, 1196, 1248, 1251 |
| Pyridoxal isonicotinoyl hydrazone | 1218, 1296, 1334 |
| Pyridoxal phosphate-6-azophenyl-2′,4′-disulfonic acid | 2324 |
| Pyridoxine (Vitamin B6) | 632, 1119, 1220, 1270, 2210 |
| Pyrilamine | 1545, 2155 |
| Pyrimethamine | 633, 2116, 2117 |
| Pyrimidin-2-one beta-ribofuranoside | 1265, 2481 |
| Pyrimidineimidazole (See PH-302) | 1821 |
| Pyrimidines | 2279 |
| Pyrithione | 2101, 2266 |
| Pyrogallol | 1183, 1217 |
| Pyrroles | 1993 |
| Pyrrolidine dithiocarbamate | 904, 1088, 1189, 1262, 2073, 2178, 2185, 2195, 2201, 2221, 2372, 2462, 2513 |
| Pyrrolidino-4-iodotamoxifen | 2106 |
| Pyrrolobenzodiazepine derivatives | 904, 1019, |
| Pyrrolopyrimidine | 1839 |
| Pyruvaldehyde | 2266, 2338, 2447 |
| Pyruvic acid | 2073 |
| PZ-39 | 940, 1019 |
| Q | |
| Quaternary ammonium compounds | 904 |
| Quazepam | 634, 1419, 1839 |
| Quercetagetin | 855 |
| Quercetagetin-3,6,7-trimethylether | 855 |
| Quercetin | 902, 904, 914, 927, 943, 958, 962, 970, 1019, 1024, 1034, 1036, 1097, 1119, 1155, 1217, 1218, 1231, 1234, 1236, 1241, 1248, 1264, 1270, 1286, 1296, 1306, 1327, 1334, 1377, 1545, 1607, 1622, 1751, 1839, 1900, 1979, 1992, 2041, 2046, 2066, 2073, 2104, 2106, 2107, 2117, 2156, 2178, 2186, 2201, 2210, 2268, 2279, 2301, 2313, 2314, 2338, 2342, 2347, 2376, 2423, 2430, 2432, 2435, 2436, 2447, 2462, 2490, 2493 |
| Quercetin, EGCG, Catechin, and Betaine | 1607 |
| Quercetin, Naringenin, and Rutin | 904 |
| Quetiapine | 634, 904, 1064, 1545, 1579, 1839, 2006 |
| Quil A | 2201 |
| Quinacrine | 904, 1088, 1840, 2309 |
| Quinagolide | 635 |
| Quinalphos | 1097, 1189, 1296, 2041, 2046 |
| Quinapril | 636, 1033, 1092, 2447 |
| Quinazolines | 2019, 2026 |
| Quinelorane | 2002, 2004 |
| Quinidine | 637, 905, 927, 943, 1334, 1545, 1589, 1840, 1900, 2061, 2078, 2111, 2117, 2229, 2250, 2465 |
| Quinidinium | 927 |
| Quinine | 638, 905, 927, 1177, 1183, 1545, 1589, 1840, 1900, 2078, 2111 |
| Quinoline | 1231, 1241, 1334, 1356, 1613, 2227, 2256, 2270, 2274, 2340, 2345, 2382, 2462, 2474 |
| Quinolinic acid | 2073 |
| Quinones | 2309 |
| Quinoxalines | 2213 |
| Quinpirole | 1265, 2002, 2004 |
| Quintozene | 1979, 2041 |
| Quinuclidinyl benzilate | 1250, 1251, 1252 |
| Quinupristin and Dalfopristin | 638 |
| R | |
| R 667 | 1841 |
| R 848 | 2186, 2195, 2210, 2218, 2430, 2462 |
| R 59949 | 1088 |
| R 121919 | 1267, 2317 |
| R 126638 | 1545, 1841 |
| R-(-)-Deprenyl | 1019 |
| R-(+)-Citronellal | 960 |
| R-(+)-Verapamil | 1019 |
| R483 | 1419 |
| Rab4 | 905 |
| Rabeprazole | 640, 905, 1296, 1334, 1419, 1545, 1841 |
| Rabies Immune Globulin (Human) | 640 |
| Rabies Virus Vaccine | 641 |
| Raclopride | 1019 |
| Radix Puerariae | 1326 |
| Radixin | 947 |
| Radon | 1241, 2272 |
| Rafoxanide | 840 |
| Rainbow trout (Oncorhynchus mykiss) | 906 |
| Raloxifene | 641, 906, 927, 996, 1034, 1060, 1062, 1088, 1121, 1189, 1217, 1222, 1270, 1292, 1345, 1345, 1377, 1545, 1566, 1841, 1900, 1986, 2026, 2038, 2041, 2046, 2086, 2088, 2097, 2098, 2164, 2189, 2190, 2195, 2198, 2210, 2229, 2246, 2250, 2253, 2276, 2278, 2288, 2301, 2302, 2330, 2331, 2353, 2365, 2372, 2382, 2383, 2388, 2397, 2399, 2405, 2420, 2425, 2430, 2442, 2447, 2462, 2468, 2474, 2489, 2515, 2516, 2520 |
| Raltegravir | 642, 906, 1768, 1842, 2489 |
| Raltitrexed | 642, 2405, 2474, 2481 |
| Ramatroban | 2440 |
| Ramelteon | 643, 1327, 1334, 1420, 1842, 1900 |
| Ramipril | 643, 1033, 1092, 1158, 1262, 2276, 2301, 2377, 2447 |
| Ramosetron | 1534, 1855 |
| Ranibizumab | 644, 1245 |
| Ranitidine | 644, 906, 1039, 1041, 1196, 1217, 2068, 2155 |
| Ranolazine | 645, 1545, 1560, 1842 |
| Rapacuronium | 646 |
| Rapamycin | 906, 1982, 2174 |
| Rapeseed oil | 1044, 1116, 1217, 1262, 2253, 2345 |
| Rasagiline | 646, 1546, 2260 |
| Rasburicase | 647, 1215, 2078 |
| Razoxane | 927, 2276, 2303 |
| Reactive oxygen species (ROS) | 962, 1088, 1097, 1106, 1189, 1217, 1296, 1613, 1842, 2013, 2019, 2178, 2179, 2180, 2186, 2195, 2201, 2326, 2338, 2340, 2345, 2372, 2423, 2442, 2447, 2462, 2483, 2528 |
| Rebamipide | 906, 1218, 1262, 1842, 1992, 2061, 2078, 2101, 2178, 2189, 2241, 2276, 2367, 2372, 2435, 2520 |
| Reboxetine | 648, 1546, 1842 |
| Red grape juice polyphenols | 1929 |
| Red peony root | 1135 |
| Red wine | 1842 |
| Red yeast rice | 1929 |
| Relcovaptan | 1248 |
| Remifentanil | 648 |
| Remofovir mesylate | 1842 |
| Renzapride | 1843 |
| Repaglinide | 649, 906, 984, 1375, 1377, 1788, 1843, 1900, 2233, 2404, 2415, 2416, 2418 |
| Repinotan | 1546 |
| RES 701-1 | 2013, 2306 |
| Reserpine | 649, 927, 930, 1296, 1900, 2026, 2246 |
| Resiniferatoxin | 2073, 2462, 2479 |
| Resistin | 1972 |
| Resorcinol | 1097, 1189, 2309 |
| Resveratrol | 824, 906, 943, 958, 962, 970, 971, 985, 995, 996, 1019, 1024, 1027, 1034, 1042, 1060, 1088, 1097, 1177, 1183, 1189, 1207, 1209, 1217, 1222, 1231, 1234, 1236, 1238, 1241, 1252, 1254, 1265, 1270, 1272, 1291, 1296, 1327, 1334, 1345, 1346, 1395, 1492, 1546, 1613, 1844, 1900, 1908, 1972, 1979, 1992, 2013, 2019, 2026, 2041, 2046, 2048, 2073, 2082, 2097, 2101, 2106, 2117, 2178, 2180, 2186, 2189, 2190, 2195, 2201, 2210, 2224, 2227, 2237, 2238, 2241, 2253, 2266, 2272, 2276, 2301, 2305, 2309, 2313, 2328, 2331, 2333, 2338, 2340, 2342, 2345, 2346, 2359, 2363, 2367, 2372, 2376, 2410, 2420, 2423, 2430, 2432, 2433, 2435, 2436, 2447, 2453, 2462, 2474, 2490, 2513, 2516, 2520, 2525 |
| Resveratrol derivatives | 1177, 1972 |
| Retapamulin | 650 |
| Retene (7-Isopropyl-1-methylphenanthrene) | 1291 |
| Reteplase | 650 |
| Retigabine | 2295 |
| Retinaldehyde | 1054, 1102, 1103, 1106, 1108 |
| Retinoic acid | 1904, 1929 |
| Retinoids | 822, 1102, 1103, 1844, 2442, 2474 |
| Retinol (Vitamin A) | 651, 924, 928, 1098, 1103, 1111, 1121, 1179, 1183, 1217, 1223, 1262, 1265, 1297, 1347, 1368, 1613, 1946, 1972, 2086, 2186, 2204, 2248, 2323, 2340, 2345, 2346, 2375, 2379, 2431, 2449, 2453, 2463, 2520 |
| Retinol acetate | 1161, 1194, 1222, 2204, 2210, 2270, 2276, 2359, 2451 |
| Retinol palmitate | 2195, 2198, 2210, 2218, 2385 |
| Retrograded tapioca starch | 1929 |
| Retrorsine | 1845 |
| Retusin | 1008 |
| RG 12525 | 1845 |
| Rhapontigenin | 2041, 2046 |
| Rhapontin | 944 |
| Rhei Rhizoma extract | 907, 958 |
| Rhein | 2447 |
| Rheum palmatum | 1490 |
| Rho(D) Immune Globulin | 651 |
| Rhodamine 123 (6-Amino-9-(2-methoxycarbonylphenyl)xanthen-3-ylidene]azanium chloride) | 907 |
| Rhodiola rosea | 1845 |
| Ribavirin | 652, 1546, 1768, 2210, 2218, 2413, 2462 |
| Riboflavin (Vitamin B2) | 652, 1270, 2288 |
| Riccardin D | 907 |
| Rice bran oil diet | 1929 |
| Rifabutin | 653, 1845, 1848, 1900, 2489 |
| Rifalazil | 1846 |
| Rifampicin (See Rifampin) | 654, 824, 907, 927, 930, 944, 958, 962, 996, 1056, 1189, 1242, 1243, 1296, 1334, 1356, 1368, 1377, 1381, 1401, 1403, 1404, 1423, 1546, 1551, 1553, 1613, 1846, 1848, 1900, 1904, 1906, 1929, 1932, 2041, 2045, 2121, 2150, 2311, 2313, 2314, 2317, 2346, 2385, 2415, 2416, 2418, 2490 |
| Rifampin (Rifampicin) | 654, 824, 907, 927, 930, 944, 958, 962, 996, 1056, 1189, 1242, 1243, 1296, 1334, 1356, 1368, 1377, 1381, 1401, 1403, 1404, 1423, 1546, 1551, 1553, 1613, 1846, 1848, 1900, 1904, 1906, 1929, 1932, 2041, 2045, 2121, 2150, 2311, 2313, 2314, 2317, 2346, 2385, 2415, 2416, 2418, 2490 |
| Rifamycins | 930, 1848, 2106, 2111, 2416 |
| Rifapentine | 655, 1900 |
| Rifaximin | 655, 1848 |
| Rilonacept | 655 |
| Riluzole | 656 |
| Rimantadine | 656 |
| Rimexolone | 657 |
| Rimonabant | 1155, 1258, 1259, 1929, 2073, 2186, 2195, 2462 |
| Risedronate | 657, 1972 |
| Risperidone | 658, 908, 927, 1064, 1117, 1327, 1479, 1483, 1502, 1523, 1534, 1547, 1548, 1553, 1558, 1559, 1570, 1580, 1589, 1848, 2001, 2002, 2004, 2006, 2073, 2164, 2165, 2167, 2170, 2337, 2381, 2399, 2430 |
| Ritanserin | 2161, 2164, 2165 |
| Ritonavir | 659, 908, 919, 1120, 1155, 1331, 1334, 1366, 1368, 1377, 1401, 1423, 1479, 1533, 1534, 1548, 1551, 1552, 1553, 1560, 1589, 1782, 1849, 1900, 1985, 2210, 2301, 2312, 2313, 2462, 2490 |
| Ritonavir and Lopinavir | 660, 1553, 1560, 1782 |
| Rituximab | 661, 2207 |
| Rivaroxaban | 895, 908, 1420, 1812, 1849 |
| Rivastigmine | 661, 1040, 1155, 1195, 1254, 1256, 2264 |
| Rivoglitazone | 1155, 2493 |
| Rivulobirin A | 869 |
| Rizatriptan | 662 |
| RL3142 (4-Dimethylamino-4′-(imidazol-1-yl)chalcone) | 1849 |
| RMI 12330A | 1248 |
| Ro 03-7410 | 1589 |
| Ro 15-4513 | 2079 |
| Ro 28-2653 | 2276 |
| Ro 31-8220 | 1097, 1265, 2073, 2155, 2195, 2210, 2266, 2372, 2447, 2462 |
| Ro 31-8425 | 2276 |
| Ro 32-0432 | 2013 |
| Ro 41-5253 | 2186, 2218, 2221, 2224, |
| Ro 47-8634 | 930 |
| Ro 48-8071 | 1850 |
| Ro 65-7199 | 1043, 1097, 1103, 1243, 2022, 2053, 2170, 2323, 2367 |
| Ro 66-0074 | 1043, 1097, 1103, 2022, 2053, 2170, 2323, 2367 |
| Ro 363 | 1073 |
| Robinetin | 943, 962 |
| Rocuronium | 663 |
| Rofecoxib | 1111, 1177, 1270, 1510, 1553, 2178, 2195, 2198, 2211, 2309, 2361, 2365, 2367, 2370, 2372, 2423, 2430, 2451 |
| Roflumilast | 663, 908, 1327, 1850 |
| Rogletimide | 1979 |
| Rokitamycin | 1850 |
| Rolafagrel | 2447 |
| Rolipram | 1248, 2013, 2195, 2204, 2210, 2320, 2462 |
| Rolofylline | 1850 |
| Romidepsin | 664, 908, 927, 944, 1020, 1296, 1334, 1356, 1368, 1377, 1401, 1423, 1589, 1850, 1900, 2314, 2376 |
| Romiplostim | 665 |
| Ropinirole | 665, 1724 |
| Ropivacaine | 666, 1850 |
| Roquinimex | 1851, 2186, 2204, 2218 |
| Roscovitine | 908, 1231, 1234, 1236, 1238, 1702, 2376, 2474 |
| Rose Bengal | 925, 1355, 1754 |
| Rosemary phytochemicals | 909 |
| Rosiglitazone | 666, 876, 1021, 1049, 1060, 1156, 1190, 1234, 1262, 1265, 1270, 1368, 1376, 1377, 1548, 1589, 1620, 1851, 1900, 1941, 1972, 2053, 2178, 2195, 2204, 2210, 2218, 2221, 2247, 2253, 2301, 2317, 2345, 2346, 2372, 2376, 2418, 2447, 2483, 2513 |
| Rosmarinic acid | 909, 1327, 1492, 1814 |
| Rossicaside B from Boschniakia rossica | 1607 |
| Rostafuroxin | 909 |
| Rosuvastatin | 667, 909, 930, 1020, 1395, 1553, 1851, 2061, 2400 |
| Rotavirus Vaccine | 668 |
| Rotenone | 1088, 1217, 1979, 2073, 2082, 2178, 2195, 2210, 2283, 2296, 2301, 2326, 2379, 2420, 2423, 2430, 2447, 2462, 2483 |
| Rotigotine | 668 |
| Rottlerin | 1026, 1979, 2019, 2201, 2221, 2276, 2301, 2324, 2373, 2376, 2520 |
| Roxithromycin | 885, 1247, 1851, 1900, 2195, 2210, 2462 |
| Royal jelly | 2041, 2046, 2520 |
| RPR 106541 | 1852 |
| RPR 121056 | 1242, 1243 |
| RS-21607 | 1852 |
| (R)-(-)-2-Chloro-N-[1-11C-propyl]n-propylnorapomorphine | 905 |
| (R,S)-CGP12177 | 1019 |
| (R,S)-PK11195 | 1019 |
| [(R)-2-(9-(1H-Imidazol-1-yl)nonyl)-2,5,7,8-tetramethylchroman-6-ol] | 1911 |
| RU 486 (Mifepristone) | 489, 930, 955, 962, 965, 985, 1034, 1188, 1231, 1248, 1355, 1657, 1794, 1900, 1906, 1932, 1965, 1992, 2041, 2101, 2106, 2150, 2178, 2188, 2195, 2201, 2204, 2209, 2217, 2221, 2259, 2278, 2301, 2308, 2312, 2317, 2332, 2364, 2367, 2376, 2423, 2425, 2461, 2465, 2513, 2520 |
| RU 24858 | 2195, 2317 |
| RU 43044 | 2195 |
| RU 58668 | 2041 |
| Rubella Virus Vaccine (Live) | 669 |
| Ruboxistaurin | 1554, 1852 |
| Rubus alceifolius Poir | 1607 |
| Rufinamide | 669, 1852 |
| Rupatadine | 1852 |
| Ruscogenin | 2178, 2462 |
| Rutaecarpine (Rutecarpine) | 1327, 1334, 1347, 1492, 1739, 1852 |
| Ruthenium | 2101 |
| Ruthenium compounds | 2101, 2474 |
| Ruthenium red | 2383, 2474, 2479 |
| Rutin | 904, 1218, 1585 |
| RV 538 | 2474 |
| RWJ-53050 | 1852 |
| RXP470.1 | 1156 |
| Ryanodine | 2383 |
| S | |
| S 3304 | 1900, 2276 |
| S 16020 | 1852 |
| S 20098 | 2317 |
| S 28463 | 2186, 2204, 2221 |
| S-(-)-beta-Citronellol | 960 |
| S-(1,2-Dichlorovinyl)cysteine | 2474 |
| S-(2,4-Dinitrophenyl)glutathione | 943, 962 |
| S,S’-1,4-Phenylenebis(1,2-ethanediyl)bisisoselenourea | 2373 |
| S,S’-1,4-Phenylene-bis(1,2-ethanediyl)bisisothiourea | 2462, 2474 |
| (S)-6-[(4-Chlorophenyl)(1H-1,2,4-triazol-1-yl)methyl]-1-[11C]methyl-1H-benzotriazole | 1973, 1977 |
| (S)-N-[1-(3-Morpholin-4-ylphenyl)ethyl]-3-phenylacrylamide | 1862 |
| (S)-N-[1-(4-Fluoro-3-morpholin-4-ylphenyl)ethyl]-3-(4-fluorophenyl)acrylamide | 1862 |
| (S,S)-3-[3-(Methylsulfonyl)phenyl]-1-propylpiperidine hydrochloride [(-)-OSU6162] | 1864 |
| S. cerevisiae var. Boulardii (See Saccharomyces boulardii) | 671 |
| S1 combination | 1106, 1354, 1356, 1995, 2223, 2481 |
| S-3304 | 1852 |
| Saccharated ferric oxide | 2474 |
| Saccharin | 2479 |
| Saccharomyces boulardii (S. cerevisiae var. boulardii) | 671 |
| Sacrosidase | 671 |
| S-Adenosyl L-methionine (AdoMet) | 1608, 1613, 1853, 2291, 2447 |
| S-Adenosylhomocysteine | 1262, 2405 |
| Safflower oil | 2345 |
| Safrole | 1334, 1356, 1589, 1613, 1853, 1900 |
| Saiko-keishi-to | 1613 |
| Saikosaponin | 2210, 2447, 2462 |
| Salbutamol (See Albuterol) | 15, 1040, 1050, 1079, 2211, 2317 |
| Salicylaldehyde isonicotinoyl hydrazone | 1218, 1296, 1334 |
| Salicylamide | 1189 |
| Salicylates | 1183, 2196, 2462 |
| Salicylic Acid | 671, 1608, 2317, 2409, 2410, 2493 |
| Salinomycin | 909, 2302 |
| Saliva Substitute | 672 |
| S-Allylcysteine | 1613, 2447 |
| Salmeterol | 672, 1079, 1080, 1248, 1377, 1852, 2317 |
| Salmonella vaccines | 2198, 2462 |
| Salsalate | 673 |
| Salts | 1248, 2479 |
| Salvia disermas constituents (Rosmarinic acid, Caffeic acid, Salvigenin, Luteolin,Luteolin 7-O-beta-Arabinoside, Luteolin 7-O-β-Glucoside, and Ocotillol II) | 1327 |
| Salvia lavandulaefolia | 1176 |
| Salvia miltiorrhiza (See Danshen) | 857, 1176, 1327, 1330, 1490, 1723 |
| Salvianolic acid | 1327, 1714, 2447, 2448, 2462 |
| Salvigenin | 1327, 1742 |
| Salvinorin A | 1403 |
| Sanglifehrin A | 2221 |
| Sanguinarine | 1097, 1296, 1327, 1347, 2117, 2462 |
| Sanguisorba officinalis | 1176 |
| Saponins | 2186, 2196, 2232, 2276, 2423, 2462 |
| Saponins from the root of Platycodon grandiflorum (Changkil saponins) | 1608 |
| Sapropterin | 674 |
| Saquinavir | 674, 909, 927, 958, 1005, 1853, 1900, 2210, 2301, 2414, 2462 |
| Sarafotoxins s6 | 2013, 2014 |
| Sardilipin | 675, 1156 |
| Sargramostim | 675 |
| Sarin | 1040, 1041, 1195, 1196, 1242, 2338 |
| Sarizotan | 1328, 1554, 1854 |
| Satraplatin | 1193 |
| Satratoxin G | 2196, 2210, 2462 |
| Satsuma mandarin (See Citrus unshiu) | 1490 |
| Saw palmetto (Serenoa repens) | 1854 |
| Saxagliptin | 676, 859, 1993 |
| SB202190 | 1930 |
| SB203580 | 943, 1097, 1116, 1222, 1231, 1234, 1248, 1262, 1265, 1270, 1296, 1930, 2013, 2019, 2026, 2074, 2178, 2186, 2196, 2210, 2213, 2218, 2221, 2266, 2317, 2342, 2346, 2373, 2376, 2447, 2462, 2465, 2467, 2474, 2513, 2520 |
| SB209670 | 2014 |
| SB216763 | 1222, 2101, 2474, 2520 |
| SB22489G | 2161 |
| SB225002 | 2213 |
| S-Bioallethrin | 1838 |
| SBT1102 | 1875 |
| SBT1214 | 927, 1875 |
| SBT1216 | 1875 |
| SC435 | 1930 |
| SC560 | 1177, 1183, 1222, 1979, 2367, 2373, 2411 |
| SC52151 | 1854 |
| SC58560 | 2367 |
| Scarlet red | 1296 |
| SCH66712 | 1380, 1854 |
| SCH351125 | 1854 |
| SCH530348 (Vorapaxar) | 1328 |
| SCH727965 | 1237 |
| Schisandra fruit | 1492, 1854 |
| Schisandra sphenanthera extract (Wuzhi) | 910 |
| Schisandrol A | 910, 1746 |
| Schisandrol B | 910 |
| Schizandrin | 1854 |
| Schizandrin B | 1222 |
| Scoparone | 1598 |
| Scopolamine | 676, 1254, 1256 |
| Scopolamine derivatives | 1250, 1251, 1252 |
| Scopoletin | 1598, 2490, 2493 |
| Scorpion venoms | 1248 |
| Scriptaid | 1241 |
| Scutellaria baicalensis (Huangqin, Baikal Skullcap) | 1555 |
| Scutellaria baicalensis Georgi extract (See Wogonin) | 996, 1222, 1231, 1400, 2373 |
| Scutellariae radix | 1490, 1653 |
| Scutellariae radix flavonoids | 1854 |
| Scutellarin | 910, 2301, 2489, 2493, 2520 |
| SCY-635 | 910 |
| S-Decylglutathione | 2117 |
| S-Dimethylarsino-glutathione (Darinaparsin) | 941 |
| SDZ HDL 376 | 2385 |
| SDZ IMM 125 | 1854 |
| Sea buckthorn (Hippophae rhamnoides L.) leaf tea | 1608 |
| Sealapex | 2373 |
| sec-Butylamine | 1395 |
| sec-Butylbenzene | 1189 |
| Secobarbital | 677, 1334, 2241 |
| Secoisolariciresinol | 2313 |
| Secondary alkyl amines | 1366, 1854 |
| Seco-pancratistatin analogs | 1855 |
| Secosteroids | 2516 |
| Secretin | 678 |
| Secretoneurin | 2201 |
| Selagin | 855 |
| Selective estrogen receptor modulators | 2041 |
| Selective serotonin reuptake inhibitors | 1065, 1396, 1497, 1502, 1510, 1556, 2010, 2160, 2259 |
| Selegiline | 678, 1334, 1354, 1366, 1420, 1531, 1555, 1855, 2326, 2420 |
| Selenium | 679, 933, 1217, 1231, 1234, 1236, 1257, 1900, 1904, 1906, 2074, 2101, 2117, 2180, 2186, 2201, 2204, 2218, 2246, 2302, 2365, 2391, 2423, 2425, 2430, 2442, 2447, 2449, 2462, 2468, 2511 |
| Selenium compounds | 1296, 2117 |
| Selenium oxide | 2074 |
| Selenium-Cisplatin conjugate | 1217 |
| Selenocysteine | 1296, 2074, 2117 |
| Selenocystine | 1608 |
| Selenomethionine | 1183, 2074 |
| Selenomethylselenocysteine | 943, 1222, 1234, 1242 |
| Seliciclib (R-Roscovitine) | 910, 1237, 1855, 1972 |
| Semagacestat | 1174, 1855 |
| Senna | 680 |
| Seocalcitol | 1222, 1234, 1236, 1238, 2376 |
| Sepiapterin | 2082 |
| Septin | 1531 |
| Serenoa repens (See Saw palmetto) | 1854 |
| Sermorelin | 680 |
| Serotonin | 1177, 1183, 1222, 1248, 2074, 2159, 2161, 2164, 2168, 2169, 2186, 2196, 2204, 2210, 2221, 2227, 2259, 2399, 2412, 2435, 2462, 2475, 2479 |
| Serotonin (5HT)-3 receptor antagonists | 1855 |
| Serpentine | 1589, 1684 |
| Serpentine asbestos | 1262, 2019, 2068, 2078, 2196, 2204, 2210, 2218, 2221, 2266, 2276, 2278, 2330, 2425, 2442, 2447, 2449, 2462, 2474 |
| Sertaconazole | 680 |
| Sertindole | 1556, 1855 |
| Sertraline | 681, 1368, 1401, 1420, 1423, 1497, 1522, 1550, 1551, 1556, 1573, 1589, 1855, 1900, 2053, 2074, 2093, 2161, 2259, 2261, 2399, 2430, 2462, 2476 |
| Serum | 1291 |
| Serum proteins | 1559 |
| Sesame lignans (Sesamin) | 858, 1328, 1396, 1559, 1910 |
| Sesamex | 1296, 1334 |
| Sesamin (See Sesame lignans) | 858, 1328, 1396, 1559, 1910 |
| Sesamol | 1217 |
| Sesquiterpene coumarins (Ferula species) | 910 |
| Sesquiterpenes | 910, 927 |
| Sestamibi | 941 |
| S-Ethyl glutathione | 1613, 2474 |
| Setileuton | 1328 |
| Sevelamer | 682 |
| Seville orange juice | 1856 |
| Sevoflurane | 682, 959, 1608, 1930, 2178, 2196, 2313, 2447, 2462 |
| Shengmaisan | 1900 |
| Shenmai | 1328, 1858 |
| S-Hexylglutathione-sepharose | 2106, 2121 |
| Shi-bi-lin herbal formula | 2204, 2210, 2462 |
| Shiga toxin | 822, 2196, 2210, 2462 |
| Shikimic acid | 2189, 2520 |
| Shikonin | 1223 |
| Shogaol | 2345, 2373, 2462 |
| Shoseiryuto | 1493 |
| Shoseiryu-to | 2155 |
| SIB 1893 | 1334, 1347 |
| Siberian ginseng (Eleutheroccus senticosus) | 1858 |
| Sibutramine | 683, 1067, 1366, 1420, 1556, 1559, 1858, 2091, 2399 |
| Sildenafil | 683, 911, 941, 1034, 1248, 1396, 1858, 1975, 2093, 2204, 2300, 2312, 2328, 2462, 2511 |
| Silibinin (See Silybin) | 930, 1097, 1262, 1334, 1396, 1401, 1493, 1559, 1585, 1608, 1613, 1859, 1900, 2041, 2046, 2272, 2276, 2373, 2447, 2489, 2490, 2520 |
| Silicates | 2074 |
| Silicon dioxide | 2196, 2221, 2423, 2462 |
| Silodosin | 684 |
| Silodosin (KMD-3213) | 1859 |
| Silver | 1193, 1217, 2078, 2186, 2462 |
| Silver Nitrate | 685 |
| Silver Sulfadiazine | 685, 2078 |
| Silvestrol | 911 |
| Silybin (See Silibinin) | 930, 1097, 1262, 1334, 1396, 1401, 1493, 1559, 1585, 1608, 1613, 1859, 1900, 2041, 2046, 2272, 2276, 2373, 2447, 2489, 2490, 2520 |
| Silybin A | 959 |
| Silybin B | 959 |
| Silybinin (See Silybin) | 930, 1097, 1262, 1334, 1396, 1401, 1493, 1559, 1585, 1608, 1613, 1859, 1900, 2041, 2046, 2272, 2276, 2373, 2447, 2520 |
| Silychristin | 959 |
| Silydianin | 959 |
| Silymarin | 943, 971, 1024, 1097, 1613, 1859, 2041, 2046, 2178, 2272, 2447, 2462, 2490 |
| Silymarin flavonolignans (Silychristin, Silydianin, Silybin A, Silybin B, Isosilybin A, Isosilybin B) | 959 |
| Simazine | 1189, 1296, 1334, 1979, 2041, 2180, 2186, 2462 |
| Simendan | 2296 |
| Simethicone | 686 |
| Simvastatin | 686, 822, 911, 927, 930, 959, 962, 965, 1020, 1118, 1156, 1244, 1270, 1368, 1377, 1559, 1859, 1900, 1973, 2013, 2049, 2061, 2147, 2210, 2245, 2250, 2301, 2313, 2314, 2337, 2338, 2415, 2416, 2449, 2453, 2462, 2474, 2513 |
| Sinapinic acid | 2196, 2301, 2373, 2462 |
| Sincalide | 687, 962, 2416, 2418 |
| Sinecatechins | 687 |
| Sinensetin | 1492, 1814 |
| Singlet oxygen | 1217, 1861 |
| Sinomenine | 1493, 1561, 1861 |
| Sipholenol A | 886, 1014 |
| Sipholenol L | 886, 1014 |
| Sipholenone E | 886, 1014 |
| Siphonellinol D | 886, 1014 |
| Sirolimus | 688, 878, 911, 927, 941, 959, 962, 1020, 1228, 1861, 1900, 1975, 2062, 2101, 2121, 2178, 2189, 2204, 2221, 2276, 2317, 2376, 2383, 2430, 2442, 2447, 2462, 2474, 2513, 2520 |
| Sirtinol | 1027 |
| Sitafloxacin | 2490, 2493 |
| Sitagliptin | 689, 859, 1376, 1861, 1993 |
| Sitaxentan | 689, 864, 1585, 2015 |
| Sitosterol | 911, 927, 930, 943, 995, 1024, 2041, 2046 |
| Sizofiran | 2210 |
| Skatole | 1328, 1356 |
| Smallpox Vaccine | 690, 2224 |
| S-Mephenytoin | 1861 |
| S-Mephobarbital | 1862 |
| S-Methylisothiopseudouronium | 1092, 2373, 2462 |
| S-Methylthiocitrulline | 2013 |
| Smoke | 1097, 1296, 1613, 2051, 2210, 2301, 2365, 2367, 2373, 2463 |
| SN-38 | 941 |
| SN50 peptide | 1262, 2106, 2442, 2447, 2463 |
| SNI2011 | 1862 |
| S-Nitro-N-acetylpenicillamine | 1231, 1979, 2210, 2373, 2430 |
| S-Nitrosoglutathione | 1248, 2186, 2218, 2221, 2463 |
| S-Nitroso-N-acetylpenicillamine | 2013, 2186, 2423, 2474 |
| S-Nitrosopenicillamine | 965 |
| SNS-032 (BMS-387032) | 1237 |
| Sodium | 1943, 2013, 2086, 2301, 2373, 2377, 2386, 2387, 2390, 2391, 2392, 2394, 2413, 2479, 2516 |
| Sodium Acetate | 690 |
| Sodium arsenate | 962, 971, 1119, 1189, 1223, 1241, 1347, 1992, 2029, 2051, 2074, 2113, 2117, 2189, 2253, 2270, 2296, 2309, 2317, 2423, 2432, 2463, 2474 |
| Sodium arsenite | 812, 912, 927, 944, 1026, 1097, 1183, 1191, 1208, 1209, 1217, 1232, 1236, 1241, 1262, 1265, 1296, 1347, 1900, 1979, 2019, 2029, 2032, 2041, 2046, 2074, 2104, 2106, 2113, 2117, 2121, 2157, 2168, 2178, 2186, 2189, 2190, 2196, 2201, 2204, 2210, 2221, 2227, 2238, 2241, 2253, 2261, 2270, 2272, 2274, 2276, 2279, 2301, 2309, 2313, 2317, 2331, 2333, 2335, 2352, 2362, 2364, 2373, 2376, 2379, 2380, 2430, 2442, 2447, 2451, 2453, 2463, 2465, 2467, 2474, 2520, 2528 |
| Sodium azide | 927, 944, 1178, 1183, 1862, 2074, 2186, 2278, 2301, 2359, 2420, 2474 |
| Sodium benzoate | 2474 |
| Sodium Bicarbonate | 690 |
| Sodium bichromate | 1347, 2210, 2218 |
| Sodium bisulfite | 1248 |
| Sodium bromide | 2393 |
| Sodium butyrate | 1640 |
| Sodium chlorate | 2393 |
| Sodium Chloride | 691, 930, 965, 1092, 1943, 2066, 2463, 2074, 2400, 2435, 2479 |
| Sodium cholate | 1242, 1901 |
| Sodium dodecyl sulfate | 2178, 2186, 2196, 2204, 2221, 2463 |
| Sodium fluoride | 2190 |
| Sodium hydrosulfide | 1608 |
| Sodium Hypochlorite | 692 |
| Sodium iodide | 2393 |
| Sodium Iodide 131I | 692, 1248, 2392 |
| Sodium Lactate | 692 |
| Sodium nitrite | 1041, 2463 |
| Sodium nitroprusside | 912 |
| Sodium Oxybate | 693 |
| Sodium Phenylbutyrate | 693, 1247 |
| Sodium perchlorate | 2393 |
| Sodium pertechnetate 99mTc | 2393 |
| Sodium Phosphates | 694 |
| Sodium Polystyrene Sulfonate | 694 |
| Sodium salicylate | 1862, 2178, 2186, 2196, 2218, 2278, 2385, 2463 |
| Sodium selenate | 2242 |
| Sodium selenite | 930, 1209, 1217, 1236, 1270, 2074, 2107, 2178, 2186, 2296, 2320, 2338, 2357, 2423, 2442, 2447, 2463, 2483 |
| Sodium Tetradecyl Sulfate | 695 |
| Sodium thiocyanate | 2393 |
| Sodium Thiosulfate | 695 |
| Sodium tungstate (VI) | 2525 |
| Sodium valproate | 912, 1977 |
| Solifenacin | 695, 1251, 1862 |
| Soman | 1040, 1242, 2338 |
| Somatostatin | 696, 2317 |
| Somatostatin analogs | 1561, 1863 |
| Somatropin | 696, 1261, 2088, 2188 |
| Soot | 1241 |
| Sophora flaveacens | 1291, 1608 |
| Sophora flavescens Ait (See Matrine) | 1328, 1608 |
| Sorafenib | 697, 912, 959, 1020, 1204, 1420, 1863, 1973, 2064, 2236, 2237, 2331 |
| Sorbitol | 698, 2261 |
| Sorcin | 912 |
| Sotalol | 698, 1073, 2091, 2229, 2236 |
| Sotrastaurin | 1863 |
| Soy extract | 1863 |
| Soy isoflavones | 1291, 1345 |
| Soy protein | 823, 1608 |
| Soybean [Glycine max (L.) Merrill] | 1930 |
| Soybean Oil | 699, 930, 944, 962, 979, 1932, 2117, 2147, 2221, 2373, 2406, 2410 |
| SP1049C-Doxorubicin-pluronics | 913 |
| SP5186 | 2178, 2513 |
| Spartakus (See Prochloraz) | 1291 |
| Sparteine | 1561 |
| SPD-304 | 1863 |
| Spectinomycin | 700 |
| Spermidine | 1189, 2106, 2111, 2309 |
| Spermine | 2309 |
| Spermine nitric oxide complex | 2474 |
| S-phenyl-N-acetylcysteine | 2121 |
| Spice constituents | 1863 |
| Spices (Cinnamon, Black or White pepper, Ginger, Mace, Nutmeg, (1S,2R)-1-Acetoxy-2-(4-allyl-2,6-dimethoxyphenoxy)-1-(3,4-dimethoxyphenyl)propane) | 1396 |
| Spinosad | 880, 913 |
| Spiperone | 2002 |
| Spiramycin | 700, 1863 |
| Spironolactone | 700, 913, 930, 962, 965, 1034, 1186, 1189, 1377, 1901, 1932, 1942, 1943, 2313, 2338, 2418, 2447, 2490 |
| Splenda (See Sucralose) | 1863 |
| SPP301 | 1864 |
| SQ29548 | 2440 |
| Squalene | 2338 |
| Squalestatin 1 | 1932, 2150 |
| SR12813 | 1901 |
| SR13668 | 1329, 1685 |
| SR140333B | 2479 |
| SR144528 | 1259, 2196, 2218, 2221, 2463 |
| SR48968 | 2437 |
| SR58611A | 1082, 2247 |
| SR59230A | 1073, 1080, 1082, 2247, 2483 |
| Src inhibitors | 1975 |
| St. John’s Wort (Hypericum perforatum L.) | 701, 876, 914, 1178, 1420, 1491, 1494, 1762, 1868, 1900, 1910, 2312 |
| St. John’s wort components | 1762 |
| ST1435 | 1088 |
| Stanolone benzoate | 1189 |
| Stanozolol | 1967, 2317 |
| Staphylococcal enterotoxin B | 2201, 2204, 2186, 2463 |
| Star fruit juice (Averrhoa carambola) | 1864 |
| STAT3 inhibitors | 1864 |
| Statins | 823, 913, 959, 970, 995, 1020, 1118, 1157, 1220, 1366, 1376, 1396, 1561, 1609, 1864, 2093, 2147, 2456, 2511 |
| Staurosporine | 913, 1097, 1229, 1296, 1347, 1901, 2019, 2074, 2196, 2212, 2357, 2359, 2420, 2474, 2520 |
| Staurosporine aglycone (SA) | 2302 |
| Stavudine | 702, 1241, 2335, 2483 |
| Stearic acid | 996, 1060, 1217, 1334, 1401, 1423, 1589, 1613, 1901, 2210, 2345, 2423 |
| Stearic acid-g-chitosan polymeric micelle | 913 |
| Stemona alkaloids (Stemocurtisine, Oxystemokerrine, Stemofoline) | 913 |
| Sterigmatocystin | 1292, 1329, 2121 |
| Steroid and xenobiotic receptor (SXR) agonists and antagonists | 1867 |
| Steroid carbamates (11-Carbamic acid N,N-dibenzyl progesterone ester and 11-Carbamic acid N,N-dibutyl progesterone ester) | 914 |
| Steroid hormones | 941 |
| Steroid sulfatase inhibitors | 1975 |
| Steroidal compounds | 1975 |
| Steroidal liver X receptor agonists (T0901317, ATI-111) | 995 |
| Steroids | 1867, 1901, 2435 |
| Sterol esters | 1154 |
| Sterols | 2212 |
| S-tetradecanoyl-Coenzyme A | 2106 |
| Stigmasterol | 995 |
| Stigmatellin | 2420 |
| Stilbene from Cajanus cajan L | 1931 |
| Stilbene oxide | 965 |
| Stilbenes | 914 |
| Stilbenoid compounds | 1177 |
| Stiripentol | 1334, 1423, 1562, 1585, 1867, 1901 |
| Strawberry fruit (Fragaria ananassa) | 1869 |
| Streptokinase | 703 |
| Streptomycin | 703, 962, 2283 |
| Streptonigrin | 2309 |
| Streptozocin | 704, 930, 1161, 1217, 1334, 1613, 1943, 2178, 2218, 2272, 2291, 2332, 2423, 2425, 2447, 2463 |
| S-Trityl-L-cysteine derivatives | 914 |
| Strontium 89 (89Sr) | 704, 1212 |
| Strychnos ligustrina wood | 1492 |
| Styrene | 1217, 1296, 1334, 1366, 1609, 1613, 1870, 1904, 2022, 2041, 2111, 2117, 2121, 2125, 2204, 2241, 2309, 2474, 2479, 2528 |
| SU1498 | 2237 |
| SU5402 | 2074, 2430, 2463 |
| SU5614 | 2064, 2520 |
| SU6668 | 2238, 2331 |
| SU11657 | 2064 |
| Suberic acid | 1189 |
| Succimer | 704, 2078 |
| Succinates | 2410 |
| Succinic acid | 2409 |
| Succinylcholine (Suxamethonium Chloride) | 705, 1196 |
| Sucralfate | 706, 2013, 2204 |
| Sucralose (Splenda) | 1863 |
| Sucrose | 1042, 1049, 2301, 2340 |
| Sucrose laurate | 1393 |
| Sudan | 1097, 1296, 2340, 1354, 1870 |
| Sufentanil | 706, 1870 |
| Suillus bovines | 1838 |
| Sulconazole | 707 |
| Sulfacetamide | 707 |
| Sulfadiazine | 708, 1377, 1396, 1401, 1870, 2295, 2296 |
| Sulfadimidine | 2312 |
| Sulfamethazine | 1901, 2296, 2313 |
| Sulfamethoxazole | 1870, 1885, 2110, 2116, 2120, 2145, 2157, 2186, 2295, 2296, 2423, 2456 |
| Sulfanitran | 962 |
| Sulfaphenazole | 1334, 1401, 1403 |
| Sulfasalazine | 708, 914, 959, 1021, 1262, 2196, 2276, 2295, 2296 |
| Sulfates | 1248 |
| Sulfathiazole | 1975 |
| Sulfinpyrazone | 944, 962, 1368, 1377, 1901, 2111, 2117, 2312, 2313, 2317 |
| Sulfiredoxin | 1606 |
| Sulfisoxazole | 709 |
| Sulfix-60 | 2210 |
| Sulfobromophthalein | 962, 2106, 2111, 2186, 2405, 2410, 2416, 2418 |
| Sulfonamides | 1232, 1248, 2295, 2296, 2317 |
| Sulfonylalkylamides | 1870 |
| Sulfonylurea drugs | 985, 2233 |
| Sulfonylurea receptor (ABCC8/9) ligands | 914 |
| Sulfonylureas (Glibenclamide, Glimepiride, Glipizide) | 1376, 1396 |
| Sulforafan | 962, 1219, 1334, 2022, 2106, 2111, 2117, 2201, 2272, 2309, 2373, 2376, 2490 |
| Sulforaphane | 1329, 1648, 1773, 1870 |
| Sulforidazine | 1483 |
| Sulfur compounds | 2111 |
| Sulfur dioxide | 1296, 1334 |
| Sulglicotide | 2463 |
| Sulindac | 709, 914, 943, 962, 965, 971, 979, 1024, 1069, 1097, 1098, 1114, 1115, 1116, 1178, 1183, 1189, 1194, 1208, 1223, 1223, 1232, 1234, 1236, 1238, 1241, 1296, 1334, 1347, 1996, 2019, 2028, 2041, 2053, 2068, 2074, 2101, 2117, 2121, 2178, 2196, 2224, 2225, 2227, 2241, 2246, 2270, 2304, 2309, 2328, 2340, 2342, 2345, 2357, 2367, 2373, 2376, 2379, 2406, 2407, 2409, 2410, 2420, 2423, 2430, 2451, 2463, 2474, 2490, 2493, 2495 |
| Sulpiride | 710, 1562, 1871 |
| Sulprostone | 2301, 2361 |
| Sumatriptan | 711, 1871, 2074, 2093, 2160, 2161, 2259 |
| Suncus murinus (house musk shrew) | 1871 |
| Sunitinib | 711, 914, 941, 959, 1871, 2238, 2314, 2329 |
| Sunset yellow FCF | 925, 1355 |
| Superoxides | 1183, 1217, 2111, 2196, 2247, 2301, 2447 |
| Suramin | 712, 2218, 2221, 2463, 2516 |
| Surface-active agents | 1183 |
| SX 3030 | 2490, 2493, 2495 |
| Syl611 (semisynthetic taxane derivative) | 915 |
| Sym-trinitrobenzene | 2186, 2204, 2218, 2221, 2373, 2447, 2463 |
| Synthetic opiate analgesics | 1871 |
| Synthetic steroidal liver X receptor agonists | 823 |
| Systhane | 965, 1103, 1189, 1243, 1296, 2022, 2041, 2106, 2121, 2309 |
| T | |
| T0070907 | 1060, 2186, 2345 |
| T0901317 | 995, 996, 1931 |
| t10,c12-CLA | 1931 |
| T113242 | 2225, 2246 |
| T-2 Toxin | 1292, 1799, 2463 |
| T-5224 | 2489, 2493 |
| Tabimorelin (NN703) | 1871 |
| Tabun | 1040, 1041, 1242 |
| Tacrine | 713, 1040, 1158, 1196, 1242, 1254, 1256, 1296, 1329, 1334, 1562, 2110, 2249, 2386, 2420 |
| Tacrolimus | 713, 878, 915, 927, 930, 960, 1021, 1421, 1871, 1901, 1937, 1975, 2019, 2062, 2186, 2201, 2204, 2317, 2373, 2383, 2447, 2463, 2494 |
| Tadalafil | 714, 1873, 1975, 2196, 2328, 2463 |
| TAK-715 | 1873 |
| Talc | 715, 2110, 2120, 2295 |
| Taleranol | 1189, 2041 |
| Talinolol | 1873 |
| Talipexole | 1067 |
| Tamoxifen | 715, 916, 927, 930, 944, 960, 965, 1021, 1024, 1026, 1043, 1049, 1088, 1100, 1116, 1161, 1178, 1183, 1189, 1190, 1191, 1194, 1204, 1207, 1209, 1217, 1223, 1232, 1234, 1238, 1245, 1248, 1254, 1256, 1262, 1264, 1267, 1292, 1334, 1345, 1347, 1367, 1377, 1397, 1421, 1444, 1534, 1563, 1580, 1589, 1873, 1901, 1906, 1975, 1993, 2008, 2010, 2013, 2019, 2022, 2026, 2038, 2041, 2044, 2046, 2051, 2053, 2065, 2066, 2069, 2074, 2078, 2088, 2098, 2106, 2111, 2117, 2121, 2150, 2151, 2157, 2164, 2168, 2189, 2190, 2196, 2204, 2210, 2222, 2227, 2232, 2241, 2242, 2253, 2261, 2266, 2269, 2276, 2278, 2288, 2298, 2309, 2312, 2313, 2314, 2317, 2346, 2353, 2360, 2362, 2363, 2373, 2376, 2381, 2382, 2383, 2403, 2404, 2432, 2420, 2423, 2425, 2427, 2430, 2442, 2447, 2448, 2451, 2463, 2471, 2474, 2483, 2490, 2494, 2495, 2520, 2528 |
| Tamoxifen metabolites (Endoxifen, N-Desmethyl-tamoxifen, Z-4-Hydroxy-tamoxifen) | 1976 |
| Tamoxifen-derived aromatase inhibitors | 1968 |
| Tamsulosin | 716, 1566, 1874 |
| t-Amyl methyl ether | 1648 |
| Tandospirone | 1566, 1874 |
| Tandutinib | 916 |
| Tanespimycin | 1330, 1367, 1421, 1875 |
| Tangeretin | 902, 1742, 1875 |
| Tanshinol borneol ester | 1330, 1376, 1566, 1875 |
| Tanshinones (Tanshinone I, Tanshinone IIA, Cryptotanshinone, and Dihydrotanshinone I) | 916, 1043, 1292, 1296, 1330, 1714, 1723, 1988, 2074, 2261, 2301, 2474 |
| Tanshinones from Salvia miltiorrhiza | 916, 1327 |
| Tanzanian plant extracts | 1875 |
| Tapentadol | 717, 1574 |
| Tariquidar | 917 |
| Tariquidar derivatives | 1021 |
| Tartary buckwheat sprout powder | 1931 |
| Tartrazine | 925, 1355 |
| Taurine | 858, 930, 962, 1062, 1088, 1203, 1609, 1875, 1931, 2196, 2359, 2430, 2447, 2463 |
| Taurochenodeoxycholic acid | 930, 962, 965, 1875, 2400, 2401 |
| Taurocholic acid | 927, 930, 960, 962, 965, 1248, 1932, 2338, 2400, 2401, 2405, 2453 |
| Taurodeoxycholic acid | 930 |
| Taurolithocholic acid | 930, 1248 |
| Tauromuricholic acid | 927, 930, 962, 965, 2401 |
| Tauromustine | 1875 |
| Tauroursodeoxycholic acid | 928, 930, 960, 962, 965, 1932, 2179, 2317, 2376, 2400, 2401, 2420 |
| Tautomycin | 2002 |
| Taxanes | 917, 928, 944, 1021, 1024, 1345, 1875 |
| Taxifolin | 944, 1098, 2042, 2046, 2178, 2186 |
| Taxoids | 1875, 2032 |
| Taxol (See Paclitaxel) | 559, 2312 |
| Tazarotene | 717, 2393 |
| Tazobactam | 2196, 2463 |
| TBBPA | 1977 |
| TBC 3214 | 1088, 2013, 2015, 2447 |
| t-Butyl acetylene | 1613 |
| TDP 521252 | 2474 |
| TDP 665759 | 2474 |
| Tea | 2106, 2111 |
| Tea polyphenols | 1329 |
| Tea tree oil (Terpinen-4-ol) | 917 |
| Tebuconazole | 928, 962, 1296, 1383, 1979 |
| Tecarfarin | 1397 |
| Technetium (99mTc) 1,2-bis(bis(2-ethoxyethyl)phosphino)ethane | 944 |
| Technetium (99mTc) mebrofenin | 2210, 2463 |
| Technetium (99mTc) sestamibi | 928, 944 |
| Technetium (99mTc) tricarbonyl 4-((2-methoxyphenyl)piperazin-1-yl)dithioformate | 2159 |
| Tectochrysin | 928, 944, 1024 |
| Tegafur | 1229, 1350, 1354, 1356, 1566, 1995, 2474, 2481 |
| Tegafur-Uracil | 1995 |
| Tegaserod | 718, 1334, 1556, 1585, 1589 |
| Tegillarca granosa extract (See Haishengsu) | 874 |
| TEI 9647 | 2516 |
| Telatinib | 917, 1021 |
| Telbivudine | 718 |
| Telithromycin | 719, 885, 1875 |
| Tellimagrandin I | 1041, 2227 |
| Telmisartan | 720, 839, 960, 996, 1001, 1034, 1088, 1158, 2447, 2489, 2493 |
| Temazepam | 720, 1876 |
| Temefos | 1041 |
| Temocapril hydrochloride | 1242 |
| Temocaprilat | 962, 1242 |
| Temozolomide | 721, 917, 1088, 1876, 2272, 2274, 2279, 2373, 2423, 2442, 2463, 2474, 2520 |
| Tempol | 1217, 2247, 2338, 2463, 2474 |
| Temsirolimus | 721, 1223, 1566, 1876, 2042, 2376 |
| Tenecteplase | 722 |
| Teniposide | 723, 1356, 1368, 1377, 1401, 1901 |
| Tenofovir | 723, 942, 960, 970, 1877, 2408 |
| Tenoxicam | 724, 1376, 1397, 2411 |
| Tephrosin | 2463 |
| Terameprocol | 928, 1232 |
| Terazosin | 725 |
| Terbinafine | 725, 1522, 1535, 1566, 1580, 1877, 1901, 2186, 2201, 2204, 2312 |
| Terbutaline | 726, 1079, 1080 |
| Terbutryne | 1296 |
| Terbutylazine | 1041, 1296 |
| Terconazole | 726 |
| Terephthalic acid | 1223, 1236, 1241, 1905, 1906, 2363, 2376 |
| Terfenadine | 1567, 1877, 1901, 2155 |
| Terguride | 1725 |
| Teriparatide | 726 |
| Teriparatide | 726 |
| Terodiline | 1567 |
| Terpenic compounds from Euphorbia lagascae and E. tuckeyana methanolic extracts | 918 |
| Terpenoids | 960, 1877 |
| Terpinolene | 960 |
| Territrem | 1877 |
| Tertatolol | 2161 |
| tert-Butyl alcohol | 1111, 2201, 2086 |
| tert-Butyl-2-(6-((2-(acetylamino)-1,3-benzothiazol-4-yl)oxy)pyrimidin-4-yl)-5-(trifluoromethyl)phenylcarbamate | 2479 |
| tert-Butylcatechol | 2463 |
| tert-Butylhydroperoxide | 824, 930, 944, 1041, 1044, 1050, 1100, 1103, 1106, 1111, 1161, 1183, 1204, 1211, 1217, 1220, 1232, 1234, 1241, 1264, 1265, 1347, 1613, 1993, 2013, 2019, 2026, 2028, 2066, 2074, 2078, 2091, 2101, 2107, 2117, 2121, 2135, 2137, 2139, 2147, 2178, 2196, 2210, 2225, 2246, 2253, 2270, 2274, 2304, 2309, 2320, 2342, 2345, 2346, 2352, 2363, 2367, 2373, 2376, 2380, 2382, 2423, 2438, 2442, 2447, 2450, 2451, 2463, 2465, 2474, 2513, 2520 |
| Tertiary-amyl methyl ether | 1356 |
| Tesamorelin | 727 |
| Tesmilifene | 918, 1877 |
| Testolactone | 728, 1979 |
| Testosterone | 728, 1027, 1060, 1067, 1116, 1186, 1262, 1265, 1296, 1368, 1709, 1878, 1901, 1943, 1976, 1979, 2013, 2015, 2019, 2042, 2046, 2066, 2067, 2068, 2075, 2086, 2147, 2152, 2156, 2189, 2196, 2270, 2313, 2317, 2320, 2328, 2375, 2410, 2447, 2463, 2493, 2520 |
| Testosterone 17beta-cypionate | 2074, 2159 |
| Testosterone enanthate | 1183, 1189, 1218, 1232, 1243, 1245, 1262, 2015, 2057, 2062, 2067, 2101, 2111, 2141, 2211, 2266, 2298, 2414, 2420, 2451, 2523 |
| Testosterone propionate | 1189 |
| Testosterone undecanoate | 2073, 2159 |
| Tetanus Immune Globulin | 729 |
| Tetanus Toxoid | 729, 2186, 2218 |
| Tetrabenazine | 729, 1567 |
| Tetrabrominated diphenyl ether 47 | 1098, 1189, 1296, 1979, 2210, 2221, 2432, 2463 |
| Tetrabromobisphenol A | 1098, 1296, 1334, 1979, 2042, 2061, 2118, 2269, 2383, 2432 |
| Tetrabromobisphenol A-bisallylether | 1296, 2042 |
| Tetrabromophthalic anhydride | 1098 |
| Tetracaine | 730, 2383, 2479 |
| Tetrachlorodian | 1189, 2042 |
| Tetrachlorodibenzodioxin | 928, 962, 965, 979, 1024, 1042, 1093, 1098, 1108, 1111, 1116, 1119, 1161, 1189, 1208, 1223, 1232, 1236, 1296, 1334, 1347, 1401, 1404, 1423, 1613, 1901, 1906, 1932, 1979, 2019, 2022, 2042, 2066, 2074, 2078, 2086, 2106, 2125, 2186, 2189, 2196, 2201, 2204, 2210, 2224, 2250, 2253, 2276, 2278, 2282, 2306, 2309, 2323, 2332, 2338, 2376, 2393, 2400, 2406, 2410, 2423, 2425, 2430, 2432, 2447, 2450, 2465, 2474, 2481, 2490, 2493, 2494, 2516, 2525, 2528 |
| Tetrachloroethylene | 1217, 2074, 2186, 2278, 2340, 2463 |
| Tetrachloroisophthalonitrile | 2026 |
| Tetrachlorvinphos | 1979, 2042 |
| Tetracycline | 730, 824, 918, 928, 930, 965, 1042, 1043, 1083, 1120, 1189, 1211, 1217, 1609, 1932, 2053, 2061, 2066, 2118, 2156, 2196, 2250, 2253, 2261, 2276, 2278, 2333, 2352, 2409, 2410, 2411, 2431, 2465 |
| Tetracycline CMT-3 | 2276, 2447, 2463 |
| Tetradecanoylphorbol acetate (TPA) | 944, 1021, 1208, 1217, 1223, 1232, 1234, 1236, 1241, 1613, 1932, 1943, 1979, 1995, 2042, 2046, 2074, 2118, 2121, 2186, 2189, 2196, 2198, 2201, 2204, 2211, 2212, 2213, 2218, 2221, 2227, 2241, 2272, 2278, 2309, 2340, 2342, 2345, 2367, 2373, 2376, 2381, 2411, 2447, 2463, 2465, 2467, 2474, 2479, 2513, 2520 |
| Tetradecylselenoacetic acid | 2201, 2342, 2423, 2463 |
| Tetradifon | 1979, 2042 |
| Tetrahydrobenzo[4′,5′]thieno[3′,2′:5,6] pyrido[4,3-d]pyrimidin-4(3H)-ones |
918 |
| Tetrahydrobiopterin (BH4) | 2082 |
| Tetrahydrocannabinol | 1217, 1259, 1296, 1567, 1878, 2074, 2157, 2186, 2201, 2204, 2373, 2528 |
| Tetrahydrodaidzein | 2042, 2046 |
| Tetrahydroisoquinoline-ethyl-phenylamine | 918 |
| Tetrahydronaphthalenes | 1943, 1979 |
| Tetrahydropalmatine | 1330, 1568, 1878 |
| Tetrahydrothiophene | 2106 |
| Tetrahydroxy-5-cholan-24-oic acid | 930 |
| Tetrahydrozoline | 731 |
| Tetraiodothyroacetic acid | 2227, 2373 |
| Tetraisopropylpyrophosphamide | 1041 |
| Tetrakis(4-Benzoic acid)porphyrin | 2301 |
| Tetrakis(N-Methyl-4-pyridiniumyl)porphine manganese(III) complex | 2474 |
| Tetralin | 1098, 1189, 2042, 2046 |
| Tetramethoxystilbene | 1330, 1345, 1976 |
| Tetramethrin | 1189, 1901, 2313, 2190 |
| Tetramethylcyclopropane | 1609 |
| Tetramethylpyrazine (Ligusticum chuanxiong Hort) | 918, 1120, 1248, 1490, 2074 |
| Tetramethylrosamine | 928 |
| Tetramethylthiourea | 1262, 2178, 2447, 2463 |
| Tetrandrine | 859, 918, 1878, 1901, 2178, 2447, 2463 |
| Tetrathiomolybdate | 2196, 2201, 2463 |
| Tetrazepam | 1306 |
| Tetrodotoxin | 2324, 2386, 2387, 2390, 2391 |
| Tezosentan | 2015 |
| TG100435 | 1878 |
| Thai plant extracts | 918 |
| Thalidomide | 731, 918, 928, 1013, 1217, 1257, 1421, 1460, 1879, 1904, 2033, 2178, 2186, 2189, 2196, 2198, 2201, 2210, 2212, 2213, 2218, 2221, 2237, 2295, 2341, 2367, 2373, 2401, 2425, 2435, 2447, 2449, 2456, 2463, 2465, 2467, 2513, 2520 |
| Thalifendine | 1450 |
| Thallium | 1223, 1234, 1236, 1609 |
| Thapsigargin | 918, 928, 1067, 1098, 1111, 1208, 1209, 1248, 2086, 2196, 2431, 2463, 2474 |
| Theaflavin | 2474 |
| Theanine | 1471 |
| Thenoyltrifluoroacetone | 2178, 2423 |
| Theophylline | 732, 1062, 1211, 1296, 1314, 1330, 1334, 1568, 1613, 1879, 2053, 2061, 2196, 2221, 2250, 2463 |
| Thiabendazole | 733, 840, 1098, 1296, 1330, 1334, 1368, 1901, 2118, 2121 |
| Thiacetazone | 2067 |
| Thiamazole (See Methimazole) | 471, 1183, 1190, 1267, 1579, 1814, 2054, 2066, 2067, 2068, 2125, 2276, 2306, 2333, 2335, 2338, 2345, 2451 |
| Thiamethoxam | 1803 |
| Thiamine (Vitamin B1) | 733, 1270, 2210 |
| Thiamylal | 1879, 2241 |
| Thiazoles | 1613, 2022, 2111 |
| Thiazolidinediones (Glitazones) | 1021, 1060, 1568, 1879, 2344, 2483 |
| Thiazolyl blue | 928 |
| Thienopyridine antiplatelet agents (Prasugrel and Clopidogrel) | 1367 |
| Thienopyridines | 1879 |
| Thimerosal | 2074, 2111, 2118, 2121, 2157 |
| Thioacetamide | 812, 928, 979, 985, 1027, 1044, 1060, 1062, 1211, 1217, 1218, 1223, 1236, 1262, 1296, 1355, 1610, 1613, 2066, 2068, 2086, 2088, 2104, 2106, 2111, 2113, 2118, 2178, 2190, 2196, 2210, 2218, 2247, 2249, 2276, 2278, 2301, 2309, 2314, 2331, 2373, 2376, 2382, 2423, 2436, 2447, 2449, 2463, 2474, 2513, 2520, 2525 |
| Thiocitrulline | 2373 |
| Thiocoraline | 1296, 1377, 1401, 1879, 1901 |
| Thioctic acid | 2111, 2309 |
| Thiocyanate | 1248, 2393 |
| Thiodicarb | 918, 928, 1217 |
| Thioflavin T | 1178, 1183, 2302, 2352 |
| Thioglycolates | 2178, 2196, 2463 |
| Thioguanine | 734, 970, 971, 1049, 2477 |
| Thiohydantoins | 1296 |
| Thiolated PEG-g-PEI copolymer | 1879 |
| Thiomers (thiolated polymers) | 1354, 1879 |
| Thiopental | 734, 1252, 2196, 2463 |
| Thioperamide | 2155 |
| Thiophene amide derivatives | 919 |
| Thiophenes | 2118, 2376 |
| Thiopronin | 1610 |
| Thioredoxin | 1610 |
| Thioridazine | 735, 1064, 1356, 1401, 1423, 1483, 1497, 1502, 1551, 1568, 1613, 1879, 1901, 2053 |
| Thiorphan | 1178, 1183 |
| Thiotepa | 735, 1368, 1575, 1685, 1885, 2026, 2106, 2111, 2116, 2118, 2272 |
| Thiothixene | 736, 1535 |
| Thiourea | 1248, 2067, 2074, 2078, 2186, 2392 |
| Thiram | 1217, 1296, 1613, 2186, 2204, 2237, 2276, 2317, 2423, 2520 |
| Thonningianin A | 2118 |
| Thrombin | 737 |
| Thromboxane A2 | 2013, 2440 |
| Thujone | 1355, 1367 |
| Thymeleatoxin | 930 |
| Thymolphthalein | 1099 |
| Thyroid | 737 |
| Thyroid hormone | 961, 1189, 1931, 2432, 2490 |
| Thyrotropin Alpha | 737 |
| Thyroxine | 1179, 1183, 1252, 1267, 1377, 1992, 2074, 2078, 2159, 2227, 2276, 2314, 2318, 2333, 2345, 2373, 2393, 2435, 2474, 2493, 2516 |
| Tiagabine | 738 |
| Tiamulin | 1880 |
| Tian Xian | 1880 |
| Tiapride | 1040, 1041, 1196 |
| Tiaprofenic Acid | 738 |
| Tibolone | 1223, 1270, 1880, 1979, 2042, 2178, 2474, 2513, 2520 |
| Ticagrelor | 739, 919, 1330, 1397, 1421, 1570, 1880 |
| Ticarcillin and Clavulanate Potassium | 740 |
| Ticlopidine | 740, 1313, 1334, 1367, 1368, 1421, 1423, 1570, 1589, 2131, 2134, 2137, 2145, 2312, 2418 |
| Ticrynafen | 1401 |
| Tigecycline | 741 |
| Tilidine | 1422, 1880 |
| Tiliroside | 1331, 1397, 1880 |
| Tiludronate | 742 |
| Timolol | 742, 1073, 1570, 2091 |
| Tin mesoporphyrin | 2463 |
| Tin protoporphyrin IX | 2196 |
| Tinidazole | 743, 1901 |
| Tinospora crispa stem | 1492 |
| Tinzaparin | 744 |
| Tioconazole | 744 |
| Tiopronin | 745 |
| Tiospirone | 1570 |
| Tiotidine | 2155 |
| Tiotropium | 745, 1570, 1880 |
| Tipifarnib | 919, 928, 1115, 1880, 1901, 2190, 2447, 2490 |
| Tipranavir | 745, 919, 1331, 1881 |
| Tipranavir/Ritonavir | 919, 1331 |
| Tirapazamine | 1217, 1368 |
| Tirilazad | 1881 |
| Tirofiban | 746 |
| Titanium | 1262, 2463 |
| Titanium alloy (TiAl6V4) | 2196, 2463 |
| Titanium dioxide | 2210 |
| Titanium nitride | 2196, 2463 |
| Tizanidine | 747, 1321, 1331, 1334 |
| TMEM106B | 1158 |
| TO901317 | 824, 996, 1103, 1159, 1161, 1244, 2088, 2246, 2253, 2323, 2385 |
| Tobacco smoke pollution | 1080, 1190, 1241, 1296, 1993, 2074, 2204, 2210, 2218, 2241, 2278, 2333, 2373, 2423, 2447, 2451, 2468, 2474, 2490 |
| Tobacco tar | 1334, 2190, 2221 |
| Tobramycin | 747, 2284 |
| Tocainide | 748 |
| Tocilizumab | 749 |
| Tocofersolan | 749 |
| Tocopherol (Vitamin E) | 750, 944, 1119, 1161, 1179, 1183, 1217, 1232, 1234, 1236, 1257, 1262, 1270, 1272, 1892, 1901, 1904, 1910, 1943, 1979, 1986, 2074, 2107, 2113, 2178, 2186, 2196, 2204, 2218, 2272, 2276, 2313, 2338, 2347, 2376, 2380, 2382, 2420, 2423, 2447, 2450, 2463, 2468, 2474, 2511 |
| Tocotrienols | 1881 |
| Tofisopam | 1881 |
| Tolazamide | 750, 2234 |
| Tolazoline | 751 |
| Tolbutamide | 751, 985, 1377, 1397, 1401, 1422, 1570 |
| Tolcapone | 751 |
| Tolclofos-methyl | 1189, 2042, 2046 |
| Tolfenamic acid | 1334 |
| Tolmetin | 752 |
| Tolnaftate | 753, 2186, 2201, 2204 |
| Tolterodine | 753, 1251, 1252, 1475, 1479, 1525, 1571, 1881 |
| Toluene | 1217, 1571, 1610, 1881, 1906, 2074, 2309, 2314, 2401, 2411, 2412, 2413 |
| Toluene 2,4-diisocyanate | 1296, 1613, 2019, 2053, 2111, 2125, 2155, 2178, 2180, 2186, 2196, 2201, 2204, 2210, 2218, 2221, 2256, 2276, 2296, 2301, 2345, 2447, 2463, 2513, 2520 |
| Toluidinesulfonamide hypoxia-induced factor 1 inhibitors | 1397 |
| Tolvaptan | 754, 919, 1881 |
| Tolylfluanid | 2318 |
| Topiramate | 754, 1045, 1093, 1881, 2189, 2232, 2313 |
| Topotecan | 755, 882, 919, 1022, 1024, 1044, 1100, 1111, 1217, 1882, 2082, 2249, 2274, 2468, 2474, 2520 |
| Torasemide | 1397 |
| Torcetrapib | 1244, 1942 |
| Toremifene | 756, 1022, 1189, 1331, 1355, 1367, 1376, 1397, 1571, 1882, 1969, 1976, 2042, 2046, 2074, 2106 |
| Torsemide | 756, 1052, 1377, 1401, 1943, 2447 |
| Tositumomab and Iodine 131I Tositumomab | 757 |
| Tosyllysine chloromethyl ketone | 2074, 2186, 2201, 2463 |
| Tosylphenylalanyl chloromethyl ketone | 1106, 2074, 2178, 2373, 2431, 2447, 2463 |
| Toxaphene | 1041, 1189, 1208, 1217, 1979, 2042, 2046, 2313, 2318, 2376 |
| Toxin II (Anemonia sulcata) | 2386, 2387 |
| TP53 | 919 |
| TPA023 | 1882 |
| Trabectedin (ET-743, Yondelis) | 919, 942, 961, 1733, 1882, 1901 |
| Trace Metals | 757 |
| Tramadol | 757, 1064, 1535, 1556, 1559, 1571, 1585, 1589, 1882, 2002, 2004, 2164, 2320, 2499, 2505, 2508, 2510 |
| Trandolapril | 758, 1034, 1052 |
| Tranexamic Acid | 759 |
| Tranilast | 1022, 1293 |
| trans-[PtCl2(NH3)(2-Methylbutylamine or sec-butylamine)] | 1395 |
| trans-1,2-Dihydro-1,2-naphthalenediol | 1296, 1334, 1347, 1356, 1368, 1377, 1401, 1423, 1589, 1613, 1901 |
| trans-1,4-bis(2-Chlorobenzaminomethyl)cyclohexane dihydrochloride | 2053, 2221 |
| trans-10,cis-12-Conjugated linoleic acid | 824, 1042, 1232, 1234, 1236, 2061, 2068, 2253, 2279, 2330, 2340, 2345, 2380, 2408, 2463, 2474, 2483, 2516 |
| trans-Dihydronarciclasine | 1293 |
| trans-Permethrin | 1610, 1838 |
| trans-Phenylpropene | 1883 |
| Transplatin | 1395, 2106 |
| Trantinterol | 1331, 1574 |
| Tranylcypromine | 759, 1334, 1356, 1574, 1613, 1883, 2074, 2320 |
| Trapidil | 1044, 2251 |
| Trapping agents (Glutathione, Potassium cyanide, and Methoxylamine) | 1331, 1883 |
| Trastuzumab | 760, 1976, 2026, 2027, 2333 |
| Traveler’s Diarrhea and Cholera Vaccine | 761 |
| Travoprost | 761 |
| Traxoprodil | 1574 |
| Trazodone | 761, 1488, 1570, 1574, 1883, 2423 |
| Trenbolone | 1189, 2042, 2153 |
| Treprostinil | 762, 1398 |
| Trequinsin | 1248 |
| Trestolone | 1979 |
| Tretinoin | 762, 824, 928, 962, 965, 979, 1026, 1041, 1052, 1054, 1060, 1088, 1098, 1103, 1106, 1108, 1111, 1115, 1121, 1161, 1179, 1183, 1189, 1190, 1193, 1194, 1200, 1202, 1204, 1208, 1217, 1219, 1223, 1232, 1234, 1236, 1241, 1248, 1249, 1254, 1256, 1259, 1262, 1265, 1272, 1296, 1334, 1347, 1368, 1377, 1401, 1404, 1423, 1589, 1613, 1622, 1901, 1906, 1932, 1979, 1988, 1989, 2013, 2019, 2026, 2042, 2055, 2059, 2064, 2074, 2078, 2086, 2101, 2111, 2118, 2135, 2137, 2150, 2152, 2156, 2178, 2180, 2186, 2189, 2190, 2196, 2198, 2201, 2204, 2210, 2212, 2218, 2221, 2224, 2237, 2238, 2247, 2253, 2266, 2270, 2276, 2278, 2301, 2309, 2313, 2318, 2320, 2330, 2331, 2332, 2340, 2345, 2346, 2361, 2363, 2367, 2373, 2376, 2379, 2393, 2423, 2431, 2435, 2438, 2439, 2442, 2447, 2449, 2450, 2463, 2465, 2474, 2481, 2483, 2513, 2516, 2520, 2528 |
| Triacetin | 763 |
| Triacsin C | 824, 2074, 2147 |
| Triadimefon | 965, 1044, 1103, 1243, 1270, 1296, 1613, 1979, 2042, 2106, 2111, 2121, 2129, 2147, 2298, 2309, 2357, 2447, 2449, 2497 |
| Triamcinolone | 763, 1024, 1189, 1985, 2318, 2447, 2520 |
| Triamterene | 765, 1334, 1575 |
| Triazenes | 2272 |
| Triazolam | 765, 1306, 1709, 1884, 1901 |
| Triazoles | 1383, 1884, 2111 |
| Tribromodiphenyl ether 28 | 1098, 1189, 2432 |
| Tribromoethanol | 2196, 2306, 2463 |
| Tributyltin | 823, 1404, 1884, 1977, 1979, 2042, 2463 |
| Tricetin-3′,4′,5′-trimethylether | 855 |
| Trichlorfon | 1041, 1179, 1183, 1189, 1217, 1251 |
| Trichloroacetic Acid | 766, 2190, 2340 |
| Trichloroepoxypropane | 1296, 1334 |
| Trichloroethylene | 928, 1088, 1223, 1238, 1262, 1610, 1613, 1884, 2318, 2340, 2463, 2465 |
| Trichloronitritodiammineplatinum | 2431 |
| Trichostatin A | 962, 965, 1223, 1241, 1296, 1347, 1363, 1610, 1885, 2042, 2107, 2196, 2221, 2272, 2274, 2367, 2373, 2376, 2393, 2420, 2423, 2425, 2442, 2447, 2474, 2481 |
| Triclabendazole | 840 |
| Triclabendazole sulfone | 840 |
| Triclabendazole sulfoxide | 840 |
| Triclosan | 1885, 2313 |
| Tricyclic antidepressants | 1065, 1502, 1522, 1535, 1885 |
| Tricyclic-based FBPase inhibitors | 1885 |
| Tricyclodecane-9-yl-xanthogenate | 1116, 2373, 2463 |
| Trientine | 766 |
| Triethylene glycol dimethacrylate | 2118 |
| Triethylenetetramine | 2425, 2447, 2474 |
| Triethylenethiophosphoramide (See Thiotepa) | 735, 1368, 1575, 1685, 1885, 2026, 2106, 2111, 2116, 2118, 2272 |
| Triethyllead | 2106, 2111, 2118, 2309 |
| Triflumizol | 1189 |
| Trifluoperazine | 766, 2221, 2154, 2495 |
| Trifluoroethanol | 2086 |
| Trifluralin | 1368, 2181, 2313 |
| Trifluridine | 767 |
| Trihexyphenidyl | 767, 1487 |
| Triiodothyronine | 2435, 2483 |
| Trilostane (3beta-Hydroxysteroid dehydrogenase inhibitor) | 1977 |
| Trimebutine | 768 |
| Trimellitic anhydride | 1229, 2186, 2204, 2218, 2301, 2463, 2513 |
| Trimethadione | 1885 |
| Trimethobenzamide | 768 |
| Trimethoprim | 768, 928, 1376, 1377, 1885, 2110, 2116, 2120, 2145, 2157, 2295, 2296 |
| Trimethoprim and Sulfamethoxazole | 769, 1885, 2110, 2116, 2120, 2145, 2157, 2295, 2296, 2456 |
| Trimethylamine | 2068 |
| Trimethylarsine | 1191 |
| Trimethylarsine oxide | 944, 962, 965, 1191, 2111 |
| Trimethylene-bis(4-hydroxyiminomethylpyridinium) | 1041 |
| Trimethyloxamine | 2212 |
| Trimetrexate | 770 |
| Trimipramine | 770, 920, 1575, 1580, 1885 |
| Trinitrobenzenesulfonic acid | 1119, 1190, 1217, 1229, 1262, 2054, 2082, 2147, 2178, 2186, 2189, 2196, 2204, 2213, 2218, 2221, 2367, 2373, 2432, 2450, 2463, 2479, 2513 |
| Trinitrotoluene | 1296, 2074 |
| Tripanavir | 1553 |
| Tripchlorolide | 2474 |
| Tripelennamine | 1575, 2155 |
| Triphala | 1575, 1886 |
| Triphenyl phosphate | 1189 |
| Triphenylethylene | 1189 |
| Triphenyltin | 1404, 1884 |
| Triphenyltin chloride | 1296, 2111, 2196, 2210, 2463 |
| Triprolidine | 771, 2155 |
| Triptans | 1331, 1556, 1886 |
| Tripterine | 1189, 1219, 1234, 1296, 2019, 2064, 2178, 2186, 2196, 2198, 2246, 2463, 2513 |
| Tripterygium wilfordii (See Triptolide) | 920, 1886, 2178, 2221, 2463 |
| Triptolide (Tripterygium wilfordii) | 920, 1886, 2178, 2221, 2463 |
| Triptorelin | 772, 1965 |
| tris(2-Carboxyethyl)phosphine | 1191 |
| [tris(1,10-Phenanthroline)lanthanum(III)] trithiocyanate (KP772, FFC24)(lanthanum compound) | 942 |
| Triterpenes | 1098, 1229, 1334, 2022, 2111, 2118, 2121, 2213, 2309 |
| Triterpenoid saponins | 920 |
| Trofosfamide | 1815, 1886 |
| Troglitazone | 920, 929, 930, 1043, 1060, 1234, 1241, 1262, 1265, 1368, 1376, 1377, 1401, 1060, 1423, 1575, 1886, 1901, 2111, 2121, 2178, 2196, 2210, 2253, 2344, 2345, 2346, 2373, 2376, 2393, 2423, 2435, 2513 |
| Trolamine | 772 |
| Troleandomycin | 1886, 1901, 2312, 2313 |
| Tromethamine | 772 |
| Tropacocaine | 1242 |
| Tropicamide | 773, 1251, 1252 |
| Tropisetron | 773, 920, 1575, 1855, 1886, 2168 |
| Trospium | 774, 896, 1576, 1585, 1887 |
| Trypan Blue | 774 |
| Tryptamine | 1356 |
| Tryptanthrine | 920, 928, 2474 |
| Tryptophan | 774 |
| Tryptoquivaline | 1024 |
| TS108 | 2042, 2046 |
| TSU16 | 1331, 1887 |
| TSU68 | 1331 |
| Tuberculin | 775, 2216 |
| Tubocurarine | 1254, 1256 |
| Tulathromycin | 920 |
| Tungstate | 1111 |
| Tungsten | 2525 |
| Tungsten compounds | 2074, 2106 |
| Tunicamycin | 944, 965, 1046, 1060, 1088, 1208, 1209, 1238, 1995, 2066, 2091, 2107, 2121, 2221, 2274, 2296, 2412, 2413, 2463, 2468, 2528 |
| Turpentine | 930, 962, 965, 1043, 2061, 2210, 2323, 2347, 2400 |
| Tx2-6 toxin from Phoneutria nigriventer spider | 942 |
| Typhoid Vaccine | 775, 1274 |
| Tyramine | 1576, 2435 |
| Tyrosine kinase inhibitors | 921, 1022, 1197, 2018 |
| Tyrphostin AG1024 | 2324 |
| Tyrphostin AG1478 | 1034, 1088, 1189, 1265, 2013, 2019, 2074, 2347, 2373 |
| Tyrphostin AG490 | 1160 |
| Tyrphostin AG825 | 2026 |
| TZB-30878 | 1887 |
| U | |
| U0126 | 921, 928, 944, 1088, 1116, 1223, 1234, 1236, 1248, 1262, 1265, 2019, 2074, 2186, 2201, 2218, 2221, 2261, 2318, 2320, 2377, 2463, 2474, 2483, 2516, 2520 |
| U75302 | 2218, 2221 |
| UAB30 | 2442 |
| Ubiquinone | 1610, 1990, 2340, 2483 |
| Udenafil | 1887 |
| UH232 | 2002, 2004 |
| UIC2 antibody | 921 |
| UK343664 | 1887 |
| UK369003 | 921 |
| Ulipristal | 776 |
| Undecylenic Acid | 776 |
| Unsaturated dietary fats | 2463 |
| Unsaturated fatty acids | 1116, 2221, 2373, 2463 |
| Uracil | 1995, 2474 |
| Uranium | 985, 1115, 1179, 1183, 1296, 1986, 2074, 2150, 2186, 2279, 2313, 2314, 2467, 2516 |
| Uranyl acetate | 985, 1115, 1183, 2279, 2467 |
| Urea | 776, 2237 |
| Uremic toxins (3-Carboxy-4-methyl-5-propyl-2-furanpropanoic acid, Hippuric acid, Indole-3-acetic acid, 3-Indoxyl sulfate and p-Cresol) | 1398 |
| Urethane | 1217, 1223, 1236, 1241, 1254, 1256, 1265, 1613, 2019, 2074, 2186, 2189, 2190, 2196, 2201, 2204, 2210, 2218, 2221, 2241, 2301, 2359, 2360, 2367, 2373, 2377, 2431, 2442, 2447, 2463, 2520 |
| Uric acid | 962, 970, 971 |
| Urocanic acid | 2186, 2463 |
| Urofollitropin | 777 |
| Urokinase | 777 |
| Uroporphyrinogens | 1334, 1887 |
| Ursodeoxycholic acid | 930, 944, 961, 962, 965, 1234, 1236, 1887, 1901, 1929, 1932, 1986, 2042, 2046, 2178, 2210, 2318, 2377, 2400, 2463 |
| Ursodiol | 778 |
| Ursolic acid | 909, 1384, 1423, 1684, 1809, 2468 |
| Usnic acid | 1217, 1404, 1576, 1887, 2489, 2493 |
| Ustekinumab | 778 |
| V | |
| V11294 | 1576, 1887 |
| Valacyclovir | 779 |
| Valdecoxib | 1510, 1576, 1888, 2373 |
| Valerenic acid | 961 |
| Valerian (Valeriana officinalis L.) | 779, 1491, 1888 |
| Valeriana officinalis L. (See Valerian) | 779, 1491, 1888 |
| Valerylsalicylate | 2318, 2367 |
| Valganciclovir | 780 |
| Valinomycin | 930 |
| Valproic Acid and Derivatives | 780, 921, 928, 961, 962, 996, 1083, 1099, 1236, 1252, 1262, 1265, 1356, 1367, 1368, 1398, 1401, 1422, 1566, 1576, 1888, 1910, 1977, 2006, 2069, 2074, 2101, 2125, 2129, 2135, 2178, 2186, 2210, 2218, 2259, 2318, 2363, 2387, 2393, 2395, 2402, 2412, 2431, 2447, 2463, 2474 |
| Valrubicin | 781 |
| Valsartan | 782, 1088, 1092, 1576, 1888, 1943, 2093, 2431, 2447 |
| Valspodar (PSC-833) | 921, 928, 944, 1024, 1888 |
| Vanadates | 930, 944, 1027, 1204, 1217, 1248, 2248, 2323, 2377, 2520 |
| Vanadium | 1060, 1098, 1116, 1296, 2204, 2210, 2218, 2236, 2248, 2431, 2463, 2474 |
| Vanadium compounds | 2178, 2196 |
| Vanadium pentoxide | 1262, 2181, 2210, 2224, 2309, 2330, 2423, 2463, 2513 |
| Vanadyl sulfate | 1060, 1161, 1210, 1217, 2013, 2074, 2196, 2306, 2373, 2380, 2412, 2431 |
| Vancomycin | 783 |
| Vandetanib (Zactima, ZD6474) | 942 |
| Vanillic acid | 2301, 2493 |
| Vanillin | 1189, 2493 |
| Vanoxerine | 1576 |
| Vardenafil | 783, 1024, 1888, 2328 |
| Varenicline | 784, 922 |
| Varicella Virus Vaccine | 785 |
| Varicella-Zoster Immune Globulin (Human) | 785 |
| Variegatic acid | 1838 |
| Vascular endothelial growth factor (VEGF) | 921 |
| Vasopressin | 785, 1248, 1942 |
| Vasotocin | 1248 |
| Vaticanol B | 2373 |
| Vecuronium | 786 |
| Vegetamin | 1422 |
| Vehicle emissions | 1241, 1262, 2367, 2373, 2447 |
| Velaglucerase Alpha | 786 |
| Veliparib | 922, 1331, 1577 |
| Velnacrine | 1297, 1334 |
| Venlafaxine | 786, 922, 928, 944, 1265, 1331, 1422, 1423, 1497, 1544, 1551, 1556, 1567, 1577, 1589, 1888, 2062, 2318, 2396, 2399 |
| Verapamil | 788, 848, 922, 928, 944, 962, 965, 1073, 1080, 1248, 1377, 1404, 1552, 1621, 1889, 1901, 2379, 2423, 2447, 2463 |
| Veratridine | 2074 |
| Veratrum nigrum | 1291 |
| Verbenone | 1356, 1368 |
| Verlukast | 928, 944, 962, 971, 1297, 2118 |
| Vernakalant | 789, 1580 |
| Vernonia amygdalina | 1890 |
| Verteporfin | 789, 2288 |
| Vesnarinone | 1890 |
| Vicriviroc | 1228 |
| Vigabatrin | 790 |
| Vildagliptin | 859, 1993 |
| Vinblastine | 790, 923, 928, 930, 944, 962, 1111, 1217, 1234, 1580, 1890, 2083, 2118, 2196, 2312, 2432, 2471, 2474 |
| Vinca alkaloids | 923, 928, 1890 |
| Vincamine | 791 |
| Vinclozolin | 1027, 1034, 1043, 1046, 1047, 1052, 1103, 1106, 1115, 1183, 1189, 1197, 1203, 1223, 1264, 1267, 1297, 1334, 1613, 1906, 1979, 1986, 1993, 2006, 2015, 2022, 2042, 2046, 2066, 2067, 2074, 2093, 2094, 2096, 2101, 2118, 2174, 2178, 2181, 2189, 2190, 2196, 2212, 2213, 2218, 2227, 2237, 2238, 2251, 2253, 2256, 2270, 2296, 2313, 2318, 2320, 2381, 2432, 2447, 2450, 2451, 2453, 2463, 2465, 2467, 2520, 2523, 2525 |
| Vincristine | 791, 923, 928, 930, 944, 961, 962, 964, 1116, 1217, 1242, 1248, 1890, 2019, 2111, 2189, 2210, 2272, 2312, 2352, 2373, 2431, 2463, 2474, 2481, 2516 |
| Vindesine | 792, 924 |
| Vindoline | 1684 |
| Vinflunine | 792, 1891 |
| Vinorelbine | 793, 924, 942, 1024, 1241, 1581, 1891, 2373 |
| Vinpocetine | 794, 1088, 2305 |
| Vinyl carbamate | 1121, 1223, 1236, 1601, 1613, 2042, 2046, 2190, 2359, 2360, 2361, 2362, 2373, 2377 |
| Vinyl chloride | 1054, 1108, 1611, 1613, 2022, 2032, 2111, 2121, 2241, 2272, 2474, 2528 |
| Vinylidene chloride | 1270, 1297, 1334, 1613, 2111, 2121, 2153, 2186 |
| Virodhamine | 2463 |
| Visfatin | 823 |
| Vitamin A (See Retinol) | 651, 924, 928, 1098, 1103, 1111, 1121, 1179, 1183, 1217, 1223, 1262, 1265, 1297, 1347, 1368, 1613, 1946, 1972, 2086, 2186, 2204, 2248, 2323, 2340, 2345, 2347, 2375, 2379, 2431, 2449, 2453, 2463, 2520 |
| Vitamin B1 (See Thiamine) | 733, 1270, 2210 |
| Vitamin B12 (See Cyanocobalamin) | 188, 1270, 2291 |
| Vitamin B12a (See Hydroxocobalamin) | 365 |
| Vitamin B3 (See Niacin) | 521, 988, 994, 1150, 1804, 2249, 2301, 2385 |
| Vitamin B5 (See Pantothenic Acid) | 565 |
| Vitamin B6 (See Pyridoxine) | 632, 1119, 1220, 1270, 2210 |
| Vitamin B7 (See Biotin) | 84, 1346 |
| Vitamin B9 (See Folic Acid) | 325, 869, 943, 952, 1040, 1103, 1119, 1188, 1196, 1222, 1241, 1270, 1388, 2084, 2085, 2200, 2209, 2270, 2272, 2287, 2288, 2291, 2296, 2317, 2340, 2345, 2425, 2460, 2473, 2513, 2519 |
| Vitamin C (See Ascorbic Acid) | 51, 1036, 1040, 1119, 1215, 1247, 1294, 1355, 1612, 1662, 1891, 1978, 2012, 2066, 2072, 2105, 2110, 2114, 2119, 2152, 2183, 2203, 2272, 2300, 2308, 2317, 2320, 2337, 2420, 2423, 2446, 2472, 2513, 2528 |
| Vitamin D | 924, 1621, 1891, 1901, 1931, 1977, 1985, 2313 |
| Vitamin D3 (See Cholecalciferol) | 154, 924, 1045, 1049, 1088, 1108, 1161, 1187, 1222, 1229, 1233, 1235, 1238, 1294, 1368, 1400, 1899, 1986, 2098, 2153, 2190, 2276, 2283, 2331, 2361, 2362, 2366, 2371, 2446, 2448, 2458, 2516 |
| Vitamin E (See Tocopherol) | 750, 944, 1119, 1161, 1179, 1183, 1217, 1232, 1234, 1236, 1257, 1262, 127 0, 1272, 1892, 1901, 1904, 1910, 1943, 1979, 1986, 2074, 2107, 2113, 2178, 2186, 2196, 2204, 2218, 2272, 2276, 2313, 2338, 2347, 2376, 2380, 2382, 2420, 2423, 2447, 2450, 2463, 2468, 2474, 2483, 2511 |
| Vitamin E TPGS (D-alpha-Tocopheryl polyethylene glycol 1000 succinate) | 924 |
| Vitamin K | 979, 2313, 2323 |
| Vitamin K antagonists | 1385, 1893 |
| Vitamin K1 (See Phytonadione) | 589, 2210 |
| Vitamin K2 | 1893 |
| Vitamin K3 | 944, 1098, 1217, 1218, 1297, 1334, 1347, 2013, 2019, 2111, 2147, 2246, 2301, 2309, 2423 |
| Vitamins (Multiple) | 794 |
| Vitex agnus-castus (See Chaste tree berry) | 1287, 1317, 1415, 1490, 1759 |
| VIVIT peptide | 2201, 2218, 2221 |
| Volatile organic compounds | 1611 |
| Vorapaxar (SCH 530348) | 1293, 1328, 1621, 1893 |
| Voriconazole | 795, 843, 1398, 1401, 1423, 1580, 1893, 1901, 2066 |
| Vorinostat | 796, 1223, 1297, 1347, 1977, 2026, 2377, 2463, 2481 |
| Vorozole | 1297, 1404, 1973, 1977, 1979 |
| VPP | 1942 |
| V-PROLI/NO (O2-vinyl-1-[2-(carboxylato)pyrrolidin-1-yl]diazen-1-ium-1,2-diolate) | 1611 |
| VX | 1041 |
| W | |
| W232R suppressor | 924 |
| W7 | 1217, 2463 |
| Warfarin | 797, 924, 1161, 1210, 1293, 1331, 1334, 1398, 1401, 1404, 1422, 1471, 1574, 1581, 1893, 1894, 1901, 1911, 2022, 2048, 2050, 2051, 2083, 2106, 2210, 2323, 2353, 2474, 2521 |
| Water | 1248, 2013 |
| WAY100635 | 1019, 2159, 2161 |
| WAY200070 | 1977 |
| WAY362450 | 1931 |
| Weichang’an | 2431 |
| Wellsolve | 925 |
| Wen-pi-tang-Hab-Wu-ling-san | 1332, 1587 |
| Wheat antioxidants | 1932 |
| WHI P154 | 2019 |
| White pepper | 1396 |
| White wheat bread | 1932 |
| Win 55212-2 | 1259, 2074, 2463 |
| WIN 64338 | 1197 |
| Witch Hazel (Hamamelis virginiana L.) | 798 |
| Withaferin A and siamois polyphenols (quercetin) | 925 |
| Wogonin (Scutellaria baicalensis Georgi extract) | 823, 902, 925, 996, 1332, 1400, 1422, 1587, 2493 |
| Woohwangcheongsimwon | 1367 |
| Wortmannin | 930, 962, 1060, 1088, 1223, 1234, 1248, 1265, 1297, 2013, 2019, 2026, 2101, 2189, 2196, 2213, 2221, 2301, 2373, 2377, 2463, 2474, 2520 |
| WP744 | 1223, 2474 |
| WP1066 | 2431 |
| WP9QY peptide | 2463 |
| WR 1065 | 2118, 2424 |
| Wuji pill compound | 1332, 1895 |
| Wu-Zi-Yan-Zong-Wan | 1611 |
| WY-14,643 | 1932 |
| X | |
| X910279 | 1990 |
| Xamoterol | 1073 |
| Xanthene food dyes (Rose bengal, Phroxine, Amaranth, Erythrosine B, Allura red, New coccine, Acid red, Tartrazine, Sunset yellow FCF, Brilliant blue FCF, and Indigo carmine) | 925, 1355, 1895 |
| Xanthine derivatives | 925 |
| Xanthohumol from beer hops (Humulus lupulus L.) | 942, 1332, 1762, 1932, 2042, 2046, 2210, 2367, 2373 |
| XELOX | 1995 |
| Xenobiotics | 2432, 2436 |
| Xenoestrogens | 1977 |
| Xenoestrogens (nonylphenol, phenol estrogen, TBBPA, DE-71, 4-BP) | 1977 |
| Xenon | 1265 |
| Xerocomic acid | 1838 |
| Ximelagatran | 925, 1895, 2141, 2145 |
| XK469 | 1232, 2474 |
| XK469I | 1585, 1587 |
| XR9576 | 869, 925 |
| Xylazine | 2367, 2373 |
| Xylenes | 1217, 2395, 2479 |
| Xylometazoline | 799 |
| Y | |
| Y134 compound | 2042, 2046 |
| Y27632 | 1179, 1183, 2301, 2447 |
| Yangonin | 1775 |
| (-)-Yatein | 1791 |
| YC-1 (3-(5′-Hydroxymethyl-2′-furyl)-1-benzylindazole) | 925 |
| Yellow Fever Vaccine | 800, 1228 |
| YH439 | 1297 |
| Yikun Neiyi Wan | 1977 |
| Yin zhi huang | 1895 |
| YM17E | 1587, 1895 |
| YM511 | 1979 |
| YM758 | 1332, 1587 |
| YM796 | 1895 |
| Yohimbine | 800, 1067, 1069, 1587, 1895 |
| Yondelis (ET-743, Trabectidin) | 919, 942, 961, 1733, 1882, 1901 |
| Youngiasides | 1293 |
| YQ36 | 925 |
| Yttrium complex | 925 |
| YU101 | 1183 |
| Z | |
| Z335 | 961, 962 |
| Z338 | 1896 |
| Z-4-hydroxy-tamoxifen | 1896, 1976 |
| Zafirlukast | 801, 1110, 1334, 1377, 1401, 1423, 1585, 1587, 1589, 1613, 1896, 1901, 2257 |
| Zalcitabine | 801, 1988 |
| Zaleplon | 802, 1587, 1763, 1896 |
| Zaltoprofen | 1896 |
| Zampanolide | 925 |
| Zanamivir | 802 |
| Zaprinast | 2328, 2463 |
| ZD2574 | 2013, 2015 |
| ZD4054 | 1978 |
| ZD9331 | 1232, 1234, 2186, 2474, 2481 |
| Zearalenol | 1189, 2042 |
| Zearalenone | 926, 942, 1332, 1367, 1611, 1896, 1901, 1979, 2042, 2046, 2125, 2186, 2196, 2201, 2210, 2313, 2436, 2463, 2490 |
| Zeaxanthin | 2118 |
| Zeocin | 2474 |
| Zeranol | 1978, 1332, 2042, 2013, 2186, 2259, 2301 |
| Zerumbone | 1223, 1297, 1347, 2118, 2178, 2309, 2373, 2463, 2465 |
| Ziconotide | 803 |
| Zidovudine | 803, 926, 928, 970, 971, 1024, 1241, 1367, 1422, 1587, 1896, 2410, 2424 |
| Zileuton | 804, 942, 1110, 1111, 1332, 1334, 1400, 1585, 1588, 1896, 2257 |
| Zilongjin | 926 |
| Zinc | 996, 1026, 1027, 1034, 1103, 1116, 1180, 1183, 1201, 1217, 1223, 1248, 1262, 1270, 1897, 1906, 1932, 2019, 2022, 2029, 2078, 2096, 2101, 2147, 2178, 2179, 2186, 2189, 2204, 2210, 2218, 2236, 2237, 2253, 2266, 2272, 2309, 2345, 2352, 2373, 2377, 2386, 2390, 2397, 2424, 2432, 2447, 2449, 2451, 2463, 2474, 2520, 2525 |
| Zinc (II) complex | 926 |
| Zinc chloride | 1248, 1262, 2096, 2118, 2442 |
| Zinc mesoporphyrin | 2447 |
| Zinc Oxide | 804 |
| Zinc protoporphyrin | 2178, 2424, 2463 |
| Zinc Sulfate | 805, 996, 1108, 1201, 1223, 1252, 1262, 1613, 1906, 2019, 2022, 2029, 2078, 2147, 2157, 2178, 2210, 2236, 2237, 2261, 2386, 2395, 2432, 2450, 2464, 2479, 2520, 2525 |
| Zineb | 1041, 1297, 2464 |
| Zingiber aromaticum | 1897 |
| Zingiber cassumunar rhizome | 1492 |
| Ziprasidone | 805, 1535, 1588, 1897, 2002, 2154, 2164, 2232, 2381 |
| Ziram | 2181, 2186, 2204, 2464 |
| ZK159222 | 2377, 2516 |
| ZK168281 | 2516 |
| ZM241385 | 1986 |
| ZNF217 | 926 |
| Zoledronic Acid | 806, 1377, 1978, 2276, 2447 |
| Zolmitriptan | 807, 1332, 2093 |
| Zolpidem | 807, 1332, 1400, 1423, 1580, 1588, 1763, 1897 |
| Zonampanel | 961 |
| Zonisamide | 808, 1423, 1898 |
| Zopiclone | 809, 1377, 1400, 1588, 1763, 1898 |
| Zoster Vaccine | 809 |
| Zosuquidar | 926 |
| Zotepine | 1898 |
| Zoxazolamine | 2314 |
| Zuclopenthixol | 810, 1535, 1588, 1998, 2002 |
| Zwitterionic uracil derivatives | 1898 |
| Zygophyllaceae (See Peganum harmala L.) | 1324 |
| Zymosan | 1052, 1111, 1193, 1217, 1264, 2050, 2074, 2178, 2186, 2189, 2196, 2198, 2201, 2204, 2210, 2212, 2213, 2218, 2221, 2224, 2248, 2249, 2257, 2276, 2278, 2303, 2305, 2318, 2323, 2345, 2347, 2362, 2363, 2364, 2367, 2373, 2412, 2418, 2431, 2447, 2449, 2453, 2464, 2465, 2467, 2479, 2513, 2520 |